{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8580dbbc-3699-434f-aebf-e49304f39ddf", "code": "3068-39-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3068-39-1", "code_system": "CAS", "references": [ "2b879cdd-1131-4049-9621-926a02ce308b", "738e16a8-d170-4ced-8266-0d8bced21080" ] }, { "uuid": "c3912cbb-dcc5-4823-9451-fa9cc9051a9b", "code": "221-326-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.388", "code_system": "ECHA (EC/EINECS)", "references": [ "2b879cdd-1131-4049-9621-926a02ce308b" ] }, { "uuid": "66b5aed8-b1d0-4392-a755-6719be7f3604", "code": "23DG89Z6G0", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7aa47422-c869-4882-b78f-eeef3fdad15c", "code": "DTXSID80883732", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80883732", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "0e6a433a-4db3-4c8c-9b93-cdd4df8637f8", "name": "BASIC RED 1:1", "stdName": "BASIC RED 1:1", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "a13bec7e-26c3-4e92-83e1-6b23c5614b4d", "f62b8aa4-6535-48c4-9426-0a68e48ab975", "cd4a653d-dc27-4af8-b8d1-4fbc549740ff" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "aec4a59c-52d9-4cc4-be18-5b6fe8149d18", "name_org": "INCI" } ] }, { "uuid": "d273502b-dc42-4ba4-adb6-821f519d5cd8", "name": "BASONYL 485", "stdName": "BASONYL 485", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "display_name": false }, { "uuid": "a956c388-a13b-4778-9b7e-94f8797a6141", "name": "BENZOIC ACID, 2-(6-(ETHYLAMINO)-3-(ETHYLIMINO)-2,7-DIMETHYL-3H-XANTHEN-9-YL)-, METHYL ESTER, MONOHYDROCHLORIDE", "stdName": "BENZOIC ACID, 2-(6-(ETHYLAMINO)-3-(ETHYLIMINO)-2,7-DIMETHYL-3H-XANTHEN-9-YL)-, METHYL ESTER, MONOHYDROCHLORIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "display_name": false }, { "uuid": "8722b162-8125-4e73-9ea0-8006c4cda5b8", "name": "BENZOIC ACID, O-(6-(ETHYLAMINO)-3-(ETHYLIMINO)-2,7-DIMETHYL-3H-XANTHEN-9-YL)-, METHYL ESTER, HYDROCHLORIDE", "stdName": "BENZOIC ACID, O-(6-(ETHYLAMINO)-3-(ETHYLIMINO)-2,7-DIMETHYL-3H-XANTHEN-9-YL)-, METHYL ESTER, HYDROCHLORIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "display_name": false }, { "uuid": "41be54c8-c9e2-4d6c-9a0a-7825e9fb4163", "name": "C.I. BASIC RED 1:1", "stdName": "C.I. BASIC RED 1:1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "display_name": false }, { "uuid": "ccbf2ef2-f972-4b30-b848-f1f2892f2b58", "name": "CI 45161", "stdName": "CI 45161", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "f62b8aa4-6535-48c4-9426-0a68e48ab975", "cd4a653d-dc27-4af8-b8d1-4fbc549740ff" ], "display_name": false }, { "uuid": "45bc10d6-c796-497e-b162-4679c5f8662a", "name": "RHODAMINE 590", "stdName": "RHODAMINE 590", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "display_name": false }, { "uuid": "7c12037a-6ebb-447f-a336-50ff9581d0a7", "name": "RHODAMINE F 4G", "stdName": "RHODAMINE F 4G", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "display_name": false }, { "uuid": "0bb1acba-4465-4166-a2f8-a0b7a42c1eb6", "name": "XANTHYLIUM, 3,6-BIS(ETHYLAMINO)-9-(2-(METHOXYCARBONYL)PHENYL)-2,7-DIMETHYL-, CHLORIDE (1:1)", "stdName": "XANTHYLIUM, 3,6-BIS(ETHYLAMINO)-9-(2-(METHOXYCARBONYL)PHENYL)-2,7-DIMETHYL-, CHLORIDE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "display_name": false } ], "references": [ { "uuid": "f62b8aa4-6535-48c4-9426-0a68e48ab975", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "cd4a653d-dc27-4af8-b8d1-4fbc549740ff", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "74994d1a-387f-44be-8fb4-6188c7ddb05c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2b879cdd-1131-4049-9621-926a02ce308b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391602000, "tags": [ "NOMEN" ] }, { "uuid": "ff4b24a9-36e2-465f-b759-457de1a7ed07", "citation": "SRS import [23DG89Z6G0]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=23DG89Z6G0", "doc_type": "SRS", "public_domain": true, "document_date": 1493391602000, "tags": [ "NOMEN" ] }, { "uuid": "a13bec7e-26c3-4e92-83e1-6b23c5614b4d", "citation": "BASIC RED 1:1 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "738e16a8-d170-4ced-8266-0d8bced21080", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2f770bd3-be15-46ff-af50-9d278fcf6cb8", "id": "2f770bd3-be15-46ff-af50-9d278fcf6cb8", "molfile": "\n Marvin 01132102332D \n\n 32 35 0 0 0 0 999 V2000\n 8.9741 -15.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6886 -14.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6886 -13.9657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4031 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1176 -13.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5466 -13.9657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2610 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9755 -13.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6899 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4045 -13.9657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2612 -14.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8932 -15.