{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "804c1dd5-90ef-4150-b6d0-df586ab8de51",
          "code": "G04BX12",
          "comments": "ATC|GENITO URINARY SYSTEM AND SEX HORMONES|UROLOGICALS|OTHER UROLOGICALS, INCL. ANTISPASMODICS|Other urologicals|phenyl salicylate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=G04BX12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "0aea4109-c1d5-4fc8-a042-9f905f6b0756",
          "code": "PHENYL SALICYLATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=5213",
          "code_system": "JECFA EVALUATION",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "f43e0cd4-3ac0-4b5f-a1ff-75056f1bd527",
          "code": "118-55-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=118-55-8",
          "code_system": "CAS",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9",
            "47949e15-0978-43c2-8641-c49a26249f8c"
          ]
        },
        {
          "uuid": "07c64159-e00e-4428-bd35-1bbe290c1ca9",
          "code": "C75079",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75079",
          "code_system": "NCI_THESAURUS",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "9acf2c08-7cb4-4a4a-a933-d6bdbf5525dd",
          "code": "C026041",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026041",
          "code_system": "MESH",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "4d0eb9b7-fba9-47a2-99c9-c648caf62160",
          "code": "PHENYL SALICYLATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phenyl_salicylate",
          "code_system": "WIKIPEDIA",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "2ef9796b-0c7e-41f4-87fb-095607b46f26",
          "code": "QG04BX12",
          "comments": "VATC|UROLOGICALS|UROLOGICALS|Other urologicals|phenyl salicylate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QG04BX12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "49cfb196-aa33-4a7a-a6b3-b6e349d5c1c3",
          "code": "204-259-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.873",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "cf0a98ba-e66a-4c95-9174-c53856e85a45",
          "code": "36122",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/36122/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "89a23ac7-3175-4e16-a1fd-7e3565727819",
          "code": "895808",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/895808/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "360f28d0-f23c-4218-ae54-d0096b5b7df8",
          "code": "m8690",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8690?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "c7346bf5-b706-4f61-8f53-bec29025105c",
          "code": "SUB14839MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "72b988fb-aac3-4ab4-87a7-8dee016338e8",
          "code": "CHEMBL1339216",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1339216",
          "code_system": "ChEMBL",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "db60b8a6-1aa6-4193-afc4-c7e452fd89f8",
          "code": "8361",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8361",
          "code_system": "PUBCHEM",
          "references": [
            "98f1dee3-8c76-4cc8-af05-1e02d4f62de9"
          ]
        },
        {
          "uuid": "1449938a-a353-2773-a9d8-a1cd7f63e0cc",
          "code": "DTXSID6021957",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6021957",
          "code_system": "EPA CompTox",
          "references": [
            "b62c1f6b-3951-0241-19db-899ed869420a"
          ]
        },
        {
          "uuid": "d2ec8425-06cc-4da7-61b8-a2da8b42ac5d",
          "code": "C2356",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2356",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3a3bc643-c5a7-8e98-f306-6ebdf921ac79"
          ]
        },
        {
          "uuid": "a5040fea-3041-ddb8-54ae-fbf5178c8b64",
          "code": "3462",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3462",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3a3bc643-c5a7-8e98-f306-6ebdf921ac79"
          ]
        },
        {
          "uuid": "da4224ea-1cd2-b90f-b534-4e41f315974f",
          "code": "DB11071",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11071",
          "code_system": "DRUG BANK",
          "references": [
            "3a3bc643-c5a7-8e98-f306-6ebdf921ac79"
          ]
        },
        {
          "uuid": "ce846ff3-7ee7-4944-a379-49d6caf0f30d",
          "code": "28A37T47QO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a055699d-a38a-5599-be34-6c1b64d03ecb",
          "code": "34918",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34918",
          "code_system": "CHEBI",
          "references": [
            "3a3bc643-c5a7-8e98-f306-6ebdf921ac79"
          ]
        },
        {
          "uuid": "4f6c2e43-aa5f-ce31-72cc-b64ffc8065d5",
          "code": "1534209",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1534209",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "3a3bc643-c5a7-8e98-f306-6ebdf921ac79"
          ]
        },
        {
          "uuid": "70aa7d18-3aae-93d5-fbf1-5beafecbc2b6",
          "code": "28A37T47QO",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=28A37T47QO",
          "code_system": "DAILYMED",
          "references": [
            "4a21833e-5a62-91ab-83b8-6cd65b26ba28"
          ]
        },
        {
          "uuid": "f736b525-8218-6168-0728-76c9cb6307be",
          "code": "100000079433",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a6dbd6e9-f396-e25e-1022-bbe7ee6677ca"
          ]
        },
        {
          "uuid": "fe360a51-9ba2-5d0d-efe2-774ed5d4bf45",
          "code": "33406",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=33406",
          "code_system": "NSC",
          "references": [
            "b76fc9df-82b6-e413-aced-d76f365488ee"
          ]
        },
        {
          "uuid": "45487258-a5a1-4693-9434-f35112d07ff5",
