{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "eb6f3d20-7461-3121-67e0-17d713a03d26", "code": "165361", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/165361", "code_system": "PUBCHEM", "references": [ "2b76c526-4c75-dd4b-15e1-d69f7af621e7" ] }, { "uuid": "252a2288-c08b-4201-95ae-d601c4394a13", "code": "295UUP4557", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "6d2ade51-a068-40f4-b00e-6f16b5e1fe76", "code": "56523-60-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=56523-60-5", "code_system": "CAS", "references": [ "1c49e2a2-6f44-4409-bd80-4f424cf6dae5" ] } ], "substance_class": "chemical", "names": [ { "uuid": "029ed74a-43ae-4862-b78c-38c107d88c61", "name": "L-Lysine, L-β-aspartyl-", "stdName": "L-LYSINE, L-.BETA.-ASPARTYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1c49e2a2-6f44-4409-bd80-4f424cf6dae5" ], "display_name": false }, { "uuid": "543bc649-4836-4b21-8009-788190ec9f7e", "name": "L-β-Aspartyl-L-lysine", "stdName": "L-.BETA.-ASPARTYL-L-LYSINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1c49e2a2-6f44-4409-bd80-4f424cf6dae5" ], "display_name": true } ], "references": [ { "uuid": "2b76c526-4c75-dd4b-15e1-d69f7af621e7", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "1c49e2a2-6f44-4409-bd80-4f424cf6dae5", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1e05d0fd-d3ae-4515-a040-21d54071d23e", "id": "1e05d0fd-d3ae-4515-a040-21d54071d23e", "molfile": "\n Marvin 08312200292D \n\n 18 17 0 0 1 0 999 V2000\n 4.9563 -5.0546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7635 -4.8840 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.0194 -4.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8265 -3.9291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3148 -5.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0590 -6.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6103 -6.8958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2518 -6.4526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1361 -7.2695 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.3708 -7.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2550 -8.3945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7855 -7.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5509 -7.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2003 -7.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9656 -7.6705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6151 -8.1792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7213 -7.0690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4681 -3.4860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 5 1 6 0 0 0\n 3 4 2 0 0 0 0\n 3 18 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 12 1 1 0 0 0\n 10 11 2 0 0 0 0\n 10 17 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "C(CCN)C[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N", "formula": "C10H19N3O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c2104c55-5898-4cc5-a93f-36d138291485" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "261.2754", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "18b27bb1-090c-4946-94ab-8f09549a7846", "version": "5", "structure": { "id": "72e2bcb8-c3b2-449e-9757-ef55a7ae827c", "molfile": "\n JSDraw208312200292D\n\n 18 17 0 0 1 0 0 V2000\n 22.8765 -6.0213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4028 -5.6988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8866 -4.2157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4128 -3.8931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4453 -6.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.9615 -8.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.0040 -9.5029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.4352 -8.6649 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2163 -10.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7693 -10.7922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.5503 -12.3368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4444 -11.1713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8916 -10.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1197 -11.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5668 -10.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.7949 -11.9296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5411 -9.8303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8441 -3.0552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 2 5 1 6 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 9 12 1 1 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 10 17 1 0 0 0 0\n 6 8 1 0 0 0 0\n 3 18 1 0 0 0 0\nM END", "smiles": "C(CCN)C[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N", "formula": "C10H19N3O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "261.2754", "optical_activity": "UNSPECIFIED", "references": [ "1c49e2a2-6f44-4409-bd80-4f424cf6dae5" ], "stereo_centers": 2 }, "modifications": { "uuid": "35861e32-d679-48db-9598-da145e0e484c" }, "unii": "295UUP4557" } ] }