{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1e247ab1-9930-46c2-8052-051fb6dc1dfa",
          "code": "88-58-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=88-58-4",
          "code_system": "CAS",
          "references": [
            "6b244b65-b989-430c-bb9d-ed3d097e058e",
            "15f2d0e2-9ed4-48ba-a7e8-d1613ad8e6b8"
          ]
        },
        {
          "uuid": "e10aa2b5-1441-4ef8-ba92-34fae2460960",
          "code": "21 CFR 176.170",
          "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=176.170",
          "code_system": "CFR",
          "references": [
            "6b244b65-b989-430c-bb9d-ed3d097e058e"
          ]
        },
        {
          "uuid": "91fc0f00-e25a-4d99-a070-36f264a8a1b4",
          "code": "201-841-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.674",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6b244b65-b989-430c-bb9d-ed3d097e058e"
          ]
        },
        {
          "uuid": "884fb844-11f8-4885-b7fc-79cae61d6177",
          "code": "2374",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2374",
          "code_system": "PUBCHEM",
          "references": [
            "6b244b65-b989-430c-bb9d-ed3d097e058e"
          ]
        },
        {
          "uuid": "eea26c17-a5f1-35e9-2265-6881f5313102",
          "code": "DTXSID8041248",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8041248",
          "code_system": "EPA CompTox",
          "references": [
            "2e779b3f-d995-4a8d-3f20-2ddb4c719916"
          ]
        },
        {
          "uuid": "42c52027-4c1b-296f-ceb8-c162c8022ca9",
          "code": "DB04638",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04638",
          "code_system": "DRUG BANK",
          "references": [
            "aa55e942-9ef8-03c0-f554-76805376c432"
          ]
        },
        {
          "uuid": "bfb4b064-4a18-4694-8f17-8bddcf7fd1a9",
          "code": "26XK13B61B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "13a8854d-b5a8-beb9-f5d7-a20724b26063",
          "code": "41094",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:41094",
          "code_system": "CHEBI",
          "references": [
            "aa55e942-9ef8-03c0-f554-76805376c432"
          ]
        },
        {
          "uuid": "37179677-c82a-0452-99a8-5db791e3f5ac",
          "code": "11",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=11",
          "code_system": "NSC",
          "references": [
            "fe641b61-367a-8d89-6f30-50f748a33989"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "51a4e9a3-c6d7-49a8-a187-61e5569889a4",
          "name": "1,4-BENZENEDIOL, 2,5-BIS(1,1-DIMETHYLETHYL)-",
          "stdName": "1,4-BENZENEDIOL, 2,5-BIS(1,1-DIMETHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "420622ee-1e97-4039-829a-4549e8d1975b",
          "name": "1,4-DIHYDROXY-2,5-DI-TERT-BUTYLBENZENE",
          "stdName": "1,4-DIHYDROXY-2,5-DI-TERT-BUTYLBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "ca461d37-df62-4fdb-8b28-55b22cd961b7",
          "name": "2,5-DI-TERT-BUTYL HYDROQUINONE",
          "stdName": "2,5-DI-TERT-BUTYL HYDROQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "fc3dd982-6802-4dd1-9434-4c9ec7a637fe"
          ],
          "display_name": false
        },
        {
          "uuid": "db4f5d4c-ee89-4f14-b530-a52d3643c2aa",
          "name": "2,5-DI-TERT-BUTYL-1,4-BENZENEDIOL",
          "stdName": "2,5-DI-TERT-BUTYL-1,4-BENZENEDIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "1d47b157-0a1c-4f20-bce4-93ef5acb4d31",
          "name": "2,5-DI-TERT-BUTYL-1,4-BENZOHYDROQUINONE",
          "stdName": "2,5-DI-TERT-BUTYL-1,4-BENZOHYDROQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "1ee38b6a-787b-437a-82f5-4f6b6530f22a",
          "name": "2,5-DI-TERT-BUTYL-1,4-HYDROQUINONE",
          "stdName": "2,5-DI-TERT-BUTYL-1,4-HYDROQUINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "368958ee-7379-44d4-bf66-396e98827393",
          "name": "2,5-DI-TERT-BUTYLBENZENE-1,4-DIOL",
          "stdName": "2,5-DI-TERT-BUTYLBENZENE-1,4-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "52865532-a4be-41d2-aa64-0464c9e8e307"
          ],
          "display_name": false
        },
        {
          "uuid": "70f9aa0b-daac-4efc-afee-63ce1a9fe0d3",
          "name": "2,5-DI-TERT-BUTYLHYDROQUINONE",
          "stdName": "2,5-DI-TERT-BUTYLHYDROQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "11965e71-16e5-42f1-9db3-f581fb01f250"
          ],
          "display_name": false
        },
        {
          "uuid": "f4564801-7d95-4072-9e5f-3a2066a8a05e",
          "name": "2,5-DI-TERT-BUTYLQUINOL",
          "stdName": "2,5-DI-TERT-BUTYLQUINOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "0d4ac17a-2a5b-4aea-95ac-4780771b1918",
          "name": "BUTYLHYDROQUINONE, 2,5-DI-TERT-",
          "stdName": "BUTYLHYDROQUINONE, 2,5-DI-TERT-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "174f4984-e925-4f41-92a9-6ec5eedf4933"
          ],
          "display_name": false
        },
        {
          "uuid": "9d7ec2c4-8f03-4141-9c43-edc86f7f86f0",
          "name": "DI-T-BUTYLHYDROQUINONE",
          "stdName": "DI-T-BUTYLHYDROQUINONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "fc145a82-0a25-4856-88f3-fae67fa79f95",
            "6fe980fd-bbfb-47e8-9274-afe2dacfc546"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "56b610bf-69ef-432a-8e45-6807aa5a1188",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "82b15867-da61-4b50-a5e8-4984cfcd1182",
          "name": "DI-TERT-BUTYLHYDROQUINONE",
          "stdName": "DI-TERT-BUTYLHYDROQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "d20bb13e-bb73-4190-9a7b-c229d4efb54b"
          ],
          "display_name": true
        },
        {
          "uuid": "10fd292c-871d-40c8-bbe2-866f3b649651",
          "name": "HYDROQUINONE, 2,5-DI-TERT-BUTYL-",
          "stdName": "HYDROQUINONE, 2,5-DI-TERT-BUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "c78ea547-e681-4422-b3bc-650d10ddd37f",
