{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2bbdd30d-2b1c-454d-a431-851f205e8d64",
          "code": "68391-32-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68391-32-2",
          "code_system": "CAS",
          "references": [
            "1c9d8c67-45a2-470c-8e20-67be6b997e6b",
            "a51b6b8b-6597-4231-8fba-b130ddff1e92"
          ]
        },
        {
          "uuid": "40f19e42-5d1e-4a88-b001-f7298a872de5",
          "code": "176742-32-8",
          "type": "NON-SPECIFIC SUBSTITUTION",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=176742-32-8",
          "code_system": "CAS",
          "references": [
            "1c9d8c67-45a2-470c-8e20-67be6b997e6b",
            "7c24736b-2445-4279-aece-f66f67990dfa"
          ]
        },
        {
          "uuid": "d42fd5ab-b173-45f7-8037-a868e3520869",
          "code": "269-944-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.566",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1c9d8c67-45a2-470c-8e20-67be6b997e6b"
          ]
        },
        {
          "uuid": "c6b51a69-ca13-5748-96cb-30898adfa08e",
          "code": "135515517",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135515517",
          "code_system": "PUBCHEM",
          "references": [
            "38f5c0df-25b6-4cc9-9c88-1029de27fb85"
          ]
        },
        {
          "uuid": "82e21eb8-0033-48fe-884a-2823723152c3",
          "code": "25Q279FD5C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "26d5be43-de5f-98d6-a7cc-ac33c8aee31d",
          "code": "DTXSID90887342",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90887342",
          "code_system": "EPA CompTox",
          "references": [
            "09f8ecc3-437a-ed73-a49c-75647eed6173"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6fbf5ac4-1363-44df-9b81-49abbbb5c510",
          "name": "2-NAPHTHALENAMINIUM, 8-(2-(4-AMINO-3-NITROPHENYL)DIAZENYL)-7-HYDROXY-N,N,N-TRIMETHYL-, CHLORIDE (1:1)",
          "stdName": "2-NAPHTHALENAMINIUM, 8-(2-(4-AMINO-3-NITROPHENYL)DIAZENYL)-7-HYDROXY-N,N,N-TRIMETHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4333603-4e20-4e66-bda8-e34466edee64",
            "a98cc164-885a-4b1f-969b-2de1321341aa"
          ],
          "display_name": false
        },
        {
          "uuid": "84bfeea2-9c9d-4943-a558-4e06b0d3350d",
          "name": "ARIANOR SIENNA BROWN 306001",
          "stdName": "ARIANOR SIENNA BROWN 306001",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4333603-4e20-4e66-bda8-e34466edee64",
            "524824fa-d4b4-45e0-ae66-7e2cb593b82f"
          ],
          "display_name": false
        },
        {
          "uuid": "1b50376d-16c6-4e14-a7f7-0bb63acec55a",
          "name": "BASIC BROWN 17",
          "stdName": "BASIC BROWN 17",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4333603-4e20-4e66-bda8-e34466edee64",
            "ee31e53f-4142-4801-958c-f9674d9c9caf",
            "524824fa-d4b4-45e0-ae66-7e2cb593b82f",
            "da456095-5a15-400f-990a-85d4bd6f4883"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6e0db046-db12-4874-a807-538ed8ce3518",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "56e163f2-658a-42d6-a3cd-10a7dad3f921",
          "name": "C.I. BASIC BROWN 17",
          "stdName": "C.I. BASIC BROWN 17",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4333603-4e20-4e66-bda8-e34466edee64",
            "a98cc164-885a-4b1f-969b-2de1321341aa"
          ],
          "display_name": false
        },
        {
          "uuid": "21a5cc16-65d3-419e-8a33-c4cbc737a88d",
          "name": "CI 12251",
          "stdName": "CI 12251",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4333603-4e20-4e66-bda8-e34466edee64",
            "524824fa-d4b4-45e0-ae66-7e2cb593b82f"
          ],
          "display_name": false
        },
        {
          "uuid": "5a21aacb-1c31-4254-a64b-8092d02be053",
          "name": "JAROCOL SIENNA BROWN",
          "stdName": "JAROCOL SIENNA BROWN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4333603-4e20-4e66-bda8-e34466edee64",
            "524824fa-d4b4-45e0-ae66-7e2cb593b82f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "524824fa-d4b4-45e0-ae66-7e2cb593b82f",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d4333603-4e20-4e66-bda8-e34466edee64",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a98cc164-885a-4b1f-969b-2de1321341aa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee31e53f-4142-4801-958c-f9674d9c9caf",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c9d8c67-45a2-470c-8e20-67be6b997e6b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392157000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a17e10a-5a3d-4d56-8f32-502866975d5b",
          "citation": "SRS import [25Q279FD5C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=25Q279FD5C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392157000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da456095-5a15-400f-990a-85d4bd6f4883",
          "citation": "BASIC BROWN 17 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38f5c0df-25b6-4cc9-9c88-1029de27fb85",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a51b6b8b-6597-4231-8fba-b130ddff1e92",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7c24736b-2445-4279-aece-f66f67990dfa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "09f8ecc3-437a-ed73-a49c-75647eed6173",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "986629e9-e294-4f3d-9282-5426b498057e",
          "id": "986629e9-e294-4f3d-9282-5426b498057e",
