{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f50ccc8e-dea8-4d39-bb3c-0a6cc1c37c48",
          "code": "17162-39-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17162-39-9",
          "code_system": "CAS",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f",
            "3d0ec87b-f006-40a7-92f7-57280745f849"
          ]
        },
        {
          "uuid": "7ce5bafb-48e4-4a49-8304-0f4ed875a2b6",
          "code": "C66378",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66378",
          "code_system": "NCI_THESAURUS",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f"
          ]
        },
        {
          "uuid": "ac1171be-ae56-44a2-822d-dddf63504ed7",
          "code": "21 CFR 341.20",
          "comments": "PART 341 -- COLD, COUGH, ALLERGY, BRONCHODILATOR, AND ANTIASTHMATIC DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 341.20 Nasal decongestant active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=341.20",
          "code_system": "CFR",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f"
          ]
        },
        {
          "uuid": "b6c5e269-d699-4bd6-84c5-a73b46f023ff",
          "code": "241-219-3",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f"
          ]
        },
        {
          "uuid": "5c424084-2d01-4744-bc34-c6fb08e4f4dc",
          "code": "91167",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/91167/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f"
          ]
        },
        {
          "uuid": "b7aa4266-7013-4dd1-aed4-8c11238813fd",
          "code": "SUB03775MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f"
          ]
        },
        {
          "uuid": "76472ed9-d617-49ec-963d-26802b5d036a",
          "code": "CHEMBL1215",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1215",
          "code_system": "ChEMBL",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f"
          ]
        },
        {
          "uuid": "f585e263-471f-49d3-9a87-3505dec36192",
          "code": "46174134",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/46174134",
          "code_system": "PUBCHEM",
          "references": [
            "58ffe86a-4b43-4836-926f-57a4e319d64f"
          ]
        },
        {
          "uuid": "a01e0eb7-d27f-1a8f-6963-b077bbfdb055",
          "code": "C29709",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Agonist[C87053]|Alpha-Adrenergic Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29709",
          "code_system": "NCI_THESAURUS",
          "references": [
            "59208bd4-cb9b-c13f-4b81-185b49010a38"
          ]
        },
        {
          "uuid": "2531b949-5d63-49b4-84c0-0a713d3c7201",
          "code": "14787-58-7",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14787-58-7",
          "code_system": "CAS",
          "references": [
            "3d0ec87b-f006-40a7-92f7-57280745f849"
          ]
        },
        {
          "uuid": "a25d7fad-f0d2-064e-ee98-5fd48eb7d965",
          "code": "DBSALT001320",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001320",
          "code_system": "DRUG BANK",
          "references": [
            "59208bd4-cb9b-c13f-4b81-185b49010a38"
          ]
        },
        {
          "uuid": "521baf54-5810-44da-9704-033d3b466334",
          "code": "27O3Q5ML57",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c9cbcea6-cd94-1ea7-ab3a-85eef4f1bd21",
          "code": "1532950",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1532950",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "59208bd4-cb9b-c13f-4b81-185b49010a38"
          ]
        },
        {
          "uuid": "12bf7bef-a8bb-ca07-beae-117277718c53",
          "code": "27O3Q5ML57",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=27O3Q5ML57",
          "code_system": "DAILYMED",
          "references": [
            "8672e9dc-92db-6b3b-dab6-6ccc4277e0fe"
          ]
        },
        {
          "uuid": "9b4dd140-f76e-30e5-dfeb-76dfeafd6437",
          "code": "100000085297",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "09ffd2ce-e1c4-5a5f-937c-e07379cf5c8d"
          ]
        },
        {
          "uuid": "96769074-484c-aa7b-cb77-b40bc0b34bfc",
          "code": "DTXSID901026092",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901026092",
          "code_system": "EPA CompTox",
          "references": [