          "name": "NAUGARD 451",
          "stdName": "NAUGARD 451",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "33617483-011b-402f-834f-f6aea67b9233"
          ],
          "display_name": false
        },
        {
          "uuid": "2d86d0e0-1885-4b4f-b378-f4f38b3d584f",
          "name": "NSC-11",
          "stdName": "NSC-11",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d24571d-62a3-4b64-bf43-0ab424f8676e",
            "83fce6cc-a099-464d-8ea4-3d8b7d16aa57"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "174f4984-e925-4f41-92a9-6ec5eedf4933",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fc145a82-0a25-4856-88f3-fae67fa79f95",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d24571d-62a3-4b64-bf43-0ab424f8676e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83fce6cc-a099-464d-8ea4-3d8b7d16aa57",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33617483-011b-402f-834f-f6aea67b9233",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d20bb13e-bb73-4190-9a7b-c229d4efb54b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11965e71-16e5-42f1-9db3-f581fb01f250",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc3dd982-6802-4dd1-9434-4c9ec7a637fe",
          "citation": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?FR=176.170&CFRPart=&FRSearch=",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?FR=176.170&CFRPart=&FRSearch=",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52865532-a4be-41d2-aa64-0464c9e8e307",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b244b65-b989-430c-bb9d-ed3d097e058e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390930000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe5fd981-273f-4258-acda-828706bac1d9",
          "citation": "SRS import [26XK13B61B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=26XK13B61B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390930000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1076733c-233e-408c-9fce-a758c43f19eb",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fe980fd-bbfb-47e8-9274-afe2dacfc546",
          "citation": "DI-T-BUTYLHYDROQUINONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e779b3f-d995-4a8d-3f20-2ddb4c719916",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=88-58-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa55e942-9ef8-03c0-f554-76805376c432",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "15f2d0e2-9ed4-48ba-a7e8-d1613ad8e6b8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fe641b61-367a-8d89-6f30-50f748a33989",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "98153a88-7854-4e3a-8fc3-72af267795f0",
          "id": "98153a88-7854-4e3a-8fc3-72af267795f0",
          "molfile": "\n  Marvin  01132107542D          \n\n 16 16  0  0  0  0            999 V2000\n    7.7092   -6.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -6.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0602   -6.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -7.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -5.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1894   -5.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1894   -4.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4322   -4.0022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -4.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5868   -4.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5868   -5.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3316   -5.6606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -3.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0602   -3.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7092   -3.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -2.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n 11  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  2  0  0  0  0\n 13  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1cc(c(cc1O)C(C)(C)C)O",
          "formula": "C14H22O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6c2e679c-8d22-43c6-9411-8156d73ea902"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "222.3238",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5b4e9daf-3785-417a-868d-4324bc1ce60a",
      "version": "7",
      "structure": {
        "id": "6ffc66fc-0443-4a0d-bdf0-f440cb301bc1",
        "molfile": "\n  Marvin  01132105492D          \n\n 16 16  0  0  0  0            999 V2000\n    6.8841   -3.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -4.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1894   -4.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1894   -5.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -5.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -6.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7092   -6.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0602   -6.4846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -7.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5868   -5.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5868   -4.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3316   -5.6606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4322   -4.0022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0602   -3.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7092   -3.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8841   -2.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11 10  1  0  0  0  0\n  2 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  3 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n  1 15  1  0  0  0  0\n  1 16  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1cc(c(cc1O)C(C)(C)C)O",
        "formula": "C14H22O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "222.3238",
        "optical_activity": "NONE",
        "references": [
          "fe5fd981-273f-4258-acda-828706bac1d9",
          "1076733c-233e-408c-9fce-a758c43f19eb"
        ],
        "stereo_centers": 0
      },
      "unii": "26XK13B61B"
    }
  ]
}