{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9b76d157-619c-47ef-bb23-2a322416c309",
          "code": "13415-86-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13415-86-6",
          "code_system": "CAS",
          "references": [
            "f9245291-c588-93fb-84d4-6562c998e0cc"
          ]
        },
        {
          "uuid": "c46acb6a-fc43-4293-b58c-65feab35c7f8",
          "code": "ALPHA-PYRROLIDINOHEXIOPHENONE",
          "comments": "α-Pyrrolidinohexiophenone (α-PHP, alpha-PHP, α-Pyrrolidinohexanophenone, PV-7) is a synthetic stimulant drug of the cathinone class developed in the 1960s[1] which has been reported as a novel designer drug. It is a longer chain homologue of α-PVP, having an extra carbon on the alkyl side chain, and is a structural isomer of pyrovalerone. Sweden's public health agency suggested to classify α-PHP as narcotic on June 1, 2015. As of October 2015 α-PHP is a controlled substance in China.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Alpha-Pyrrolidinohexiophenone",
          "code_system": "WIKIPEDIA",
          "references": [
            "56c6ca8b-80a9-4deb-8d82-123a2951777e"
          ]
        },
        {
          "uuid": "4c5c4274-133c-4db8-b1b0-fb02cd6c071f",
          "code": "102107923",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102107923",
          "code_system": "PUBCHEM",
          "references": [
            "56c6ca8b-80a9-4deb-8d82-123a2951777e"
          ]
        },
        {
          "uuid": "969cf561-be93-9450-7756-b6340c1ddf37",
          "code": "DTXSID301016924",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301016924",
          "code_system": "EPA CompTox",
          "references": [
            "66e3b88b-16ba-8b04-cfd9-90e2127b61d8"
          ]
        },
        {
          "uuid": "373470d4-2848-468a-90d9-baab850ed184",
          "code": "7544",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "code_system": "DEA NO.",
          "references": [
            "a9cd0246-ff35-60d7-659b-5321c9e1efc5"
          ]
        },
        {
          "uuid": "7281a612-1d17-46b5-b898-4e16336ba552",
          "code": "297J9K8A4G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6b729edd-8e24-ef22-9d92-982ef8c8be70",
          "code": "Designer-drugs-ALPHA-PHP",
          "comments": "Wikipedia|List of designer drugs|Stimulants|Pyrrolidines and Pyrrolidinophenones",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "a73f9808-ab8c-def9-480b-73a59ed38f31"
          ]
        },
        {
          "uuid": "7d1f0a42-5164-0095-ddb1-a5b702f5fd2e",
          "code": "300000032746",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a6bee1f9-b01e-b52c-ef78-a5cea821b4e0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "08af692a-e0b4-4b90-ab47-6cb877914f6f",
          "amount": {
            "uuid": "a1fe6dcc-13c0-4ac9-b8ea-2b53e61ff8ee"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "266981ad-6e9b-4bbd-b3cc-df592393ba01",
            "refuuid": "f299125d-a391-41c5-8825-11805eef1d7f",
            "name": "ALPHA-PHP",
            "unii": "297J9K8A4G",
            "linking_id": "297J9K8A4G",
            "ref_pname": "ALPHA-PHP",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5d4d98f1-1937-4464-bc7c-630cd42ccdf8",
          "amount": {
            "uuid": "b3b9d272-a25b-49d9-9b41-6969a2839084"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "f9245291-c588-93fb-84d4-6562c998e0cc"
          ],
          "related_substance": {
            "uuid": "e41c9181-f675-42fe-99f1-eeed6cc63004",
            "refuuid": "c969fbbb-5642-45bb-8c75-f3aa1c70666a",
            "name": "ALPHA-PHP HYDROCHLORIDE",
            "unii": "Z5DJ7QN981",
            "linking_id": "Z5DJ7QN981",
            "ref_pname": "ALPHA-PHP HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0c9d3716-c48a-4327-b916-d8b90aea8824",
          "amount": {
            "uuid": "eaba8827-4b52-4cb4-97c1-b70f98802939"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "c8655601-344c-40b6-a704-69161c4ec093"
          ],
          "related_substance": {
            "uuid": "07213f80-8ebe-462a-aeb6-66345ec9485c",
            "refuuid": "45dac3cd-892b-a854-4a95-4a73edeab5fe",
            "name": "ALPHA-PHP, (R)-",
            "unii": "2ZI9K4QY9D",
            "linking_id": "2ZI9K4QY9D",
            "ref_pname": "ALPHA-PHP, (R)-"
          }
        },
        {
          "uuid": "cbb9f505-ebc4-4a73-a92f-ae6c4e2a7fdd",
