{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "af98f562-d314-44cc-8c42-ce2ce24e76d7",
          "code": "23089-26-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23089-26-1",
          "code_system": "CAS",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6",
            "d5fe80f6-0772-42c5-9469-8cb3abd6df0e"
          ]
        },
        {
          "uuid": "f626542b-06ca-4301-b170-18be7a027350",
          "code": "C80904",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80904",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "acaa882e-1029-4961-948a-ef31afc049f1",
          "code": "C004497",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004497",
          "code_system": "MESH",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "c69264e1-8cf4-4e4c-ab8b-0547e803670b",
          "code": "BISABOLOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bisabolol",
          "code_system": "WIKIPEDIA",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "e3c4c833-9b61-4a64-93a7-a53a775b4b17",
          "code": "SUB08474MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "0c67cf7b-8d41-4d07-8b64-37bc9eb768f8",
          "code": "3667",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3667",
          "code_system": "INN",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "4f57472c-7dfe-4576-8d2c-994ea92a947f",
          "code": "19461",
          "comments": "RxNorm",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/19461/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "08dff321-0bb2-466f-9246-af430dae2fb9",
          "code": "m2515",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2515?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "1915f88a-64f0-408f-8eff-0f6d32a1b187",
          "code": "SUB79626",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "7701781a-8db2-4d37-8af6-ca24a3534b70",
          "code": "CHEMBL2104360",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104360",
          "code_system": "ChEMBL",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "4dd7efe6-3048-4160-b5c6-8045725c001b",
          "code": "245-423-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.279",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "d49c4d0d-6b4a-48c0-8278-ecb964b56918",
          "code": "442343",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442343",
          "code_system": "PUBCHEM",
          "references": [
            "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6"
          ]
        },
        {
          "uuid": "c0eede30-e254-b7e2-acc7-9860836f31cc",
          "code": "DTXSID4042094",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4042094",
          "code_system": "EPA CompTox",
          "references": [
            "782e75b8-0ac0-f802-5402-736bdef55677"
          ]
        },
        {
          "uuid": "fac1b57d-c51e-4468-9d13-81a32d7a39c6",
          "code": "1306126",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306126/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8c3e2f9b-097d-0a81-9c00-db3010ac3cdf"
          ]
        },
        {
          "uuid": "6d0504e5-1445-d2c3-52ed-d867f2f34917",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "63109291-807c-721a-63cb-69becdb5e855"
          ]
        },
        {
          "uuid": "a3e052e1-0f4f-4538-8ad7-87e579a35e8a",
          "code": "24WE03BX2T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b12e8001-3e56-34cf-341f-5e5824fb2703",
          "code": "DB13153",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13153",
          "code_system": "DRUG BANK",
          "references": [
            "63109291-807c-721a-63cb-69becdb5e855"
          ]
        },
        {
          "uuid": "4ce27eb1-001d-e94c-2ac1-bcaa9fae165e",
          "code": "4619",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4619",
          "code_system": "DRUG CENTRAL",
          "references": [
            "63109291-807c-721a-63cb-69becdb5e855"
          ]
        },
        {
          "uuid": "59d5435e-49a8-2ad2-37f7-9867b096669e",
          "code": "1362307",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1362307",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "63109291-807c-721a-63cb-69becdb5e855"
          ]
        },
        {
          "uuid": "0e5d2df0-3906-6033-0091-687b5d1c412f",
          "code": "24WE03BX2T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=24WE03BX2T",
          "code_system": "DAILYMED",
          "references": [
            "cb96b4b4-2d06-4edc-f6eb-dc19474e5294"
          ]
        },
        {
          "uuid": "703a649d-1cf3-881b-b7e4-21ce0ef53a35",
          "code": "100000082277",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f95f9725-3d91-60bc-5dea-b9df5f0bde20"
          ]
        },
        {
          "uuid": "a94cd046-c703-1991-9b9c-f3fae867bf5c",
          "code": "2009",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2009/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "1c3fec3d-0dab-6097-7d6d-6a2a407920b4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "435e9f35-c343-464a-92cf-8517b49e6cc5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "83065f95-4e44-462c-8833-a0632af8a1cf",
            "refuuid": "fb811d21-a76c-411c-be21-54eb28f25fbb",
            "name": "LEVOMENOL",
