{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cd8e0d68-9349-43b3-a4c6-eef6b3b10127",
          "code": "6683-19-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6683-19-8",
          "code_system": "CAS",
          "references": [
            "2ef65606-4e8d-452c-b745-ccf63f372f7a",
            "2d61de23-57e9-4389-a854-eda73933f401"
          ]
        },
        {
          "uuid": "f0bc5862-961d-4c5c-9658-33483044fab2",
          "code": "1369405",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1369405/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2ef65606-4e8d-452c-b745-ccf63f372f7a"
          ]
        },
        {
          "uuid": "4c9f67c3-d71a-4ea7-b5e6-5d5a1724408e",
          "code": "SUB131028",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2ef65606-4e8d-452c-b745-ccf63f372f7a"
          ]
        },
        {
          "uuid": "63a245e7-6774-4a9a-b461-bff1933310c5",
          "code": "229-722-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.021",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2ef65606-4e8d-452c-b745-ccf63f372f7a"
          ]
        },
        {
          "uuid": "a5663dd6-f47b-4063-b2be-c472ab13199a",
          "code": "64819",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64819",
          "code_system": "PUBCHEM",
          "references": [
            "2ef65606-4e8d-452c-b745-ccf63f372f7a"
          ]
        },
        {
          "uuid": "53f69850-e502-9805-de33-207e485a971a",
          "code": "DTXSID1027633",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1027633",
          "code_system": "EPA CompTox",
          "references": [
            "b38c4d3d-427f-e8b7-7c83-de2d340c409a"
          ]
        },
        {
          "uuid": "fe5f51c2-66b0-4c71-8326-994a90e56d6a",
          "code": "255PIF62MS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fa0f4299-bce5-2d6a-df9b-2cb7c03991d3",
          "code": "1544938",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1544938",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "96af3231-c8d6-a8b7-4655-15f39d00a5e2"
          ]
        },
        {
          "uuid": "3ca69c1b-9ca6-d6c6-13fc-777a9d61f060",
          "code": "Pentaerythritol tetrakis(3,5-di-tert-butyl-4-hydroxyhydrocinnamate)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pentaerythritol_tetrakis(3,5-di-tert-butyl-4-hydroxyhydrocinnamate)",
          "code_system": "WIKIPEDIA",
          "references": [
            "c618af34-c00f-a81b-614a-3fe6e7db950d"
          ]
        },
        {
          "uuid": "bc456e17-be55-b806-f4be-a6a292d9ed14",
          "code": "255PIF62MS",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=255PIF62MS",
          "code_system": "DAILYMED",
          "references": [
            "e30bd997-82f1-5f76-739f-75769cf6a26b"
          ]
        },
        {
          "uuid": "fa48f256-c633-d4c0-dba2-34fe4235c1be",
          "code": "100000156898",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "31a452e8-df9f-7aa2-3e2c-a04eda8da441"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bdd19ae9-48e4-440e-9c78-e2efe3f0252b",
          "name": "ANOX 20",
          "stdName": "ANOX 20",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c0ad160-9d1b-45ca-b344-42b3e6a5d1ff"
          ],
          "display_name": false
        },
        {
          "uuid": "c59cafde-09ac-4bab-9e86-27a5031ae4fd",
          "name": "ANTIOXIDANT 1010",
          "stdName": "ANTIOXIDANT 1010",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdd8b60a-33c7-48ee-9adb-0f5cd4416673"
          ],
          "display_name": false
        },
        {
          "uuid": "50d1661e-8e19-4212-b003-2d83cd5c4953",
          "name": "BENZENEPROPANOIC ACID, 3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXY-, 1,1'-(2,2-BIS((3-(3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXYPHENYL)-1-OXOPROPOXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "stdName": "BENZENEPROPANOIC ACID, 3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXY-, 1,1'-(2,2-BIS((3-(3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXYPHENYL)-1-OXOPROPOXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdd8b60a-33c7-48ee-9adb-0f5cd4416673"
          ],
          "display_name": false
        },
        {
          "uuid": "d80a1cf6-ce97-4da6-8c35-d474b731f733",
          "name": "HYDROCINNAMIC ACID, 3,5-DI-TERT-BUTYL-4-HYDROXY-, NEOPENTANETETRAYL ESTER",
          "stdName": "HYDROCINNAMIC ACID, 3,5-DI-TERT-BUTYL-4-HYDROXY-, NEOPENTANETETRAYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "990d831a-3fd8-4cfa-bb6b-096a8f6a3b1d"
          ],
          "display_name": false
        },
        {
          "uuid": "a52276c1-4838-46ea-b441-aacc1b826948",
          "name": "IRGANOX 1010",
          "stdName": "IRGANOX 1010",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57553399-c692-430c-a1ba-de6764b601b8"
          ],
          "display_name": false
        },
        {
          "uuid": "5c527513-ee81-4610-935e-96ca534b3184",
          "name": "IRGANOX-1010",
          "stdName": "IRGANOX-1010",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "900670b6-5d56-4c7e-a90c-f982db442734"
          ],
          "display_name": false
        },
        {
          "uuid": "90d665dd-9da9-4f8e-af53-c04e4fd10db1",
          "name": "NEOPENTANETETRAYL 3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE",
          "stdName": "NEOPENTANETETRAYL 3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdd8b60a-33c7-48ee-9adb-0f5cd4416673"
          ],
