{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5239c23a-0aaa-442d-bea6-e1c88378a122",
          "code": "122397-96-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=122397-96-0",
          "code_system": "CAS",
          "references": [
            "3fe4a698-22f8-4e6a-b0a0-5ed969aa5ca9",
            "504883ac-18f6-4c62-b643-a023e3276b8a"
          ]
        },
        {
          "uuid": "eb13c24b-eb75-4bb3-9136-ad84a8cfc6b9",
          "code": "11163251",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11163251",
          "code_system": "PUBCHEM",
          "references": [
            "3fe4a698-22f8-4e6a-b0a0-5ed969aa5ca9"
          ]
        },
        {
          "uuid": "68095873-89a3-4f93-92a7-6219dff593ec",
          "code": "24XJ91ONU1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "09674af6-4943-ded5-4e09-40aed3258b23",
          "code": "DTXSID50153590",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50153590",
          "code_system": "EPA CompTox",
          "references": [
            "f6d86f05-a913-4204-861b-dac6226d012c"
          ]
        },
        {
          "uuid": "4d0c3321-0723-bb14-9d5b-08f71effbde7",
          "code": "884",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/884/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "372787e8-cdd0-3748-7aaf-6de253d30efb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f2353294-d918-4099-8e90-ec1a2aff8169",
          "name": "2-ETHOXY-4-FORMYLPHENYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "2-ETHOXY-4-FORMYLPHENYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22103ba3-b1ed-4292-adc7-1f6ed6926146",
            "fda2921d-6012-4c06-8af5-e9b07050e049"
          ],
          "display_name": false
        },
        {
          "uuid": "e73f9a8d-35f4-4605-89ae-d90315ec8bf4",
          "name": "BENZALDEHYDE, 3-ETHOXY-4-(.BETA.-D-GLUCOPYRANOSYLOXY)-",
          "stdName": "BENZALDEHYDE, 3-ETHOXY-4-(.BETA.-D-GLUCOPYRANOSYLOXY)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22103ba3-b1ed-4292-adc7-1f6ed6926146",
            "fda2921d-6012-4c06-8af5-e9b07050e049"
          ],
          "display_name": false
        },
        {
          "uuid": "e0040a18-6047-4362-bca5-3212f7c84c2d",
          "name": "ETHYL VANILLIN .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "ETHYL VANILLIN .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4cc14ed-6b50-46db-a63f-967d02e9e43b",
            "22103ba3-b1ed-4292-adc7-1f6ed6926146",
            "041327e7-af33-43e7-9fc7-5f65fa87519d",
            "efea04f6-d343-41d0-af0f-085ca2fb4eb1"
          ],
          "display_name": true
        },
        {
          "uuid": "df9f7f65-79f9-4ad4-b03a-764c0eac54f9",
          "name": "ETHYL VANILLIN .BETA.-D-GLUCOPYRANOSIDE [FHFI]",
          "stdName": "ETHYL VANILLIN .BETA.-D-GLUCOPYRANOSIDE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4cc14ed-6b50-46db-a63f-967d02e9e43b",
            "22103ba3-b1ed-4292-adc7-1f6ed6926146"
          ],
          "display_name": false
        },
        {
          "uuid": "2df93f60-4d80-427f-bb7b-5d0904717c9f",
          "name": "ETHYL VANILLIN GLUCOSIDE",
          "stdName": "ETHYL VANILLIN GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22103ba3-b1ed-4292-adc7-1f6ed6926146",
            "fda2921d-6012-4c06-8af5-e9b07050e049"
          ],
          "display_name": false
        },
        {
          "uuid": "42d2e9dd-5bf9-4182-a713-fc8ad3491996",
          "name": "FEMA NO. 3801",
          "stdName": "FEMA NO. 3801",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4cc14ed-6b50-46db-a63f-967d02e9e43b",
            "22103ba3-b1ed-4292-adc7-1f6ed6926146"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "041327e7-af33-43e7-9fc7-5f65fa87519d",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "22103ba3-b1ed-4292-adc7-1f6ed6926146",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fda2921d-6012-4c06-8af5-e9b07050e049",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4cc14ed-6b50-46db-a63f-967d02e9e43b",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fe4a698-22f8-4e6a-b0a0-5ed969aa5ca9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391223000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2268cb7-c3fd-40ff-a974-2e09ed741c42",
          "citation": "SRS import [24XJ91ONU1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=24XJ91ONU1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391223000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efea04f6-d343-41d0-af0f-085ca2fb4eb1",
          "citation": "ETHYL VANILLIN .BETA.-D-GLUCOPYRANOSIDE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9088fef1-a0ed-850e-02c6-f36ce48e2029",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=122397-96-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "504883ac-18f6-4c62-b643-a023e3276b8a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "30e9b418-70ee-700e-389b-481027e86a50",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f6d86f05-a913-4204-861b-dac6226d012c",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "372787e8-cdd0-3748-7aaf-6de253d30efb",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1fb82554-d800-43e4-a1a8-20b1efdf6e2d",
          "id": "1fb82554-d800-43e4-a1a8-20b1efdf6e2d",
          "molfile": "\n  Marvin  01132101482D          \n\n 23 24  0  0  1  0            999 V2000\n    4.3439  -12.4236    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.3439  -11.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6294  -11.1861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0584  -12.8360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0584  -13.6611    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.7728  -14.0736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8168  -13.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8168  -12.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5315  -12.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2434  -12.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9558  -12.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9558  -11.5796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2434  -13.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5333  -14.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5333  -14.8715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2443  -15.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2443  -16.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3439  -14.0736    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.3439  -14.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6294  -13.6611    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.9150  -14.0736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6294  -12.8360    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.9150  -12.4236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 22  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 14  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 13 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  6  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  1  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  6  0  0  0\nM  END",
          "smiles": "CCOc1cc(ccc1O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C=O",
          "formula": "C15H20O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "35830579-556c-4d1f-9aef-c4ca50fbdd1f"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "328.3151",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f88a0aca-2578-4b6d-a8a1-5ee221468de4",
      "version": "8",
      "structure": {
        "id": "76c85dc4-9378-430b-aad7-dd10a9a94f7f",
        "molfile": "\n  Marvin  01132106102D          \n\n 23 24  0  0  1  0            999 V2000\n    6.8168  -12.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2434  -12.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5315  -12.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2434  -13.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8168  -13.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5333  -14.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6294  -12.8360    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6294  -13.6611    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3439  -14.0736    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0584  -13.6611    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.0584  -12.8360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3439  -12.4236    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3439  -14.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9150  -14.0736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9150  -12.4236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7728  -14.0736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5333  -14.8715    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3439  -11.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9558  -12.4022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2443  -15.2819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2443  -16.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9558  -11.5796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6294  -11.1861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  6  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  2  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  2  2  0  0  0  0\n  3  1  2  0  0  0  0\n 11 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  1  0  0  0  0\n  9 13  1  6  0  0  0\n  8 14  1  1  0  0  0\n  7 15  1  6  0  0  0\n 10 16  1  1  0  0  0\n  6 17  1  0  0  0  0\n  5 16  1  0  0  0  0\n 12 18  1  1  0  0  0\n  2 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 19 22  2  0  0  0  0\n 18 23  1  0  0  0  0\nM  END",
        "smiles": "CCOc1cc(ccc1O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C=O",
        "formula": "C15H20O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "328.3151",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f2268cb7-c3fd-40ff-a974-2e09ed741c42",
          "fda2921d-6012-4c06-8af5-e9b07050e049"
        ],
        "stereo_centers": 5
      },
      "unii": "24XJ91ONU1"
    }
  ]
}