{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "30c00573-d062-42df-9159-db973d47b23d", "code": "26048-05-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=26048-05-5", "code_system": "CAS", "references": [ "c1d3f52e-8c9a-427f-83dd-eff68604e66f", "bd67e9a3-ffb6-416e-94f9-7d9d56b7c61c" ] }, { "uuid": "6fc6d6e6-54c8-4495-81a9-13c44f1a2a66", "code": "C004456", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67004456", "code_system": "MESH", "references": [ "c1d3f52e-8c9a-427f-83dd-eff68604e66f" ] }, { "uuid": "ccf0b2f0-40f5-4ea9-902c-d533cce82631", "code": "BEAUVERICIN", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Beauvericin", "code_system": "WIKIPEDIA", "references": [ "c1d3f52e-8c9a-427f-83dd-eff68604e66f" ] }, { "uuid": "3d8d7922-ec02-4c65-9696-4fdef569fd69", "code": "3007984", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3007984", "code_system": "PUBCHEM", "references": [ "c1d3f52e-8c9a-427f-83dd-eff68604e66f" ] }, { "uuid": "7d12ddaf-5ba0-edb9-dfbb-33d89dff20bc", "code": "C1976", "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Antibiotic[C259]|Depsipeptide Antineoplastic Antibiotic", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1976", "code_system": "NCI_THESAURUS", "references": [ "656ad5cb-be84-9a57-4349-1b87466f8a72" ] }, { "uuid": "aeb3e00a-0840-bfed-8a88-7633d98af024", "code": "C1011", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1011", "code_system": "NCI_THESAURUS", "references": [ "9c77b077-803e-877e-2b71-37392691d925" ] }, { "uuid": "756a5762-c6fa-470b-a02f-97d09a62415f", "code": "26S048LS2R", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "09642ab3-49c0-3672-2434-b82d3a9a74ce", "code": "3000", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3000", "code_system": "CHEBI", "references": [ "656ad5cb-be84-9a57-4349-1b87466f8a72" ] }, { "uuid": "09ce1675-4e55-e2a7-8927-e5dec88d7e01", "code": "DTXSID00891834", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00891834", "code_system": "EPA CompTox", "references": [ "656ad5cb-be84-9a57-4349-1b87466f8a72" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b20daae9-dbc9-4df5-972e-dfe6f15b1391", "name": "BEAUVERICIN", "stdName": "BEAUVERICIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "67a6fe38-f07b-43b8-bb1a-83ba9d5f8389", "f37f634d-2b22-4005-beee-705a347004eb" ], "display_name": true }, { "uuid": "67edaa49-3a72-4f5f-b1cc-72393a2e8f0e", "name": "CYCLO((2R)-2-HYDROXY-3-METHYLBUTANOYL-N-METHYL-L-PHENYLALANYL-(2R)-2-HYDROXY-3-METHYLBUTANOYL-N-METHYL-L-PHENYLALANYL-(2R)-2-HYDROXY-3-METHYLBUTANOYL-N-METHYL-L-PHENYLALANYL)", "stdName": "CYCLO((2R)-2-HYDROXY-3-METHYLBUTANOYL-N-METHYL-L-PHENYLALANYL-(2R)-2-HYDROXY-3-METHYLBUTANOYL-N-METHYL-L-PHENYLALANYL-(2R)-2-HYDROXY-3-METHYLBUTANOYL-N-METHYL-L-PHENYLALANYL)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f37f634d-2b22-4005-beee-705a347004eb", "9c8af1f1-3624-45aa-a5d6-4fd8c3bad6ca" ], "display_name": false } ], "references": [ { "uuid": "67a6fe38-f07b-43b8-bb1a-83ba9d5f8389", "citation": "chemid", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f37f634d-2b22-4005-beee-705a347004eb", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9c8af1f1-3624-45aa-a5d6-4fd8c3bad6ca", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c1d3f52e-8c9a-427f-83dd-eff68604e66f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391649000, "tags": [ "NOMEN" ] }, { "uuid": "6aa63763-eddf-40c8-bb7a-f09049c4bbc2", "citation": "SRS import [26S048LS2R]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=26S048LS2R", "doc_type": "SRS", "public_domain": true, "document_date": 1493391649000, "tags": [ "NOMEN" ] }, { "uuid": "656ad5cb-be84-9a57-4349-1b87466f8a72", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "9c77b077-803e-877e-2b71-37392691d925", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "bd67e9a3-ffb6-416e-94f9-7d9d56b7c61c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "60a08006-315f-e0ae-7f52-321263e8fa3d", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5f27025f-2fbd-4b1f-a1ff-b2087b3d2559", "id": "5f27025f-2fbd-4b1f-a1ff-b2087b3d2559", "molfile": "\n Marvin 01132104552D \n\n 57 60 0 0 1 0 999 V2000\n 8.9109 -3.7049 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.6256 -3.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -2.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -1.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -0.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -1.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -4.5295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -4.5295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -5.7663 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.9109 -6.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -7.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -7.4154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -7.4154 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.1963 -8.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -8.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -9.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -9.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -9.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -8.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -8.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4817 -7.0032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4817 -6.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -7.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -8.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -7.0032 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.0525 -6.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3379 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6232 -6.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3379 -4.9418 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.6232 -4.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9086 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9086 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1940 -6.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4794 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4794 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1940 -4.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -4.5295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -3.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3777 -3.3154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -3.2926 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.4817 -3.7049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -3.