          "display_name": false
        },
        {
          "uuid": "2cf246dc-200a-479e-af0d-40d1ba23748e",
          "name": "PENTAERTHRITYL TETRA-DI-T-BUTYL HYDROXYHYDROCINNAMATE",
          "stdName": "PENTAERTHRITYL TETRA-DI-T-BUTYL HYDROXYHYDROCINNAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "900670b6-5d56-4c7e-a90c-f982db442734"
          ],
          "display_name": false
        },
        {
          "uuid": "fdd17827-e3b3-441e-baf2-0ad8f93c2b5f",
          "name": "PENTAERYTHRITOL 3-(4-HYDROXY-3,5-DI-TERT-BUTYLPHENYL)PROPIONATE (1:4)",
          "stdName": "PENTAERYTHRITOL 3-(4-HYDROXY-3,5-DI-TERT-BUTYLPHENYL)PROPIONATE (1:4)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdd8b60a-33c7-48ee-9adb-0f5cd4416673"
          ],
          "display_name": false
        },
        {
          "uuid": "90693873-580f-4b7b-a9e0-9fb5616edb25",
          "name": "PENTAERYTHRITOL 4-HYDROXY-3,5-DI-TERT-BUTYLPHENYLPROPIONATE",
          "stdName": "PENTAERYTHRITOL 4-HYDROXY-3,5-DI-TERT-BUTYLPHENYLPROPIONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdd8b60a-33c7-48ee-9adb-0f5cd4416673"
          ],
          "display_name": false
        },
        {
          "uuid": "c8369c74-20e4-4f60-924e-140eae6c50b1",
          "name": "PENTAERYTHRITOL TETRAKIS ESTER WITH 3-(3,5-DI-TERT-BUTYL-4-HYDROXYPHENYL)PROPIONIC ACID",
          "stdName": "PENTAERYTHRITOL TETRAKIS ESTER WITH 3-(3,5-DI-TERT-BUTYL-4-HYDROXYPHENYL)PROPIONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdd8b60a-33c7-48ee-9adb-0f5cd4416673"
          ],
          "display_name": false
        },
        {
          "uuid": "47d08d28-3640-4f08-8df8-4071fc287f59",
          "name": "PENTAERYTHRITOL TETRAKIS(3-(3,5-DI-TERT-BUTYL-4-HYDROXYPHENYL)PROPIONATE)",
          "stdName": "PENTAERYTHRITOL TETRAKIS(3-(3,5-DI-TERT-BUTYL-4-HYDROXYPHENYL)PROPIONATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "797a4ba0-c762-404b-9f37-9901f31b1dc4"
          ],
          "display_name": true
        },
        {
          "uuid": "6b77b70b-53c4-4e0f-8322-95b509dd2aa5",
          "name": "PENTAERYTHRITYL TETRA-DI-T-BUTYL HYDROXYHYDROCINNAMATE",
          "stdName": "PENTAERYTHRITYL TETRA-DI-T-BUTYL HYDROXYHYDROCINNAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "3c0ad160-9d1b-45ca-b344-42b3e6a5d1ff",
            "17bb1132-d9ae-4087-b298-a27d8bace76b"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "755f661c-6a56-470c-9d75-d31fb66dd238",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "fd0ed772-8a3c-49e9-9bf6-bc80612dbfe8",
          "name": "PENTAERYTHRITYL TETRAKIS (3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE)",
          "stdName": "PENTAERYTHRITYL TETRAKIS (3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cf58557-12c8-4228-8cc9-e738d46c8ea7"
          ],
          "display_name": false
        },
        {
          "uuid": "5d5dec0d-b191-4ee4-ade3-839c540aa002",
          "name": "PENTAERYTHRITYL TETRAKIS(3,5-DI-TERT- BUTYL-4-HYDROXYHYDROCINNAMATE)",
          "stdName": "PENTAERYTHRITYL TETRAKIS(3,5-DI-TERT- BUTYL-4-HYDROXYHYDROCINNAMATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be798d0a-2f1c-442a-ac47-bc8be89e719e"
          ],
          "display_name": false
        },
        {
          "uuid": "0a7d6c18-ceb3-4713-9fb4-671c6cc1c142",
          "name": "PENTAERYTHRITYL TETRAKIS(3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE)",
          "stdName": "PENTAERYTHRITYL TETRAKIS(3,5-DI-TERT-BUTYL-4-HYDROXYHYDROCINNAMATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cf58557-12c8-4228-8cc9-e738d46c8ea7"
          ],
          "display_name": false
        },
        {
          "uuid": "2d661098-3947-4638-b368-50db5a125fdb",
          "name": "PLASTIC ADDITIVE 2",
          "stdName": "PLASTIC ADDITIVE 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c79a3fe-01fb-4063-b4ea-ed47ba12ef13",
            "e611abe9-b949-44bb-8ff9-6a978b0c89da"
          ],
          "display_name": false
        },
        {
          "uuid": "306b3f62-2cae-400c-bc20-a16254460a7c",
          "name": "PLASTIC ADDITIVE 2 [USP-RS]",
          "stdName": "PLASTIC ADDITIVE 2 [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c79a3fe-01fb-4063-b4ea-ed47ba12ef13"
          ],
          "display_name": false
        },
        {
          "uuid": "5117d94b-7229-41f9-a191-1318f5fc0a37",
          "name": "TINOGARD TT",
          "stdName": "TINOGARD TT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c0ad160-9d1b-45ca-b344-42b3e6a5d1ff"
          ],
          "display_name": false
        },
        {
          "uuid": "6cc739be-3c60-481b-84fb-df4422f701cd",
          "name": "TINOGARD TTDD",
          "stdName": "TINOGARD TTDD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3c0ad160-9d1b-45ca-b344-42b3e6a5d1ff"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "900670b6-5d56-4c7e-a90c-f982db442734",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "931118a1-5444-4135-8be0-00ca8028cb91",
          "citation": "DMF",
          "doc_type": "DMF",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57553399-c692-430c-a1ba-de6764b601b8",
          "citation": "http://www.pesticideinfo.org/Detail_Chemical.jsp?Rec_Id=PC33034",
