{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "133649bf-6422-4c48-bea8-592dcbe24785",
          "code": "61477-95-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61477-95-0",
          "code_system": "CAS",
          "references": [
            "a6db1e38-1f4a-4d4e-b9dd-3b900d1b7c8c",
            "fa9d97b6-3bf9-4baa-861b-e7f897c598a6"
          ]
        },
        {
          "uuid": "96c47094-f486-4ee6-89f8-10ed926a6b97",
          "code": "C66182",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66182",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a6db1e38-1f4a-4d4e-b9dd-3b900d1b7c8c"
          ]
        },
        {
          "uuid": "928de73a-4b5e-48bb-8a3a-4490edd50463",
          "code": "SUB09046MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a6db1e38-1f4a-4d4e-b9dd-3b900d1b7c8c"
          ]
        },
        {
          "uuid": "d245e184-08e0-43db-b853-9b65b6408a6b",
          "code": "4304",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4304",
          "code_system": "INN",
          "references": [
            "a6db1e38-1f4a-4d4e-b9dd-3b900d1b7c8c"
          ]
        },
        {
          "uuid": "b1bcca81-fce9-4587-b801-fc454ef0b2ab",
          "code": "262-810-2",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a6db1e38-1f4a-4d4e-b9dd-3b900d1b7c8c"
          ]
        },
        {
          "uuid": "c5a16a86-3471-4a7e-8659-3dc1a436b730",
          "code": "CHEMBL2110958",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2110958",
          "code_system": "ChEMBL",
          "references": [
            "a6db1e38-1f4a-4d4e-b9dd-3b900d1b7c8c"
          ]
        },
        {
          "uuid": "c23e2177-e88b-94dd-4cbe-60cde1599e03",
          "code": "DTXSID60210441",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60210441",
          "code_system": "EPA CompTox",
          "references": [
            "9c3d4fd7-8747-8ae4-4224-b77619859018"
          ]
        },
        {
          "uuid": "54577664-817d-3080-802f-6f1550200681",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5b05f76b-4129-f909-b5f7-17cd1f766c94"
          ]
        },
        {
          "uuid": "7cfdaddd-72d5-80f8-40ae-9993ff5cb7ec",
          "code": "68808",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68808",
          "code_system": "PUBCHEM",
          "references": [
            "7fe70d3e-b9f7-aaa9-8765-cc5df94d22c3"
          ]
        },
        {
          "uuid": "3f72e481-034f-416b-9755-05cf1cf4facd",
          "code": "267GPF992J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b00ea3f9-5567-e80e-dbe0-00229629cdaa",
          "code": "100000080378",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4008dd69-c9df-b0b9-8d09-c536df85e2d1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2ca2d28a-f1aa-484f-858f-bf3b1aa4f8d8",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a2b4a9d3-1eef-4126-afe2-218cd5147f9d",
            "refuuid": "89f89750-cd6b-421a-a5a7-440044407360",
            "name": "MONALAZONE",
            "unii": "2UP9F49N8H",
            "linking_id": "2UP9F49N8H",
            "ref_pname": "MONALAZONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dcd99f82-555e-4157-ad55-2a8740a62004",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "f85ab309-2ea1-4102-b12c-1de488c58296",
            "refuuid": "89f89750-cd6b-421a-a5a7-440044407360",
            "name": "MONALAZONE",
            "unii": "2UP9F49N8H",
            "linking_id": "2UP9F49N8H",
            "ref_pname": "MONALAZONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28a1eecb-5b4b-4237-b4aa-b0ab687925f0",
          "name": "MONALAZONE DISODIUM",
          "stdName": "MONALAZONE DISODIUM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c022456-dada-4905-9ca4-6c92df4a60a9",
            "f74e6c29-df42-4050-b976-94f56cb35ef8",
            "21d7bf09-c49a-4cc5-ba49-3297e4f33b2f",
            "9c085a2d-d1b4-404c-b272-d2d4085dd9c3",
            "af6c9921-7561-4af4-a689-b534790ee549",
            "7b869ee9-ecca-4544-8c62-077577eaffa5",
            "0204ba68-426f-48e5-a9db-fa0445b0c2ac",
            "ad990fc0-d942-40c6-ba9b-8dbb6c6e1225"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "db23db28-73ec-4568-acc1-22cbb18dfaea",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "bad6e685-680f-4e2f-a17d-bea9e37b777a",
          "name": "MONALAZONE DISODIUM [MART.]",
          "stdName": "MONALAZONE DISODIUM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0204ba68-426f-48e5-a9db-fa0445b0c2ac"
          ],
          "display_name": false
        },
        {
          "uuid": "df5e2d73-88bb-9bfa-baaa-5d4fa1e73fcc",
          "name": "Monalazone disodium [WHO-DD]",
          "stdName": "MONALAZONE DISODIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557aa77c-c3cf-ad79-4e9e-622316f1c696"
          ],
          "display_name": false
        },
        {
          "uuid": "28d22fb0-7ae3-47b9-b8a0-93a87da9a64c",
          "name": "P-(CHLOROSULFAMOYL)BENZOIC ACID DISODIUM SALT",
          "stdName": "P-(CHLOROSULFAMOYL)BENZOIC ACID DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b869ee9-ecca-4544-8c62-077577eaffa5"
          ],
          "display_name": false
        },
        {
          "uuid": "4e0cc056-d0d8-4fd3-8041-8178f94ed6e1",
          "name": "monalazone disodium [INN]",
          "stdName": "MONALAZONE DISODIUM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad990fc0-d942-40c6-ba9b-8dbb6c6e1225"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7b869ee9-ecca-4544-8c62-077577eaffa5",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ad990fc0-d942-40c6-ba9b-8dbb6c6e1225",
