{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "567f1e9a-c81a-4bd9-b30f-2c56971cb033",
          "code": "55589-62-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55589-62-3",
          "code_system": "CAS",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d",
            "06feadb5-7d71-49af-a3df-11a6e61a8621"
          ]
        },
        {
          "uuid": "8f1aa66f-3c52-4305-b121-99917e49ebfc",
          "code": "C76512",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76512",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "cd0b3586-06e7-4444-898a-e2e2a2c1f598",
          "code": "C006362",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67006362",
          "code_system": "MESH",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "4a90f18d-5a63-4c50-bdda-c2a200b6a828",
          "code": "21 CFR 172.800",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart I--Multipurpose Additives|Sec. 172.800 Acesulfame potassium.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=172.800",
          "code_system": "CFR",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "b75bd0ee-9fd2-4f23-a70e-5b47ac47f8f6",
          "code": "ACESULFAME POTASSIUM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acesulfame_potassium",
          "code_system": "WIKIPEDIA",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "bb110252-86b4-4a86-ab5e-c505f1746a73",
          "code": "INS-950",
          "comments": "Codex Alimentarius|Functional Classification|Flavour enhancer|Sweetener",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=104",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "af77277d-0c94-4c91-b099-452b4546be9f",
          "code": "INS-950",
          "comments": "JECFA|Functional Classification|Food Additive|FLAVOUR_ENHANCER|SWEETENER",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=950",
          "code_system": "JECFA EVALUATION",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "e98e174f-655a-4fcc-83f0-64964fc20caa",
          "code": "1310545",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1310545/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "2498bc77-1b1b-4a24-8368-609007f9d1bf",
          "code": "m1308",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1308?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "f9bfcf33-af9e-4fcf-8f3b-353d7f17f490",
          "code": "SUB11688MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "43af5b7d-64f0-4e93-987b-cb09239a122b",
          "code": "CHEMBL176687",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL176687",
          "code_system": "ChEMBL",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "9b56f19d-460f-4242-9997-6779921f8ad4",
          "code": "259-715-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.269",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cc3b89be-f384-4e8c-92fd-50a4e13c316d"
          ]
        },
        {
          "uuid": "15b89907-fda7-6f88-4d9b-c4d42ac1c38a",
          "code": "DTXSID1030606",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1030606",
          "code_system": "EPA CompTox",
          "references": [
            "d5a8f5a9-1b85-0f13-c865-6df6f2bfe206"
          ]
        },
        {
          "uuid": "0cc55729-641e-b068-9783-ea8f23507f18",
          "code": "C283",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Artificial Sweetener",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C283",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8c4c0db8-7f8c-f8a5-ee64-90a4a7d476a6"
          ]
        },
        {
          "uuid": "047a3dfe-f210-f814-1b14-e09b2f16ad18",
          "code": "11074431",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11074431",
          "code_system": "PUBCHEM",
          "references": [
            "7a463cdc-57a2-dfec-25b1-380b05dac21d"
          ]
        },
        {
          "uuid": "d522e637-1ede-6ab5-12aa-979c2cbf8468",
          "code": "1179 (Number of products:14)",
          "comments": "Dietary Supplement Label Database|Other|Acesulfame potassium",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1179&item=Acesulfame potassium",
          "code_system": "DSLD",
          "references": [
            "8c4c0db8-7f8c-f8a5-ee64-90a4a7d476a6"
          ]
        },
        {
          "uuid": "68c990e0-e83c-4d55-a4a4-b70db56038d6",
          "code": "23OV73Q5G9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "47680993-5e06-1e73-b43a-49fdb2bde107",
          "code": "1002505",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1002505",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "8c4c0db8-7f8c-f8a5-ee64-90a4a7d476a6"
          ]
        },
        {
