{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "432b3dc4-039d-48f7-90a5-1de2d2eed9c1",
          "code": "178928-70-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=178928-70-6",
          "code_system": "CAS",
          "references": [
            "18cc3116-9bec-4430-8bbb-c9b37c6bca6e",
            "c580d5e2-4a0a-4618-bafa-67fd6b81a4bb"
          ]
        },
        {
          "uuid": "ade586c4-636e-46aa-bee7-d6d1ef095ba3",
          "code": "C97996",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97996",
          "code_system": "NCI_THESAURUS",
          "references": [
            "18cc3116-9bec-4430-8bbb-c9b37c6bca6e"
          ]
        },
        {
          "uuid": "bef9f779-04c0-4e1b-a53a-27a8520bf47a",
          "code": "C550005",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67550005",
          "code_system": "MESH",
          "references": [
            "18cc3116-9bec-4430-8bbb-c9b37c6bca6e"
          ]
        },
        {
          "uuid": "305fa8a2-2842-48e0-b1c3-c0367fb78681",
          "code": "m9267",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9267?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "18cc3116-9bec-4430-8bbb-c9b37c6bca6e"
          ]
        },
        {
          "uuid": "7951308a-a968-411a-97d0-bf4de189e99e",
          "code": "6451142",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6451142",
          "code_system": "PUBCHEM",
          "references": [
            "18cc3116-9bec-4430-8bbb-c9b37c6bca6e"
          ]
        },
        {
          "uuid": "88446f39-abcf-c8c6-b55f-88d0bc94320e",
          "code": "7893",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7893",
          "code_system": "HSDB",
          "references": [
            "0ab4d11e-226e-f474-bcc9-c41b3c81b7cd"
          ]
        },
        {
          "uuid": "7f56fe83-7a19-76e8-525e-4043360a9be0",
          "code": "DTXSID4034869",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4034869",
          "code_system": "EPA CompTox",
          "references": [
            "5e96662b-4d58-946c-529f-1c7046cfe658"
          ]
        },
        {
          "uuid": "0aeecc6c-29fc-3392-7434-a324ff252b36",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "873f25f8-56a1-faf5-7434-0f28d7745884"
          ]
        },
        {
          "uuid": "1510ec97-d488-4f8e-b937-204b02d96733",
          "code": "27B9FV58IY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1d770296-54d6-92de-ace1-32bd33020f9b",
          "code": "Prothioconazole",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Prothioconazole",
          "code_system": "WIKIPEDIA",
          "references": [
            "7a35c010-ee76-b1bd-8672-7f3e70d6bb44"
          ]
        },
        {
          "uuid": "44ea4ada-4ace-686a-cb2b-8de3e95ba68b",
          "code": "prothioconazole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/prothioconazole.html",
          "code_system": "ALANWOOD",
          "references": [
            "ffcffff0-b8a0-d77b-d040-3bcd59e99dc0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "30be7420-a7b0-4ac4-b893-cd62f27f44f2",
          "name": "(RS)-2-(2-(1-CHLOROCYCLOPROPYL)-3-(2-CHLOROPHENYL)-2-HYDROXYPROPYL)-2,4-DIHYDRO-1,2,4-TRIAZOLE-3-THIONE",
          "stdName": "(RS)-2-(2-(1-CHLOROCYCLOPROPYL)-3-(2-CHLOROPHENYL)-2-HYDROXYPROPYL)-2,4-DIHYDRO-1,2,4-TRIAZOLE-3-THIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f23b4ee9-f040-4aa2-93de-7032aae9dfc1",
            "7527e5c4-83dd-4f46-8e8c-1cec2f86ab99"
          ],
          "display_name": false
        },
        {
          "uuid": "29a1307a-55a8-4a54-8c61-f32463a7e001",
          "name": "2-(2-(1-CHLOROCYCLOPROPYL)-3-(2-CHLOROPHENYL)-2-HYDROXYPROPYL)-1,2-DIHYDRO-3H-1,2,4-TRIAZOLE-3-THIONE",
          "stdName": "2-(2-(1-CHLOROCYCLOPROPYL)-3-(2-CHLOROPHENYL)-2-HYDROXYPROPYL)-1,2-DIHYDRO-3H-1,2,4-TRIAZOLE-3-THIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ef307f2-3260-45ac-880e-99d84747627e",
            "0d8a9be0-d64b-4174-bf1a-c03fb370f661"
          ],
          "display_name": false
        },
        {
          "uuid": "30d91789-ca60-4de1-b074-727870e8f7cf",
          "name": "3H-1,2,4-TRIAZOLE-3-THIONE, 2-(2-(1-CHLOROCYCLOPROPYL)-3-(2-CHLOROPHENYL)-2-HYDROXYPROPYL)-1,2-DIHYDRO-",
          "stdName": "3H-1,2,4-TRIAZOLE-3-THIONE, 2-(2-(1-CHLOROCYCLOPROPYL)-3-(2-CHLOROPHENYL)-2-HYDROXYPROPYL)-1,2-DIHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ef307f2-3260-45ac-880e-99d84747627e",
            "7a1821f3-69bf-4fbe-8756-a54629a404aa"
          ],
          "display_name": false
        },
        {
          "uuid": "23b73886-fac5-4642-9b21-d9698adc69bc",
          "name": "JAU 6476",
          "stdName": "JAU 6476",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ef307f2-3260-45ac-880e-99d84747627e",
            "7a1821f3-69bf-4fbe-8756-a54629a404aa"
          ],
          "display_name": false
        },
        {
          "uuid": "18028aaa-525f-4127-b67e-36027fbf3efe",
          "name": "JAU-6476",
          "stdName": "JAU-6476",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0c8bc9f-d511-46f2-bb88-607925c2a1af",
            "5ef307f2-3260-45ac-880e-99d84747627e"
          ],
          "display_name": false
        },
        {
          "uuid": "68d617e1-5470-427b-954f-61d37d8c8ab1",
          "name": "PROTHIOCONAZOLE",
          "stdName": "PROTHIOCONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "500a363d-a26c-4635-a0f3-5d27a449cbe3",
            "5ef307f2-3260-45ac-880e-99d84747627e",
            "b7c61667-baad-49c1-b69f-de742a578643",
            "60e8e0d3-6698-49c9-94b3-59b3a84b9005",
            "7a1821f3-69bf-4fbe-8756-a54629a404aa",
            "250eaf5f-d1f4-4994-baee-940d38934453"
          ],
          "display_name": true
        },
        {
          "uuid": "000d72b4-2237-41ed-99ca-72f3081a79ab",
          "name": "PROTHIOCONAZOLE [ISO]",
          "stdName": "PROTHIOCONAZOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "500a363d-a26c-4635-a0f3-5d27a449cbe3",
            "5ef307f2-3260-45ac-880e-99d84747627e"
          ],
          "display_name": false
        },
        {
          "uuid": "4ec85e25-0ec9-42a4-8034-9e2b287e0a86",
          "name": "PROTHIOCONAZOLE [MI]",
          "stdName": "PROTHIOCONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7c61667-baad-49c1-b69f-de742a578643",
