{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "74a41b75-5756-4fac-9de4-824c6cb448b9",
          "code": "5001-51-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5001-51-4",
          "code_system": "CAS",
          "references": [
            "30f403d9-416c-42c9-9126-0f33a2f4cfe6",
            "1b89a847-2ee4-4ca5-85c9-011df7ea75da"
          ]
        },
        {
          "uuid": "8bf0e782-c3a8-45da-ab84-7ad28197aae0",
          "code": "225-668-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.335",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "30f403d9-416c-42c9-9126-0f33a2f4cfe6"
          ]
        },
        {
          "uuid": "d87a402b-b5da-5707-31bf-d4d08a93faa6",
          "code": "11170166",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11170166",
          "code_system": "PUBCHEM",
          "references": [
            "8922ad56-da54-3db5-8575-bf2218b94a62"
          ]
        },
        {
          "uuid": "60cba1a6-6402-4d38-913d-91ab2d5b02cc",
          "code": "258F856K63",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9f4636a5-f678-3e3d-d928-d43f287a8f74",
          "code": "100000076570",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2f12060f-c768-de3e-49d2-59ce43c06969"
          ]
        },
        {
          "uuid": "82c09cbd-64cc-006f-087d-f7af0ba8a669",
          "code": "15850",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=15850",
          "code_system": "NSC",
          "references": [
            "5187741f-7bed-0e58-ea29-a8203caa1d8f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9c2325f1-cb4c-41d7-8506-5b857fa8f46f",
          "name": "CALCIUM BIS(4-O-(.BETA.-D-GALACTOSYL)-D-GLUCONATE)",
          "stdName": "CALCIUM BIS(4-O-(.BETA.-D-GALACTOSYL)-D-GLUCONATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1434c0f4-010e-4e2f-9338-81e4f13e4de3"
          ],
          "display_name": false
        },
        {
          "uuid": "eb0d69a2-7393-4481-a710-e131baa7b4a2",
          "name": "CALCIUM LACTOBIONATE ANHYDROUS",
          "stdName": "CALCIUM LACTOBIONATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7527e4b-44ac-41fe-a368-4e3f11ea93b7"
          ],
          "display_name": true
        },
        {
          "uuid": "fe23f013-0974-4051-99c6-2c26a9234886",
          "name": "D-GLUCONIC ACID, 4-O-.BETA.-D-GALACTOPYRANOSYL-, CALCIUM SALT (2:1)",
          "stdName": "D-GLUCONIC ACID, 4-O-.BETA.-D-GALACTOPYRANOSYL-, CALCIUM SALT (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027b8b10-e08d-419c-a2d7-ef099b4d3388"
          ],
          "display_name": false
        },
        {
          "uuid": "c4d952a7-a525-4d48-a094-9121edf8133f",
          "name": "LACTOBIONIC ACID CALCIUM SALT",
          "stdName": "LACTOBIONIC ACID CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027b8b10-e08d-419c-a2d7-ef099b4d3388"
          ],
          "display_name": false
        },
        {
          "uuid": "9eb9a16b-3311-4bf7-b30d-cf34ba2edf90",
          "name": "LACTOBIONIC ACID, CALCIUM SALT (2:1)",
          "stdName": "LACTOBIONIC ACID, CALCIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1434c0f4-010e-4e2f-9338-81e4f13e4de3"
          ],
          "display_name": false
        },
        {
          "uuid": "719875b6-b073-4e92-809b-7876a6341503",
          "name": "NSC-15850",
          "stdName": "NSC-15850",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "027b8b10-e08d-419c-a2d7-ef099b4d3388"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c7527e4b-44ac-41fe-a368-4e3f11ea93b7",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "027b8b10-e08d-419c-a2d7-ef099b4d3388",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1434c0f4-010e-4e2f-9338-81e4f13e4de3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30f403d9-416c-42c9-9126-0f33a2f4cfe6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392056000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e845a94-f50a-49df-984c-76f09292802a",
          "citation": "SRS import [258F856K63]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=258F856K63",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392056000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f12060f-c768-de3e-49d2-59ce43c06969",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8922ad56-da54-3db5-8575-bf2218b94a62",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "1b89a847-2ee4-4ca5-85c9-011df7ea75da",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5187741f-7bed-0e58-ea29-a8203caa1d8f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "34b80de7-81fd-4a07-b0fc-7428d737ea51",
          "id": "34b80de7-81fd-4a07-b0fc-7428d737ea51",
          "molfile": "\n  Marvin  01132102492D          \n\n  1  0  0  0  1  0            999 V2000\n    5.3430  -12.5464    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7e4ac92f-24b5-4a7a-b987-843b7ec1fea4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ad418ac0-3c4e-418d-b58a-734ad85f644d",
          "id": "ad418ac0-3c4e-418d-b58a-734ad85f644d",
          "molfile": "\n  Marvin  01132108592D          \n\n 24 24  0  0  1  0            999 V2000\n   -0.1043  -11.3200    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.1061  -10.4941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8175  -11.7329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5308  -11.3242    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.6089  -11.7288    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.6096  -12.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1082  -12.9639    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -0.8260  -12.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5436  -12.9640    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -2.2572  -12.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8909  -13.0865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5436  -13.7923    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -2.2572  -14.2087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8260  -14.2087    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -0.8259  -15.0370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1082  -13.7922    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.6096  -14.2086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3222  -11.3159    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.3204  -10.4900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0354  -11.7246    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.0372  -12.5505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7486  -11.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4619  -11.7204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7468  -10.4858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 12  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  6  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  6  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)[O-]",
