{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "141e45e0-45a5-4514-993c-2099df2c1db0",
          "code": "4680-44-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4680-44-8",
          "code_system": "CAS",
          "references": [
            "d5e20709-89a6-4ee3-a3c2-1de54d84c7fc",
            "4b4ca0e8-ac5a-4a2a-9b59-9fad5182ce03"
          ]
        },
        {
          "uuid": "9a19a982-7edc-4db7-b6c8-9525d3fa6909",
          "code": "225-131-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.846",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d5e20709-89a6-4ee3-a3c2-1de54d84c7fc"
          ]
        },
        {
          "uuid": "8e683a93-c632-4062-88f7-e8ea34bb8e44",
          "code": "23669132",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23669132",
          "code_system": "PUBCHEM",
          "references": [
            "d5e20709-89a6-4ee3-a3c2-1de54d84c7fc"
          ]
        },
        {
          "uuid": "69b03729-1f79-4d1a-b6cb-182e5cd7ff51",
          "code": "2854QZ74M5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8304268f-227d-e6a5-2632-530e31ee10b6",
          "code": "DTXSID90963670",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90963670",
          "code_system": "EPA CompTox",
          "references": [
            "3bc755b7-94c3-389c-0cd1-ddd7278029fa"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8e6604df-5c39-4dc5-89db-f75a5e707e0e",
          "name": "(±)-DIHEPTYL SODIUM SULFOSUCCINATE",
          "stdName": "(+/-)-DIHEPTYL SODIUM SULFOSUCCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "7d126f4a-f852-4a42-b08a-843dfd180fef"
          ],
          "display_name": false
        },
        {
          "uuid": "da491a4c-be9b-4875-a7e3-2d9474708df0",
          "name": "BUTANEDIOIC ACID, 2-SULFO-, 1,4-DIHEPTYL ESTER, SODIUM SALT (1:1)",
          "stdName": "BUTANEDIOIC ACID, 2-SULFO-, 1,4-DIHEPTYL ESTER, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "f81aff8c-3e0c-4373-85e8-8c8c6c32390d"
          ],
          "display_name": false
        },
        {
          "uuid": "1bc46cc3-ed9c-4cf3-9f96-48ca6a350338",
          "name": "BUTANEDIOIC ACID, SULFO-, 1,4-DIHEPTYL ESTER, SODIUM SALT",
          "stdName": "BUTANEDIOIC ACID, SULFO-, 1,4-DIHEPTYL ESTER, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "f81aff8c-3e0c-4373-85e8-8c8c6c32390d"
          ],
          "display_name": false
        },
        {
          "uuid": "bd4b9a24-0e6c-466c-9e0b-1d26b77e68f1",
          "name": "DIHEPTYL SODIUM SULFOSUCCINATE",
          "stdName": "DIHEPTYL SODIUM SULFOSUCCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f63a61e1-db53-4c02-b0ba-578d74fd1621",
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "f81aff8c-3e0c-4373-85e8-8c8c6c32390d",
            "246f07a6-4f4e-42ab-83fc-512fa943d78f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e43d4aa5-418d-4ff1-a861-2a77ef302f6c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e147c7fa-5f55-4e9a-8d68-d4cbabeecbd2",
          "name": "DIHEPTYL SODIUM SULFOSUCCINATE, (±)-",
          "stdName": "DIHEPTYL SODIUM SULFOSUCCINATE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "7d126f4a-f852-4a42-b08a-843dfd180fef"
          ],
          "display_name": false
        },
        {
          "uuid": "5783c45e-6045-4db2-a0b7-038ad315c786",
          "name": "SINNOZON MH 85",
          "stdName": "SINNOZON MH 85",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "f81aff8c-3e0c-4373-85e8-8c8c6c32390d"
          ],
          "display_name": false
        },
        {
          "uuid": "fb57b188-efe6-446a-b2ba-b914f1444bce",
          "name": "SUCCINIC ACID, SULFO-, 1,4-DIHEPTYL ESTER, SODIUM SALT",
          "stdName": "SUCCINIC ACID, SULFO-, 1,4-DIHEPTYL ESTER, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "f81aff8c-3e0c-4373-85e8-8c8c6c32390d"
          ],
          "display_name": false
        },
        {
          "uuid": "8ab3713c-5ac6-455f-b3bd-08ee72bdc2ec",
          "name": "SUCCINIC ACID, SULFO-, DIHEPTYL ESTER, S-SODIUM SALT",
          "stdName": "SUCCINIC ACID, SULFO-, DIHEPTYL ESTER, S-SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "f81aff8c-3e0c-4373-85e8-8c8c6c32390d"
          ],
          "display_name": false
        },
        {
          "uuid": "7d4c4229-73b7-458c-b79a-f4aaf2b4586d",
          "name": "SUCCINIC ACID, SULFO-, DIHEPTYL ESTER, SODIUM SALT",
          "stdName": "SUCCINIC ACID, SULFO-, DIHEPTYL ESTER, SODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73cad0cd-300b-4ef1-a78f-1748d1538235",
            "f81aff8c-3e0c-4373-85e8-8c8c6c32390d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f81aff8c-3e0c-4373-85e8-8c8c6c32390d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "73cad0cd-300b-4ef1-a78f-1748d1538235",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "246f07a6-4f4e-42ab-83fc-512fa943d78f",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d126f4a-f852-4a42-b08a-843dfd180fef",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5e20709-89a6-4ee3-a3c2-1de54d84c7fc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90cd3d0d-46ce-490c-9ecd-3493d9cfc949",
          "citation": "SRS import [2854QZ74M5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2854QZ74M5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f63a61e1-db53-4c02-b0ba-578d74fd1621",