          "uuid": "60b96b12-9d92-5513-58fa-be4a0f7790ea",
          "code": "100000076648",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7e264516-f4b1-6d4e-fe9a-d7247caa4048"
          ]
        },
        {
          "uuid": "534a79d7-df01-2414-c230-49df9357abdb",
          "code": "23OV73Q5G9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=23OV73Q5G9",
          "code_system": "DAILYMED",
          "references": [
            "6af9e2aa-1465-7155-0514-d68c31014ddc"
          ]
        },
        {
          "uuid": "52575cd1-207f-bc91-7883-88d7ac565d3d",
          "code": "760104",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=760104",
          "code_system": "NSC",
          "references": [
            "047d1728-f860-0440-42e9-bac7deabbe11"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c8add5b3-7571-416c-a00a-c31c8a9d05fc",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "65f657c5-b6bf-43fd-8c15-e05f6928d87a",
            "refuuid": "852b6dda-696e-40a2-894c-741235804de3",
            "name": "ACESULFAME",
            "unii": "MA3UYZ6K1H",
            "linking_id": "MA3UYZ6K1H",
            "ref_pname": "ACESULFAME",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "71914faa-c5eb-44fb-ba56-560d2c5af447",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "001efea3-8ad0-42c7-9a79-e2cc50b72485",
            "refuuid": "852b6dda-696e-40a2-894c-741235804de3",
            "name": "ACESULFAME",
            "unii": "MA3UYZ6K1H",
            "linking_id": "MA3UYZ6K1H",
            "ref_pname": "ACESULFAME",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "836e2f12-1499-4bf6-ad22-3cf8952f7b02",
          "amount": {
            "uuid": "39a79d95-59b9-4d8e-a827-4f15d2c72a2d",
            "low": 3,
            "units": "PPM"
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "7ca52756-e0d1-cc05-5438-434553ce9e3c"
          ],
          "related_substance": {
            "uuid": "5a02ce08-9d59-49a1-bd9b-0b5507a1148f",
            "refuuid": "e0a750a8-b532-4432-a873-c5422ff06356",
            "name": "FLUORIDE ION",
            "unii": "Q80VPU408O",
            "linking_id": "Q80VPU408O",
            "ref_pname": "FLUORIDE ION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "062a2650-e3fc-40d6-bb8e-97b0a6ca9d22",
          "amount": {
            "uuid": "bd4d9c4e-275b-4bfd-99b2-acfbb31d5f93",
            "units": "PPM",
            "high_limit": 20
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "548a2d8f-386c-474b-bd64-809d2557d9fb"
          ],
          "related_substance": {
            "uuid": "3947b779-675c-423b-a893-e9c1efa5b6c5",
            "refuuid": "530a3786-54c6-431d-a4bc-cc9fadd2d3fb",
            "name": "5-CHLOROACESULFAME",
            "unii": "98K78OBT7F",
            "linking_id": "98K78OBT7F",
            "ref_pname": "5-CHLOROACESULFAME"
          }
        },
        {
          "uuid": "3e223473-2a19-44f8-8047-93bb2c881685",
          "amount": {
            "uuid": "4728ab68-7f2b-47fc-a95a-e5d13401ed9d",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.125
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "fcecb871-8aa3-4679-ba8d-a6edfc315e93"
          ],
          "related_substance": {
            "uuid": "cd98ceab-4ec8-4a0a-a307-b7366de582f2",
            "refuuid": "421abd37-3f74-49fb-b26b-fa96147ecb94",
            "name": "ACETOACETAMIDE",
            "unii": "6O9U7CFY0T",
            "linking_id": "6O9U7CFY0T",
            "ref_pname": "ACETOACETAMIDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0436f644-6a6c-4d5f-8a91-9d106feda89e",
          "name": "1,2,3-OXATHIAZIN-4(3H)-ONE, 6-METHYL-, 2,2-DIOXIDE, POTASSIUM SALT (1:1)",
          "stdName": "1,2,3-OXATHIAZIN-4(3H)-ONE, 6-METHYL-, 2,2-DIOXIDE, POTASSIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfd6351-fbf3-4e5b-b3c0-607c5561b969"
          ],
          "display_name": false
        },
        {
          "uuid": "21f7db96-168a-42d5-916a-7ec1b40ec0ac",
          "name": "3,4-Dihydro-6-methyl-1,2,3-oxathiazine-4-one-2,2-dioxide potassium salt",
          "stdName": "3,4-DIHYDRO-6-METHYL-1,2,3-OXATHIAZINE-4-ONE-2,2-DIOXIDE POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9f2ca9f-5172-490c-bd61-ceafabea06b1"
          ],
          "display_name": false
        },
        {
          "uuid": "22695e15-6d1c-4059-849b-733aa288d3e5",
          "name": "6-METHYL-1,2,3-OXATHIAZINE-4(3H)-ONE-2,2-DIOXIDE POTASSIUM SALT",
          "stdName": "6-METHYL-1,2,3-OXATHIAZINE-4(3H)-ONE-2,2-DIOXIDE POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9f2ca9f-5172-490c-bd61-ceafabea06b1"
          ],
          "display_name": false
        },
        {
