{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f5ccb04c-658a-4a98-95ef-06b9a6485dfe",
          "code": "URIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Uric_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "23eb2fd7-0689-4bd8-9313-a02b707cb8e4",
          "code": "200-720-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.655",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "821727bc-56a6-4c28-bb19-752ba1638141",
          "code": "1427088",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427088/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "e22dd473-4112-481e-9221-3f84c1ae0ade",
          "code": "m11330",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11330?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "425c2c7d-cc5f-410a-ac86-70fe6c1ab720",
          "code": "SUB32801",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "91e86451-d7ff-4b3d-b29d-8ae850e255c7",
          "code": "21 CFR 862.1775",
          "comments": "PART 862 -- CLINICAL CHEMISTRY AND CLINICAL TOXICOLOGY DEVICES|Subpart B--Clinical Chemistry Test Systems|Sec. 862.1775 Uric acid test system.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=862.1775",
          "code_system": "CFR",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "e5822f00-acf8-44dd-bae9-e781574d7e09",
          "code": "1175",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1175",
          "code_system": "PUBCHEM",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "6e93fa1c-6767-4842-a5f9-63f05dbe628b",
          "code": "69-93-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=69-93-2",
          "code_system": "CAS",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de",
            "9f4effc4-8cb7-42a7-9855-2b0ed58b99f7"
          ]
        },
        {
          "uuid": "e069cd6d-ad40-4ca6-9c64-2fe7a501c119",
          "code": "C62652",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62652",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "a443d42a-1363-4529-a363-01b04ba54b29",
          "code": "D014527",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014527",
          "code_system": "MESH",
          "references": [
            "ff5d5394-6b2d-4892-a4d3-dbead185b4de"
          ]
        },
        {
          "uuid": "7ac9be6d-5fe0-b70f-e2a4-3d2c13843d77",
          "code": "DTXSID3042508",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3042508",
          "code_system": "EPA CompTox",
          "references": [
            "5bec7d03-f25a-3731-3a5b-faa97373b6bf"
          ]
        },
        {
          "uuid": "10ed026c-03c5-8710-1e92-f253ccb37720",
          "code": "C1916",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Nitrogen Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1916",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5a46cbac-f909-6058-456a-bd4ac2a1fb28"
          ]
        },
        {
          "uuid": "06e9da2a-7d9b-9217-fea6-fc715e0985e8",
          "code": "DB08844",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08844",
          "code_system": "DRUG BANK",
          "references": [
            "5a46cbac-f909-6058-456a-bd4ac2a1fb28"
          ]
        },
        {
          "uuid": "a2f1251a-72e4-4106-ae16-d7bc6bd221d1",
          "code": "268B43MJ25",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "528954a4-3767-50a4-6ba6-e1efde0b2405",
          "code": "3056 (Number of products:1)",
          "comments": "Dietary Supplement Label Database|chemical|Uric Acid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3056&item=Uric Acid",
          "code_system": "DSLD",
          "references": [
            "5a46cbac-f909-6058-456a-bd4ac2a1fb28"
          ]
        },
        {
          "uuid": "7c759df7-a8dc-e7b7-f303-ce03eb50b21f",
          "code": "17775",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17775",
          "code_system": "CHEBI",
          "references": [
            "5a46cbac-f909-6058-456a-bd4ac2a1fb28"
          ]
        },
        {
          "uuid": "f3c6b066-c607-e25a-8421-03b7f5e25b4f",
          "code": "268B43MJ25",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=268B43MJ25",
          "code_system": "DAILYMED",
          "references": [
            "5f0286a6-21a1-1024-af5f-190877cd0fd2"
          ]
        },
        {
          "uuid": "67cfd2a0-3ddf-54c7-1789-36499c983a88",
          "code": "100000126333",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "83a9cb10-aa75-ef28-dc7c-7699209e9500"
          ]
        },
        {
