{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "714b8122-3298-45f7-bee0-886c82470a9c",
          "code": "2438-80-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2438-80-4",
          "code_system": "CAS",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc",
            "b76c1a28-a0c0-4f5c-a09a-515521eb0717"
          ]
        },
        {
          "uuid": "40c2a1cb-f86f-4ca5-ba87-40848da2a4fe",
          "code": "87-96-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-96-7",
          "code_system": "CAS",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc",
            "4607b643-75ee-4ba9-86a3-0a3d54f8166c"
          ]
        },
        {
          "uuid": "b7754dce-e1b5-4dcf-8ff3-6c35e6118730",
          "code": "D005643",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005643",
          "code_system": "MESH",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc"
          ]
        },
        {
          "uuid": "f913c8d4-7399-4b8e-94c4-d6f3296f9403",
          "code": "FUCOSE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fucose",
          "code_system": "WIKIPEDIA",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc"
          ]
        },
        {
          "uuid": "46f6f28b-8b40-4eb1-91e3-1095cf496e9d",
          "code": "201-785-4",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.624",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc"
          ]
        },
        {
          "uuid": "d59d1c97-d48c-415b-859a-b9d347f38e20",
          "code": "m5578",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5578?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc"
          ]
        },
        {
          "uuid": "fc2474d2-d283-4b70-be91-aa2c44ad338f",
          "code": "219-452-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.684",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc"
          ]
        },
        {
          "uuid": "bcfd1848-81ec-47bd-b922-a35c5e43fc89",
          "code": "3034656",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3034656",
          "code_system": "PUBCHEM",
          "references": [
            "76e01c08-cffb-4706-a580-969f1329fccc"
          ]
        },
        {
          "uuid": "7b0e2a0c-5c67-4db9-05bb-aaf49fdd69ef",
          "code": "667018",
          "comments": "ORPHAN DRUG|Designated|Treatment of Congenital Disorder of Glycosylation IIc",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=667018",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "a7ea89d5-3145-c523-4f65-595e86811a76",
          "code": "C68479",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Monosaccharide[C68471]|Hexose",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68479",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "b84bdd41-7f8c-3526-86b2-fbe2537457f2",
          "code": "753120",
          "comments": "ORPHAN DRUG|Designated|Treatment of Leukocyte Adhesion Deficiency Type- II",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=753120",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "b0e60100-2630-67e5-1c9b-d4086bd1ff42",
          "code": "DB15236",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15236",
          "code_system": "DRUG BANK",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "919946a2-f2e9-4444-aa27-4e51f2e5efa4",
          "code": "28RYY2IV3F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a0658ec4-a2ce-2093-e184-67449b359231",
          "code": "C68481",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68481",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b205b79c-be42-539e-c293-a746e077e5f7"
          ]
        },
        {
          "uuid": "458a3cf4-6350-0617-b583-7af243d4a894",
          "code": "2466731",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2466731/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "416225dd-3181-cfc8-4855-f68bb5f983a2"
          ]
        },
        {
          "uuid": "1e8c1a96-acc1-34ba-13b7-d4707753fd66",
          "code": "18287",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18287",
          "code_system": "CHEBI",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "fc2dc13a-2e90-a570-a2f8-75ec029fa0df",
          "code": "2181",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2181",
          "code_system": "CHEBI",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "2bee502e-26c3-82e5-3fd2-e6f7b1822bc2",
          "code": "33984",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:33984",
          "code_system": "CHEBI",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "e0be1ab1-482f-42da-2607-676f221217ca",
          "code": "1286606",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1286606",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "cf2e741e-c842-592f-c96b-a8321220353e"
          ]
        },
        {
          "uuid": "52cb30f3-1a64-7af6-0f16-f2076d4b2107",
          "code": "DTXSID50883845",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50883845",
          "code_system": "EPA CompTox",
          "references": [
            "dc5c794a-956c-3840-9d1d-7a73329c7f4b"
          ]
        },
        {
          "uuid": "d23e1d3f-94a4-cbd9-bc11-3e51c828378f",