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6899 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4045 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9755 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2610 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5466 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5466 -11.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2610 -11.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2610 -10.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5466 -9.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -10.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -11.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0196 -11.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8221 -11.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4893 -10.5895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7140 -10.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1176 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4031 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6886 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 31 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 29 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 8 17 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 3 0 0 0\n 14 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 29 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 19 24 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 2 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "CCNc1cc2c(cc1C)c(-c3ccccc3C(=O)OC)c-4cc(C)c(=NCC)cc4o2", "formula": "C27H28N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "95fec7a3-9d9a-43bb-97e8-ad512fa4c79b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "428.5238", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "121810f5-1c0b-4e42-b9b6-979fe7e27379", "id": "121810f5-1c0b-4e42-b9b6-979fe7e27379", "molfile": "\n Marvin 01132101092D \n\n 1 0 0 0 0 0 999 V2000\n 12.6785 -15.3400 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "Cl", "formula": "ClH", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "cb9c3840-ea66-41ad-9404-413882555ff3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "36.4609", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3d719a56-cf65-4b88-8d7a-b5ace0250db2", "version": "4", "structure": { "id": "0343378c-bf26-48fa-9f5c-aa369a44cef1", "molfile": "\n Marvin 01132100292D \n\n 33 35 0 0 0 0 999 V2000\n 12.6785 -15.3400 0.0000 Cl 0 5 0 0 0 0 0 0 0 0 0 0\n 12.5466 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1176 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4031 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4031 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6886 -13.9657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6886 -14.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9741 -15.2032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1176 -13.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5466 -13.9657 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0\n 13.2610 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2610 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9755 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6899 -12.7282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4045 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6899 -13.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4045 -13.9657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2612 -14.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8932 -15.3085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9755 -13.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6886 -12.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5466 -11.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2610 -11.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2610 -10.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5466 -9.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -10.2532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8321 -11.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0196 -11.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8221 -11.7642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4893 -10.5895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7140 -10.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 6 2 0 0 0 0\n 11 10 1 0 0 0 0\n 3 11 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 2 0 0 0 0\n 2 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 18 22 2 0 0 0 0\n 22 13 1 0 0 0 0\n 5 23 1 0 0 0 0\n 2 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 24 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 32 33 1 0 0 0 0\nM CHG 2 1 -1 12 1\nM END", "smiles": "CCNc1cc2c(cc1C)c(-c3ccccc3C(=O)OC)c4cc(C)c(cc4[o+]2)NCC.[Cl-]", "formula": "C27H29N2O3.Cl", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "464.9847", "optical_activity": "NONE", "references": [ "ff4b24a9-36e2-465f-b759-457de1a7ed07", "74994d1a-387f-44be-8fb4-6188c7ddb05c" ], "stereo_centers": 0 }, "unii": "23DG89Z6G0" } ] }