{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f7000d88-74c2-42f9-af8a-99dad1a1fbac",
          "code": "537-42-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=537-42-8",
          "code_system": "CAS",
          "references": [
            "539664ef-c683-49c7-8a7a-1f80810901ea",
            "8e55ea1d-cb2a-4412-95e3-9500b2ba9125"
          ]
        },
        {
          "uuid": "c92265d9-d270-4d7a-bccd-0da77e72bfce",
          "code": "18259-15-9",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18259-15-9",
          "code_system": "CAS",
          "references": [
            "539664ef-c683-49c7-8a7a-1f80810901ea",
            "3cbab3ee-0830-489a-83f4-6dc9088f61d0"
          ]
        },
        {
          "uuid": "fb7900bb-ba4e-4804-b21c-98e225b84f5a",
          "code": "5281727",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281727",
          "code_system": "PUBCHEM",
          "references": [
            "539664ef-c683-49c7-8a7a-1f80810901ea"
          ]
        },
        {
          "uuid": "abce5452-2157-fca9-f912-11ef9140e52e",
          "code": "Pterostilbene",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pterostilbene",
          "code_system": "WIKIPEDIA",
          "references": [
            "ae78ecc4-7b2d-2e44-8eed-5e75bfc1ecda"
          ]
        },
        {
          "uuid": "d9493a7f-15ef-babc-bacc-4fdfca0bebf8",
          "code": "DTXSID9041106",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9041106",
          "code_system": "EPA CompTox",
          "references": [
            "cb6e4d95-f289-df0c-b594-620ec6bd51bb"
          ]
        },
        {
          "uuid": "fa64e6d0-4af8-44b5-8ebe-dd7a865a4c73",
          "code": "C153353",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C153353",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c12269a2-972e-820c-d42a-6941715d9188"
          ]
        },
        {
          "uuid": "5c58bcf7-ac4b-aa24-6969-a5a44cc7bdcd",
          "code": "628218",
          "comments": "ORPHAN DRUG|Designated|Treatment of Amyotrophic Lateral Sclerosis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=628218",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "80206a7c-1299-f299-6f07-2adb497ad94a",
          "code": "C275",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C275",
          "code_system": "NCI_THESAURUS",
          "references": [
            "41622c42-8891-feb5-96e4-9f9791d4ceca"
          ]
        },
        {
          "uuid": "47db4cb1-1aed-49fd-14e6-9129a04e3a10",
          "code": "1717 (Number of products:177)",
          "comments": "Dietary Supplement Label Database|Chemical|Pterostilbene",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1717&item=Pterostilbene",
          "code_system": "DSLD",
          "references": [
            "41622c42-8891-feb5-96e4-9f9791d4ceca"
          ]
        },
        {
          "uuid": "a6a62489-2608-4d86-9c70-6049b9c513e9",
          "code": "26R60S6A5I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d29f86a6-cff5-9c86-e127-249c94745668",
          "code": "8630",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8630",
          "code_system": "CHEBI",
          "references": [
            "41622c42-8891-feb5-96e4-9f9791d4ceca"
          ]
        },
        {
          "uuid": "2cea3278-1b57-190e-67b8-a055144c484c",
          "code": "100000176848",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e48dacb4-e4b7-592e-5c01-dcff441ca4da"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "49a0234e-db2b-40b2-8c84-aaa3528f3a7d",
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "references": [
            "1553749a-e6a5-fe0e-2d04-6b4c5999ffc6"
          ],
          "related_substance": {
            "uuid": "43b93bf8-285b-48ae-8b54-da1cda680aee",
            "refuuid": "87cc4cdd-771f-4c20-829f-f1ae7a9723d4",
            "name": "ALMOND",
            "unii": "3Z252A2K9G",
            "linking_id": "3Z252A2K9G",
            "ref_pname": "ALMOND",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "59985f31-967b-4ea4-a5d8-2d0b93e126ca",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "aa73e969-f536-4158-91f3-6bf7688d93c5",
            "refuuid": "977abae1-e89d-4b30-a2cf-c0e8f283502a",
            "name": "PTEROCARPUS MARSUPIUM WOOD",
            "unii": "O8F66201WM",
            "linking_id": "O8F66201WM",
            "ref_pname": "PTEROCARPUS MARSUPIUM WOOD"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5459c508-360e-41fd-91c3-9ad592e1bcd2",
          "name": "3,5-DIMETHOXY-4'-HYDROXY-TRANS-STILBENE",
          "stdName": "3,5-DIMETHOXY-4'-HYDROXY-TRANS-STILBENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
            "66b8a496-fef3-4d92-80d5-781089eccbe9"
          ],
          "display_name": false
        },
        {
          "uuid": "c53a6e7d-48dc-4977-a7dd-5f39ee489556",
          "name": "4-((1E)-2-(3,5-DIMETHOXYPHENYL)ETHENYL)PHENOL",
          "stdName": "4-((1E)-2-(3,5-DIMETHOXYPHENYL)ETHENYL)PHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
            "66b8a496-fef3-4d92-80d5-781089eccbe9"
          ],
          "display_name": false
        },
        {
          "uuid": "7137bcc4-aa68-69d1-1336-8798e4419edd",
          "name": "EH-301 COMPONENT PTEROSTILBENE",
          "stdName": "EH-301 COMPONENT PTEROSTILBENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d407fddb-c4cd-e548-b73c-6bb4411a397d"
          ],
          "display_name": false
        },
        {
          "uuid": "22abe469-c69a-480e-8fdb-fb7f72604fe3",
          "name": "PHENOL, 4-((1E)-2-(3,5-DIMETHOXYPHENYL)ETHENYL)-",
          "stdName": "PHENOL, 4-((1E)-2-(3,5-DIMETHOXYPHENYL)ETHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
            "66b8a496-fef3-4d92-80d5-781089eccbe9"
          ],
          "display_name": false
        },
        {
          "uuid": "eb35b46b-25cc-4f70-ac16-7d1df1605e34",
          "name": "PTEROSTILBENE",
          "stdName": "PTEROSTILBENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3d2253f-af48-4b9e-b2e3-db93867411e4",
            "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
            "219722a1-b77f-4c21-bd3c-15d674cb67b6",
            "49b4c7ba-f854-4896-bf51-f547e9a52c40"
          ],
          "display_name": true
        },
        {
          "uuid": "bdfbc35c-2abf-419c-beb8-cbd37a8a1c60",
          "name": "PTEROSTILBENE, (E)-",
          "stdName": "PTEROSTILBENE, (E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
            "66b8a496-fef3-4d92-80d5-781089eccbe9"
          ],
          "display_name": false
        },
        {
          "uuid": "311b9950-d67e-286d-2644-2e1006f5784e",