          "code": "300000041011",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f2630de3-2edd-b24e-c1ce-112f265e6c85"
          ]
        },
        {
          "uuid": "9632c990-20f9-0067-c6d9-5fd73169cc55",
          "code": "1219",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1219",
          "code_system": "NSC",
          "references": [
            "bd9841c2-32ee-30c7-e40b-bc0fe6b03c21"
          ]
        },
        {
          "uuid": "47f7a88c-aea1-332e-1989-446a37f01398",
          "code": "28RYY2IV3F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=28RYY2IV3F",
          "code_system": "DAILYMED",
          "references": [
            "f4f399af-3ada-d4a1-14b8-f11206b1f0be"
          ]
        },
        {
          "uuid": "304e62d0-0789-9d43-35cb-877df63a9fbc",
          "code": "JK-273",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/JK-273/relevant/1/",
          "code_system": "USAN",
          "references": [
            "d120dd03-8ab7-c06c-770a-7d310cc98dbd"
          ]
        },
        {
          "uuid": "8a6fa624-1f14-35e1-45eb-5a5afd23c5e2",
          "code": "12611",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=12611",
          "code_system": "INN",
          "references": [
            "d120dd03-8ab7-c06c-770a-7d310cc98dbd"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "439a5d7c-008d-4f61-a5ca-a20be05969ea",
          "citation": "https://ir.avalotx.com/press-releases/detail/156",
          "url": "https://ir.avalotx.com/press-releases/detail/156",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "31bdd961-b024-470d-a949-b4bfeda06805",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5107b89d-74aa-4625-b2ae-d923cb924fba",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26338c24-e2a4-45e5-ac8a-0f219f01dd29",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd82aefb-dcc6-4995-b566-cd8730a5a392",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e573d0f4-623d-4fc4-bcc3-411f0b50e81b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f862d6e1-0dd4-47d9-983b-d912ba6b48d9",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba84b359-18aa-419f-9783-6f24ad32e439",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76e01c08-cffb-4706-a580-969f1329fccc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390885000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebefbd53-d5a3-4f80-ac3d-2e6399a5cffa",
          "citation": "SRS import [28RYY2IV3F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=28RYY2IV3F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390885000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "028058dc-7866-462a-aa8a-f5a614eb2a1f",
          "citation": "FUCOGEL? 1.5P product infor sheet",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5bf0c0b-9767-464d-a401-57fd47f1988a",
          "citation": "L-FUCOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c515497e-b8b6-448b-bab4-089fb1a44d56",
          "citation": "FUCOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b72b4de3-19ae-4853-a969-5bcc282efd22",
          "citation": "L-FUCOSE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f2630de3-2edd-b24e-c1ce-112f265e6c85",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "cf2e741e-c842-592f-c96b-a8321220353e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b76c1a28-a0c0-4f5c-a09a-515521eb0717",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4607b643-75ee-4ba9-86a3-0a3d54f8166c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "935dbed2-f281-fcf9-792e-f231a4d62170",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "d694086b-2dcc-457d-aeb6-c99beb0f26dd",
          "citation": "Fucose - Cerecor",
          "url": "https://adisinsight.springer.com/drugs/800053277",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "b205b79c-be42-539e-c293-a746e077e5f7",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "bd9841c2-32ee-30c7-e40b-bc0fe6b03c21",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "416225dd-3181-cfc8-4855-f68bb5f983a2",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "cb9dc94c-32c0-4798-a3b4-b42f5c533275",
          "citation": "USAN COUN 2023",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d120dd03-8ab7-c06c-770a-7d310cc98dbd",
          "citation": "USAN Coun 2023",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "f4f399af-3ada-d4a1-14b8-f11206b1f0be",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "77c24cec-5eb7-27a7-1bd4-ca0defe94a5e",
          "citation": "USAN COUN 2023",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "dc5c794a-956c-3840-9d1d-7a73329c7f4b",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "ecdb1023-3111-5b1c-d528-f1c442d260c4",
          "citation": "INN P129",
          "doc_type": "INN_LIST",
          "public_domain": true
        },
        {
          "uuid": "8e76acf6-2128-4d8e-9512-7771f459196e",
          "citation": "INN P129",
          "url": "https://cdn.who.int/media/docs/default-source/international-nonproprietary-names-(inn)/pl129.pdf?sfvrsn=678fceea_3&download=true",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6a624adc-70a9-495d-abbc-f1adad840bd6",
          "id": "6a624adc-70a9-495d-abbc-f1adad840bd6",