            "unii": "24WE03BX2T",
            "linking_id": "24WE03BX2T",
            "ref_pname": "LEVOMENOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4ad21143-91d6-460a-8882-518ff42fe6f4",
          "comments": "Constituent of Matricaria recutita flower head.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "9c2257e7-2dd2-4186-a1d1-7bfe9c846fbf"
          ],
          "related_substance": {
            "uuid": "919fbfdc-a79b-4cc1-b9a8-44cbe6d3e6bf",
            "refuuid": "3347cc3f-fac6-4a3c-945d-f0bd68dd3c46",
            "name": "CHAMOMILE",
            "unii": "FGL3685T2X",
            "linking_id": "FGL3685T2X",
            "ref_pname": "CHAMOMILE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6a58ad64-fccb-4857-ab1c-d4a78391c18b",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "710b4152-c508-49c9-b36b-39f8fb032c43"
          ],
          "related_substance": {
            "uuid": "b9bec6c0-6bf8-4d09-8acd-a26020317dd3",
            "refuuid": "3347cc3f-fac6-4a3c-945d-f0bd68dd3c46",
            "name": "CHAMOMILE",
            "unii": "FGL3685T2X",
            "linking_id": "FGL3685T2X",
            "ref_pname": "CHAMOMILE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e33aa3e0-ebea-45ef-b55a-e376c311b9d5",
          "name": "(-)-.ALPHA.-BISABOLOL",
          "stdName": "(-)-.ALPHA.-BISABOLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "fc664b6d-e175-4a0a-ba10-8f839b842626"
          ],
          "display_name": false
        },
        {
          "uuid": "866d394d-8636-4e98-b7c9-d08b36aa827f",
          "name": "(-)-.ALPHA.-BISABOLOL (CONSTITUENT OF CHAMOMILE) [DSC]",
          "stdName": "(-)-.ALPHA.-BISABOLOL (CONSTITUENT OF CHAMOMILE) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "f43f0dcd-9694-452e-8853-45d94bc3c051"
          ],
          "display_name": false
        },
        {
          "uuid": "4b265efd-d20b-499b-80b4-3d402f99515d",
          "name": "(-)-6-METHYL-2-(4-METHYL-3-CYCLOHEXEN-1-YL)-5-HEPTEN-2-OL",
          "stdName": "(-)-6-METHYL-2-(4-METHYL-3-CYCLOHEXEN-1-YL)-5-HEPTEN-2-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ce11a5d-8679-4cb9-b1ed-894351a68d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "ac14caaf-6f3f-44c7-ac07-f7bf0b4fd485",
          "name": "(.ALPHA.S,1S)-.ALPHA.-BISABOLOL",
          "stdName": "(.ALPHA.S,1S)-.ALPHA.-BISABOLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "e70e3458-babd-4133-bab9-dc04e8fd6868"
          ],
          "display_name": false
        },
        {
          "uuid": "f0d223c2-6e18-484e-a08a-c1330e935b97",
          "name": ".ALPHA.-BISABOLOL",
          "stdName": ".ALPHA.-BISABOLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "8ab08aa5-cbf5-4a39-9a9c-6d2b64071186"
          ],
          "display_name": false
        },
        {
          "uuid": "4a55a3c1-bd6b-4632-af8a-09425cef756a",
          "name": ".ALPHA.-BISABOLOL (-)-FORM [MI]",
          "stdName": ".ALPHA.-BISABOLOL (-)-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "e18a2eee-7fe2-4ea4-98e5-566a97bcca11"
          ],
          "display_name": false
        },
        {
          "uuid": "8117dd03-301a-4e3b-ac6c-237f8bf840ad",
          "name": ".ALPHA.-BISABOLOL, (-)-",
          "stdName": ".ALPHA.-BISABOLOL, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "1a4fbde1-2b3b-48a9-9103-479c2f74cb07"
          ],
          "display_name": false
        },
        {
          "uuid": "52545e24-4467-45a0-948b-cd7e4aa5662c",
          "name": "3-CYCLOHEXENE-1-METHANOL, .ALPHA.,4-DIMETHYL-.ALPHA.-(4-METHYL-3-PENTEN-1-YL)-, (.ALPHA.S,1S)-",
          "stdName": "3-CYCLOHEXENE-1-METHANOL, .ALPHA.,4-DIMETHYL-.ALPHA.-(4-METHYL-3-PENTEN-1-YL)-, (.ALPHA.S,1S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d05a693c-c60f-43e2-83db-00f95795cf8e",
            "b71c41af-0e8b-43e8-aa12-278f2af100fb"
          ],
          "display_name": false
        },
        {
          "uuid": "1ae67509-c9ca-4e30-8f5c-fa4dc29bfd8e",
          "name": "5-HEPTEN-2-OL, 6-METHYL-2-(4- METHYL-3-CYCLOHEXEN-1-YL), (-)-",
          "stdName": "5-HEPTEN-2-OL, 6-METHYL-2-(4- METHYL-3-CYCLOHEXEN-1-YL), (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "40f88346-5872-45bf-9e37-a80c76862ed0"
          ],
          "display_name": false
        },
        {
          "uuid": "e6362287-5feb-4a67-82c6-9ba05083dafd",
          "name": "ALPHA-(-)-BISABOLOL",
          "stdName": "ALPHA-(-)-BISABOLOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "40f88346-5872-45bf-9e37-a80c76862ed0"
          ],
          "display_name": false
        },
        {
          "uuid": "0f9da1bd-8b08-4400-a609-2ce543afe584",
          "name": "BISABOLOL",
          "stdName": "BISABOLOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "df23e21d-e40b-49a5-969c-c9f6c1eea2b8",
            "41c77126-7d52-4771-af47-04b96cdf6d21",
            "8ab08aa5-cbf5-4a39-9a9c-6d2b64071186",
            "d92d2d50-6285-4e35-8585-46073f3535e2",
            "1b5fbf8f-0ecf-4c04-9138-9a48f8a7912c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "671236ac-4bdc-432a-bbf8-3a0f201eb7ca",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "92092805-f02b-49a0-8748-9dc9a4a4a741",
          "name": "BISABOLOL [VANDF]",