          "url": "http://www.pesticideinfo.org/Detail_Chemical.jsp?Rec_Id=PC33034",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdd8b60a-33c7-48ee-9adb-0f5cd4416673",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "990d831a-3fd8-4cfa-bb6b-096a8f6a3b1d",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "797a4ba0-c762-404b-9f37-9901f31b1dc4",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB8489584.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB8489584.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c0ad160-9d1b-45ca-b344-42b3e6a5d1ff",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be798d0a-2f1c-442a-ac47-bc8be89e719e",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cf58557-12c8-4228-8cc9-e738d46c8ea7",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c79a3fe-01fb-4063-b4ea-ed47ba12ef13",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ef65606-4e8d-452c-b745-ccf63f372f7a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389858000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9336a539-a6e8-4294-85c0-f060ad6c5f51",
          "citation": "SRS import [255PIF62MS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=255PIF62MS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389858000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17bb1132-d9ae-4087-b298-a27d8bace76b",
          "citation": "PENTAERYTHRITYL TETRA-DI-T-BUTYL HYDROXYHYDROCINNAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e611abe9-b949-44bb-8ff9-6a978b0c89da",
          "citation": "PLASTIC ADDITIVE 2 [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b38c4d3d-427f-e8b7-7c83-de2d340c409a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6683-19-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31a452e8-df9f-7aa2-3e2c-a04eda8da441",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c618af34-c00f-a81b-614a-3fe6e7db950d",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "553106d9-96d3-cc26-3522-7e0f04aeeca6",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "2d61de23-57e9-4389-a854-eda73933f401",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "96af3231-c8d6-a8b7-4655-15f39d00a5e2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e30bd997-82f1-5f76-739f-75769cf6a26b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8d2cb3a5-e6e2-45b0-a58d-f3337971a001",
          "id": "8d2cb3a5-e6e2-45b0-a58d-f3337971a001",
          "molfile": "\n  Marvin  01132107202D          \n\n 85 88  0  0  0  0            999 V2000\n   -0.6208   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2125   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0375   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1917   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0167   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4292   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2542   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6625   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4875   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9042   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8917   -2.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7167   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1292   -3.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5375   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3625   -2.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7667   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3542   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5917   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0042   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8292   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2375   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0625   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4750   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3000   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0583   -0.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2375   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4667    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0500    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8750    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4667   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0542   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8792   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4167   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4167   -4.6375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7042   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9917   -4.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7125   -5.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0000   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1750   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7625   -5.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9417   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5250   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2958   -6.2875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9375   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7625   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5292   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1250   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9500   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2958   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5375   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1292   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2875   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9542   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8417   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8375   -4.6375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5500   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2625   -4.