          "amount": {
            "uuid": "5ec7d1c2-5df4-4dbb-b2cd-8e98435eaffe"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "ea41ff97-79b5-4fb4-932f-308f775a9775"
          ],
          "related_substance": {
            "uuid": "f9a4d99f-28dd-4529-b331-a22c2f1249e3",
            "refuuid": "0027d31e-e5a3-20aa-338f-da985d07a9e5",
            "name": "ALPHA-PHP, (S)-",
            "unii": "JP4ZQQ46VW",
            "linking_id": "JP4ZQQ46VW",
            "ref_pname": "ALPHA-PHP, (S)-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c3995fda-595a-4e40-925e-4811f054d9a4",
          "name": ".ALPHA.-PHP",
          "stdName": ".ALPHA.-PHP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feacfbd7-ceb0-4a8f-8486-8b79c54de30e"
          ],
          "display_name": false
        },
        {
          "uuid": "a2f0964f-dade-45db-a84b-c9433e95616e",
          "name": ".ALPHA.-PYRROLIDINOHEXIOPHENONE",
          "stdName": ".ALPHA.-PYRROLIDINOHEXIOPHENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a48c0dc-0c17-48b7-a1c8-80e8b38fee59"
          ],
          "display_name": false
        },
        {
          "uuid": "b47c03c9-7e6f-4532-8bac-fb0a3e9c7733",
          "name": "1-HEXANONE, 1-PHENYL-2-(1-PYRROLIDINYL)-",
          "stdName": "1-HEXANONE, 1-PHENYL-2-(1-PYRROLIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a3b7f6c-d72d-4ceb-911a-5058d981380b"
          ],
          "display_name": false
        },
        {
          "uuid": "cf75774f-6e49-4d17-b2a7-8bb95db1bda8",
          "name": "1-PHENYL-2-(1-PYRROLIDINYL)-1-HEXANONE",
          "stdName": "1-PHENYL-2-(1-PYRROLIDINYL)-1-HEXANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fae3fd72-82ce-4188-b032-fa43b86afc2f"
          ],
          "display_name": false
        },
        {
          "uuid": "c0a4e8a7-5972-51d1-099c-f61ec0fa2207",
          "name": "ALPHA-PHP",
          "stdName": "ALPHA-PHP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9cd0246-ff35-60d7-659b-5321c9e1efc5"
          ],
          "display_name": true
        },
        {
          "uuid": "8110d220-a043-30f5-43dc-e8cedbd9ef50",
          "name": "ALPHA-PYRROLIDINOHEXANOPHENONE",
          "stdName": "ALPHA-PYRROLIDINOHEXANOPHENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9cd0246-ff35-60d7-659b-5321c9e1efc5"
          ],
          "display_name": false
        },
        {
          "uuid": "20336607-36da-4669-aa0d-9959e8f4ac7a",
          "name": "HEXANOPHENONE, 2-(1-PYRROLIDINYL)-",
          "stdName": "HEXANOPHENONE, 2-(1-PYRROLIDINYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a3b7f6c-d72d-4ceb-911a-5058d981380b"
          ],
          "display_name": false
        },
        {
          "uuid": "ff7363ce-600b-42ef-a64c-3c179e72d25d",
          "name": "J3.226.366F",
          "stdName": "J3.226.366F",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fae3fd72-82ce-4188-b032-fa43b86afc2f"
          ],
          "display_name": false
        },
        {
          "uuid": "484fdb03-c5e8-4afa-92b4-36f81d745bb7",
          "name": "PV-7",
          "stdName": "PV-7",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a48c0dc-0c17-48b7-a1c8-80e8b38fee59"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "feacfbd7-ceb0-4a8f-8486-8b79c54de30e",
          "citation": "Forensic Toxicol, 32, 266-81 (2014)",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3a3b7f6c-d72d-4ceb-911a-5058d981380b",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fae3fd72-82ce-4188-b032-fa43b86afc2f",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.226.366F",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.226.366F",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a48c0dc-0c17-48b7-a1c8-80e8b38fee59",
          "citation": "https://en.wikipedia.org/wiki/Alpha-Pyrrolidinohexiophenone",
          "url": "https://en.wikipedia.org/wiki/Alpha-Pyrrolidinohexiophenone",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56c6ca8b-80a9-4deb-8d82-123a2951777e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393200000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0c1724f-3771-4461-8ea7-8f092afd424e",
          "citation": "SRS import [297J9K8A4G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=297J9K8A4G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393200000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6bee1f9-b01e-b52c-ef78-a5cea821b4e0",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "f9245291-c588-93fb-84d4-6562c998e0cc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a9cd0246-ff35-60d7-659b-5321c9e1efc5",
