{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5679d66d-089b-4d09-ab17-cc5d100697c4", "code": "960531-53-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=960531-53-7", "code_system": "CAS", "references": [ "51d1f632-1e30-4cf6-87dd-fc8ddab8eb54", "e8542bbd-8930-46ca-a3de-fd4052540c3c" ] }, { "uuid": "3394f272-019a-41a9-a6e5-a4d49203a63c", "code": "1664430", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1664430/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "51d1f632-1e30-4cf6-87dd-fc8ddab8eb54" ] }, { "uuid": "31bd59a9-57af-4fa8-a558-92a707370f1c", "code": "90479646", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90479646", "code_system": "PUBCHEM", "references": [ "51d1f632-1e30-4cf6-87dd-fc8ddab8eb54" ] }, { "uuid": "c1601c26-93b3-4646-a8e0-2b0b11d26678", "code": "2732R0E76W", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c824d7d6-bba6-b04e-8dd3-3af42281237d", "code": "2732R0E76W", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2732R0E76W", "code_system": "DAILYMED", "references": [ "04f1d280-4393-1351-e7ff-f921ecd02760" ] }, { "uuid": "503effbe-6492-6d26-e507-e52b26ad6da2", "code": "300000053817", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "2c0f57b8-d913-3881-0bc5-5966bd11be3a" ] } ], "relationships": [ { "uuid": "f2a9fd7e-fd7e-444e-90bf-9949b8136c57", "type": "SUBSTANCE->SUB_ALTERNATE", "related_substance": { "uuid": "a4508b34-ff6f-44ae-8c63-b6daa510dd4e", "refuuid": "e21a69a2-5c3c-4b40-ae6b-136408f77029", "name": "ALTERNATIVE DEFINITION for [TRIPEPTIDE-10 CITRULLINE]", "linking_id": "e21a69a2-5c3c-4b40-ae6b-136408f77029", "ref_pname": "NO NAME" } } ], "substance_class": "chemical", "names": [ { "uuid": "7b104ad7-4468-4662-b99e-b44e85201e47", "name": "DECORINYL", "stdName": "DECORINYL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "cbef9e70-e071-4871-9847-1f7a21b88fd1", "ec7e72e0-48ac-4d05-96d9-8bb613f8c125" ], "display_name": false }, { "uuid": "b4aa7955-ba47-4b1a-a268-8344c6b7f379", "name": "L-ORNITHINAMIDE, L-LYSYL-L-.ALPHA.-ASPARTYL-L-ISOLEUCYL-N5-(AMINOCARBONYL)-", "stdName": "L-ORNITHINAMIDE, L-LYSYL-L-.ALPHA.-ASPARTYL-L-ISOLEUCYL-N5-(AMINOCARBONYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "65e40c02-9554-4764-b24e-8978ea83099b", "cbef9e70-e071-4871-9847-1f7a21b88fd1" ], "display_name": false }, { "uuid": "1bc66ed6-87de-49ed-a45e-188739f24ac9", "name": "TRIPEPTIDE-10 CITRULLINE", "stdName": "TRIPEPTIDE-10 CITRULLINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "cbef9e70-e071-4871-9847-1f7a21b88fd1", "ec7e72e0-48ac-4d05-96d9-8bb613f8c125", "9a50825f-5ec2-4e7b-93a1-bfa5d3c69038" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f53caf37-68c1-4cc7-b0b0-91c9c28b9c1c", "name_org": "INCI" } ] } ], "references": [ { "uuid": "65e40c02-9554-4764-b24e-8978ea83099b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "cbef9e70-e071-4871-9847-1f7a21b88fd1", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ec7e72e0-48ac-4d05-96d9-8bb613f8c125", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "51d1f632-1e30-4cf6-87dd-fc8ddab8eb54", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392367000, "tags": [ "NOMEN" ] }, { "uuid": "c1914c7f-ce83-422e-818f-d7f116b28323", "citation": "SRS import [2732R0E76W]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2732R0E76W", "doc_type": "SRS", "public_domain": true, "document_date": 1493392367000, "tags": [ "NOMEN" ] }, { "uuid": "9a50825f-5ec2-4e7b-93a1-bfa5d3c69038", "citation": "TRIPEPTIDE-10 CITRULLINE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e8542bbd-8930-46ca-a3de-fd4052540c3c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "04f1d280-4393-1351-e7ff-f921ecd02760", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "2c0f57b8-d913-3881-0bc5-5966bd11be3a", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c49cfbb8-7f55-4acb-83fe-917f8e43ee3e", "id": "c49cfbb8-7f55-4acb-83fe-917f8e43ee3e", "molfile": "\n Marvin 01132110102D \n\n 37 36 0 0 1 0 999 V2000\n 6.0449 -3.8253 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.0449 -3.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3303 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6158 -3.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7594 -4.2378 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.7594 -5.0629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -5.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1883 -5.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -6.3004 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.7594 -6.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0449 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3303 -6.7129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0449 -5.4753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1883 -6.7129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -5.4753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6173 -6.7129 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.6173 -7.5380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3318 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0463 -6.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7609 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4752 -6.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1898 -6.3004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -3.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -3.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1883 -4.2378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -3.8253 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.6173 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3318 -3.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0463 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7609 -3.8253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4752 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1898 -3.8253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4752 -5.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -3.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6173 -2.5878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1883 -2.5878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 5 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 24 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 14 1 1 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 6 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\n 27 26 1 6 0 0 0\n 27 28 1 0 0 0 0\n 27 35 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 2 0 0 0 0\nM END", "smiles": "CC[C@H](C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)N", "formula": "C22H42N8O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e28b5928-31ec-4fae-a570-c9a4eecaf7c2" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "530.6192", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "9185c01b-9f58-4744-b1b1-9d230949d8d1", "version": "10", "structure": { "id": "0aa87d70-53b0-4d5f-b262-66a344ec42c7", "molfile": "\n Marvin 01132100482D \n\n 37 36 0 0 1 0 999 V2000\n 6.7594 -4.2378 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.7594 -5.0629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -5.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1883 -5.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -6.3004 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.1883 -6.7129 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6173 -6.7129 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.3318 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0463 -6.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7609 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4752 -6.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1898 -6.3004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6173 -7.5380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -5.4753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7594 -6.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0449 -6.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3303 -6.7129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0449 -5.4753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -3.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1883 -4.2378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -3.8253 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.6173 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3318 -3.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0463 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7609 -3.8253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4752 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1898 -3.8253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4752 -5.0629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9029 -3.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6173 -2.5878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1883 -2.5878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4739 -3.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0449 -3.8253 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.3303 -4.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6158 -3.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0449 -3.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 1 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 8 14 1 6 0 0 0\n 7 15 2 0 0 0 0\n 5 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 1 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 22 30 1 6 0 0 0\n 30 31 1 0 0 0 0\n 30 32 2 0 0 0 0\n 20 33 2 0 0 0 0\n 1 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 34 37 1 6 0 0 0\nM END", "smiles": "CC[C@H](C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)N", "formula": "C22H42N8O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "530.6192", "optical_activity": "UNSPECIFIED", "references": [ "65e40c02-9554-4764-b24e-8978ea83099b", "c1914c7f-ce83-422e-818f-d7f116b28323" ], "stereo_centers": 5 }, "unii": "2732R0E76W" } ] }