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -2.4681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -2.4681 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.4817 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3379 -7.4154 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.6232 -7.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3379 -8.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -6.1786 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.3402 -7.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0548 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 9 1 0 0 0 0\n 1 47 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 55 1 1 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 6 0 0 0\n 17 25 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 24 19 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 25 1 0 0 0 0\n 27 28 2 0 0 0 0\n 29 27 1 0 0 0 0\n 30 29 1 0 0 0 0\n 29 52 1 1 0 0 0\n 31 30 1 0 0 0 0\n 31 32 2 0 0 0 0\n 33 31 1 0 0 0 0\n 33 34 1 6 0 0 0\n 33 41 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 35 1 0 0 0 0\n 35 40 2 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 2 0 0 0 0\n 40 39 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 41 1 0 0 0 0\n 43 44 2 0 0 0 0\n 43 45 1 0 0 0 0\n 46 45 1 0 0 0 0\n 45 49 1 1 0 0 0\n 46 47 1 0 0 0 0\n 47 48 2 0 0 0 0\n 49 50 1 0 0 0 0\n 49 51 1 0 0 0 0\n 52 53 1 0 0 0 0\n 52 54 1 0 0 0 0\n 55 56 1 0 0 0 0\n 55 57 1 0 0 0 0\nM END", "smiles": "CC(C)[C@@H]1C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](Cc3ccccc3)C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](Cc4ccccc4)C(=O)O1", "formula": "C45H57N3O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1eb0ac83-4d3b-4871-a060-cb9f56ce26fd" }, "defined_stereo": 6, "ez_centers": 0, "molecular_weight": "783.9505", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "7ecc6498-4809-4894-b0c5-27783614b316", "version": "9", "structure": { "id": "0a9aaf60-544a-4715-bfad-6a37f007f296", "molfile": "\n Marvin 01132100482D \n\n 57 60 0 0 1 0 999 V2000\n 9.6256 -3.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -2.4681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -1.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -0.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -1.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -3.7049 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.1963 -3.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4817 -3.7049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -3.2926 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.0525 -3.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -4.5295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3379 -4.9418 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.3379 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6232 -6.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -6.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -7.0032 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.3379 -7.4154 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.6232 -7.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3379 -8.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -7.4154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -8.2400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4817 -7.0032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -7.4154 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.9109 -7.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -6.1786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -5.7663 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.6256 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -4.5295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -4.5295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -6.1786 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.3402 -7.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0548 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -7.4154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -8.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -8.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9109 -9.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -9.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -9.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3402 -8.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6256 -8.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4817 -6.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6232 -4.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9086 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9086 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1940 -6.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4794 -5.7663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4794 -4.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1940 -4.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7671 -2.4681 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.4817 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0525 -2.0558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1963 -2.4681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3777 -3.3154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 2 1 0 0 0 0\n 8 1 1 6 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 1 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 19 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 23 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 8 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 30 33 2 0 0 0 0\n 29 34 1 1 0 0 0\n 34 35 1 0 0 0 0\n 34 36 1 0 0 0 0\n 27 37 2 0 0 0 0\n 26 38 1 6 0 0 0\n 38 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 2 0 0 0 0\n 44 39 1 0 0 0 0\n 25 45 1 0 0 0 0\n 15 46 1 6 0 0 0\n 46 47 1 0 0 0 0\n 48 47 1 0 0 0 0\n 49 48 2 0 0 0 0\n 50 49 1 0 0 0 0\n 51 50 2 0 0 0 0\n 52 51 1 0 0 0 0\n 47 52 2 0 0 0 0\n 11 53 1 1 0 0 0\n 53 54 1 0 0 0 0\n 53 55 1 0 0 0 0\n 9 56 2 0 0 0 0\n 12 57 2 0 0 0 0\nM END", "smiles": "CC(C)[C@@H]1C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](Cc3ccccc3)C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](Cc4ccccc4)C(=O)O1", "formula": "C45H57N3O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 6, "ez_centers": 0, "molecular_weight": "783.9505", "optical_activity": "UNSPECIFIED", "references": [ "67a6fe38-f07b-43b8-bb1a-83ba9d5f8389", "6aa63763-eddf-40c8-bb7a-f09049c4bbc2" ], "stereo_centers": 6 }, "unii": "26S048LS2R" } ] }