{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5d8dc6c8-f08c-4226-98df-d75a8edf2405",
          "code": "1921-70-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1921-70-6",
          "code_system": "CAS",
          "references": [
            "b7483f73-b308-425f-b6a2-dba527a19750",
            "d511f563-178e-4c62-a1b8-0899f214c926"
          ]
        },
        {
          "uuid": "c0c81418-79ea-4fe4-9179-ff9ee4f3abc0",
          "code": "C009042",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67009042",
          "code_system": "MESH",
          "references": [
            "b7483f73-b308-425f-b6a2-dba527a19750"
          ]
        },
        {
          "uuid": "e182708a-86a3-4a9e-b1bb-808fa68495d5",
          "code": "PRISTANE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pristane",
          "code_system": "WIKIPEDIA",
          "references": [
            "b7483f73-b308-425f-b6a2-dba527a19750"
          ]
        },
        {
          "uuid": "a0f1ade8-7f61-44b0-9832-c2f51709b31d",
          "code": "217-650-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.047",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b7483f73-b308-425f-b6a2-dba527a19750"
          ]
        },
        {
          "uuid": "4d5a1049-bde8-4cc5-b1af-cd7ce176e851",
          "code": "m9140",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9140?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b7483f73-b308-425f-b6a2-dba527a19750"
          ]
        },
        {
          "uuid": "bd95979e-4ed0-4de9-b37c-d90addf4f1c1",
          "code": "15979",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15979",
          "code_system": "PUBCHEM",
          "references": [
            "b7483f73-b308-425f-b6a2-dba527a19750"
          ]
        },
        {
          "uuid": "3d288e44-153f-f0db-98ae-92753097d796",
          "code": "8345",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8345",
          "code_system": "HSDB",
          "references": [
            "121a5fac-0184-2325-18fc-bb58b130317a"
          ]
        },
        {
          "uuid": "405d0a02-57f9-c4d6-485b-8d167ce018b5",
          "code": "DTXSID70870919",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70870919",
          "code_system": "EPA CompTox",
          "references": [
            "f2b762d1-49f0-0bf4-356b-ff85c72531fc"
          ]
        },
        {
          "uuid": "119b654c-34e8-1cfd-f8fe-ed422c88a2d1",
          "code": "C44351",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Carcinogenic Hydrocarbon",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44351",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8e826866-fb0b-c2d9-4e6b-7528b4fa2224"
          ]
        },
        {
          "uuid": "08acfb8d-0142-ef9a-b3bc-676654a08150",
          "code": "C29850",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29850",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7a9baf93-0790-0c77-a455-657abec8196e"
          ]
        },
        {
          "uuid": "3a211de6-4741-4f03-99e5-f54b9a5ee221",
          "code": "26HZV48DT1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "06a8cf2e-2496-bff2-5907-793233e8551e",
          "code": "53181",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:53181",
          "code_system": "CHEBI",
          "references": [
            "8e826866-fb0b-c2d9-4e6b-7528b4fa2224"
          ]
        },
        {
          "uuid": "76462469-6ea9-6cf6-3b3f-351483f1db04",
          "code": "114852",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=114852",
          "code_system": "NSC",
          "references": [
            "3586429f-4a21-9d84-a129-3ad6ce8d8904"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2f6e62fb-1432-4775-8c37-e6b3a9c98f8e",
          "name": "2,6,10,14-TETRAMETHYLPENTADECANE",
          "stdName": "2,6,10,14-TETRAMETHYLPENTADECANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "a4594aea-6707-4811-88a3-8d8af24fae74"
          ],
          "display_name": false
        },
        {
          "uuid": "56955628-a73d-44b6-9e78-cd7b99f7da64",
          "name": "NORPHYTAN",
          "stdName": "NORPHYTAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "a4594aea-6707-4811-88a3-8d8af24fae74"
          ],
          "display_name": false
        },
        {
          "uuid": "b2c27e5a-9550-4f52-a7cd-2775e2b9f498",
          "name": "NORPHYTANE",
          "stdName": "NORPHYTANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "a4594aea-6707-4811-88a3-8d8af24fae74"
          ],
          "display_name": false
        },
        {
          "uuid": "cc86d8b8-41a8-4129-9033-66e191e1bc89",
          "name": "NSC-114852",
          "stdName": "NSC-114852",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "a4594aea-6707-4811-88a3-8d8af24fae74"
          ],
          "display_name": false
        },
        {
          "uuid": "72dc604f-f9da-4ff7-aa5c-032537933f50",
          "name": "PENTADECANE, 2,6,10,14-TETRAMETHYL-",
          "stdName": "PENTADECANE, 2,6,10,14-TETRAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "a4594aea-6707-4811-88a3-8d8af24fae74"
          ],
          "display_name": false
        },
        {
          "uuid": "fb679219-9f3b-4df6-8f13-f4af7ba4eea7",
          "name": "PRISTAN",
          "stdName": "PRISTAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "a4594aea-6707-4811-88a3-8d8af24fae74"
          ],
          "display_name": false
        },
        {
          "uuid": "1789631a-7f6d-4f87-87ff-2b2107e6ccbb",
          "name": "PRISTANE",
          "stdName": "PRISTANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "f19ef228-36ad-4940-91bf-77cea682e360",