          "name": "Pterostilbene [WHO-DD]",
          "stdName": "PTEROSTILBENE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "375daffe-a913-1e3c-8a9c-ab57ae7f4a1e"
          ],
          "display_name": false
        },
        {
          "uuid": "f1742009-4696-4bad-a3f6-fe85d63ae7c4",
          "name": "TRANS-3,5-DIMETHOXY-4'-HYDROXYSTILBENE",
          "stdName": "TRANS-3,5-DIMETHOXY-4'-HYDROXYSTILBENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
            "66b8a496-fef3-4d92-80d5-781089eccbe9"
          ],
          "display_name": false
        },
        {
          "uuid": "85c76e96-d1ad-4115-81e8-c7e45e80c49c",
          "name": "TRANS-PTEROSTILBENE",
          "stdName": "TRANS-PTEROSTILBENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
            "66b8a496-fef3-4d92-80d5-781089eccbe9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "66b8a496-fef3-4d92-80d5-781089eccbe9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "257aab9d-f2ab-42cc-b972-d2841b7cea7f",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3d2253f-af48-4b9e-b2e3-db93867411e4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "219722a1-b77f-4c21-bd3c-15d674cb67b6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "539664ef-c683-49c7-8a7a-1f80810901ea",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37f3f68d-b2e6-4eef-b662-1c5990c8607c",
          "citation": "SRS import [26R60S6A5I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=26R60S6A5I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49b4c7ba-f854-4896-bf51-f547e9a52c40",
          "citation": "PTEROSTILBENE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae78ecc4-7b2d-2e44-8eed-5e75bfc1ecda",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Pterostilbene",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cb6e4d95-f289-df0c-b594-620ec6bd51bb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=537-42-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1553749a-e6a5-fe0e-2d04-6b4c5999ffc6",
          "citation": "Food Chem. 2014 Apr 1;148:300-6. doi: 10.1016/j.foodchem.2013.10.057. Epub 2013 Oct 19.",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "e48dacb4-e4b7-592e-5c01-dcff441ca4da",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d407fddb-c4cd-e548-b73c-6bb4411a397d",
          "citation": "https://adisinsight.springer.com/drugs/800051629",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "c12269a2-972e-820c-d42a-6941715d9188",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "41622c42-8891-feb5-96e4-9f9791d4ceca",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8e55ea1d-cb2a-4412-95e3-9500b2ba9125",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3cbab3ee-0830-489a-83f4-6dc9088f61d0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "375daffe-a913-1e3c-8a9c-ab57ae7f4a1e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "346a5c83-4b30-479b-8939-3baf9a23987f",
          "id": "346a5c83-4b30-479b-8939-3baf9a23987f",
          "molfile": "\n  Marvin  01132102482D          \n\n 19 20  0  0  0  0            999 V2000\n   -2.1181    1.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2931    1.1622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8806    0.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2931   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8806   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2931   -1.6957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1181   -1.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0556   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3569   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1819   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5944   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4194   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -1.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6569   -1.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0694   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8944   -0.9812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6569   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0556    0.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 19  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 19  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 18  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(/C=C/c2ccc(cc2)O)cc(c1)OC",
          "formula": "C16H16O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b0b2cf82-3abb-4b57-924b-ae0918ea4e01"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "256.297",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b1c0b458-d630-4c34-b8a6-bb5f29c2b832",
      "version": "17",
      "structure": {
        "id": "4defab6e-c2f5-4036-b898-057271a9e86e",
        "molfile": "\n  Marvin  01132104042D          \n\n 19 20  0  0  0  0            999 V2000\n    4.0694   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6569   -1.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -1.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4194   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8319   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6569   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5944   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1819   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3569   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0556   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8806   -0.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2931   -0.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8806    0.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0556    0.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2931    1.1622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1181    1.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2931   -1.6957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1181   -1.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8944   -0.9812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n  9 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 13 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 11 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n  4  7  1  0  0  0  0\n  1 19  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(/C=C/c2ccc(cc2)O)cc(c1)OC",
        "formula": "C16H16O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "256.297",
        "optical_activity": "NONE",
        "references": [
          "219722a1-b77f-4c21-bd3c-15d674cb67b6",
          "37f3f68d-b2e6-4eef-b662-1c5990c8607c"
        ],
        "stereo_centers": 0
      },
      "unii": "26R60S6A5I"
    }
  ]
}