{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "649243ec-7caf-4784-9e99-56e079742ba0",
          "code": "29761-21-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29761-21-5",
          "code_system": "CAS",
          "references": [
            "0c848952-d591-462d-9d48-fe2f4dd419ed",
            "1f7f7447-7da0-42d3-9f6c-9d84a9fa5727"
          ]
        },
        {
          "uuid": "cd955581-9bbc-4bb4-9f6f-f6942a98d262",
          "code": "249-828-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.283",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0c848952-d591-462d-9d48-fe2f4dd419ed"
          ]
        },
        {
          "uuid": "42e1b632-def3-4e83-bd8d-acf72a188ef4",
          "code": "34697",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/34697",
          "code_system": "PUBCHEM",
          "references": [
            "0c848952-d591-462d-9d48-fe2f4dd419ed"
          ]
        },
        {
          "uuid": "3e1dc3e2-6fc5-b62c-45fb-ab5e008fbda8",
          "code": "6797",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6797",
          "code_system": "HSDB",
          "references": [
            "e6a1684f-8cac-d89f-d0fe-b691fe594021"
          ]
        },
        {
          "uuid": "ad9e82c4-499b-92d2-88f7-d8e69fe28080",
          "code": "DTXSID3025465",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3025465",
          "code_system": "EPA CompTox",
          "references": [
            "85ae1d02-b9c8-090f-38b9-0d46b1da68fb"
          ]
        },
        {
          "uuid": "21d9ba51-6cf2-4848-af65-60c8e5763330",
          "code": "2927JBB380",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ff8b5e8c-6272-43d9-8f88-cf4997e9c0b8",
          "name": "DIACIZER D 148",
          "stdName": "DIACIZER D 148",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc57a0fd-d9d9-421d-812b-d2f00b775686",
            "6ae15c88-a29b-4ea1-a26e-f863a5badd93"
          ],
          "display_name": false
        },
        {
          "uuid": "838c9064-bb34-42b8-857e-3f1651a4e4d9",
          "name": "DIPHENYL ISODECYL PHOSPHATE",
          "stdName": "DIPHENYL ISODECYL PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc57a0fd-d9d9-421d-812b-d2f00b775686",
            "6ae15c88-a29b-4ea1-a26e-f863a5badd93"
          ],
          "display_name": false
        },
        {
          "uuid": "f512f292-3885-4552-93ee-aed0d78d6215",
          "name": "ISODECYL ALCOHOL, DIPHENYL PHOSPHATE",
          "stdName": "ISODECYL ALCOHOL, DIPHENYL PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc57a0fd-d9d9-421d-812b-d2f00b775686",
            "6ae15c88-a29b-4ea1-a26e-f863a5badd93"
          ],
          "display_name": false
        },
        {
          "uuid": "39b1831f-aac9-4869-803e-3c1b08241b65",
          "name": "ISODECYL DIPHENYL PHOSPHATE",
          "stdName": "ISODECYL DIPHENYL PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92f2486e-ce9b-48df-9d6e-24069ba72b32",
            "bc57a0fd-d9d9-421d-812b-d2f00b775686"
          ],
          "display_name": true
        },
        {
          "uuid": "d47b2a3a-25df-4456-ba8c-2b6a0b55beff",
          "name": "ISODECYLDIPHENYL PHOSPHATE [HSDB]",
          "stdName": "ISODECYLDIPHENYL PHOSPHATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92f2486e-ce9b-48df-9d6e-24069ba72b32",
            "bc57a0fd-d9d9-421d-812b-d2f00b775686"
          ],
          "display_name": false
        },
        {
          "uuid": "c7334b3d-36d5-41bb-a95a-b9bac32a1622",
          "name": "PHOSFLEX 390",
          "stdName": "PHOSFLEX 390",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc57a0fd-d9d9-421d-812b-d2f00b775686",
            "6ae15c88-a29b-4ea1-a26e-f863a5badd93"
          ],
          "display_name": false
        },
        {
          "uuid": "cfeb70be-c5a4-4c21-a02d-234983e198bb",
          "name": "PHOSPHORIC ACID, ISODECYL DIPHENYL ESTER",
          "stdName": "PHOSPHORIC ACID, ISODECYL DIPHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc57a0fd-d9d9-421d-812b-d2f00b775686",
            "6ae15c88-a29b-4ea1-a26e-f863a5badd93"
          ],
          "display_name": false
        },
        {
          "uuid": "97bb39d2-30dc-4cd0-aaf3-9e042fc49c17",
          "name": "SANTICIZER 148",
          "stdName": "SANTICIZER 148",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92f2486e-ce9b-48df-9d6e-24069ba72b32",
            "bc57a0fd-d9d9-421d-812b-d2f00b775686"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6ae15c88-a29b-4ea1-a26e-f863a5badd93",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bc57a0fd-d9d9-421d-812b-d2f00b775686",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92f2486e-ce9b-48df-9d6e-24069ba72b32",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c848952-d591-462d-9d48-fe2f4dd419ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cc0e9cf-d9b4-4a9d-8171-2f0ac779e81b",
          "citation": "SRS import [2927JBB380]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2927JBB380",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6a1684f-8cac-d89f-d0fe-b691fe594021",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+29761-21-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85ae1d02-b9c8-090f-38b9-0d46b1da68fb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=29761-21-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f7f7447-7da0-42d3-9f6c-9d84a9fa5727",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f3c14667-1a58-4e1b-93cd-b980987147dd",