          "stdName": "BISABOLOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "1b5fbf8f-0ecf-4c04-9138-9a48f8a7912c"
          ],
          "display_name": false
        },
        {
          "uuid": "650487a3-060e-440f-99b6-b64f87f49479",
          "name": "BISABOLOL, (-)-.ALPHA.",
          "stdName": "BISABOLOL, (-)-.ALPHA.",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "85230591-8e9b-4115-97a1-20e78268c250"
          ],
          "display_name": false
        },
        {
          "uuid": "57d276cd-82c0-43da-b75f-ad4909a2f76b",
          "name": "FEMA NO. 4666",
          "stdName": "FEMA NO. 4666",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "40f88346-5872-45bf-9e37-a80c76862ed0"
          ],
          "display_name": false
        },
        {
          "uuid": "8b32826e-d85b-4fec-ba3a-c41bc17cbcb8",
          "name": "KAMILLOSAN",
          "stdName": "KAMILLOSAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "f43f0dcd-9694-452e-8853-45d94bc3c051"
          ],
          "display_name": false
        },
        {
          "uuid": "353c45b8-8c3f-4d88-a073-d3b620392143",
          "name": "LEVOMENOL",
          "stdName": "LEVOMENOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "8ac23dc7-37ff-4d7b-b1db-fb611f2e6025",
            "8e37a4c3-d1d6-4918-8712-d160b3b6061d",
            "783a6e51-5420-421e-b191-b768759b2ba1",
            "9a784644-ae41-4b28-aee7-94bc0a043b25",
            "a8606009-ade8-408e-b2e8-1d87fa9d3d86",
            "e8a3c7f1-331a-43af-bdfb-5fdb7ab70c5c",
            "6ce11a5d-8679-4cb9-b1ed-894351a68d6d",
            "1645ff7f-fcc2-4662-a5b5-0d4d53a656d2",
            "c6ac90f6-31bf-45ca-aa17-8d8a1838c1ac"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "8ec73c43-d1f3-401e-8733-ac8fc4eae135",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "466bf7ce-f3e7-400e-ac88-4aba0bfb9f20",
          "name": "LEVOMENOL [MART.]",
          "stdName": "LEVOMENOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a784644-ae41-4b28-aee7-94bc0a043b25"
          ],
          "display_name": false
        },
        {
          "uuid": "e7056ab3-bda8-45d0-ace1-5cc69b1bf8e4",
          "name": "LEVOMENOL [USP-RS]",
          "stdName": "LEVOMENOL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a86ba8a8-0e02-4e28-8489-64ed427e6895",
            "c6ac90f6-31bf-45ca-aa17-8d8a1838c1ac"
          ],
          "display_name": false
        },
        {
          "uuid": "31e2401b-d77a-f651-5844-befb1a5f6e93",
          "name": "Levomenol [WHO-DD]",
          "stdName": "LEVOMENOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19018f39-43aa-9b7d-5342-86c2981eb0f7"
          ],
          "display_name": false
        },
        {
          "uuid": "c6e4ef6b-f39a-4ba0-9e4d-c93135e42eb2",
          "name": "levomenol [INN]",
          "stdName": "LEVOMENOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e37a4c3-d1d6-4918-8712-d160b3b6061d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "41c77126-7d52-4771-af47-04b96cdf6d21",
          "citation": "BISABOLOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "df23e21d-e40b-49a5-969c-c9f6c1eea2b8",
          "citation": "BISABOLOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ce11a5d-8679-4cb9-b1ed-894351a68d6d",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b71c41af-0e8b-43e8-aa12-278f2af100fb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d05a693c-c60f-43e2-83db-00f95795cf8e",
          "citation": "STN 2008",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc664b6d-e175-4a0a-ba10-8f839b842626",
          "citation": "martindale",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a86ba8a8-0e02-4e28-8489-64ed427e6895",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e70e3458-babd-4133-bab9-dc04e8fd6868",
          "citation": "MARTINADALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e37a4c3-d1d6-4918-8712-d160b3b6061d",
          "citation": "INN Proposed List 32",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL32.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a784644-ae41-4b28-aee7-94bc0a043b25",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40f88346-5872-45bf-9e37-a80c76862ed0",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6ac90f6-31bf-45ca-aa17-8d8a1838c1ac",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8606009-ade8-408e-b2e8-1d87fa9d3d86",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a4fbde1-2b3b-48a9-9103-479c2f74cb07",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ab08aa5-cbf5-4a39-9a9c-6d2b64071186",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d92d2d50-6285-4e35-8585-46073f3535e2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e18a2eee-7fe2-4ea4-98e5-566a97bcca11",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85230591-8e9b-4115-97a1-20e78268c250",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b5fbf8f-0ecf-4c04-9138-9a48f8a7912c",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f43f0dcd-9694-452e-8853-45d94bc3c051",
          "citation": "USP-DSC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c7f3f84-a2f3-48bd-a587-ee4a6b9dafa6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c2257e7-2dd2-4186-a1d1-7bfe9c846fbf",
          "citation": "2015 USP DIETARY SUPPLEMENTS COMPENDIUM",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "710b4152-c508-49c9-b36b-39f8fb032c43",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a77a4334-22e3-41d7-90c5-78d27db59825",