            "679c6b15-7d6e-02fc-7cfe-af50ba5f24b5"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "96cfbe7a-2469-4f40-adb4-d51370a80d2a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9a13b1df-4bce-48f5-9c19-a84e2548268b",
            "refuuid": "b8d03da0-6192-44ca-b296-34f941dd0df9",
            "name": "PHENYLEPHRINE",
            "unii": "1WS297W6MV",
            "linking_id": "1WS297W6MV",
            "ref_pname": "PHENYLEPHRINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bfada540-6b08-45ff-9644-f6f1d8987adc",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "fe8cdb59-423f-40f4-94cc-b52fe05b25f6",
            "refuuid": "b8d03da0-6192-44ca-b296-34f941dd0df9",
            "name": "PHENYLEPHRINE",
            "unii": "1WS297W6MV",
            "linking_id": "1WS297W6MV",
            "ref_pname": "PHENYLEPHRINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "76f96f3f-628a-4360-97a3-5361cdea7e47",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "02171b46-a4bf-4a5e-a802-bb9e2156b970",
            "refuuid": "9e65d0a0-88fc-46ac-bd17-7204cdea03e9",
            "name": "Tartaric Acid",
            "unii": "W4888I119H",
            "linking_id": "W4888I119H",
            "ref_pname": "Tartaric Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "510b6e6f-37c2-4f21-864d-da21be32716c",
          "amount": {
            "uuid": "da944398-4150-4e90-9131-9763234c0861",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "f37e70e6-e04b-4fb7-81dc-6a0983392648"
          ],
          "related_substance": {
            "uuid": "ec2c3e10-d35d-476d-94dc-c3c1979f4bd8",
            "refuuid": "133644f1-0bca-44a6-ae06-7af7122d5d07",
            "name": "PHENYLEPHRONE",
            "unii": "Y4FM912JTR",
            "linking_id": "Y4FM912JTR",
            "ref_pname": "PHENYLEPHRONE"
          }
        },
        {
          "uuid": "56823355-69b5-4aa8-b333-13d2e624428d",
          "amount": {
            "uuid": "a61b10f4-01f1-4074-be50-f54dd9a473ee",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "c64f6d72-af11-4d73-bfea-b53acc60bef9"
          ],
          "related_substance": {
            "uuid": "a94abb01-f73b-4bc9-b47d-57edcf3efd4c",
            "refuuid": "e8508b09-dbcc-400d-9fce-c4393af5ed7d",
            "name": "BENZYLPHENYLEPHRINE",
            "unii": "O2JO4751KY",
            "linking_id": "O2JO4751KY",
            "ref_pname": "BENZYLPHENYLEPHRINE"
          }
        },
        {
          "uuid": "d438fdf7-625a-4f30-8acc-1e5ec3aca01d",
          "amount": {
            "uuid": "a77c5b9a-e16f-421c-9cf8-6efd25060cc1",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "e51f10c5-052b-455f-8566-c980109c7475"
          ],
          "related_substance": {
            "uuid": "0124f8b2-deb1-4be0-9674-07983e3827d7",
            "refuuid": "1cb80bab-8d4d-4b34-9312-e9824e0c02d3",
            "name": "NORFENEFRINE",
            "unii": "D2P3M6SRN5",
            "linking_id": "D2P3M6SRN5",
            "ref_pname": "NORFENEFRINE"
          }
        },
        {
          "uuid": "16984f16-94ef-4aec-a04c-51877437caa0",
          "amount": {
            "uuid": "6a01c249-8c55-4efe-9bdb-576596e7628b",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "c07c91e0-e114-47d0-8d8e-469e4e82066f"
          ],
          "related_substance": {
            "uuid": "6bbdf65a-ec02-4e07-9a34-9a0c78d9a67f",
            "refuuid": "a4536d27-b073-4f0b-9ae4-8844e8685c4e",
            "name": "BENZYLPHENYLEPHRONE",
            "unii": "OON2Y3767M",
            "linking_id": "OON2Y3767M",
            "ref_pname": "BENZYLPHENYLEPHRONE"
          }
        },
        {
          "uuid": "cedb8c9c-2b59-467b-a406-9c41bbc84469",
          "amount": {
            "uuid": "b31b4d1a-e39d-4c51-8a88-14d8a49e4e45"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "009357ef-7ed5-4e23-96d4-7580e57815c2"
          ],
          "related_substance": {
            "uuid": "8af28e24-5ef0-4f04-922c-3e8359b2c80f",
            "refuuid": "6a04680b-1ec9-4522-a9aa-07ebcf6671e4",
            "name": "N-nitroso-phenylephrine",
            "unii": "EK75W3XJ2R",
            "linking_id": "EK75W3XJ2R",
            "ref_pname": "N-nitroso-phenylephrine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b58367c3-44f9-4994-a21b-73ef176e11a3",
          "name": "(-)-1-(3-HYDROXYPHENYL)-2-METHYLAMINOETHANOL, HYDROGEN TARTRATE",