          "uuid": "af1d15d3-fcf5-4853-6c26-402a6c4cb9d9",
          "code": "3975",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3975",
          "code_system": "NSC",
          "references": [
            "250145d9-3a04-e355-f155-f171b28dea3b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "acb4dcfd-2761-4897-9995-b43268f7f6a0",
          "amount": {
            "uuid": "eea1c99d-d2d6-4fda-bb79-dc51f8f81c34"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7e2f446a-371e-4c97-a946-5b5da956d122",
            "refuuid": "671e85b9-87bd-43c4-a264-78f4b9a71584",
            "name": "URIC ACID",
            "unii": "268B43MJ25",
            "linking_id": "268B43MJ25",
            "ref_pname": "URIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a4e96901-e286-43af-abcb-734c5ca5de19",
          "amount": {
            "uuid": "3197854d-6bf8-4d83-9d1b-230deeff6da0"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "8713c0d2-2034-4b02-b434-273af7c81291",
            "refuuid": "9d030cf8-3338-4e53-a8b3-2c47d2d8b953",
            "name": "SODIUM URATE",
            "unii": "WA4Q622EWK",
            "linking_id": "WA4Q622EWK",
            "ref_pname": "SODIUM URATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "28d6ef85-fd87-445e-951e-e8888c898fb1",
          "amount": {
            "uuid": "aeb332fd-6faf-4d01-b158-3b441baa7544"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "991a052e-fa5f-482b-bd38-96bc2ce69f12",
            "refuuid": "e14cbce1-ae43-496f-8da2-aaf1e0454653",
            "name": "LITHIUM URATE",
            "unii": "2070T42AXF",
            "linking_id": "2070T42AXF",
            "ref_pname": "LITHIUM URATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "05b7783e-972e-4945-84a5-898efa985b99",
          "amount": {
            "uuid": "06a055e9-ed5e-4664-a6e4-f01a8ac062cf"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b2c5e01b-f416-438e-ae9b-97e140a8a256",
            "refuuid": "a4b4e7ae-cb98-4935-97c1-c5d64fbd8968",
            "name": "DISODIUM URATE",
            "unii": "1TX0E9ZJ0W",
            "linking_id": "1TX0E9ZJ0W",
            "ref_pname": "DISODIUM URATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "766fb5df-ac3a-411f-b457-2f448fbed7e0",
          "amount": {
            "uuid": "fb3063ba-24bb-4618-98bb-1bd4ca2453c1"
          },
          "type": "METABOLITE->PARENT",
          "mediator_substance": {
            "uuid": "54912bf4-a28a-41c9-a4df-55ff2d445522",
            "refuuid": "a330d756-778f-4186-9315-54abfe486428",
            "name": "PEGADRICASE",
            "unii": "50XB37EKN8",
            "linking_id": "50XB37EKN8",
            "ref_pname": "PEGADRICASE",
            "substance_class": "reference"
          },
          "references": [
            "52faec25-59bd-41c3-8067-7cc490bf3dd7"
          ],
          "related_substance": {
            "uuid": "a0f1fbe4-e7ea-479b-842a-e43159edd154",
            "refuuid": "d108ef9f-3e3b-4676-a367-2b1283068899",
            "name": "Allantoin",
            "unii": "344S277G0Z",
            "linking_id": "344S277G0Z",
            "ref_pname": "Allantoin",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6286ba4f-de99-4c75-9153-6fbf4c933784",
          "amount": {
            "uuid": "2be5989b-9db9-4df7-8d5e-e04aa69c7ec3"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "b8b0154f-f35c-4014-9e1c-7ea8b5235191"
          ],
          "related_substance": {
            "uuid": "82cad6ac-2929-4f67-85b4-ff6d87939a22",
            "refuuid": "a2002599-0fc8-4e34-af18-c318477785cf",
            "name": "NELARABINE",
            "unii": "60158CV180",
            "linking_id": "60158CV180",
            "ref_pname": "NELARABINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0fbf30d5-0d68-4934-8422-a7f1e7143ccd",
          "amount": {
            "uuid": "6e65a246-86e6-4b61-baa7-df8ae1f44ffe"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "fd84c8fc-0399-6a29-c3e1-7059b5324b44"
          ],
          "related_substance": {
            "uuid": "c6c2a3ac-acb5-419c-9968-a3f4f152c2ea",
            "refuuid": "904349cc-363e-4d10-bd49-2a51d0e09d96",
            "name": "IDELALISIB",
            "unii": "YG57I8T5M0",
            "linking_id": "YG57I8T5M0",
            "ref_pname": "IDELALISIB",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0403582a-7845-4726-bb6f-2a0f11abca32",
          "amount": {
            "uuid": "0ede68b0-1ddb-4c0d-a3a1-47dd4e9d655e"
          },
          "type": "PARENT->METABOLITE",
          "mediator_substance": {