          "id": "f3c14667-1a58-4e1b-93cd-b980987147dd",
          "molfile": "\n  Marvin  01132112382D          \n\n 27 28  0  0  0  0            999 V2000\n    4.5750   -0.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8552   -1.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8586   -2.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1423   -0.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4294   -1.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7130   -0.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0002   -1.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2838   -0.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4325   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1455   -0.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1455   -0.0934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1455    0.7336    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1455    1.5539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3322    0.7336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4845    0.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8998   -0.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7372   -0.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1733    0.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7649    1.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9240    1.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9553    0.7198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7582    0.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1804    1.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0178    1.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.4192    0.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9936   -0.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1665    0.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 12 21  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCCCCCOP(=O)(Oc1ccccc1)Oc2ccccc2",
          "formula": "C22H31O4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0e295552-2ad6-4815-aaa5-a2a0307f6743"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "390.4537",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "737f9aeb-bdf5-4515-889c-1f709548d4d0",
      "version": "4",
      "structure": {
        "id": "1613d6b7-2326-4a0a-a5cb-66188338aebc",
        "molfile": "\n  Marvin  01132101202D          \n\n 27 28  0  0  0  0            999 V2000\n   -1.1455    0.7336    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3322    0.7336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9553    0.7198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1455   -0.0934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1455    1.5539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4845    0.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7582    0.7198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1455   -0.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8998   -0.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9240    1.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1804    1.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1665    0.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4325   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7372   -0.0519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7649    1.3843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0178    1.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9936   -0.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2838   -0.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1733    0.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.4192    0.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0002   -1.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7130   -0.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4294   -1.3254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1423   -0.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8552   -1.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5750   -0.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8586   -2.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  9  2  0  0  0  0\n  6 10  1  0  0  0  0\n  7 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 15  2  0  0  0  0\n 11 16  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 18  1  0  0  0  0\n 14 19  2  0  0  0  0\n 16 20  2  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 15 19  1  0  0  0  0\n 17 20  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCCCCCOP(=O)(Oc1ccccc1)Oc2ccccc2",
        "formula": "C22H31O4P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "390.4537",
        "optical_activity": "NONE",
        "references": [
          "7cc0e9cf-d9b4-4a9d-8171-2f0ac779e81b",
          "92f2486e-ce9b-48df-9d6e-24069ba72b32"
        ],
        "stereo_centers": 0
      },
      "unii": "2927JBB380"
    }
  ]
}