          "uuid": "ea13fd00-8316-490b-9cf2-51c73c6eb3f6",
          "name": "ACESULFAME K",
          "stdName": "ACESULFAME K",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e93d66e-20a0-4b51-afda-864a50784d10"
          ],
          "display_name": false
        },
        {
          "uuid": "0cf1b325-1cd4-43de-9f85-d3f4b1c015be",
          "name": "ACESULFAME POTASSIUM",
          "stdName": "ACESULFAME POTASSIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e6ddcf1-8f55-4c40-90bf-987d6e539955",
            "3e006b9e-cfc4-4122-ab82-00f40556812b",
            "1b10678c-3a3f-4d2a-b0df-90f1ace1d0cd",
            "4f6f9dea-41b2-4dde-946d-cb20c11b4e9c",
            "afe1d14e-af48-43d2-84e8-fd3cb2691bec",
            "8022f3cc-d6a1-4fd3-9d87-ce03bb4ec923",
            "79e51a3e-0dd7-4483-b6e1-d221d87f71af",
            "204135bc-01bf-44da-a1f7-bd1c976f4a2a",
            "7aa16dcf-dc2e-4132-806c-6491e394d26a",
            "d02b9fc6-a34f-4a81-a34e-dbad21951e2e",
            "ffa2d199-4d0a-4558-b551-c7d8a128aefb",
            "18ed0053-57f4-4eca-b99c-538866409374"
          ],
          "display_name": true
        },
        {
          "uuid": "eeb89850-0e76-49c4-b315-e13f2c4962fe",
          "name": "ACESULFAME POTASSIUM SALT",
          "stdName": "ACESULFAME POTASSIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d545e4e1-3491-4a81-a27a-3622064fc6d6",
            "6d94b63f-aa5d-4c2d-8717-8108391cc3b0"
          ],
          "display_name": false
        },
        {
          "uuid": "149a4284-9b23-4a04-8694-9c7fceed5688",
          "name": "ACESULFAME POTASSIUM SALT [MI]",
          "stdName": "ACESULFAME POTASSIUM SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d545e4e1-3491-4a81-a27a-3622064fc6d6"
          ],
          "display_name": false
        },
        {
          "uuid": "c8f084ed-1ce2-02a9-1ebf-1325a998b67c",
          "name": "ACESULFAME POTASSIUM [EP MONOGRAPH]",
          "stdName": "ACESULFAME POTASSIUM [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d051ebf1-2975-66a5-c201-33a58d89c829"
          ],
          "display_name": false
        },
        {
          "uuid": "1d409abb-8c13-43b1-8497-2bc47215f77f",
          "name": "ACESULFAME POTASSIUM [FCC]",
          "stdName": "ACESULFAME POTASSIUM [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e6ddcf1-8f55-4c40-90bf-987d6e539955"
          ],
          "display_name": false
        },
        {
          "uuid": "3307dda9-0890-47ee-ba51-18a6e0e6efb9",
          "name": "ACESULFAME POTASSIUM [II]",
          "stdName": "ACESULFAME POTASSIUM [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f6f9dea-41b2-4dde-946d-cb20c11b4e9c"
          ],
          "display_name": false
        },
        {
          "uuid": "cdb2b675-3785-474e-9044-19798d354249",
          "name": "ACESULFAME POTASSIUM [MART.]",
          "stdName": "ACESULFAME POTASSIUM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e006b9e-cfc4-4122-ab82-00f40556812b"
          ],
          "display_name": false
        },
        {
          "uuid": "2a5e9fe0-38dd-4316-996f-b5890639f7ea",
          "name": "ACESULFAME POTASSIUM [USP-RS]",
          "stdName": "ACESULFAME POTASSIUM [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "204135bc-01bf-44da-a1f7-bd1c976f4a2a"
          ],
          "display_name": false
        },
        {
          "uuid": "8f33bd95-268f-c27d-8a6c-7bcbd4926b0d",
          "name": "Acesulfame potassium [WHO-DD]",
          "stdName": "ACESULFAME POTASSIUM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0e25cab-b4c5-c612-a937-9b26b474b2a1"
          ],
          "display_name": false
        },
        {
          "uuid": "54bf2be4-452c-4af7-8cf0-7d10ed2f32d4",
          "name": "E 950",
          "stdName": "E 950",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfd6351-fbf3-4e5b-b3c0-607c5561b969"
          ],
          "display_name": false
        },
        {
          "uuid": "29c8f96b-2dbc-4457-b3b6-8f95cc2a1502",
          "name": "E-950",
          "stdName": "E-950",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6d5314b-03ff-4fde-9b52-94c3811adae3"
          ],
          "display_name": false
        },
        {
          "uuid": "f0a46d37-355c-4aa9-a2a9-f0599361995f",
          "name": "INS NO.950",
          "stdName": "INS NO.950",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6d5314b-03ff-4fde-9b52-94c3811adae3"
          ],
          "display_name": false
        },
        {
          "uuid": "dff26079-2369-4f18-bd02-0bca9c4532be",
          "name": "INS-950",
          "stdName": "INS-950",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6d5314b-03ff-4fde-9b52-94c3811adae3"