            "uuid": "427e86e2-1321-465d-b3d2-5dbba9b76fba",
            "refuuid": "117e08c3-651b-4717-8a10-8c0a0689b11a",
            "name": "XANTHINE DEHYDROGENASE/OXIDASE",
            "unii": "ATA6VBL43H",
            "linking_id": "ATA6VBL43H",
            "ref_pname": "XANTHINE DEHYDROGENASE/OXIDASE",
            "substance_class": "reference"
          },
          "references": [
            "c7e9b1d9-c9db-469b-8dee-bbd15fe7ac11"
          ],
          "related_substance": {
            "uuid": "ae0c84d3-e597-49fc-ad81-e475272ce115",
            "refuuid": "d6f6c4f0-f360-4bd4-a785-12b73597a12d",
            "name": "XANTHINE",
            "unii": "1AVZ07U9S7",
            "linking_id": "1AVZ07U9S7",
            "ref_pname": "XANTHINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a360ea8e-9e4e-4d19-82ad-3b5be1f28189",
          "amount": {
            "uuid": "e59d5a24-82ea-4e3e-98d8-ed026ebaae03"
          },
          "type": "ENZYME->SUBSTRATE",
          "references": [
            "ddde0698-a441-4659-bbe3-95f37a0b2950"
          ],
          "related_substance": {
            "uuid": "02999e23-a8b8-4ff8-a063-deaca96f6c50",
            "refuuid": "3e6cbab4-9235-4c9d-af23-1707c19015d9",
            "name": "PEGLOTICASE",
            "unii": "R581OT55EA",
            "linking_id": "R581OT55EA",
            "ref_pname": "PEGLOTICASE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9c68ec7b-8b62-4b4b-b593-3f7bdfef4c83",
          "amount": {
            "uuid": "0b0f1333-53fc-4fd7-ad6b-32abdce73399"
          },
          "type": "INHIBITOR OF FORMATION->TARGET",
          "references": [
            "5972fb49-9e2e-4890-bd0e-c1ec898742aa"
          ],
          "related_substance": {
            "uuid": "75254250-f9a7-408e-9f8a-8614ffdce7d3",
            "refuuid": "a6d8d0d3-1a41-4e92-8006-710101e3165d",
            "name": "OXYPURINOL",
            "unii": "G97OZE5068",
            "linking_id": "G97OZE5068",
            "ref_pname": "OXYPURINOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1badff33-6865-4076-9880-84745c5c8163",
          "amount": {
            "uuid": "e579cb5a-8820-4b30-b279-f15054b41bdb"
          },
          "type": "INHIBITOR OF FORMATION->TARGET",
          "references": [
            "5972fb49-9e2e-4890-bd0e-c1ec898742aa"
          ],
          "related_substance": {
            "uuid": "8cab7438-1bbb-493c-a103-c3f42d3802a6",
            "refuuid": "fb91e4cf-1658-4e1f-ac40-af393234b5d0",
            "name": "ALLOPURINOL",
            "unii": "63CZ7GJN5I",
            "linking_id": "63CZ7GJN5I",
            "ref_pname": "ALLOPURINOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "894f0c19-59b8-4927-a18a-ac2d3dc5314a",
          "amount": {
            "uuid": "299ebbb2-dce1-4ea0-baa4-124dd6c87062"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a61d0264-d668-48ef-bbee-3b3f2117a37e",
            "refuuid": "a17b2e2a-0edf-4896-81d3-946b691fd1c1",
            "name": "Uric acid ammonium salt",
            "unii": "524UGG86Q5",
            "linking_id": "524UGG86Q5",
            "ref_pname": "Uric acid ammonium salt",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "88a87bc3-f79a-4a3a-bc64-6fe1fed583c6",
          "name": "2,6,8-TRIOXYPURINE",
          "stdName": "2,6,8-TRIOXYPURINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b960df08-47fb-4c5b-ba01-46cd1d1d1d6e",
            "e1f655ad-511e-457d-91bb-a7ac89da886b"
          ],
          "display_name": false
        },
        {
          "uuid": "5fb19b80-1daa-40e1-98a6-d614c304cb8a",
          "name": "7,9-DIHYDRO-1H-PURINE-2,6,8(3H)-TRIONE",
          "stdName": "7,9-DIHYDRO-1H-PURINE-2,6,8(3H)-TRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db5cab7c-d1f3-43a9-a928-13078da86aa1",
            "e1f655ad-511e-457d-91bb-a7ac89da886b"
          ],
          "display_name": false
        },
        {
          "uuid": "6c903ef0-83b1-4cfd-a78c-890695253318",
          "name": "8-HYDROXYXANTHINE",
          "stdName": "8-HYDROXYXANTHINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db5cab7c-d1f3-43a9-a928-13078da86aa1",
            "1881cac4-ae40-4b62-baab-a5a49822492b"
          ],
          "display_name": false
        },
        {
          "uuid": "17a3a975-1861-05f4-98be-6ab6990be22b",
          "name": "IDELALISIB METABOLITE M54",
          "stdName": "IDELALISIB METABOLITE M54",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd84c8fc-0399-6a29-c3e1-7059b5324b44"
          ],
          "display_name": false
        },
        {
