{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2f6f45dd-3e05-49ef-8c4e-6d2b7f453eb6", "code": "73772-46-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=73772-46-0", "code_system": "CAS", "references": [ "a3b858ac-7ae5-49d1-be6c-3e22fb0f5390", "5687ebe4-92eb-4c03-8705-16368dde405f" ] }, { "uuid": "19b8ff79-408b-4620-a8ff-d3dad164a2c6", "code": "C83583", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83583", "code_system": "NCI_THESAURUS", "references": [ "a3b858ac-7ae5-49d1-be6c-3e22fb0f5390" ] }, { "uuid": "d7bfbe61-9ecf-48b2-8641-0344cf22189f", "code": "277-600-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.525", "code_system": "ECHA (EC/EINECS)", "references": [ "a3b858ac-7ae5-49d1-be6c-3e22fb0f5390" ] }, { "uuid": "8292ae11-ba92-4637-a506-929fa52a4fed", "code": "173219", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/173219", "code_system": "PUBCHEM", "references": [ "a3b858ac-7ae5-49d1-be6c-3e22fb0f5390" ] }, { "uuid": "746cb4e6-b740-902f-5e59-d1e5a1a97ac3", "code": "DTXSID6052825", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6052825", "code_system": "EPA CompTox", "references": [ "edb92c59-d159-01fe-a4e8-ff6fb4241839" ] }, { "uuid": "55b3dc70-5bb2-fe37-bea0-0500fef31318", "code": "C45678", "comments": "Industrial Aid", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678", "code_system": "NCI_THESAURUS", "references": [ "bb24b3b2-8160-cc41-aabb-81001b07d38c" ] }, { "uuid": "553b7c4b-4cd1-4e3f-8aaf-9a358247b815", "code": "26JA650O77", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d6f5ad9a-eeb1-53bb-7475-5a3012875cee", "code": "2584845", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2584845/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "97fdd9f8-3ad1-e9be-e5f9-9c329a1443db" ] }, { "uuid": "78f7d298-20af-35b7-73df-05b7845ffe79", "code": "26JA650O77", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=26JA650O77", "code_system": "DAILYMED", "references": [ "d1a851f6-c480-f201-9c01-356476b9a635" ] } ], "substance_class": "chemical", "names": [ { "uuid": "b7404888-951c-4889-8715-d826b86344b8", "name": "CAPRYLAMIDOPROPYL BETAINE", "stdName": "CAPRYLAMIDOPROPYL BETAINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b24b1936-dbda-4207-9df8-4b9ee4202b5c", "806a5acc-d1c7-4a7f-a86b-cc06facd0c60" ], "display_name": true }, { "uuid": "244e83f8-ab7c-4bba-a1ba-3a9d0f48f4cf", "name": "COLATERIC CYAB", "stdName": "COLATERIC CYAB", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "b24b1936-dbda-4207-9df8-4b9ee4202b5c", "d66169e9-b8b6-42f5-ab75-24f1812f19ee" ], "display_name": false }, { "uuid": "0f63f153-064e-4ddb-809b-6d4eff7632a0", "name": "CYAB", "stdName": "CYAB", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "b24b1936-dbda-4207-9df8-4b9ee4202b5c", "d66169e9-b8b6-42f5-ab75-24f1812f19ee" ], "display_name": false } ], "references": [ { "uuid": "806a5acc-d1c7-4a7f-a86b-cc06facd0c60", "citation": "http://www.masonsurfactants.com/PDFs/PC/PersonalCareProductsSummary.PDF", "url": "http://www.masonsurfactants.com/PDFs/PC/PersonalCareProductsSummary.PDF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b24b1936-dbda-4207-9df8-4b9ee4202b5c", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d66169e9-b8b6-42f5-ab75-24f1812f19ee", "citation": "http://www.scribd.com/doc/17230306/ColaTeric-CYAB", "url": "http://www.scribd.com/doc/17230306/ColaTeric-CYAB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a3b858ac-7ae5-49d1-be6c-3e22fb0f5390", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390553000, "tags": [ "NOMEN" ] }, { "uuid": "f86c0a84-2212-4fdd-a218-5f8872f2bed6", "citation": "SRS import [26JA650O77]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=26JA650O77", "doc_type": "SRS", "public_domain": true, "document_date": 1493390553000, "tags": [ "NOMEN" ] }, { "uuid": "edb92c59-d159-01fe-a4e8-ff6fb4241839", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=73772-46-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "97fdd9f8-3ad1-e9be-e5f9-9c329a1443db", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "bb24b3b2-8160-cc41-aabb-81001b07d38c", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "5687ebe4-92eb-4c03-8705-16368dde405f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "d1a851f6-c480-f201-9c01-356476b9a635", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "52c6eb25-13be-4cc4-a25a-f2e358685ae4", "id": "52c6eb25-13be-4cc4-a25a-f2e358685ae4", "molfile": "\n Marvin 01132104192D \n\n 20 19 0 0 0 0 999 V2000\n 1.2759 -7.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9931 -6.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7056 -7.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4321 -6.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1448 -7.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8619 -6.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5698 -7.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2963 -6.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2963 -5.8333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0089 -7.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7261 -6.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4340 -7.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -6.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8778 -7.0334 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 10.5058 -7.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4043 -7.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6465 -6.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6403 -6.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3950 -6.3912 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 11.6403 -7.6757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 14 1 0 0 0 0\n 14 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 18 2 0 0 0 0\nM CHG 2 14 1 19 -1\nM END", "smiles": "CCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-]", "formula": "C15H30N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "04691ca0-4b8f-42e3-a8ff-4dde3b668786" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "286.4109", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "436d7f91-3709-44a2-95b2-8e9c69e58667", "version": "6", "structure": { "id": "fd5aff29-b894-4522-bace-89eb1a25c15a", "molfile": "\n Marvin 01132113072D \n\n 20 19 0 0 0 0 999 V2000\n 12.3950 -6.3912 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 11.6403 -6.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6403 -7.6757 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6465 -6.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8778 -7.0334 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 10.5058 -7.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4043 -7.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1512 -6.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4340 -7.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7261 -6.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0089 -7.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2963 -6.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2963 -5.8333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5698 -7.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8619 -6.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1448 -7.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4321 -6.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7056 -7.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9931 -6.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2759 -7.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 5 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 12 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\nM CHG 2 1 -1 5 1\nM END", "smiles": "CCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-]", "formula": "C15H30N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "286.4109", "optical_activity": "NONE", "references": [ "806a5acc-d1c7-4a7f-a86b-cc06facd0c60", "f86c0a84-2212-4fdd-a218-5f8872f2bed6" ], "stereo_centers": 0 }, "unii": "26JA650O77" } ] }