          "code": "607",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/607/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "11060154-054c-72d4-b672-732b58b5c9e2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "eb3f78e8-7bce-44e6-a015-b0efdc511713",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b4e2c13c-00e9-4c08-8a22-cf9e6759e0c3",
            "refuuid": "f28b9564-4261-447c-850f-74b9712d4190",
            "name": "PHENYL SALICYLATE",
            "unii": "28A37T47QO",
            "linking_id": "28A37T47QO",
            "ref_pname": "PHENYL SALICYLATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7ac33634-7e6b-473b-83c7-a3fd63a1c840",
          "name": "FEMA NO. 3960",
          "stdName": "FEMA NO. 3960",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4370863-473d-4c78-a3c8-d2a065d785a7",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "def6c531-4173-425e-81df-1be60b5cdf59",
          "name": "NSC-33406",
          "stdName": "NSC-33406",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c1ac19d-90c4-4e30-be09-81e143daa866",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "4a876f08-21a2-43ed-9c61-22e8925780e9",
          "name": "PHENYL SALICYLATE",
          "stdName": "PHENYL SALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72af1a41-10d2-477e-85b5-38e26f72d117",
            "aa57be8f-48db-425c-bcef-07aa1677ca9c",
            "eaf4d67f-8e10-4c8f-a7d2-90c87e5d1af0",
            "bcbc5f58-cc72-4eca-a9ef-c01b3850a823",
            "4f90583b-3b97-4307-8e95-325c043d2a4c",
            "b9db33b3-a48a-44d6-bd9a-b35b8e69a7bd",
            "fb0bb36f-86c7-49e0-9907-1d84246145aa",
            "d298d765-8b83-43f0-b036-47ebc3373f7a",
            "d4370863-473d-4c78-a3c8-d2a065d785a7",
            "d6041f27-2d52-4f95-bb9d-b67e1539e0fc",
            "2b8957ff-321e-4abb-b15e-b8b8ada09c4e",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6cafffb1-3c60-4120-bd0b-9208b3f8a68d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "87961449-a187-4efd-87a0-f5a44dfd1f18",
          "name": "PHENYL SALICYLATE MELTING POINT STANDARD",
          "stdName": "PHENYL SALICYLATE MELTING POINT STANDARD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9fe708a4-7291-4d86-bbbc-b4493e8b2512",
            "0b6bd1c2-61de-4853-9712-732667b358d6",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "b05508dd-ebd3-48b5-9185-2383956861e8",
          "name": "PHENYL SALICYLATE [FHFI]",
          "stdName": "PHENYL SALICYLATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4370863-473d-4c78-a3c8-d2a065d785a7",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "b803b1bf-d127-4541-b968-8a09044df4a2",
          "name": "PHENYL SALICYLATE [MI]",
          "stdName": "PHENYL SALICYLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b8957ff-321e-4abb-b15e-b8b8ada09c4e",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "4147575e-49eb-7e51-3eb5-64f728894792",
          "name": "PHENYL SALICYLATE [USP-RS]",
          "stdName": "PHENYL SALICYLATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "084c4050-c01c-f6d8-d00b-f6d455cb0b2a"
          ],
          "display_name": false
        },
        {
          "uuid": "1291d0ea-a925-46da-af15-3467e1b8c9c8",
          "name": "PHENYL SALICYLATE [VANDF]",
          "stdName": "PHENYL SALICYLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb0bb36f-86c7-49e0-9907-1d84246145aa",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": false
        },
        {
          "uuid": "50449abf-5514-b3df-767d-7b9ab70ca80d",
          "name": "Phenyl salicylate [WHO-DD]",
          "stdName": "PHENYL SALICYLATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1a1fcf5-f051-4973-559f-40e61bd61e86"
          ],
          "display_name": false
        },
        {
          "uuid": "bf4b9714-1339-49f4-89be-c584019bbfc9",
          "name": "SALOL",
          "stdName": "SALOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7981b54e-11e5-4d26-8729-7c1398d50eed",
            "fb0bb36f-86c7-49e0-9907-1d84246145aa",
            "3e43a408-5d02-4568-8443-af88f600b24b",
            "3a9af5d2-ab9d-4c4b-badb-2dc88d9e4266",
            "7048814a-2e9e-48b1-b311-aabdf8603a4a",
            "7433a425-e3f9-45e1-9e2a-f411ebc0193a",
            "f8c0d503-c750-4be1-b39c-6ad80fc93712",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c",
            "d56ce374-2ac5-46ef-835f-03206fb4c931"
          ],
          "display_name": false
        },
        {
          "uuid": "ac3bdf61-b3ba-41be-892c-be2e5714b831",
          "name": "SALOL [HPUS]",
          "stdName": "SALOL [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e43a408-5d02-4568-8443-af88f600b24b",
            "f8c0d503-c750-4be1-b39c-6ad80fc93712"
          ],
          "display_name": false
        },
        {
          "uuid": "f6fac53b-0a13-4977-bde8-1e3ae2d7829a",
          "name": "SALOL [MART.]",
          "stdName": "SALOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7433a425-e3f9-45e1-9e2a-f411ebc0193a"
          ],
          "display_name": false
        },
        {
          "uuid": "f76110eb-780a-4920-b1ef-43c9ae1ce82c",
          "name": "SALOL [VANDF]",
          "stdName": "SALOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb0bb36f-86c7-49e0-9907-1d84246145aa",
            "0a8ab055-c538-456d-8903-a8c9415cfd5c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f8c0d503-c750-4be1-b39c-6ad80fc93712",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d56ce374-2ac5-46ef-835f-03206fb4c931",