          "uuid": "3a8d9ee1-2dc9-4268-a6f6-6a36efd0c4c1",
          "name": "LITHIC ACID",
          "stdName": "LITHIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b960df08-47fb-4c5b-ba01-46cd1d1d1d6e",
            "e1f655ad-511e-457d-91bb-a7ac89da886b"
          ],
          "display_name": false
        },
        {
          "uuid": "5b07cbcb-f10e-4cec-8274-175b8948c85e",
          "name": "NSC-3975",
          "stdName": "NSC-3975",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b960df08-47fb-4c5b-ba01-46cd1d1d1d6e",
            "e1f655ad-511e-457d-91bb-a7ac89da886b"
          ],
          "display_name": false
        },
        {
          "uuid": "2aba1b5e-30d1-442b-b558-40c2374581c7",
          "name": "PURINE-2,6,8(1H,3H,9H)-TRIONE",
          "stdName": "PURINE-2,6,8(1H,3H,9H)-TRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db5cab7c-d1f3-43a9-a928-13078da86aa1",
            "e1f655ad-511e-457d-91bb-a7ac89da886b"
          ],
          "display_name": false
        },
        {
          "uuid": "7fff28b6-7712-410c-a693-a113f0e720f0",
          "name": "URIC ACID",
          "stdName": "URIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7961c7af-17d7-42d0-b38b-40ad1abfe3a7",
            "4b172d3b-89c0-4b88-aea2-0e52457be9d4",
            "f8516890-ee68-41fa-b69b-ca251d717127",
            "28984f5e-d8b4-484a-a0bd-8ed92952180f",
            "e1f655ad-511e-457d-91bb-a7ac89da886b",
            "1de7c402-6d23-47b5-a751-14b63d5b4649"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3161e0cd-69a3-4b5e-b61b-fd8e8d734898",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "0c35510b-31f1-49dc-a490-394e85689c3e",
          "name": "URIC ACID [MI]",
          "stdName": "URIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8516890-ee68-41fa-b69b-ca251d717127",
            "e1f655ad-511e-457d-91bb-a7ac89da886b"
          ],
          "display_name": false
        },
        {
          "uuid": "3f2bdc3b-7646-4bf9-b64c-6f6b8d7db622",
          "name": "URICUM ACIDUM",
          "stdName": "URICUM ACIDUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82ca0ba3-437e-43ae-b9e6-ccbc1c862236",
            "b3a08c9c-50c7-40d8-9486-fc10f79508b2",
            "32e4dfae-4a55-47d7-a1e8-67bfe387abdf",
            "e1f655ad-511e-457d-91bb-a7ac89da886b"
          ],
          "display_name": false
        },
        {
          "uuid": "b5f2bc8a-52bd-4ba2-9efa-325be6e8fc0f",
          "name": "URICUM ACIDUM [HPUS]",
          "stdName": "URICUM ACIDUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3a08c9c-50c7-40d8-9486-fc10f79508b2",
            "32e4dfae-4a55-47d7-a1e8-67bfe387abdf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a8e3ac5f-4c78-45a1-9018-4fdbddffe0c8",
          "citation": "J Biol Chem. 1954 Dec;211(2):559-64",
          "url": "https://www.ncbi.nlm.nih.gov/pubmed/13221564",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "28984f5e-d8b4-484a-a0bd-8ed92952180f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e1f655ad-511e-457d-91bb-a7ac89da886b",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db5cab7c-d1f3-43a9-a928-13078da86aa1",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1881cac4-ae40-4b62-baab-a5a49822492b",
          "citation": "DL",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3a08c9c-50c7-40d8-9486-fc10f79508b2",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32e4dfae-4a55-47d7-a1e8-67bfe387abdf",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8516890-ee68-41fa-b69b-ca251d717127",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7961c7af-17d7-42d0-b38b-40ad1abfe3a7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b960df08-47fb-4c5b-ba01-46cd1d1d1d6e",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff5d5394-6b2d-4892-a4d3-dbead185b4de",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52faec25-59bd-41c3-8067-7cc490bf3dd7",
          "citation": "INTERNATIONAL JOURNAL OF CARDIOLOGY\\\\nVOLUME 213, 15 JUNE 2016, PAGES 23?27",
          "url": "http://www.sciencedirect.com/science/article/pii/S016752731530317X",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef7431ba-4d79-4320-971e-e3396bdae3ba",
          "citation": "SRS import [268B43MJ25]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=268B43MJ25",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389695000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82ca0ba3-437e-43ae-b9e6-ccbc1c862236",
          "citation": "URICUM ACIDUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b172d3b-89c0-4b88-aea2-0e52457be9d4",