          "citation": "DIHEPTYL SODIUM SULFOSUCCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b4ca0e8-ac5a-4a2a-9b59-9fad5182ce03",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3bc755b7-94c3-389c-0cd1-ddd7278029fa",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d0d7148f-c652-4e6e-b338-539559828dc5",
          "id": "d0d7148f-c652-4e6e-b338-539559828dc5",
          "molfile": "\n  Marvin  01132110482D          \n\n  1  0  0  0  0  0            999 V2000\n    8.8400   -8.9491    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ac87aee6-9948-4007-a414-9fd0e18a9c6c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "353b106b-797f-419d-84cc-c827481e237e",
          "id": "353b106b-797f-419d-84cc-c827481e237e",
          "molfile": "\n  Marvin  01132102502D          \n\n 26 25  0  0  0  0            999 V2000\n   14.7966   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0822   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3678   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6533   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9389   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2244   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5100   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7956   -6.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0811   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0811   -7.3927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3667   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6523   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.9378   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9378   -5.3303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2234   -6.5678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5090   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7945   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0801   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3656   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6512   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9368   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2223   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6523   -7.3927    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6523   -8.2177    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.3667   -7.8052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9378   -7.8052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 23  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 23 26  2  0  0  0  0\nM  CHG  1  24  -1\nM  END",
          "smiles": "CCCCCCCOC(=O)CC(C(=O)OCCCCCCC)S(=O)(=O)[O-]",
          "formula": "C18H33O7S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f188b706-68de-4c12-a4e3-e4831ee549bc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "393.5172",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "df202211-e0c5-42ed-a9f8-9114854a7401",
      "version": "6",
      "structure": {
        "id": "a438e674-f75c-42c9-beb7-7370ea9ed409",
        "molfile": "\n  Marvin  01132108322D          \n\n 27 25  0  0  0  0            999 V2000\n    1.2223   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9368   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6512   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3656   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0801   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7945   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5090   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2234   -6.5678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9378   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6523   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3667   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0811   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7956   -6.1552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5100   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2244   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9389   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6533   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3678   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0822   -6.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7966   -6.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0811   -7.3927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9378   -5.3303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6523   -7.3927    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3667   -7.8052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9378   -7.8052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6523   -8.2177    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.8400   -8.9491    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 12 21  2  0  0  0  0\n  9 22  2  0  0  0  0\n 10 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  2  0  0  0  0\n 23 26  1  0  0  0  0\nM  CHG  2  26  -1  27   1\nM  END",
        "smiles": "CCCCCCCOC(=O)CC(C(=O)OCCCCCCC)S(=O)(=O)[O-].[Na+]",
        "formula": "C18H33O7S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "416.507",
        "optical_activity": "( + / - )",
        "references": [
          "f81aff8c-3e0c-4373-85e8-8c8c6c32390d",
          "90cd3d0d-46ce-490c-9ecd-3493d9cfc949"
        ],
        "stereo_centers": 1
      },
      "unii": "2854QZ74M5"
    }
  ]
}