          "stdName": "(-)-1-(3-HYDROXYPHENYL)-2-METHYLAMINOETHANOL, HYDROGEN TARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20a00f71-6696-4417-bd5b-441cac0fdf72"
          ],
          "display_name": false
        },
        {
          "uuid": "5967e97d-b038-4a06-9d8d-a5e88490f1cf",
          "name": "(-)-3 HYDROXY-.ALPHA.-((METHYLAMINO)METHYL)BENZENEMETHANOL, HYDROGEN TARTRATE",
          "stdName": "(-)-3 HYDROXY-.ALPHA.-((METHYLAMINO)METHYL)BENZENEMETHANOL, HYDROGEN TARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20a00f71-6696-4417-bd5b-441cac0fdf72"
          ],
          "display_name": false
        },
        {
          "uuid": "7085e444-748c-4a39-998d-121b74ef68ae",
          "name": "1-M-HYDROXY-.ALPHA.-((METHYLAMINO)METHYL)BENZYL ALCOHOL, HYDROGEN TARTRATE",
          "stdName": "1-M-HYDROXY-.ALPHA.-((METHYLAMINO)METHYL)BENZYL ALCOHOL, HYDROGEN TARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20a00f71-6696-4417-bd5b-441cac0fdf72"
          ],
          "display_name": false
        },
        {
          "uuid": "0a2e351a-c5f9-473d-9f54-e430590d73f0",
          "name": "DUO-MEDIHALER COMPONENT PHENYLEPHRINE BITARTRATE",
          "stdName": "DUO-MEDIHALER COMPONENT PHENYLEPHRINE BITARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3319abca-4463-48d6-8cb1-75db1e1e8f34",
            "aba6a390-1bb0-48ae-8a71-820deb9e5b6b"
          ],
          "display_name": false
        },
        {
          "uuid": "6aa8dc0b-5cf9-48aa-b5e7-ee7fb19ea8dd",
          "name": "PHENYLEPHRINE ACID TARTRATE [MART.]",
          "stdName": "PHENYLEPHRINE ACID TARTRATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c486d3d-3d80-4d36-b42a-a8de5df7adf4"
          ],
          "display_name": false
        },
        {
          "uuid": "ed1e9610-4527-46ac-9d53-b17e386b081a",
          "name": "PHENYLEPHRINE BITARTRATE",
          "stdName": "PHENYLEPHRINE BITARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa722ed9-ba07-49dc-b2c5-08a234b605a3",
            "d5093e80-6d7e-49aa-bca6-5323e196764b",
            "55a42a54-f62e-45c9-b38a-215d8b6b1653",
            "20a00f71-6696-4417-bd5b-441cac0fdf72",
            "9214109d-6034-442c-a03d-2f598f933cf0",
            "e56b1077-b0b3-44e7-b9a2-e71d0e675f5b",
            "84ddba67-0e3f-4279-a5f6-95eefbdd2e40",
            "bf6f193c-eca1-48a5-aadb-b831817ef0d6",
            "dfface29-1b26-4b1f-b3ad-726a577ef2ca",
            "237493f2-8d00-4980-8b1a-81565f533a8a",
            "b1ceace7-8c2e-42ae-9aa7-2bd354f0efee"
          ],
          "display_name": true
        },
        {
          "uuid": "d6630007-6a97-4b5a-8a05-115dabbdd689",
          "name": "PHENYLEPHRINE BITARTRATE [ORANGE BOOK]",
          "stdName": "PHENYLEPHRINE BITARTRATE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf6f193c-eca1-48a5-aadb-b831817ef0d6"
          ],
          "display_name": false
        },
        {
          "uuid": "5e68d9fd-d9c7-18f9-74c5-99051fa7a327",
          "name": "PHENYLEPHRINE BITARTRATE [USP MONOGRAPH]",
          "stdName": "PHENYLEPHRINE BITARTRATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28a60b18-b669-8711-1599-29a2a5f003d2"
          ],
          "display_name": false
        },
        {
          "uuid": "f30ce1fb-4455-4b6a-9f4c-6241acfbd8cc",
          "name": "PHENYLEPHRINE BITARTRATE [USP-RS]",
          "stdName": "PHENYLEPHRINE BITARTRATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55a42a54-f62e-45c9-b38a-215d8b6b1653"
          ],
          "display_name": false
        },
        {
          "uuid": "2c024107-c865-4896-a7a8-1a4dcda9cf35",
          "name": "PHENYLEPHRINE BITARTRATE [VANDF]",
          "stdName": "PHENYLEPHRINE BITARTRATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1ceace7-8c2e-42ae-9aa7-2bd354f0efee"
          ],
          "display_name": false
        },
        {
          "uuid": "d2fde817-8bcd-d11b-6fbc-0366d6d88b4f",
          "name": "PHENYLEPHRINE HYDROGEN TARTRATE",
          "stdName": "PHENYLEPHRINE HYDROGEN TARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9214109d-6034-442c-a03d-2f598f933cf0"
          ],
          "display_name": false
        },
        {
          "uuid": "080ef49f-79ec-1470-ae46-6f325237781f",
          "name": "Phenylephrine bitartrate [WHO-DD]",
          "stdName": "PHENYLEPHRINE BITARTRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46adeb91-305e-1b3d-20f8-fde8cfd8f55c"