          ],
          "display_name": false
        },
        {
          "uuid": "d2dd7aca-345e-beb6-0633-5e62c8128267",
          "name": "NSC-760104",
          "stdName": "NSC-760104",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "047d1728-f860-0440-42e9-bac7deabbe11"
          ],
          "display_name": false
        },
        {
          "uuid": "917a4513-140c-420e-b714-3014d89d3006",
          "name": "OTIZON",
          "stdName": "OTIZON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfd6351-fbf3-4e5b-b3c0-607c5561b969"
          ],
          "display_name": false
        },
        {
          "uuid": "02dfeea6-fd29-4ec9-ae55-fc4644a9213b",
          "name": "POTASSIUM ACESULFAMATE",
          "stdName": "POTASSIUM ACESULFAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfd6351-fbf3-4e5b-b3c0-607c5561b969"
          ],
          "display_name": false
        },
        {
          "uuid": "77232e26-f0c4-4f66-8ccb-37916238d4c9",
          "name": "POTASSIUM ACESULFAME",
          "stdName": "POTASSIUM ACESULFAME",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f4606eb9-5522-472c-9af3-036cf8f6af43",
            "19d85f58-eae1-4b60-add3-b3ba5d8892fc",
            "dd4c37c3-81ed-4945-8477-11f1672c46b0"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2d0e9c49-10db-4375-882c-2e9909e88cec",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "88e7c807-0de8-479d-b55d-035f1cc7b86a",
          "name": "SUNETT D",
          "stdName": "SUNETT D",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acfd6351-fbf3-4e5b-b3c0-607c5561b969"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "548a2d8f-386c-474b-bd64-809d2557d9fb",
          "citation": "European Pharmacopoeia Online 9.8, Acesulfame potassium Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ae2b9847-fbff-4011-8b4f-ec312c5a39c9",
          "citation": "European Pharmacopoeia Online 9.8, Acesulfame potassium Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4f6f9dea-41b2-4dde-946d-cb20c11b4e9c",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d9f2ca9f-5172-490c-bd61-ceafabea06b1",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e93d66e-20a0-4b51-afda-864a50784d10",
          "citation": "EMA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afe1d14e-af48-43d2-84e8-fd3cb2691bec",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e006b9e-cfc4-4122-ab82-00f40556812b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e6ddcf1-8f55-4c40-90bf-987d6e539955",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd4c37c3-81ed-4945-8477-11f1672c46b0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "204135bc-01bf-44da-a1f7-bd1c976f4a2a",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7aa16dcf-dc2e-4132-806c-6491e394d26a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4606eb9-5522-472c-9af3-036cf8f6af43",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d545e4e1-3491-4a81-a27a-3622064fc6d6",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acfd6351-fbf3-4e5b-b3c0-607c5561b969",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6d5314b-03ff-4fde-9b52-94c3811adae3",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=104",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=104",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc3b89be-f384-4e8c-92fd-50a4e13c316d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6720d665-13ba-458d-8f27-3851e2af3dfd",
          "citation": "SRS import [23OV73Q5G9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=23OV73Q5G9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389669000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c76f7d49-cd21-441f-9eaa-613492c01bd5",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18ed0053-57f4-4eca-b99c-538866409374",
          "citation": "ACESULFAME POTASSIUM [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b10678c-3a3f-4d2a-b0df-90f1ace1d0cd",
          "citation": "ACESULFAME POTASSIUM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ffa2d199-4d0a-4558-b551-c7d8a128aefb",
          "citation": "ACESULFAME POTASSIUM [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8022f3cc-d6a1-4fd3-9d87-ce03bb4ec923",
          "citation": "ACESULFAME POTASSIUM [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "19d85f58-eae1-4b60-add3-b3ba5d8892fc",
          "citation": "POTASSIUM ACESULFAME [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d02b9fc6-a34f-4a81-a34e-dbad21951e2e",
          "citation": "ACESULFAME POTASSIUM [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79e51a3e-0dd7-4483-b6e1-d221d87f71af",
          "citation": "ACESULFAME POTASSIUM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d94b63f-aa5d-4c2d-8717-8108391cc3b0",
