{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "235214b8-009e-4ebd-8ac5-d54986e9bb41",
          "code": "7558-63-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7558-63-6",
          "code_system": "CAS",
          "references": [
            "2c6918ca-fefc-498f-9f65-65f0da8d42d9",
            "3ac5f1fd-a652-4ff5-b0b3-d1851fa88939"
          ]
        },
        {
          "uuid": "c92a7507-2786-42cb-9a72-7fd7b6fed401",
          "code": "INS-624",
          "comments": "Codex Alimentarius|Functional Classification|Flavour enhancer",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=308",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "2c6918ca-fefc-498f-9f65-65f0da8d42d9"
          ]
        },
        {
          "uuid": "0a8bffb1-0f99-4e5a-83b0-d17f2808be8b",
          "code": "INS-624",
          "comments": "JECFA|Functional Classification|FLAVOUR ENHANCER|SALT SUBSTITUTE",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=624",
          "code_system": "JECFA EVALUATION",
          "references": [
            "2c6918ca-fefc-498f-9f65-65f0da8d42d9"
          ]
        },
        {
          "uuid": "34aa6a79-48c4-4492-b95a-dc4ae5300b4e",
          "code": "25677-11-6",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=25677-11-6",
          "code_system": "CAS",
          "references": [
            "2c6918ca-fefc-498f-9f65-65f0da8d42d9",
            "22f0c161-6b2d-4cd8-b6ad-0112fcf7eb1f"
          ]
        },
        {
          "uuid": "c67eaf2d-f5a1-4f8c-8da3-85d86f2a68f5",
          "code": "231-447-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.589",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2c6918ca-fefc-498f-9f65-65f0da8d42d9"
          ]
        },
        {
          "uuid": "10a00414-a59d-5af2-54d6-a9ce49472ed9",
          "code": "DTXSID3047714",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3047714",
          "code_system": "EPA CompTox",
          "references": [
            "ef6dd94b-621e-064a-b4f1-007c1073bacf"
          ]
        },
        {
          "uuid": "7f048653-80d6-b2e0-f3fd-0572676babe5",
          "code": "23618774",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23618774",
          "code_system": "PUBCHEM",
          "references": [
            "3aea4eb6-9ec0-a8f5-0891-2965c1dcfb68"
          ]
        },
        {
          "uuid": "243f257c-af80-4b7e-ba94-08f49b6f4884",
          "code": "245K560GAW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "82f5de6d-9429-53db-2df6-1557b5f503ff",
          "code": "300000054519",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d42b3fef-15c4-5fdf-812a-9fb169306bf9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9aab4f78-32c9-4794-8020-6f57be9d121b",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "29f040c8-1b50-408f-9efa-6945708bee41",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a0796337-a451-e40a-4054-4a8ffcfbaf97",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "3ac5f1fd-a652-4ff5-b0b3-d1851fa88939"
          ],
          "related_substance": {
            "uuid": "76a82693-309e-45ac-b505-1c5aeb5554f7",
            "refuuid": "b0a3205c-4b2a-4b2c-9d5b-1bb16bc096da",
            "name": "MONOAMMONIUM GLUTAMATE MONOHYDRATE",
            "unii": "78J36W2R40",
            "linking_id": "78J36W2R40",
            "ref_pname": "MONOAMMONIUM GLUTAMATE MONOHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2f920183-b60e-45a3-8fc7-ad30a8ae88cc",
          "name": "AMMONIUM GLUTAMATE",
          "stdName": "AMMONIUM GLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "136ced69-c6f3-4f18-9f7e-ace1c841814b",
            "5d92973c-ec96-41f3-bc23-26f062814205"
          ],
          "display_name": true
        },
        {
          "uuid": "3e4c2490-6790-4569-b269-4a6aceb7bd00",
          "name": "E 624",
          "stdName": "E 624",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "136ced69-c6f3-4f18-9f7e-ace1c841814b",
            "fdb90dd9-3525-4eec-b0fc-3f24bd77152a"
          ],
          "display_name": false
        },
        {
          "uuid": "dba71c45-8bad-4ce5-aaaa-2fa45378dc82",
          "name": "E-624",
          "stdName": "E-624",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54757c82-8e4a-4349-aa2e-d4181b2d1433",
            "136ced69-c6f3-4f18-9f7e-ace1c841814b"
          ],
          "display_name": false
        },
        {
          "uuid": "ad8c7d98-ec67-478b-9386-98f583b3e509",
          "name": "INS NO.624",
          "stdName": "INS NO.624",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54757c82-8e4a-4349-aa2e-d4181b2d1433",
            "136ced69-c6f3-4f18-9f7e-ace1c841814b"
          ],
          "display_name": false
        },
        {
          "uuid": "4ee2dffb-3733-4484-94b8-ca3b01762240",
          "name": "INS-624",
          "stdName": "INS-624",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54757c82-8e4a-4349-aa2e-d4181b2d1433",
            "136ced69-c6f3-4f18-9f7e-ace1c841814b"
          ],
          "display_name": false
        },
        {
          "uuid": "465f9a87-8132-4c06-8051-34cefe95ac9b",
          "name": "MONOAMMONIUM GLUTAMATE",
          "stdName": "MONOAMMONIUM GLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "136ced69-c6f3-4f18-9f7e-ace1c841814b",
            "9680dfc1-114c-40bb-ae00-2f325c7f96e8"
          ],
          "display_name": false
        },
        {
          "uuid": "857e937c-643c-420f-a7db-4174108260b9",
          "name": "MONOAMMONIUM L-GLUTAMATE",
          "stdName": "MONOAMMONIUM L-GLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "25a832ed-a684-4325-98f0-41b45a0ff62b",
            "136ced69-c6f3-4f18-9f7e-ace1c841814b",
            "3dfb706b-4ba5-4df7-92db-9ea2343e8cc9",
            "60656d2f-6033-475b-8624-c7288c8d1734"
          ],
          "display_name": false
        },
        {
          "uuid": "884992b2-586c-4763-93e9-278c12375eab",
          "name": "MONOAMMONIUM L-GLUTAMATE MONOHYDRATE",