          "formula": "C12H21O12",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "3ea54cec-4090-4a94-9605-0a3627e296f8"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "357.2884",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6f2b4af6-f414-43cc-be92-d14a05534700",
      "version": "5",
      "structure": {
        "id": "9cc3d91d-6b67-4cf0-9351-64fe4efbf012",
        "molfile": "\n  Marvin  01132108092D          \n\n 49 48  0  0  1  0            999 V2000\n    5.3430  -12.5464    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    0.6096  -12.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6096  -14.2086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8259  -15.0370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2572  -14.2087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8260  -12.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8909  -13.0865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1082  -12.9639    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.1082  -13.7922    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.8260  -14.2087    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.5436  -13.7923    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.5436  -12.9640    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.2572  -12.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5308  -11.3242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8175  -11.7329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1043  -11.3200    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6089  -11.7288    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.3222  -11.3159    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0354  -11.7246    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7486  -11.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4619  -11.7204    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7468  -10.4858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0372  -12.5505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3204  -10.4900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1061  -10.4941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6096  -12.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6096  -14.2086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8259  -15.0370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2572  -14.2087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8260  -12.5519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8909  -13.0865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1082  -12.9639    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.1082  -13.7922    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.8260  -14.2087    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.5436  -13.7923    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.5436  -12.9640    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.2572  -12.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5308  -11.3242    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8175  -11.7329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1043  -11.3200    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6089  -11.7288    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.3222  -11.3159    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0354  -11.7246    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7486  -11.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4619  -11.7204    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7468  -10.4858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0372  -12.5505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3204  -10.4900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1061  -10.4941    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 19 20  1  0  0  0  0\n  9 10  1  0  0  0  0\n 20 21  1  0  0  0  0\n 10 11  1  0  0  0  0\n 20 22  2  0  0  0  0\n 11 12  1  0  0  0  0\n 19 23  1  6  0  0  0\n 12 13  1  1  0  0  0\n 18 24  1  6  0  0  0\n 17  2  1  6  0  0  0\n  8  2  1  1  0  0  0\n 16 25  1  1  0  0  0\n  9  3  1  6  0  0  0\n 10  4  1  1  0  0  0\n 11  5  1  1  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  7 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 12  6  1  0  0  0  0\n 17 18  1  0  0  0  0\n  6  8  1  0  0  0  0\n 18 19  1  0  0  0  0\n  8  9  1  0  0  0  0\n 41 26  1  6  0  0  0\n 32 26  1  1  0  0  0\n 33 27  1  6  0  0  0\n 34 28  1  1  0  0  0\n 35 29  1  1  0  0  0\n 36 30  1  0  0  0  0\n 30 32  1  0  0  0  0\n 31 37  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  1  1  0  0  0\n 38 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 40 49  1  1  0  0  0\n 40 41  1  0  0  0  0\n 41 42  1  0  0  0  0\n 42 48  1  6  0  0  0\n 42 43  1  0  0  0  0\n 43 44  1  0  0  0  0\n 43 47  1  6  0  0  0\n 44 45  1  0  0  0  0\n 44 46  2  0  0  0  0\nM  CHG  3   1   2  21  -1  45  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1 15  17  18  19  20  21  22  23  24  25  26  27  28  29  30  31\nM  SAL   1 15  32  33  34  35  36  37  38  39  40  41  42  43  44  45  46\nM  SAL   1  3  47  48  49\nM  SPA   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SPA   1  9  17  18  19  20  21  22  23  24  25\nM  SDI   1  4   -3.3109  -15.4570   -3.3109  -10.0658\nM  SDI   1  4    3.8819  -10.0658    3.8819  -15.4570\nM  SMT   1 2\nM  END",
        "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O.[Ca+2]",
        "formula": "2C12H21O12.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 18,
        "ez_centers": 0,
        "molecular_weight": "754.6549",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3e845a94-f50a-49df-984c-76f09292802a",
          "027b8b10-e08d-419c-a2d7-ef099b4d3388"
        ],
        "stereo_centers": 18
      },
      "unii": "258F856K63"
    }
  ]
}