{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7d452d0c-d864-41cc-8777-38911411e105",
          "code": "39630-46-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=39630-46-1",
          "code_system": "CAS",
          "references": [
            "6a86a60c-af5e-4f0e-b9df-f161f4ddcd6f",
            "eb2668aa-7bee-4b0a-af04-f67ea2311edc"
          ]
        },
        {
          "uuid": "3166bad0-da0c-4e83-93e9-9c93050784fc",
          "code": "57349699",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57349699",
          "code_system": "PUBCHEM",
          "references": [
            "6a86a60c-af5e-4f0e-b9df-f161f4ddcd6f"
          ]
        },
        {
          "uuid": "05d4915f-f449-2950-e41a-085686a0b337",
          "code": "DTXSID40192736",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40192736",
          "code_system": "EPA CompTox",
          "references": [
            "9c600fc4-375c-ab4c-49e3-0b709713ebf7"
          ]
        },
        {
          "uuid": "4e844d2b-0e5e-4b58-b152-27a7cd725117",
          "code": "269373P3AW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "68f980c5-2ba9-1fd1-2fe6-70ccf5aa774e",
          "code": "100000127136",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "65d737a1-2065-786f-fc6e-091117c7b740"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1e88889b-233a-4376-9364-fc626d7e8b8a",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a4103c91-62d3-457b-af6a-c742b4bf7c2d",
            "refuuid": "f8be4252-ac07-465c-887e-ec15d77e7d6a",
            "name": "GLYCYL-TYROSINE",
            "unii": "A226496H4O",
            "linking_id": "A226496H4O",
            "ref_pname": "GLYCYL-TYROSINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df1a6416-160c-4a7a-9d3a-2f5727cfdb5f",
          "name": "GLYCYL TYROSINE",
          "stdName": "GLYCYL TYROSINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63a4e0f4-a9ce-46d0-b834-20de7bb19e5d",
            "cb4e7a99-078d-4893-9ef2-908f339506ab",
            "f54ef132-c893-4bf3-b646-21b2a9ba1827"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "41ff738e-ab2c-448f-902d-52708dac9b72",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2c873404-bdcc-4405-bdb7-8a7a2de14017",
          "name": "GLYCYL-L-TYROSINE DIHYDRATE",
          "stdName": "GLYCYL-L-TYROSINE DIHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63a4e0f4-a9ce-46d0-b834-20de7bb19e5d",
            "f54ef132-c893-4bf3-b646-21b2a9ba1827"
          ],
          "display_name": false
        },
        {
          "uuid": "839c09fd-1685-4c5e-b763-55fedbe5f7d2",
          "name": "GLYCYL-TYROSINE DIHYDRATE",
          "stdName": "GLYCYL-TYROSINE DIHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "737a6c2f-fdf1-4920-a713-e4d464a1e961",
            "f54ef132-c893-4bf3-b646-21b2a9ba1827"
          ],
          "display_name": false
        },
        {
          "uuid": "aaa293d4-8322-4f55-bc05-1196c8c1a7d1",
          "name": "L-TYROSINE, GLYCYL-, DIHYDRATE",
          "stdName": "L-TYROSINE, GLYCYL-, DIHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63a4e0f4-a9ce-46d0-b834-20de7bb19e5d",
            "f54ef132-c893-4bf3-b646-21b2a9ba1827"
          ],
          "display_name": false
        },
        {
          "uuid": "3fe89eff-1b0b-4023-853b-9a4dc91e32ce",
          "name": "L-TYROSINE, N-GLYCYL-, DIHYDRATE",
          "stdName": "L-TYROSINE, N-GLYCYL-, DIHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24559de2-f160-4544-a1f0-ff090e774495",
            "f54ef132-c893-4bf3-b646-21b2a9ba1827"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "63a4e0f4-a9ce-46d0-b834-20de7bb19e5d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f54ef132-c893-4bf3-b646-21b2a9ba1827",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24559de2-f160-4544-a1f0-ff090e774495",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "737a6c2f-fdf1-4920-a713-e4d464a1e961",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a86a60c-af5e-4f0e-b9df-f161f4ddcd6f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5c98521-78a5-4a8f-9b43-5073aa7ae1af",
          "citation": "SRS import [269373P3AW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=269373P3AW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb4e7a99-078d-4893-9ef2-908f339506ab",
          "citation": "GLYCYL TYROSINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c600fc4-375c-ab4c-49e3-0b709713ebf7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=39630-46-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "65d737a1-2065-786f-fc6e-091117c7b740",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "eb2668aa-7bee-4b0a-af04-f67ea2311edc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7d35ef91-6e0e-4e36-845f-282462be99a0",
          "id": "7d35ef91-6e0e-4e36-845f-282462be99a0",
          "molfile": "\n  Marvin  01132106302D          \n\n  1  0  0  0  1  0            999 V2000\n    7.6617   -7.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "0c09ed5a-bd0f-4f81-b6d5-f07a2e6cd62d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "6adf7abc-bf78-42f7-a191-f3f464f5527d",
          "id": "6adf7abc-bf78-42f7-a191-f3f464f5527d",
          "molfile": "\n  Marvin  01132105332D          \n\n 17 17  0  0  1  0            999 V2000\n    5.7219   -4.3074    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.0075   -3.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -4.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5785   -3.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8640   -4.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8640   -5.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1496   -5.5449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5785   -5.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -5.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7219   -5.1323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364   -5.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364   -6.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1509   -5.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8653   -5.5449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364   -3.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1508   -4.3074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364   -3.0699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  1  0  0  0\n  1 15  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C[C@@H](C(=O)O)NC(=O)CN)O",
          "formula": "C11H14N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0fa1e39f-2348-4c1e-a5b3-7a8b63151b12"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "238.2403",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d5f35040-b612-4231-86d4-9f2e4bbb331c",
      "version": "5",
      "structure": {
        "id": "749870d1-9e9c-4577-b2e5-bc80d7c422f8",
        "molfile": "\n  Marvin  01132106032D          \n\n 19 17  0  0  1  0            999 V2000\n    5.7219   -4.3074    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4364   -3.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1508   -4.3074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364   -3.0699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0075   -3.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -4.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5785   -3.8949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8640   -4.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8640   -5.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1496   -5.5449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5785   -5.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -5.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7219   -5.1323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364   -6.3699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4364   -5.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1509   -5.1323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8653   -5.5449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6617   -7.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6617   -7.7708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  1 13  1  1  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 15 13  1  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  18  19\nM  SPA   1  1  18\nM  SDI   1  4    7.2417   -8.1908    7.2417   -7.3508\nM  SDI   1  4    8.0817   -7.3508    8.0817   -8.1908\nM  SMT   1 2\nM  END",
        "smiles": "c1cc(ccc1C[C@@H](C(=O)O)NC(=O)CN)O.O.O",
        "formula": "C11H14N2O4.2H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "274.2709",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "63a4e0f4-a9ce-46d0-b834-20de7bb19e5d",
          "a5c98521-78a5-4a8f-9b43-5073aa7ae1af"
        ],
        "stereo_centers": 1
      },
      "unii": "269373P3AW"
    }
  ]
}