          "molfile": "\n  Marvin  01132105322D          \n\n 11 10  0  0  1  0            999 V2000\n    7.0945   -5.3250    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.3800   -4.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0945   -6.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8089   -4.9124    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.8089   -4.0874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5234   -5.3250    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.5234   -6.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2379   -4.9124    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.2379   -4.0874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9523   -5.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9523   -6.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  4  1  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  6  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
          "smiles": "C[C@@H]([C@H]([C@H]([C@@H](C=O)O)O)O)O",
          "formula": "C6H12O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f0cee5b1-104f-47e1-b6c1-c1fd210c16ea"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "164.1567",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "58088f30-72de-4bc8-b138-d26f7f3659d4",
      "version": "39",
      "structure": {
        "id": "03d5f29a-fffa-47aa-a111-57e205dcf8cf",
        "molfile": "\n  Marvin  01132100302D          \n\n 11 10  0  0  1  0            999 V2000\n    6.3800   -4.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0945   -5.3250    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8089   -4.9124    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.5234   -5.3250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2379   -4.9124    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.9523   -5.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9523   -6.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2379   -4.0874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5234   -6.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8089   -4.0874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0945   -6.1500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  5  8  1  6  0  0  0\n  4  9  1  6  0  0  0\n  3 10  1  1  0  0  0\n  2 11  1  1  0  0  0\nM  END",
        "smiles": "C[C@@H]([C@H]([C@H]([C@@H](C=O)O)O)O)O",
        "formula": "C6H12O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "164.1567",
        "optical_activity": "( - )",
        "references": [
          "ebefbd53-d5a3-4f80-ac3d-2e6399a5cffa",
          "028058dc-7866-462a-aa8a-f5a614eb2a1f"
        ],
        "stereo_centers": 4
      },
      "unii": "28RYY2IV3F",
      "relationships": [
        {
          "uuid": "e13f5ae7-ac4a-40e8-b582-6824d713551b",
          "amount": {
            "uuid": "7c0f57fb-1c02-468d-b63e-0c9e12533f69"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "35fd85a2-328a-4f60-91dd-be158d44e91a",
            "refuuid": "b5e83bdf-092e-4a37-8b7c-d51cbc89d30d",
            "name": "ALTERNATIVE DEFINITION for [Elfucose]",
            "linking_id": "b5e83bdf-092e-4a37-8b7c-d51cbc89d30d",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "0edbc15c-a409-4e86-926b-bab6a0f0e016",
          "amount": {
            "uuid": "b700c29d-9219-48b0-86ad-fda534270556"
          },
          "comments": "Fucose replacements ",
          "type": "ACTIVE MOIETY",
          "references": [
            "d694086b-2dcc-457d-aeb6-c99beb0f26dd"
          ],
          "related_substance": {
            "uuid": "08efd394-ad4b-489e-a72c-f6c20d285be6",
            "refuuid": "58088f30-72de-4bc8-b138-d26f7f3659d4",
            "name": "Elfucose",
            "unii": "28RYY2IV3F",
            "linking_id": "28RYY2IV3F",
            "ref_pname": "Elfucose",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5989b194-b7f5-4d2a-8a33-844b12feb68c",
          "amount": {
            "uuid": "acb8bb53-ce61-4de2-9d34-4577ca2958ff"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "87b119bd-35dc-4e63-be63-760934bda51a",
            "refuuid": "62a58f00-509d-462e-a838-0f179c283a8e",
            "name": "ALTERNATIVE DEFINITION for [Elfucose]",
            "linking_id": "62a58f00-509d-462e-a838-0f179c283a8e",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "names": [
        {
          "uuid": "4e3ec640-3aa7-40f0-b7b3-405e64b81f1d",
          "name": "(-)-FUCOSE",
          "stdName": "(-)-FUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26338c24-e2a4-45e5-ac8a-0f219f01dd29",
            "5107b89d-74aa-4625-b2ae-d923cb924fba"
          ],
          "display_name": false
        },
        {
          "uuid": "7cd76f19-13ab-44d8-b4b2-e8f8949714d1",
          "name": "6-deoxy-L-galactopyranose",
          "stdName": "6-DEOXY-L-GALACTOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e76acf6-2128-4d8e-9512-7771f459196e"
          ],
          "display_name": false
        },
        {
          "uuid": "0c971af7-0cce-4021-9168-7bc4c4f641e7",
          "name": "6-deoxy-L-galactose",
          "stdName": "6-DEOXY-L-GALACTOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31bdd961-b024-470d-a949-b4bfeda06805",
            "5107b89d-74aa-4625-b2ae-d923cb924fba",
            "cb9dc94c-32c0-4798-a3b4-b42f5c533275"
          ],