          "citation": "INN Proposed List 38",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL38.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0204ba68-426f-48e5-a9db-fa0445b0c2ac",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21d7bf09-c49a-4cc5-ba49-3297e4f33b2f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f74e6c29-df42-4050-b976-94f56cb35ef8",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6db1e38-1f4a-4d4e-b9dd-3b900d1b7c8c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390690000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81d43f7d-defe-4f27-92b0-0b0fa1e8869f",
          "citation": "SRS import [267GPF992J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=267GPF992J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390690000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c085a2d-d1b4-404c-b272-d2d4085dd9c3",
          "citation": "MONALAZONE DISODIUM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5c022456-dada-4905-9ca4-6c92df4a60a9",
          "citation": "MONALAZONE DISODIUM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "af6c9921-7561-4af4-a689-b534790ee549",
          "citation": "MONALAZONE DISODIUM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c3d4fd7-8747-8ae4-4224-b77619859018",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61477-95-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4008dd69-c9df-b0b9-8d09-c536df85e2d1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5b05f76b-4129-f909-b5f7-17cd1f766c94",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7fe70d3e-b9f7-aaa9-8765-cc5df94d22c3",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "fa9d97b6-3bf9-4baa-861b-e7f897c598a6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "557aa77c-c3cf-ad79-4e9e-622316f1c696",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "309d92d8-4457-47e8-9d31-257b3f8b2f98",
          "id": "309d92d8-4457-47e8-9d31-257b3f8b2f98",
          "molfile": "\n  Marvin  01132102362D          \n\n  1  0  0  0  0  0            999 V2000\n   10.1680   -2.4858    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "47abef91-3f2e-4429-afa3-7fac07283edb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b8a5bd6d-c107-4249-8118-7599ed5629a8",
          "id": "b8a5bd6d-c107-4249-8118-7599ed5629a8",
          "molfile": "\n  Marvin  01132109332D          \n\n 14 14  0  0  0  0            999 V2000\n    7.5365   -4.0764    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.5406   -3.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2526   -2.8355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8323   -2.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1164   -3.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4020   -2.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4032   -2.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1146   -1.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8294   -2.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6843   -1.5989    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2678   -0.8828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0923   -0.8828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6683   -2.1569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0271   -1.6198    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7 10  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  2  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1cc(ccc1C(=O)[O-])S(=O)(=O)NCl",
          "formula": "C7H5ClNO4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2dde5d9d-39e1-44bf-9f55-5c52a849ebba"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "234.6382",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e4f678ad-ae7b-4928-bf6d-9d3fe2fe7cae",
      "version": "10",
      "structure": {
        "id": "f069a1ba-5ee6-4b85-942a-53c478a4ba16",
        "molfile": "\n  Marvin  01132112282D          \n\n 16 14  0  0  0  0            999 V2000\n    5.4032   -2.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4020   -2.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1164   -3.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8323   -2.8416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8294   -2.0116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1146   -1.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5406   -3.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5365   -4.0764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2526   -2.8355    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.6843   -1.5989    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6683   -2.1569    0.0000 N   0  5  0  0  0  0  0  0  0  0  0  0\n    3.0271   -1.6198    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.2678   -0.8828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0923   -0.8828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1680   -2.4858    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   10.1680   -2.4858    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  4  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  3  4  2  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  4  5  1  0  0  0  0\n 11 12  1  0  0  0  0\n  1  2  2  0  0  0  0\n 10 13  2  0  0  0  0\n  5  6  2  0  0  0  0\n 10 14  2  0  0  0  0\n  6  1  1  0  0  0  0\nM  CHG  4   9  -1  11  -1  15   1  16   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  15  16\nM  SPA   1  1  15\nM  SDI   1  4    9.7480   -2.9058    9.7480   -2.0658\nM  SDI   1  4   10.5880   -2.0658   10.5880   -2.9058\nM  SMT   1 2\nM  END",
        "smiles": "c1cc(ccc1C(=O)[O-])S(=O)(=O)[N-]Cl.[Na+].[Na+]",
        "formula": "C7H4ClNO4S.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "279.6098",
        "optical_activity": "NONE",
        "references": [
          "81d43f7d-defe-4f27-92b0-0b0fa1e8869f",
          "7b869ee9-ecca-4544-8c62-077577eaffa5",
          "ad990fc0-d942-40c6-ba9b-8dbb6c6e1225"
        ],
        "stereo_centers": 0
      },
      "unii": "267GPF992J"
    }
  ]
}