          ],
          "display_name": false
        },
        {
          "uuid": "28fbf22a-8796-4d7d-ad5e-ddbc8f2e04f2",
          "name": "R-2-(METHYLAMINO)-1-(3-HYDROXYPHENYL)ETHANOL, HYDROGEN TARTRATE",
          "stdName": "R-2-(METHYLAMINO)-1-(3-HYDROXYPHENYL)ETHANOL, HYDROGEN TARTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20a00f71-6696-4417-bd5b-441cac0fdf72"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1c486d3d-3d80-4d36-b42a-a8de5df7adf4",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55a42a54-f62e-45c9-b38a-215d8b6b1653",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfface29-1b26-4b1f-b3ad-726a577ef2ca",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1ceace7-8c2e-42ae-9aa7-2bd354f0efee",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58ffe86a-4b43-4836-926f-57a4e319d64f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "880a43ba-fe83-4706-895e-0c1b37c9629f",
          "citation": "SRS import [27O3Q5ML57]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=27O3Q5ML57",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391913000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84ddba67-0e3f-4279-a5f6-95eefbdd2e40",
          "citation": "PHENYLEPHRINE BITARTRATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fa722ed9-ba07-49dc-b2c5-08a234b605a3",
          "citation": "PHENYLEPHRINE BITARTRATE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "237493f2-8d00-4980-8b1a-81565f533a8a",
          "citation": "PHENYLEPHRINE BITARTRATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d5093e80-6d7e-49aa-bca6-5323e196764b",
          "citation": "PHENYLEPHRINE BITARTRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e56b1077-b0b3-44e7-b9a2-e71d0e675f5b",
          "citation": "PHENYLEPHRINE BITARTRATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "20a00f71-6696-4417-bd5b-441cac0fdf72",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9214109d-6034-442c-a03d-2f598f933cf0",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aba6a390-1bb0-48ae-8a71-820deb9e5b6b",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3319abca-4463-48d6-8cb1-75db1e1e8f34",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf6f193c-eca1-48a5-aadb-b831817ef0d6",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09ffd2ce-e1c4-5a5f-937c-e07379cf5c8d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c07c91e0-e114-47d0-8d8e-469e4e82066f",
          "citation": "USP",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "59208bd4-cb9b-c13f-4b81-185b49010a38",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3d0ec87b-f006-40a7-92f7-57280745f849",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "371798e4-1127-479a-af68-ae1b748d09d4",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "28a60b18-b669-8711-1599-29a2a5f003d2",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "c64f6d72-af11-4d73-bfea-b53acc60bef9",
          "citation": "USP",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e51f10c5-052b-455f-8566-c980109c7475",
          "citation": "USP",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f37e70e6-e04b-4fb7-81dc-6a0983392648",
          "citation": "USP",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8672e9dc-92db-6b3b-dab6-6ccc4277e0fe",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "46adeb91-305e-1b3d-20f8-fde8cfd8f55c",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "679c6b15-7d6e-02fc-7cfe-af50ba5f24b5",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "910a7fae-0d0d-4428-b104-c87d5be505b2",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "009357ef-7ed5-4e23-96d4-7580e57815c2",
          "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1",
          "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "36052e6d-0111-4d2a-aaab-49afe7ab5064",
          "id": "36052e6d-0111-4d2a-aaab-49afe7ab5064",
          "molfile": "\n  Marvin  01132102532D          \n\n 10  9  0  0  1  0            999 V2000\n    9.4204  -13.2121    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.4204  -12.3870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7061  -13.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7061  -14.4548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9917  -13.2121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1348  -13.6245    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.1348  -14.4496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8442  -13.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8442  -12.3820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5586  -13.6145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  6  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "[C@@H]([C@H](C(=O)O)O)(C(=O)O)O",
