{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c3e77b1e-e60a-4e9f-a070-e8a5fb407e76",
          "code": "55921-65-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55921-65-8",
          "code_system": "CAS",
          "references": [
            "fcbeb9c6-e6ee-4046-b2bc-15ec7e667e3e",
            "2c71152c-bd6d-4914-bf86-569d8ac29c2a"
          ]
        },
        {
          "uuid": "fedf79ff-1749-4090-a156-6a147590f02b",
          "code": "1741137",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1741137/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "fcbeb9c6-e6ee-4046-b2bc-15ec7e667e3e"
          ]
        },
        {
          "uuid": "e3b55e64-d8bd-48c5-acf4-ac9693c5a9f4",
          "code": "23GGI87A7F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a2a19826-2184-7774-9e2a-64cb82c6da02",
          "code": "DTXSID701021789",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701021789",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "fa17b2a8-d061-ec0d-c5aa-5109a9c285e9",
          "code": "23GGI87A7F",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=23GGI87A7F",
          "code_system": "DAILYMED",
          "references": [
            "950179cb-79ec-4c9b-9bd6-09af7c11247b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "92f86714-109b-46c5-bf44-886df1f5a984",
          "name": "2,4-PYRIMIDINEDIAMINE, 6-(1-PYRROLIDINYL)-, 3-OXIDE",
          "stdName": "2,4-PYRIMIDINEDIAMINE, 6-(1-PYRROLIDINYL)-, 3-OXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85c7b862-a71b-4c80-bcfc-67685ceabaad",
            "2c627073-5e07-4fd3-89d0-1a78731c1f1b"
          ],
          "display_name": false
        },
        {
          "uuid": "8af5e479-a34d-49b6-875f-822fa88b392a",
          "name": "PYRROLIDINYL DIAMINOPYRIMIDINE OXIDE",
          "stdName": "PYRROLIDINYL DIAMINOPYRIMIDINE OXIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85c7b862-a71b-4c80-bcfc-67685ceabaad",
            "2c627073-5e07-4fd3-89d0-1a78731c1f1b",
            "7b676084-5403-45b1-be0e-93b805f15854"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "aa2446c6-f413-47a1-be10-ee013ea7bfe8",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b003d70f-4108-4cfc-a7e9-240eab4a79f3",
          "name": "TRIAMINODIL",
          "stdName": "TRIAMINODIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85c7b862-a71b-4c80-bcfc-67685ceabaad",
            "2c627073-5e07-4fd3-89d0-1a78731c1f1b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2c627073-5e07-4fd3-89d0-1a78731c1f1b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "85c7b862-a71b-4c80-bcfc-67685ceabaad",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcbeb9c6-e6ee-4046-b2bc-15ec7e667e3e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ece58c7-066f-407b-8d81-403874427789",
          "citation": "SRS import [23GGI87A7F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=23GGI87A7F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b676084-5403-45b1-be0e-93b805f15854",
          "citation": "PYRROLIDINYL DIAMINOPYRIMIDINE OXIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2c71152c-bd6d-4914-bf86-569d8ac29c2a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "950179cb-79ec-4c9b-9bd6-09af7c11247b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "531d8033-b1b4-4280-a6b7-345b15ba30c0",
          "id": "531d8033-b1b4-4280-a6b7-345b15ba30c0",
          "molfile": "\n  Marvin  01132104202D          \n\n 14 15  0  0  0  0            999 V2000\n    7.3416   -0.8290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3416   -1.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6302   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6302   -2.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3436   -3.2832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0451   -2.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6225   -3.4530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0451   -2.0537    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.9168   -1.4748    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.9152   -3.2924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8290   -4.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0221   -4.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6094   -3.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1617   -2.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4 10  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  CHG  2   8   1   9  -1\nM  END",
          "smiles": "C1CCN(C1)c2cc(N)[n+](c(N)n2)[O-]",
          "formula": "C8H13N5O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4fb217fa-ff2a-45f8-b9b7-a020607de23f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "195.222",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e99b6c10-41b6-4816-b972-dc6dc2c96e51",
      "version": "6",
      "structure": {
        "id": "e6d4e12a-887e-474e-b0d7-e6fb96f4867e",
        "molfile": "\n  Marvin  01132111572D          \n\n 14 15  0  0  0  0            999 V2000\n    8.6225   -3.4530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0451   -2.8755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0451   -2.0537    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.9168   -1.4748    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3416   -1.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3416   -0.8290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6302   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6302   -2.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3436   -3.2832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9152   -3.2924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8290   -4.1129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0221   -4.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6094   -3.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1617   -2.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9  2  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 10 14  1  0  0  0  0\nM  CHG  2   3   1   4  -1\nM  END",
        "smiles": "C1CCN(C1)c2cc(N)[n+](c(N)n2)[O-]",
        "formula": "C8H13N5O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "195.222",
        "optical_activity": "NONE",
        "references": [
          "2c627073-5e07-4fd3-89d0-1a78731c1f1b",
          "6ece58c7-066f-407b-8d81-403874427789"
        ],
        "stereo_centers": 0
      },
      "unii": "23GGI87A7F"
    }
  ]
}