          "citation": "Electronic Code of Federal Regulations, e-CFR data is current as of February 4, 2020",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "doc_type": "CFR",
          "public_domain": true
        },
        {
          "uuid": "ea41ff97-79b5-4fb4-932f-308f775a9775",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c8655601-344c-40b6-a704-69161c4ec093",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a73f9808-ab8c-def9-480b-73a59ed38f31",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "66e3b88b-16ba-8b04-cfd9-90e2127b61d8",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a36c82d7-c6f4-4434-ab09-763ca1a969d2",
          "id": "a36c82d7-c6f4-4434-ab09-763ca1a969d2",
          "molfile": "\n  Marvin  01132108292D          \n\n 18 19  0  0  0  0            999 V2000\n    1.8775   -2.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1631   -1.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1631   -0.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4486   -0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4486    0.4715    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.1631    0.8840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9600    0.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4093    1.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8901    2.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1199    1.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2659    0.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2659    1.7090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9803    0.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6948    0.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4093    0.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4093   -0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6948   -0.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9803   -0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 11  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 10  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(C(=O)c1ccccc1)N2CCCC2",
          "formula": "C16H23NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "41cbcd09-1392-4e6d-8eba-c2be6c05bbba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "245.3605",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f299125d-a391-41c5-8825-11805eef1d7f",
      "version": "15",
      "structure": {
        "id": "c5bf5125-7bc5-4ac3-a724-daf56aea430a",
        "molfile": "\n  Marvin  01132110132D          \n\n 18 19  0  0  0  0            999 V2000\n   -2.4093    0.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4093   -0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6948   -0.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9803   -0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9803    0.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6948    0.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2659    0.8840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4486    0.4715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1631    0.8840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4486   -0.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1631   -0.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1631   -1.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2659    1.7090    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8775   -2.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9600    0.6705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4093    1.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8901    2.0035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1199    1.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n  7 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18  9  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(C(=O)c1ccccc1)N2CCCC2",
        "formula": "C16H23NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "245.3605",
        "optical_activity": "( + / - )",
        "references": [
          "feacfbd7-ceb0-4a8f-8486-8b79c54de30e",
          "c0c1724f-3771-4461-8ea7-8f092afd424e"
        ],
        "stereo_centers": 1
      },
      "unii": "297J9K8A4G"
    }
  ]
}