          "citation": "SRS import [24WE03BX2T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=24WE03BX2T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8a3c7f1-331a-43af-bdfb-5fdb7ab70c5c",
          "citation": "LEVOMENOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8ac23dc7-37ff-4d7b-b1db-fb611f2e6025",
          "citation": "LEVOMENOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "783a6e51-5420-421e-b191-b768759b2ba1",
          "citation": "LEVOMENOL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1645ff7f-fcc2-4662-a5b5-0d4d53a656d2",
          "citation": "LEVOMENOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "782e75b8-0ac0-f802-5402-736bdef55677",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=23089-26-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c3e2f9b-097d-0a81-9c00-db3010ac3cdf",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f95f9725-3d91-60bc-5dea-b9df5f0bde20",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "63109291-807c-721a-63cb-69becdb5e855",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d5fe80f6-0772-42c5-9469-8cb3abd6df0e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "38e3a3c7-d607-0fa6-5ef0-9ceb4fa11e44",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "19018f39-43aa-9b7d-5342-86c2981eb0f7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cb96b4b4-2d06-4edc-f6eb-dc19474e5294",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1c3fec3d-0dab-6097-7d6d-6a2a407920b4",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "28af49d0-8ceb-4902-b5ae-ae7a7c6c3091",
          "id": "28af49d0-8ceb-4902-b5ae-ae7a7c6c3091",
          "molfile": "\n  Marvin  01132102142D          \n\n 16 16  0  0  1  0            999 V2000\n    1.0142    1.3809    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.3040    0.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4148    1.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4187    2.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1391    2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2961    2.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0104    2.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7281    0.9674    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.1429    0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3094    0.3862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4451    1.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1619    0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8753    1.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5888    0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3023    1.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5856    0.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  7  1  1  0  0  0\n  8  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 11  8  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC[C@@](C)([C@@H]1CC=C(C)CC1)O)C",
          "formula": "C15H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5c4dfbf5-d46c-41c5-80b4-84b45108434c"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "222.3669",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fb811d21-a76c-411c-be21-54eb28f25fbb",
      "version": "22",
      "structure": {
        "id": "cd812c66-5162-4679-bb91-b8a2678a8703",
        "molfile": "\n  Marvin  01132110372D          \n\n 17 17  0  0  1  0            999 V2000\n    1.0142    1.3809    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.0104    2.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2961    2.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4187    2.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4148    1.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3040    0.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4451    1.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1619    0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8753    1.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5888    0.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3023    1.3794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5856    0.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7281    0.9674    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.3094    0.3862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1429    0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1391    2.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7281    1.7983    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7 13  1  0  0  0  0\n 13  1  1  0  0  0  0\n 13 14  1  6  0  0  0\n  1  2  1  0  0  0  0\n 13 15  1  1  0  0  0\n  1  6  1  0  0  0  0\n  4 16  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1 17  1  6  0  0  0\nM  END",
        "smiles": "CC(=CCC[C@@](C)([C@]1([H])CC=C(C)CC1)O)C",
        "formula": "C15H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "222.3669",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8c3e2f9b-097d-0a81-9c00-db3010ac3cdf",
          "6ce11a5d-8679-4cb9-b1ed-894351a68d6d",
          "8e37a4c3-d1d6-4918-8712-d160b3b6061d"
        ],
        "stereo_centers": 2
      },
      "unii": "24WE03BX2T"
    }
  ]
}