          "stdName": "MONOAMMONIUM L-GLUTAMATE MONOHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "136ced69-c6f3-4f18-9f7e-ace1c841814b",
            "9a4a602d-85cf-4fd1-a7c5-215c3d808008"
          ],
          "display_name": false
        },
        {
          "uuid": "58c3b798-1f2b-457b-b7c3-c07d1688708f",
          "name": "MONOAMMONIUM L-GLUTAMATE [FCC]",
          "stdName": "MONOAMMONIUM L-GLUTAMATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "136ced69-c6f3-4f18-9f7e-ace1c841814b",
            "3dfb706b-4ba5-4df7-92db-9ea2343e8cc9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5d92973c-ec96-41f3-bc23-26f062814205",
          "citation": "Title DetailsCitationFood Additives Data Book ",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "136ced69-c6f3-4f18-9f7e-ace1c841814b",
          "citation": "KNOVEL CONTENT",
          "doc_type": "KNOVEL CONTENT",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25a832ed-a684-4325-98f0-41b45a0ff62b",
          "citation": "Title DetailsCitationFood Additives Data Book",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dfb706b-4ba5-4df7-92db-9ea2343e8cc9",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54757c82-8e4a-4349-aa2e-d4181b2d1433",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=308",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=308",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a4a602d-85cf-4fd1-a7c5-215c3d808008",
          "citation": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-289.pdf",
          "url": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-289.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdb90dd9-3525-4eec-b0fc-3f24bd77152a",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9680dfc1-114c-40bb-ae00-2f325c7f96e8",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c6918ca-fefc-498f-9f65-65f0da8d42d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "532ba361-764f-454a-8b5b-eef8a382ed34",
          "citation": "SRS import [245K560GAW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=245K560GAW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78ca352c-b1ef-4317-be63-cf9e5d1bb6e7",
          "citation": "Food Additives Data Book",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60656d2f-6033-475b-8624-c7288c8d1734",
          "citation": "MONOAMMONIUM L-GLUTAMATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef6dd94b-621e-064a-b4f1-007c1073bacf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7558-63-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3aea4eb6-9ec0-a8f5-0891-2965c1dcfb68",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "3ac5f1fd-a652-4ff5-b0b3-d1851fa88939",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "22f0c161-6b2d-4cd8-b6ad-0112fcf7eb1f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "af021b09-7e38-46a0-9601-46779a1910af",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d42b3fef-15c4-5fdf-812a-9fb169306bf9",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4b8eec2d-2cfc-4b87-9ab5-9b1e78bbdaa2",
          "id": "4b8eec2d-2cfc-4b87-9ab5-9b1e78bbdaa2",
          "molfile": "\n  Marvin  01132103572D          \n\n  1  0  0  0  1  0            999 V2000\n    7.6069   -2.6845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "N",
          "formula": "H3N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "81620d94-6132-4fee-961e-19b1ebf471d1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0305",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "01ad523b-6985-4225-ae45-3e313afe5498",
          "id": "01ad523b-6985-4225-ae45-3e313afe5498",
          "molfile": "\n  Marvin  01132100242D          \n\n 10  9  0  0  1  0            999 V2000\n    3.5103   -3.8141    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.5103   -4.6391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2248   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9393   -3.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6538   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6538   -2.5765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3683   -3.8141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7959   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0815   -3.8141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7959   -2.5765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)O)[C@@H](C(=O)O)N",
          "formula": "C5H9NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5c159fec-ea0b-4332-adb1-1b647e696f7b"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "147.1295",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a80011c4-5720-4aee-a00f-03468b067ab6",
      "version": "8",
      "structure": {
        "id": "2eb8a4e0-d285-4916-beb2-f7a415e774d1",
        "molfile": "\n  Marvin  01132102312D          \n\n 11  9  0  0  1  0            999 V2000\n    7.6069   -2.6845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7959   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0815   -3.8141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5103   -3.8141    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.2248   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9393   -3.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6538   -3.4016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6538   -2.5765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3683   -3.8141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5103   -4.6391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7959   -2.5765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n  4 10  1  6  0  0  0\n 11  2  1  0  0  0  0\nM  END",
        "smiles": "C(CC(=O)O)[C@@H](C(=O)O)N.N",
        "formula": "C5H9NO4.H3N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "164.16",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "532ba361-764f-454a-8b5b-eef8a382ed34",
          "78ca352c-b1ef-4317-be63-cf9e5d1bb6e7"
        ],
        "stereo_centers": 1
      },
      "unii": "245K560GAW"
    }
  ]
}