{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "433783b3-ef3d-491e-bcfb-e5192d7d400b",
          "code": "980-26-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=980-26-7",
          "code_system": "CAS",
          "references": [
            "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd",
            "ef71ab05-0bd4-4aa1-a645-010f5cfbd1f6"
          ]
        },
        {
          "uuid": "c560f1fd-9b06-4138-a4a5-be688fc5b2db",
          "code": "FCN NO. 1231",
          "comments": "FCN|COLORANT|POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=1231",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd"
          ]
        },
        {
          "uuid": "6cc6e354-ecc2-40e9-8093-a7f338b2e292",
          "code": "FCN NO. 426",
          "comments": "FCN|COLORANT|POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=426",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd"
          ]
        },
        {
          "uuid": "89256427-7b69-4f4b-a406-c8ff02846832",
          "code": "FCN NO. 356",
          "comments": "FCN|COLORANT|FOOD CONTACT ARTICLES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=356",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd"
          ]
        },
        {
          "uuid": "653992b5-5c12-4dc7-bbbd-1aaa4cd38a2c",
          "code": "FCN NO. 340",
          "comments": "FCN|COLORANT|POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=340",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd"
          ]
        },
        {
          "uuid": "584b0dd2-2416-4996-b241-e059ffc80a8f",
          "code": "213-561-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.329",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd"
          ]
        },
        {
          "uuid": "5b04804e-69be-40cf-8886-c20cd14092ac",
          "code": "70423",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70423",
          "code_system": "PUBCHEM",
          "references": [
            "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd"
          ]
        },
        {
          "uuid": "d2159e79-2807-ef15-a937-8585f837f844",
          "code": "DTXSID2052655",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2052655",
          "code_system": "EPA CompTox",
          "references": [
            "a7479f32-c1c5-fb4f-bb70-c8e92421f94d"
          ]
        },
        {
          "uuid": "5c106606-edfb-46be-a291-39d53f1ea093",
          "code": "28UCS3P84C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b2afab19-e673-407e-8a61-a262754733dd",
          "name": "2,9-DIMETHYLQUINACRIDONE",
          "stdName": "2,9-DIMETHYLQUINACRIDONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9ae3aec-c907-40a2-8533-a9d663648546",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": true
        },
        {
          "uuid": "596b080a-62a9-4677-81e8-26c76709c821",
          "name": "5,12-DIHYDRO-2,9-DIMETHYLQUINO(2,3-B)ACRIDINE-7,14-DIONE",
          "stdName": "5,12-DIHYDRO-2,9-DIMETHYLQUINO(2,3-B)ACRIDINE-7,14-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9ae3aec-c907-40a2-8533-a9d663648546",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": false
        },
        {
          "uuid": "e6f32c69-ed59-43c7-9584-3fbfc676ded9",
          "name": "C.I. 73915",
          "stdName": "C.I. 73915",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9ae3aec-c907-40a2-8533-a9d663648546",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": false
        },
        {
          "uuid": "2f9a44a8-a70e-410b-afdf-0c1034f7340d",
          "name": "C.I. PIGMENT RED 122",
          "stdName": "C.I. PIGMENT RED 122",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fac6a28e-a0c2-4244-b55a-ded6a6475989",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": false
        },
        {
          "uuid": "e3413dfa-f4c1-4fe8-a491-52af2f09f867",
          "name": "CI 73915",
          "stdName": "CI 73915",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "89760f10-f16f-4433-af46-0ea7e60a93ed",
            "214da147-386e-49d4-a3c2-15a8abf6eccf",
            "2d423418-9010-4e7e-9d10-cc2921095671",
            "01ecb904-401a-4fa2-b6fe-410bb73f5a54"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "567b6375-aa2e-403a-b2de-a9bbc7770bd7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0e7a2608-c10a-42a8-a4a0-8e6a4f7015e7",
          "name": "DIHYDRO-2,9-DIMETHYLQUINO(2,3-B)ACRIDINE-7,14-DIONE, 5,12-",
          "stdName": "DIHYDRO-2,9-DIMETHYLQUINO(2,3-B)ACRIDINE-7,14-DIONE, 5,12-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9c0ccba-e72a-4a79-a52e-3747d39056ef"
          ],
          "display_name": false
        },
        {
          "uuid": "b017f7a6-1344-4350-a504-0613ff88827e",
          "name": "FASTOGEN SUPER MAGENTA R",
          "stdName": "FASTOGEN SUPER MAGENTA R",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fac6a28e-a0c2-4244-b55a-ded6a6475989",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": false
        },
        {
          "uuid": "5cb1cad4-8a23-44a8-9cf5-9ce666e0743d",
          "name": "HOSTAPERM PINK E",
          "stdName": "HOSTAPERM PINK E",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fac6a28e-a0c2-4244-b55a-ded6a6475989",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": false
        },
        {
          "uuid": "6b384e58-4982-4245-9145-da5b117173c0",
          "name": "QUINO(2,3-B)ACRIDIN-7,14-DIONE, 5,12-DIHYDRO-2,9-DIMETHYL-",
          "stdName": "QUINO(2,3-B)ACRIDIN-7,14-DIONE, 5,12-DIHYDRO-2,9-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9ae3aec-c907-40a2-8533-a9d663648546",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": false
        },
        {
          "uuid": "722036c0-5443-4c14-8916-9e9adcf78c68",
          "name": "QUINO(2,3-B)ACRIDINE-7,14-DIONE, 5,12-DIHYDRO-2,9-DIMETHYL-",
          "stdName": "QUINO(2,3-B)ACRIDINE-7,14-DIONE, 5,12-DIHYDRO-2,9-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9ae3aec-c907-40a2-8533-a9d663648546",