          "display_name": false
        },
        {
          "uuid": "4f80cef5-1ff6-41e4-a616-69693eb706e7",
          "name": "AVTX-803",
          "stdName": "AVTX-803",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "439a5d7c-008d-4f61-a5ca-a20be05969ea"
          ],
          "display_name": false
        },
        {
          "uuid": "5ea560b7-b51f-428a-879a-235b6a0d271d",
          "name": "DEOXYGALACTOSE-CERECOR",
          "stdName": "DEOXYGALACTOSE-CERECOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d694086b-2dcc-457d-aeb6-c99beb0f26dd"
          ],
          "display_name": false
        },
        {
          "uuid": "40e0bc19-74b6-d068-cb65-74295ecc8ab5",
          "name": "ELFUCOSE [USAN]",
          "stdName": "ELFUCOSE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "77c24cec-5eb7-27a7-1bd4-ca0defe94a5e"
          ],
          "display_name": false
        },
        {
          "uuid": "765f1c8e-4dac-4c13-baf7-972b8c063238",
          "name": "Elfucose",
          "stdName": "ELFUCOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d120dd03-8ab7-c06c-770a-7d310cc98dbd",
            "8e76acf6-2128-4d8e-9512-7771f459196e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "cc818ddd-9b51-4e60-bfdb-9cceb91c7b0d",
              "name_org": "INN"
            },
            {
              "uuid": "5f9ecfbd-afe4-45f7-b01b-d93b4b275519",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "e86b006d-dd7d-4680-bdb7-de2df1b38913",
          "name": "FUCOSE",
          "stdName": "FUCOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ba84b359-18aa-419f-9783-6f24ad32e439",
            "c515497e-b8b6-448b-bab4-089fb1a44d56",
            "5107b89d-74aa-4625-b2ae-d923cb924fba",
            "e573d0f4-623d-4fc4-bcc3-411f0b50e81b"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5d57d3b8-1fbd-4506-a5d6-1ac8a5c86fe5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "711f3d41-9eec-4d05-9e52-f7e7f8815210",
          "name": "FUCOSE, L-",
          "stdName": "FUCOSE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26338c24-e2a4-45e5-ac8a-0f219f01dd29",
            "5107b89d-74aa-4625-b2ae-d923cb924fba"
          ],
          "display_name": false
        },
        {
          "uuid": "a79e5e38-5f32-494c-91ea-2449ddc3eea1",
          "name": "FUCOSE-CERECOR",
          "stdName": "FUCOSE-CERECOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d694086b-2dcc-457d-aeb6-c99beb0f26dd"
          ],
          "display_name": false
        },
        {
          "uuid": "b2d0c5d3-2c80-46cf-a4d5-971531e760f8",
          "name": "L-(-)-FUCOSE",
          "stdName": "L-(-)-FUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26338c24-e2a4-45e5-ac8a-0f219f01dd29",
            "5107b89d-74aa-4625-b2ae-d923cb924fba"
          ],
          "display_name": false
        },
        {
          "uuid": "09a8c280-78bb-4c1f-ac65-719c090b1978",
          "name": "L-FUCOSE",
          "stdName": "L-FUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26338c24-e2a4-45e5-ac8a-0f219f01dd29",
            "dd82aefb-dcc6-4995-b566-cd8730a5a392",
            "f862d6e1-0dd4-47d9-983b-d912ba6b48d9",
            "b5bf0c0b-9767-464d-a401-57fd47f1988a",
            "b72b4de3-19ae-4853-a969-5bcc282efd22",
            "5107b89d-74aa-4625-b2ae-d923cb924fba"
          ],
          "display_name": false
        },
        {
          "uuid": "922d1630-7582-4faf-9523-f7666e3ca22f",
          "name": "L-FUCOSE [MI]",
          "stdName": "L-FUCOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd82aefb-dcc6-4995-b566-cd8730a5a392",
            "5107b89d-74aa-4625-b2ae-d923cb924fba"
          ],
          "display_name": false
        },
        {
          "uuid": "bf6199c2-e894-40d9-90d6-dd83041f4518",
          "name": "L-FUCOSE [USP-RS]",
          "stdName": "L-FUCOSE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f862d6e1-0dd4-47d9-983b-d912ba6b48d9",
            "5107b89d-74aa-4625-b2ae-d923cb924fba"
          ],
          "display_name": false
        },
        {
          "uuid": "f4c01c37-7c3c-4653-9765-5225073183aa",
          "name": "L-GALACTOMETHYLOSE",
          "stdName": "L-GALACTOMETHYLOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26338c24-e2a4-45e5-ac8a-0f219f01dd29",
            "5107b89d-74aa-4625-b2ae-d923cb924fba"
          ],
          "display_name": false
        },
        {
          "uuid": "ff4d1106-7d8f-4a9c-aff9-82788a09efb4",
          "name": "L-fucopyranose",
          "stdName": "L-FUCOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e76acf6-2128-4d8e-9512-7771f459196e"
          ],
          "display_name": false
        },
        {
          "uuid": "caad0bb7-7036-c3d8-f305-ac774d0147a0",
          "name": "NSC-1219",
          "stdName": "NSC-1219",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd9841c2-32ee-30c7-e40b-bc0fe6b03c21"
          ],
          "display_name": false
        },
        {
          "uuid": "25f14478-666a-a31f-93b1-99c5757784ef",
          "name": "elfucose [INN]",
          "stdName": "ELFUCOSE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecdb1023-3111-5b1c-d528-f1c442d260c4"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "ce9f693e-2273-41cc-ac57-391c0d52b185"
      }
    }
  ]
}