          "formula": "C4H6O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8e940ee3-4aa6-4b8a-8d79-420db7edf893"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "150.087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        },
        {
          "uuid": "e295980c-4874-4de0-aadd-a3e598f84165",
          "id": "e295980c-4874-4de0-aadd-a3e598f84165",
          "molfile": "\n  Marvin  01132111442D          \n\n 12 12  0  0  1  0            999 V2000\n    5.8554   -8.9465    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.8554   -8.1756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5624   -9.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1930   -8.8998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9896   -9.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1781   -9.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4880   -8.8827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7425   -9.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7425  -10.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4368  -10.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4368  -11.3577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1781  -10.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  6  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n 12  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
          "smiles": "CNC[C@@H](c1cccc(c1)O)O",
          "formula": "C9H13NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "14befb37-b5b2-4ac0-a8a1-28ebcc7ed827"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "167.2054",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "31b17913-31c3-4fcd-8a68-cfe228427833",
      "version": "26",
      "structure": {
        "id": "9765977b-0b6d-44b2-a4c4-f8910556903f",
        "molfile": "\n  Marvin  01132107522D          \n\n 22 21  0  0  1  0            999 V2000\n    8.2229  -11.5326    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.8465  -11.8926    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.4657  -11.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4657  -10.8080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0893  -11.8838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8465  -12.6128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5994  -11.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5994  -12.6173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9758  -11.5326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2229  -10.8124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3379   -9.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3379  -10.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5738  -10.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5738  -11.7083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8580  -10.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8580   -9.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6265   -9.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0361   -9.2227    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0361   -8.4280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7650   -9.6092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4150   -9.1745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2362   -9.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  2  6  1  6  0  0  0\n  7  1  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n  1 10  1  6  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18 11  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
        "smiles": "CNC[C@@H](c1cccc(c1)O)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O",
        "formula": "C9H13NO2.C4H6O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "317.2924",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "20a00f71-6696-4417-bd5b-441cac0fdf72",
          "880a43ba-fe83-4706-895e-0c1b37c9629f"
        ],
        "stereo_centers": 3
      },
      "unii": "27O3Q5ML57"
    }
  ]
}