{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cbfc2128-b3ca-4806-9985-5cb05825872c",
          "code": "1193782-16-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1193782-16-9",
          "code_system": "CAS",
          "references": [
            "4c20f517-343b-44b6-ab53-bb5a448ad05d",
            "f0390369-a306-40c3-af0f-ec1dedda14bc"
          ]
        },
        {
          "uuid": "f5d74e22-5287-4cb6-bcac-5cb99c219bb5",
          "code": "45139032",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/45139032",
          "code_system": "PUBCHEM",
          "references": [
            "4c20f517-343b-44b6-ab53-bb5a448ad05d"
          ]
        },
        {
          "uuid": "b65a61ed-5352-4321-8dac-6ced3d72e048",
          "code": "28I81JZ84V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0d8b5d29-2d50-4bb3-b69a-f7f2ce179a4b",
          "name": "17-PHENYL TRINOR PGE2-SA",
          "stdName": "17-PHENYL TRINOR PGE2-SA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00b92e99-d4d3-4857-bb9b-cde0f67d1ef3",
            "75cbef3a-b5d0-4a08-9acb-842b52c31dd6"
          ],
          "display_name": false
        },
        {
          "uuid": "90eced99-a951-4d70-ad41-fb0ec3f54875",
          "name": "17-PHENYL TRINOR PROSTAGLANDIN E2 SERINOL AMIDE",
          "stdName": "17-PHENYL TRINOR PROSTAGLANDIN E2 SERINOL AMIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00b92e99-d4d3-4857-bb9b-cde0f67d1ef3",
            "2f077bfe-1dc4-4cb7-8675-23ad7d62a068"
          ],
          "display_name": false
        },
        {
          "uuid": "db5a690b-b5e6-448e-a342-1609a228ba78",
          "name": "DIHYDROXYPROPYL DIDEHYDROLATANOPROSTAMIDE",
          "stdName": "DIHYDROXYPROPYL DIDEHYDROLATANOPROSTAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e7c5b18-2572-4bf8-a77e-6af9a695b331",
            "00b92e99-d4d3-4857-bb9b-cde0f67d1ef3",
            "2f077bfe-1dc4-4cb7-8675-23ad7d62a068"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a08f681b-152c-4f0d-a2ab-6ec42321d0d2",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "2f077bfe-1dc4-4cb7-8675-23ad7d62a068",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "00b92e99-d4d3-4857-bb9b-cde0f67d1ef3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75cbef3a-b5d0-4a08-9acb-842b52c31dd6",
          "citation": "https://www.caymanchem.com/app/template/Product.vm/catalog/10004238",
          "url": "https://www.caymanchem.com/app/template/Product.vm/catalog/10004238",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c20f517-343b-44b6-ab53-bb5a448ad05d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391955000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b51f24c5-2d8e-46e3-b30c-aebf5fcedaa5",
          "citation": "SRS import [28I81JZ84V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=28I81JZ84V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391955000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e7c5b18-2572-4bf8-a77e-6af9a695b331",
          "citation": "DIHYDROXYPROPYL DIDEHYDROLATANOPROSTAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0390369-a306-40c3-af0f-ec1dedda14bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c744ad6-ccf9-45d3-ab70-0a85a2caea2c",
          "id": "0c744ad6-ccf9-45d3-ab70-0a85a2caea2c",
          "molfile": "\n  Marvin  01132100532D          \n\n 33 34  0  0  1  0            999 V2000\n    7.2227   -6.0501    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.6775   -6.6697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0329   -6.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2893   -6.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0995   -7.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3561   -7.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1581   -8.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7107   -7.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4559   -6.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6441   -6.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9623   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1520   -5.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8865   -4.3273    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.1017   -4.0848    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.4360   -4.5776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1017   -3.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8778   -2.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1191   -2.2065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3694   -3.6581    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.1916   -3.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6084   -4.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4308   -4.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8396   -3.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6618   -3.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0706   -2.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8928   -2.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3018   -2.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3097   -3.6094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1320   -3.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5529   -4.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3783   -4.3151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5447   -2.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1320   -2.1796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 19  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  6  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 32  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
          "smiles": "C(=C/C[C@@H]1C(/C=C/[C@H](CCc2ccccc2)O)[C@@H](CC1=O)O)/CCCC(=O)NC(CO)CO",
          "formula": "C26H37NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f88cfdd8-bbb8-46c2-b9a3-92fc4535020f"
          },
          "defined_stereo": 3,
          "ez_centers": 2,
          "molecular_weight": "459.5761",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b1b63e2b-72b8-4e05-91d0-08c7d2dce0cd",
      "version": "3",
      "structure": {
        "id": "524b96a5-3fd0-425a-b346-ae45792ff09d",
        "molfile": "\n  Marvin  01132104172D          \n\n 33 34  0  0  1  0            999 V2000\n    4.4360   -4.5776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1017   -4.0848    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1017   -3.2596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8778   -2.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1191   -2.2065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3694   -3.6581    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1916   -3.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6084   -4.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4308   -4.3605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8396   -3.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6618   -3.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0706   -2.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8928   -2.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3097   -3.6094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1320   -3.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5529   -4.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3783   -4.3151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5447   -2.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1320   -2.1796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3018   -2.1802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8865   -4.3273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1520   -5.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9623   -5.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2227   -6.0501    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0329   -6.2136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2893   -6.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0995   -7.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3561   -7.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1581   -8.1056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7107   -7.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4559   -6.7074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6441   -6.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6775   -6.6697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  6  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 13 20  2  0  0  0  0\n  2 21  1  0  0  0  0\n 21  6  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  2  0  0  0  0\n 27 32  1  0  0  0  0\n 24 33  1  6  0  0  0\nM  END",
        "smiles": "C(=C/C[C@@H]1C(/C=C/[C@H](CCc2ccccc2)O)[C@@H](CC1=O)O)/CCCC(=O)NC(CO)CO",
        "formula": "C26H37NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 3,
        "ez_centers": 2,
        "molecular_weight": "459.5761",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b51f24c5-2d8e-46e3-b30c-aebf5fcedaa5",
          "75cbef3a-b5d0-4a08-9acb-842b52c31dd6"
        ],
        "stereo_centers": 4
      },
      "unii": "28I81JZ84V"
    }
  ]
}