          "molfile": "\n  Marvin  01132107552D          \n\n  1  0  0  0  0  0            999 V2000\n    1.1580   -7.5687    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0482814e-3ecd-420c-9f99-6cc7360b4c01"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "db70c773-3c5e-4c36-9ca1-e32bf68d5ff2",
          "id": "db70c773-3c5e-4c36-9ca1-e32bf68d5ff2",
          "molfile": "\n  Marvin  01132111232D          \n\n 27 29  0  0  0  0            999 V2000\n    4.2687   -3.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2687   -4.5488    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    4.9878   -4.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8591   -5.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5573   -4.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5573   -5.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8458   -6.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1343   -5.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -6.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7039   -5.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7114   -4.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.5412    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4305   -4.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4381   -3.7313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1571   -3.3151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1571   -2.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8761   -2.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8761   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1571   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1495    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4381   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4381   -2.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7266   -0.8250    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.7266    0.0000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.0076   -1.2413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1419   -4.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8534   -4.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 27  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 26  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 26  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 22 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 26 27  1  0  0  0  0\nM  CHG  4   2   1  12  -1  23   1  24  -1\nM  END",
          "smiles": "C[N+](C)(C)c1ccc2ccc(c(c2c1)/N=N/c3ccc(c(c3)[N+](=O)[O-])N)[O-]",
          "formula": "C19H19N5O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5294945e-824e-4b44-8cfc-b56063837857"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "365.3866",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f022fba0-ba4b-460f-9bb8-b2d5eae6ead0",
      "version": "7",
      "structure": {
        "id": "ca1acf23-2714-45ae-8db9-bc5359908b0c",
        "molfile": "\n  Marvin  01132110262D          \n\n 28 29  0  0  0  0            999 V2000\n    1.4381   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4381   -2.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1571   -2.4901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8761   -2.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8761   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1571   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1495    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7266   -0.8250    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.7266    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0076   -1.2413    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1571   -3.3151    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4381   -3.7313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4305   -4.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7114   -4.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7039   -5.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4229   -6.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1419   -4.9650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1343   -5.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8458   -6.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5573   -5.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5573   -4.9726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8534   -4.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.5412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2687   -4.5488    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.2687   -3.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9878   -4.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8591   -5.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1580   -7.5687    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  6  2  0  0  0  0\n  1  8  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3 11  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 17  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 23  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 18  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\nM  CHG  4   8   1  10  -1  24   1  28  -1\nM  END",
        "smiles": "C[N+](C)(C)c1ccc2ccc(c(c2c1)/N=N/c3ccc(c(c3)[N+](=O)[O-])N)O.[Cl-]",
        "formula": "C19H20N5O3.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "401.8475",
        "optical_activity": "NONE",
        "references": [
          "5a17e10a-5a3d-4d56-8f32-502866975d5b",
          "ee31e53f-4142-4801-958c-f9674d9c9caf"
        ],
        "stereo_centers": 0
      },
      "unii": "25Q279FD5C"
    }
  ]
}