            "89760f10-f16f-4433-af46-0ea7e60a93ed"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d9c0ccba-e72a-4a79-a52e-3747d39056ef",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b9ae3aec-c907-40a2-8533-a9d663648546",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89760f10-f16f-4433-af46-0ea7e60a93ed",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "214da147-386e-49d4-a3c2-15a8abf6eccf",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01ecb904-401a-4fa2-b6fe-410bb73f5a54",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fac6a28e-a0c2-4244-b55a-ded6a6475989",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c62e9cf2-32bc-4e1f-9a7a-abc301e310bd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff4f86e2-26e0-4ef6-b3e4-2b001a4b2257",
          "citation": "SRS import [28UCS3P84C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=28UCS3P84C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae6c05d0-2b99-41fb-8d44-0597cf0a252b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d423418-9010-4e7e-9d10-cc2921095671",
          "citation": "CI 73915 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7479f32-c1c5-fb4f-bb70-c8e92421f94d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=980-26-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef71ab05-0bd4-4aa1-a645-010f5cfbd1f6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe9531fc-4f81-4ebd-aec9-aedd59e6e690",
          "id": "fe9531fc-4f81-4ebd-aec9-aedd59e6e690",
          "molfile": "\n  Marvin  01132113112D          \n\n 26 30  0  0  0  0            999 V2000\n    3.1570   -2.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8725   -2.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8725   -3.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5742   -4.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2915   -3.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0057   -4.0648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7252   -3.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4269   -4.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1487   -3.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1487   -2.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4471   -2.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7252   -2.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0207   -2.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0207   -1.5887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2915   -2.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5897   -2.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8732   -2.4419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5780   -2.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3079   -2.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0065   -2.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0065   -3.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7118   -4.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2923   -4.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5780   -3.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8583   -4.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8583   -4.9176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 16  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 15  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 25  1  0  0  0  0\n 10 11  2  0  0  0  0\n 17 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 24 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\nM  END",
          "smiles": "Cc1ccc2c(c1)c(=O)c3cc4c(cc3[nH]2)c(=O)c5cc(C)ccc5[nH]4",
          "formula": "C22H16N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0f8e820a-085f-41bc-8339-ffa014e6b346"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "340.3755",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bed71280-9b3d-478d-b41e-9a204d633ac5",
      "version": "5",
      "structure": {
        "id": "941cc44c-2a35-4ee3-b866-ba83e33a4c59",
        "molfile": "\n  Marvin  01132107412D          \n\n 26 30  0  0  0  0            999 V2000\n    8.8583   -4.9176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8583   -4.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5780   -3.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5780   -2.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8732   -2.4419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1487   -2.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4471   -2.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7252   -2.8290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7252   -3.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0057   -4.0648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2915   -3.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2915   -2.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5897   -2.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8725   -2.8051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8725   -3.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5742   -4.0473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1570   -2.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0207   -2.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0207   -1.5887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4269   -4.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1487   -3.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3079   -2.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0065   -2.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0065   -3.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7118   -4.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2923   -4.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 11  1  0  0  0  0\n 14 17  1  0  0  0  0\n 12 18  1  0  0  0  0\n 18  8  1  0  0  0  0\n 18 19  2  0  0  0  0\n  9 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21  2  1  0  0  0  0\n 21  6  2  0  0  0  0\n  4 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 26  3  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc2c(c1)c(=O)c3cc4c(cc3[nH]2)c(=O)c5cc(C)ccc5[nH]4",
        "formula": "C22H16N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "340.3755",
        "optical_activity": "NONE",
        "references": [
          "ae6c05d0-2b99-41fb-8d44-0597cf0a252b",
          "ff4f86e2-26e0-4ef6-b3e4-2b001a4b2257"
        ],
        "stereo_centers": 0
      },
      "unii": "28UCS3P84C"
    }
  ]
}