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5417   -5.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2542   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0792   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -5.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3125   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7292   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5542   -6.2875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3167   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7250   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3042   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5500   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7167   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5417   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3042   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0167   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1958   -0.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2208   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0458   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2083    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0333    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6208    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 80  2  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 78  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 36 14  1  0  0  0  0\n 57 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 27 21  2  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 32 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 28  1  0  0  0  0\n 31 28  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 32  1  0  0  0  0\n 35 32  1  0  0  0  0\n 37 36  1  0  0  0  0\n 38 37  1  0  0  0  0\n 39 38  2  0  0  0  0\n 40 38  1  0  0  0  0\n 41 40  1  0  0  0  0\n 42 41  1  0  0  0  0\n 43 42  1  0  0  0  0\n 48 42  2  0  0  0  0\n 44 43  2  0  0  0  0\n 45 44  1  0  0  0  0\n 53 44  1  0  0  0  0\n 46 45  1  0  0  0  0\n 45 47  2  0  0  0  0\n 47 48  1  0  0  0  0\n 49 47  1  0  0  0  0\n 50 49  1  0  0  0  0\n 51 49  1  0  0  0  0\n 52 49  1  0  0  0  0\n 54 53  1  0  0  0  0\n 55 53  1  0  0  0  0\n 56 53  1  0  0  0  0\n 58 57  1  0  0  0  0\n 59 58  1  0  0  0  0\n 60 59  2  0  0  0  0\n 61 59  1  0  0  0  0\n 62 61  1  0  0  0  0\n 63 62  1  0  0  0  0\n 64 63  1  0  0  0  0\n 69 63  2  0  0  0  0\n 65 64  2  0  0  0  0\n 66 65  1  0  0  0  0\n 74 65  1  0  0  0  0\n 67 66  1  0  0  0  0\n 66 68  2  0  0  0  0\n 68 69  1  0  0  0  0\n 70 68  1  0  0  0  0\n 71 70  1  0  0  0  0\n 72 70  1  0  0  0  0\n 73 70  1  0  0  0  0\n 75 74  1  0  0  0  0\n 76 74  1  0  0  0  0\n 77 74  1  0  0  0  0\n 78 79  2  0  0  0  0\n 79 80  1  0  0  0  0\n 82 79  1  0  0  0  0\n 81 80  1  0  0  0  0\n 83 82  1  0  0  0  0\n 84 82  1  0  0  0  0\n 85 82  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1cc(CCC(=O)OCC(COC(=O)CCc2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C)(COC(=O)CCc3cc(c(c(c3)C(C)(C)C)O)C(C)(C)C)COC(=O)CCc4cc(c(c(c4)C(C)(C)C)O)C(C)(C)C)cc(c1O)C(C)(C)C",
          "formula": "C73H108O12",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "91bc02be-c980-4a7a-bd81-878a1a7fd907"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1177.6342",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a0ab4586-b8a4-4552-bd92-c9cabc95776b",
      "version": "12",
      "structure": {
        "id": "8b41a031-05ed-4435-89f9-a6be38e94dce",
        "molfile": "\n  Marvin  01132107142D          \n\n 85 88  0  0  0  0            999 V2000\n   -0.2208   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5250   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4750   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7292   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1917   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9417   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0625   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1958   -0.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0583   -0.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3167   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9375   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3125   -5.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1292   -3.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5375   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4667    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4667   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5292   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2125   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2083    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7167   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7250   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7042   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4875   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5500   -5.0500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7667   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7625   -5.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0167   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0167   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2375   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4917   -5.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7625   -7.