          "citation": "DL",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72af1a41-10d2-477e-85b5-38e26f72d117",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e43a408-5d02-4568-8443-af88f600b24b",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7433a425-e3f9-45e1-9e2a-f411ebc0193a",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b8957ff-321e-4abb-b15e-b8b8ada09c4e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a8ab055-c538-456d-8903-a8c9415cfd5c",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f90583b-3b97-4307-8e95-325c043d2a4c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4370863-473d-4c78-a3c8-d2a065d785a7",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcbc5f58-cc72-4eca-a9ef-c01b3850a823",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb0bb36f-86c7-49e0-9907-1d84246145aa",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b6bd1c2-61de-4853-9712-732667b358d6",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c1ac19d-90c4-4e30-be09-81e143daa866",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98f1dee3-8c76-4cc8-af05-1e02d4f62de9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390845000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e79ad266-d55f-44b7-957a-c45f49773e7d",
          "citation": "SRS import [28A37T47QO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=28A37T47QO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390845000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b758a0f-c7de-4929-9877-6ecb0948623f",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7048814a-2e9e-48b1-b311-aabdf8603a4a",
          "citation": "SALOL [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a9af5d2-ab9d-4c4b-badb-2dc88d9e4266",
          "citation": "SALOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d298d765-8b83-43f0-b036-47ebc3373f7a",
          "citation": "PHENYL SALICYLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eaf4d67f-8e10-4c8f-a7d2-90c87e5d1af0",
          "citation": "PHENYL SALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d6041f27-2d52-4f95-bb9d-b67e1539e0fc",
          "citation": "PHENYL SALICYLATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b9db33b3-a48a-44d6-bd9a-b35b8e69a7bd",
          "citation": "PHENYL SALICYLATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa57be8f-48db-425c-bcef-07aa1677ca9c",
          "citation": "PHENYL SALICYLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7981b54e-11e5-4d26-8729-7c1398d50eed",
          "citation": "SALOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9fe708a4-7291-4d86-bbbc-b4493e8b2512",
          "citation": "PHENYL SALICYLATE MELTING POINT STANDARD [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b62c1f6b-3951-0241-19db-899ed869420a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=118-55-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a6dbd6e9-f396-e25e-1022-bbe7ee6677ca",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "3a3bc643-c5a7-8e98-f306-6ebdf921ac79",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "47949e15-0978-43c2-8641-c49a26249f8c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "084c4050-c01c-f6d8-d00b-f6d455cb0b2a",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "c1a1fcf5-f051-4973-559f-40e61bd61e86",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "11060154-054c-72d4-b672-732b58b5c9e2",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        },
        {
          "uuid": "b76fc9df-82b6-e413-aced-d76f365488ee",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4a21833e-5a62-91ab-83b8-6cd65b26ba28",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "20c8b8bb-693a-4170-82d4-be1928d0d354",
          "id": "20c8b8bb-693a-4170-82d4-be1928d0d354",
          "molfile": "\n  Marvin  01132101512D          \n\n 16 17  0  0  0  0            999 V2000\n    4.2815   -0.4122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9925   -1.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9925   -2.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -2.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5628   -2.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5628   -1.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8466   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8466   -0.4122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1407   -1.6410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7059   -1.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7059    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)OC(=O)c2ccccc2O",
          "formula": "C13H10O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d3431a0e-8909-431d-a7fe-bd357de158a3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "214.2172",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f28b9564-4261-447c-850f-74b9712d4190",
      "version": "19",
      "structure": {
        "id": "0b6c3652-b074-455c-a054-250023c1ea98",
        "molfile": "\n  Marvin  01132100502D          \n\n 16 17  0  0  0  0            999 V2000\n    2.8466   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5628   -1.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1407   -1.6410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8466   -0.4122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -0.4122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5628   -2.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9925   -1.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4246   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7059   -1.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2815   -2.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9925   -2.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7059    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11  6  1  0  0  0  0\n 12  8  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 11  2  0  0  0  0\n 15 10  1  0  0  0  0\n 16 14  1  0  0  0  0\n 13  9  2  0  0  0  0\n 16 15  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)OC(=O)c2ccccc2O",
        "formula": "C13H10O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "214.2172",
        "optical_activity": "NONE",
        "references": [
          "6b758a0f-c7de-4929-9877-6ecb0948623f",
          "e79ad266-d55f-44b7-957a-c45f49773e7d"
        ],
        "stereo_centers": 0
      },
      "unii": "28A37T47QO"
    }
  ]
}