          "citation": "URIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1de7c402-6d23-47b5-a751-14b63d5b4649",
          "citation": "URIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5bec7d03-f25a-3731-3a5b-faa97373b6bf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=69-93-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "83a9cb10-aa75-ef28-dc7c-7699209e9500",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5a46cbac-f909-6058-456a-bd4ac2a1fb28",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fd84c8fc-0399-6a29-c3e1-7059b5324b44",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2014/205858Orig1s000ClinPharmR.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a90b68e7-3d2c-4f3d-556b-c1c1e43e5098",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9f4effc4-8cb7-42a7-9855-2b0ed58b99f7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c7e9b1d9-c9db-469b-8dee-bbd15fe7ac11",
          "citation": "https://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=72c1078a-55aa-4f81-9c3c-bb086575138e",
          "url": "https://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=72c1078a-55aa-4f81-9c3c-bb086575138e",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "250145d9-3a04-e355-f155-f171b28dea3b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5f0286a6-21a1-1024-af5f-190877cd0fd2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ddde0698-a441-4659-bbe3-95f37a0b2950",
          "citation": "INN Proposed List 98",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL98.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8b0154f-f35c-4014-9e1c-7ea8b5235191",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/2005/021877_s000_Arranon_BioPharmr.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5972fb49-9e2e-4890-bd0e-c1ec898742aa",
          "citation": "Elion, Gertrude B; Yü, Ts'ai-Fan; Gutman, Alexander B; Hitchings, George H (1968). \"Renal clearance of oxipurinol, the chief metabolite of allopurinol\". The American Journal of Medicine. 45 (1): 69–77. doi:10.1016/0002-9343(68)90008-9. PMID 5658870",
          "url": "https://www.sciencedirect.com/science/article/pii/0002934368900089?via%3Dihub",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1e26f42f-f243-44ad-a5dd-d0df3e7d4c78",
          "id": "1e26f42f-f243-44ad-a5dd-d0df3e7d4c78",
          "molfile": "\n  Marvin  01132101442D          \n\n 12 13  0  0  0  0            999 V2000\n    4.2361   -1.6552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4086   -1.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9275   -2.3146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -2.4827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -1.2413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9275   -0.9879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2 12  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n 11  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "c12c([nH]c(=O)[nH]1)[nH]c(=O)[nH]c2=O",
          "formula": "C5H4N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8f49eee7-9df4-478c-addf-9908d321e61e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "168.1105",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "671e85b9-87bd-43c4-a264-78f4b9a71584",
      "version": "20",
      "structure": {
        "id": "ae64f34c-51a1-41ba-b3ae-115ccb3acade",
        "molfile": "\n  Marvin  01132109032D          \n\n 12 13  0  0  0  0            999 V2000\n    2.1362   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -2.4827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9275   -2.3146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -1.2413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7086   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4086   -1.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9275   -0.9879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2361   -1.6552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  7  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11  7  2  0  0  0  0\n 12  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  5  6  1  0  0  0  0\nM  END",
        "smiles": "c12c([nH]c(=O)[nH]1)[nH]c(=O)[nH]c2=O",
        "formula": "C5H4N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "168.1105",
        "optical_activity": "NONE",
        "references": [
          "db5cab7c-d1f3-43a9-a928-13078da86aa1",
          "ef7431ba-4d79-4320-971e-e3396bdae3ba"
        ],
        "stereo_centers": 0
      },
      "unii": "268B43MJ25"
    }
  ]
}