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2375   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0792   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8292   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4292   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1750   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9917   -4.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9042   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3542   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2625   -4.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8917   -2.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8375   -4.6375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4167   -4.6375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3625   -2.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8417   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5375   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4167   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7167   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2958   -6.2875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3000   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5542   -6.2875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0458   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7125   -5.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5917   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5417   -5.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6625   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0042   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0000   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2542   -6.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2542   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6208   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0542   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8792   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1292   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2875   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9542   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0333    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6208    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1250   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9500   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2958   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0375   -2.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2042   -3.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0500    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5417   -4.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3042   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2917    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8750    0.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1292   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3042   -8.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5500   -7.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4 12  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6 26  2  0  0  0  0\n  7 33  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9 30  2  0  0  0  0\n 10 27  1  0  0  0  0\n 11 32  1  0  0  0  0\n 12 31  2  0  0  0  0\n 13 49  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18  5  1  0  0  0  0\n 19  8  1  0  0  0  0\n 20 12  1  0  0  0  0\n 21 10  1  0  0  0  0\n 22 44  1  0  0  0  0\n 23 57  1  0  0  0  0\n 24 43  1  0  0  0  0\n 25 45  1  0  0  0  0\n 26 37  1  0  0  0  0\n 27 34  2  0  0  0  0\n 28  8  2  0  0  0  0\n 29  5  1  0  0  0  0\n 30 35  1  0  0  0  0\n 31 34  1  0  0  0  0\n 32 37  2  0  0  0  0\n 33 35  2  0  0  0  0\n 34 60  1  0  0  0  0\n 35 58  1  0  0  0  0\n 36 28  1  0  0  0  0\n 37 59  1  0  0  0  0\n 38 22  2  0  0  0  0\n 39 23  2  0  0  0  0\n 40 25  2  0  0  0  0\n 41 24  2  0  0  0  0\n 42 23  1  0  0  0  0\n 43 46  1  0  0  0  0\n 44 48  1  0  0  0  0\n 45 47  1  0  0  0  0\n 46 13  1  0  0  0  0\n 47 13  1  0  0  0  0\n 48 13  1  0  0  0  0\n 49 42  1  0  0  0  0\n 50  2  1  0  0  0  0\n 51  3  1  0  0  0  0\n 52  4  1  0  0  0  0\n 53  1  1  0  0  0  0\n 54 22  1  0  0  0  0\n 55 25  1  0  0  0  0\n 56 24  1  0  0  0  0\n 57 61  1  0  0  0  0\n 58 55  1  0  0  0  0\n 59 54  1  0  0  0  0\n 60 56  1  0  0  0  0\n 61 36  1  0  0  0  0\n 62 18  1  0  0  0  0\n 63 16  1  0  0  0  0\n 64 16  1  0  0  0  0\n 65 16  1  0  0  0  0\n 66 14  1  0  0  0  0\n 67 14  1  0  0  0  0\n 68 14  1  0  0  0  0\n 69 19  1  0  0  0  0\n 70 19  1  0  0  0  0\n 71 17  1  0  0  0  0\n 72 17  1  0  0  0  0\n 73 17  1  0  0  0  0\n 74 19  1  0  0  0  0\n 75 18  1  0  0  0  0\n 76 18  1  0  0  0  0\n 77 15  1  0  0  0  0\n 78 20  1  0  0  0  0\n 79 20  1  0  0  0  0\n 80 20  1  0  0  0  0\n 81 15  1  0  0  0  0\n 82 15  1  0  0  0  0\n 83 21  1  0  0  0  0\n 84 21  1  0  0  0  0\n 85 21  1  0  0  0  0\n 29 36  2  0  0  0  0\n  2 11  2  0  0  0  0\n  3  7  2  0  0  0  0\n  4 10  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1cc(CCC(=O)OCC(COC(=O)CCc2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C)(COC(=O)CCc3cc(c(c(c3)C(C)(C)C)O)C(C)(C)C)COC(=O)CCc4cc(c(c(c4)C(C)(C)C)O)C(C)(C)C)cc(c1O)C(C)(C)C",
        "formula": "C73H108O12",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "1177.6342",
        "optical_activity": "NONE",
        "references": [
          "fdd8b60a-33c7-48ee-9adb-0f5cd4416673",
          "9336a539-a6e8-4294-85c0-f060ad6c5f51"
        ],
        "stereo_centers": 0
      },
      "unii": "255PIF62MS"
    }
  ]
}