            "1b72bd75-a3bb-40bc-9245-6108c0c8dce6",
            "aa3cbe86-581f-4fc3-9317-2bf99cb6e8fc",
            "5aae311e-3185-4282-9135-21b6e16cdbcf"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "892c91ee-1483-4cc3-9229-9703663f8c50",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1d14477c-be10-433c-8c29-f8cd33b045b6",
          "name": "PRISTANE [MI]",
          "stdName": "PRISTANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e165a63-23b0-4df0-9864-42d11d9cbc48",
            "1b72bd75-a3bb-40bc-9245-6108c0c8dce6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5aae311e-3185-4282-9135-21b6e16cdbcf",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9e165a63-23b0-4df0-9864-42d11d9cbc48",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4594aea-6707-4811-88a3-8d8af24fae74",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b72bd75-a3bb-40bc-9245-6108c0c8dce6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7483f73-b308-425f-b6a2-dba527a19750",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8037f574-169c-4827-95c2-c8bf03196e7c",
          "citation": "SRS import [26HZV48DT1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=26HZV48DT1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f19ef228-36ad-4940-91bf-77cea682e360",
          "citation": "PRISTANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa3cbe86-581f-4fc3-9317-2bf99cb6e8fc",
          "citation": "PRISTANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "121a5fac-0184-2325-18fc-bb58b130317a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1921-70-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f2b762d1-49f0-0bf4-356b-ff85c72531fc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1921-70-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8e826866-fb0b-c2d9-4e6b-7528b4fa2224",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7a9baf93-0790-0c77-a455-657abec8196e",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "d511f563-178e-4c62-a1b8-0899f214c926",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3586429f-4a21-9d84-a129-3ad6ce8d8904",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4543940b-4d80-498c-b5dd-94308e4e67fa",
          "id": "4543940b-4d80-498c-b5dd-94308e4e67fa",
          "molfile": "\n  Marvin  01132103392D          \n\n 19 18  0  0  0  0            999 V2000\n   10.4542   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4542   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1748   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7416   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0289   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3201   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6034   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.6034   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8867   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1860   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4852   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7684   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.7684   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0518   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3430   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6303   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9177   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1970   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9177   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCC(C)CCCC(C)CCCC(C)C",
          "formula": "C19H40",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b57c1cfa-ca05-4197-a0c6-f5e3e5d205f7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "268.5216",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7fec6c43-764d-41ee-82b2-2f1cd6fe62ca",
      "version": "9",
      "structure": {
        "id": "d8923eb6-cc54-45c0-be87-8509c7de43b8",
        "molfile": "\n  Marvin  01132111132D          \n\n 19 18  0  0  0  0            999 V2000\n   10.4542   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1748   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4542   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7416   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0289   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1970   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9177   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6034   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3201   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9177   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6034   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6303   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8867   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3430   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1860   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7684   -4.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0518   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4852   -3.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7684   -3.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  6  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  8  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n 19 17  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCC(C)CCCC(C)CCCC(C)C",
        "formula": "C19H40",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "268.5216",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8037f574-169c-4827-95c2-c8bf03196e7c",
          "a4594aea-6707-4811-88a3-8d8af24fae74"
        ],
        "stereo_centers": 2
      },
      "unii": "26HZV48DT1"
    }
  ]
}