          "citation": "ACESULFAME POTASSIUM SALT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d5a8f5a9-1b85-0f13-c865-6df6f2bfe206",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=55589-62-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7ca52756-e0d1-cc05-5438-434553ce9e3c",
          "citation": "USP/NF NF Monographs: Acesulfame Potassium",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "7e264516-f4b1-6d4e-fe9a-d7247caa4048",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8c4c0db8-7f8c-f8a5-ee64-90a4a7d476a6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7a463cdc-57a2-dfec-25b1-380b05dac21d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "06feadb5-7d71-49af-a3df-11a6e61a8621",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ca730380-3717-55be-972a-a14cf6fcc135",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "d051ebf1-2975-66a5-c201-33a58d89c829",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "047d1728-f860-0440-42e9-bac7deabbe11",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fcecb871-8aa3-4679-ba8d-a6edfc315e93",
          "citation": "European Pharmacopoeia Online 9.8, Acesulfame potassium Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6af9e2aa-1465-7155-0514-d68c31014ddc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e0e25cab-b4c5-c612-a937-9b26b474b2a1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bec8fa10-397e-471a-98fe-045e6b31fa6c",
          "id": "bec8fa10-397e-471a-98fe-045e6b31fa6c",
          "molfile": "\n  Marvin  01132109522D          \n\n  1  0  0  0  0  0            999 V2000\n    2.8126   -0.4008    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[K+]",
          "formula": "K",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "51eabfac-2e4b-4b0f-a921-9e23497ac7fa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "39.0983",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "66c056ad-a835-4f39-9996-a098f53da967",
          "id": "66c056ad-a835-4f39-9996-a098f53da967",
          "molfile": "\n  Marvin  01132105212D          \n\n 10 10  0  0  0  0            999 V2000\n   -1.8313    0.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1161    0.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1161   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4008   -0.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4008   -1.6620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3109   -0.4250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3109    0.4008    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7187    1.1195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1057    0.1901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4008    0.8189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 10  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC(=O)NS(=O)(=O)O1",
          "formula": "C4H5NO4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "657d2171-2e64-44d8-b04f-8325dd70ef04"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "163.1531",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7afdfc8d-30a2-4a85-93b2-2ae80e18358f",
      "version": "22",
      "structure": {
        "id": "a16f16a3-3475-4a90-aafa-cefd82ed5daa",
        "molfile": "\n  Marvin  01132108232D          \n\n 11 10  0  0  0  0            999 V2000\n    0.3109    0.4008    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3109   -0.4250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4008    0.8189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7187    1.1195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1057    0.1901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4008   -0.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1161    0.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1161   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4008   -1.6620    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.8313    0.8120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8126   -0.4008    0.0000 K   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  2  0  0  0  0\n  2  6  2  0  0  0  0\n  3  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  7  8  2  0  0  0  0\nM  CHG  2   9  -1  11   1\nM  END",
        "smiles": "CC1=CC(=NS(=O)(=O)O1)[O-].[K+]",
        "formula": "C4H4NO4S.K",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "201.2434",
        "optical_activity": "NONE",
        "references": [
          "c76f7d49-cd21-441f-9eaa-613492c01bd5",
          "6720d665-13ba-458d-8f27-3851e2af3dfd"
        ],
        "stereo_centers": 0
      },
      "unii": "23OV73Q5G9"
    }
  ]
}