{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b659a8ac-7829-4269-91ab-5bc341cbb8ba",
          "code": "188038-97-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=188038-97-3",
          "code_system": "CAS",
          "references": [
            "47f866a6-6652-4e8c-8dcf-f7c7106083a1",
            "863ef1a9-6452-4b79-9401-6c30c1db0c1f"
          ]
        },
        {
          "uuid": "0742d165-4789-4f46-89e3-1137d033665a",
          "code": "1486796",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1486796/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "47f866a6-6652-4e8c-8dcf-f7c7106083a1"
          ]
        },
        {
          "uuid": "718e3867-c91e-4b89-9dea-d0eaaa13f962",
          "code": "18319148",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18319148",
          "code_system": "PUBCHEM",
          "references": [
            "47f866a6-6652-4e8c-8dcf-f7c7106083a1"
          ]
        },
        {
          "uuid": "24490063-19ab-4f9c-9a64-8f146d6e69e8",
          "code": "28ON9X7M1L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53a3ed50-fc78-9e9d-f545-ec7466391507",
          "code": "28ON9X7M1L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=28ON9X7M1L",
          "code_system": "DAILYMED",
          "references": [
            "11dc4a38-19e7-eb42-b363-bb49a3ad7564"
          ]
        },
        {
          "uuid": "eb2a0597-18ee-1638-4e74-46bb49d4ec6d",
          "code": "DTXSID80940293",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80940293",
          "code_system": "EPA CompTox",
          "references": [
            "0f2219be-daf8-857f-fd03-9fc0141dfe5b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "35535a36-d2a1-4778-9cc1-278d334d2c62",
          "name": "(±)-2-BUTYLOCTYL BENZOATE",
          "stdName": "(+/-)-2-BUTYLOCTYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "875ac2f3-6c92-4b03-b285-3120e5058b05",
            "3bd46a03-75dc-4d35-b512-ce4f4ce5859d"
          ],
          "display_name": false
        },
        {
          "uuid": "0890617a-3be5-419c-a295-8ac176fb8019",
          "name": "1-OCTANOL, 2-BUTYL-, 1-BENZOATE",
          "stdName": "1-OCTANOL, 2-BUTYL-, 1-BENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d341ebc4-564d-4789-bc5a-481df4a71297",
            "3bd46a03-75dc-4d35-b512-ce4f4ce5859d"
          ],
          "display_name": false
        },
        {
          "uuid": "da15d1a9-719d-43df-9f14-9b06432dbc55",
          "name": "1-OCTANOL, 2-BUTYL-, BENZOATE",
          "stdName": "1-OCTANOL, 2-BUTYL-, BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d341ebc4-564d-4789-bc5a-481df4a71297",
            "3bd46a03-75dc-4d35-b512-ce4f4ce5859d"
          ],
          "display_name": false
        },
        {
          "uuid": "d95a0348-c30f-4795-b291-3e743859fd97",
          "name": "2-BUTYLOCTYL BENZOATE",
          "stdName": "2-BUTYLOCTYL BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d341ebc4-564d-4789-bc5a-481df4a71297",
            "3bd46a03-75dc-4d35-b512-ce4f4ce5859d"
          ],
          "display_name": false
        },
        {
          "uuid": "8ce42407-519c-4864-8838-c7746649a182",
          "name": "2-BUTYLOCTYL BENZOATE, (±)-",
          "stdName": "2-BUTYLOCTYL BENZOATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "875ac2f3-6c92-4b03-b285-3120e5058b05",
            "3bd46a03-75dc-4d35-b512-ce4f4ce5859d"
          ],
          "display_name": false
        },
        {
          "uuid": "6e2a1e39-42ea-45ce-b3cd-fdd65a03b5b0",
          "name": "BENZOIC ACID, 2-BUTYLOCTYL ESTER",
          "stdName": "BENZOIC ACID, 2-BUTYLOCTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2e80bce-e493-4d63-8d8a-2d6e2645a9c6",
            "3bd46a03-75dc-4d35-b512-ce4f4ce5859d"
          ],
          "display_name": false
        },
        {
          "uuid": "bf26dd24-1d6d-4005-9e41-e5e11c9b62fb",
          "name": "BUTYLOCTYL BENZOATE",
          "stdName": "BUTYLOCTYL BENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7715410-8b73-4b40-86af-812fc7b21c32",
            "d2e80bce-e493-4d63-8d8a-2d6e2645a9c6",
            "3bd46a03-75dc-4d35-b512-ce4f4ce5859d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ebedeb2c-487a-4756-a900-85d4d9e67798",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "d341ebc4-564d-4789-bc5a-481df4a71297",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3bd46a03-75dc-4d35-b512-ce4f4ce5859d",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2e80bce-e493-4d63-8d8a-2d6e2645a9c6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "875ac2f3-6c92-4b03-b285-3120e5058b05",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47f866a6-6652-4e8c-8dcf-f7c7106083a1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa21994c-72e6-4e22-ae18-2636384995d9",
          "citation": "SRS import [28ON9X7M1L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=28ON9X7M1L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7715410-8b73-4b40-86af-812fc7b21c32",
          "citation": "BUTYLOCTYL BENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "863ef1a9-6452-4b79-9401-6c30c1db0c1f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "11dc4a38-19e7-eb42-b363-bb49a3ad7564",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0f2219be-daf8-857f-fd03-9fc0141dfe5b",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ca385603-6d62-4ec9-bcb4-dab8e5da3c3c",
          "id": "ca385603-6d62-4ec9-bcb4-dab8e5da3c3c",
          "molfile": "\n  Marvin  01132110262D          \n\n 21 21  0  0  0  0            999 V2000\n    8.7395  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4540  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1684  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8829  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5974  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3119  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0264  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   13.0264  -15.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3119  -15.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3119  -16.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5974  -17.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7408  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4553  -14.7148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1698  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1698  -13.4773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8843  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5987  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3132  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3132  -15.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5987  -15.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8843  -15.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 21  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCC(CCCC)COC(=O)c1ccccc1",
          "formula": "C19H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8f7de55f-a997-4991-a020-74800f45e98b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "290.441",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "73ac9af6-6dbc-4f13-8aa1-4a006bb3ca6b",
      "version": "7",
      "structure": {
        "id": "12384ea0-5b4f-4a92-86e7-f418db2b4cf0",
        "molfile": "\n  Marvin  01132101102D          \n\n 21 21  0  0  0  0            999 V2000\n   15.8843  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5987  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3132  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3132  -15.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5987  -15.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8843  -15.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1698  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1698  -13.4773    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4553  -14.7148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7408  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5974  -17.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3119  -16.7773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3119  -15.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0264  -15.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7395  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4540  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1684  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8829  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5974  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3119  -14.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0264  -14.7148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 21 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 21 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n  7  9  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCC(CCCC)COC(=O)c1ccccc1",
        "formula": "C19H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "290.441",
        "optical_activity": "( + / - )",
        "references": [
          "aa21994c-72e6-4e22-ae18-2636384995d9",
          "d341ebc4-564d-4789-bc5a-481df4a71297"
        ],
        "stereo_centers": 1
      },
      "unii": "28ON9X7M1L"
    }
  ]
}