            "5ef307f2-3260-45ac-880e-99d84747627e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7527e5c4-83dd-4f46-8e8c-1cec2f86ab99",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f23b4ee9-f040-4aa2-93de-7032aae9dfc1",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a1821f3-69bf-4fbe-8756-a54629a404aa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ef307f2-3260-45ac-880e-99d84747627e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d8a9be0-d64b-4174-bf1a-c03fb370f661",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB9500604.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB9500604.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0c8bc9f-d511-46f2-bb88-607925c2a1af",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7c61667-baad-49c1-b69f-de742a578643",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "500a363d-a26c-4635-a0f3-5d27a449cbe3",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18cc3116-9bec-4430-8bbb-c9b37c6bca6e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390982000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14e1f047-cbb7-4bbb-9159-a75073721c81",
          "citation": "SRS import [27B9FV58IY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=27B9FV58IY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390982000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e87d48c-83a3-40b3-a0e2-6dffc8e6a6dc",
          "citation": "http://www.fao.org/fileadmin/templates/agphome/documents/",
          "url": "http://www.fao.org/fileadmin/templates/agphome/documents/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60e8e0d3-6698-49c9-94b3-59b3a84b9005",
          "citation": "PROTHIOCONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "250eaf5f-d1f4-4994-baee-940d38934453",
          "citation": "PROTHIOCONAZOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0ab4d11e-226e-f474-bcc9-c41b3c81b7cd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+178928-70-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5e96662b-4d58-946c-529f-1c7046cfe658",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=178928-70-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "873f25f8-56a1-faf5-7434-0f28d7745884",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7a35c010-ee76-b1bd-8672-7f3e70d6bb44",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "ffcffff0-b8a0-d77b-d040-3bcd59e99dc0",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c580d5e2-4a0a-4618-bafa-67fd6b81a4bb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "32201a2e-423f-4be3-b30a-c612943e6efe",
          "id": "32201a2e-423f-4be3-b30a-c612943e6efe",
          "molfile": "\n  Marvin  01132102412D          \n\n 21 23  0  0  0  0            999 V2000\n    4.4984   -2.2821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4984   -3.1071    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.2161   -2.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9294   -3.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9294   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6425   -4.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3602   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3602   -3.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6425   -2.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6425   -1.8674    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7853   -2.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0674   -3.1071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9882   -3.9321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1632   -4.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7483   -3.3821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2985   -2.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1353   -1.9513    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4984   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7853   -4.3424    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.9132   -4.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3234   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 11  2  1  0  0  0  0\n  2 18  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)CC(Cn2c(=S)[nH]cn2)(C3(CC3)Cl)O)Cl",
          "formula": "C14H15Cl2N3OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c75bfc83-26c1-4e27-92bc-941b19ca2bd8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "344.2609",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f16dbc05-b40b-451f-a7fa-f381303750fd",
      "version": "7",
      "structure": {
        "id": "3523e660-7917-4ad4-9397-091e59bf5406",
        "molfile": "\n  Marvin  01132102502D          \n\n 21 23  0  0  0  0            999 V2000\n    3.7853   -4.3424    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4984   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4984   -3.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4984   -2.2821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2161   -2.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9294   -3.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9294   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6425   -4.3424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3602   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3602   -3.1071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6425   -2.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6425   -1.8674    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7853   -2.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0674   -3.1071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2985   -2.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1353   -1.9513    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7483   -3.3821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1632   -4.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9882   -3.9321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9132   -4.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3234   -3.9321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n  6 11  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 19 14  1  0  0  0  0\n  2 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n  2 21  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)CC(Cn2c(=S)[nH]cn2)(C3(CC3)Cl)O)Cl",
        "formula": "C14H15Cl2N3OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "344.2609",
        "optical_activity": "( + / - )",
        "references": [
          "14e1f047-cbb7-4bbb-9159-a75073721c81",
          "4e87d48c-83a3-40b3-a0e2-6dffc8e6a6dc"
        ],
        "stereo_centers": 1
      },
      "unii": "27B9FV58IY"
    }
  ]
}