{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a3042a08-b8f2-447c-b8b3-4e38a0e89599",
          "code": "113221-73-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=113221-73-1",
          "code_system": "CAS",
          "references": [
            "23701c75-9761-43b8-9cf5-e43190da4489",
            "ff3c1666-da78-44fa-a1a2-01921703d349"
          ]
        },
        {
          "uuid": "91cb38b1-e378-4929-a7b6-5579ba5a1090",
          "code": "86311",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86311",
          "code_system": "PUBCHEM",
          "references": [
            "23701c75-9761-43b8-9cf5-e43190da4489"
          ]
        },
        {
          "uuid": "b573d6bd-e08a-458b-9b7a-8f1a7c729669",
          "code": "234RB7A4FB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8fe4284e-259d-24ae-4418-dbc6e6b724fa",
          "code": "DTXSID30888752",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30888752",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1f113c46-6656-4b76-86ea-c8eb8a4a65cd",
          "name": "2-NAPHTHALENECARBOXALDEHYDE, 5,6,7,8-TETRAHYDRO-5,5,7,8,8-PENTAMETHYL-",
          "stdName": "2-NAPHTHALENECARBOXALDEHYDE, 5,6,7,8-TETRAHYDRO-5,5,7,8,8-PENTAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5507accd-4301-45a9-8067-3afd0f6fd031"
          ],
          "display_name": false
        },
        {
          "uuid": "9d09de27-a2f1-43c9-9b47-1b06a0e34034",
          "name": "5,6,7,8-TETRAHYDRO-5,5,7,8,8-PENTAMETHYL-2-NAPHTHALENECARBOXALDEHYDE",
          "stdName": "5,6,7,8-TETRAHYDRO-5,5,7,8,8-PENTAMETHYL-2-NAPHTHALENECARBOXALDEHYDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8caaa6c2-bead-44f8-b24f-32b0d778d1a7"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "5507accd-4301-45a9-8067-3afd0f6fd031",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8caaa6c2-bead-44f8-b24f-32b0d778d1a7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23701c75-9761-43b8-9cf5-e43190da4489",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393609000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdb350b0-4a84-40ab-911e-99557c30bec4",
          "citation": "SRS import [234RB7A4FB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=234RB7A4FB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393609000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff3c1666-da78-44fa-a1a2-01921703d349",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6dc475a7-c697-4665-945b-c28095b45d79",
          "id": "6dc475a7-c697-4665-945b-c28095b45d79",
          "molfile": "\n  Marvin  01132105422D          \n\n 17 18  0  0  0  0            999 V2000\n    8.4971   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7826   -4.8459    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7826   -4.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0681   -3.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5984   -2.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -2.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3536   -4.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6391   -3.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9247   -4.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9246   -4.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2102   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2102   -6.0835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6391   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3536   -4.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0681   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -5.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5984   -5.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 15  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 14  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 13  2  0  0  0  0\n 12 11  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
          "smiles": "CC1CC(C)(C)c2ccc(cc2C1(C)C)C=O",
          "formula": "C16H22O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc9f39ee-cdb5-4b73-bd01-f2cbfee2881b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "230.3459",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3dbecbb8-a058-4867-b4db-8b3774b24736",
      "version": "3",
      "structure": {
        "id": "4a0e07f6-87a1-4671-b49f-e25b4970b24f",
        "molfile": "\n  Marvin  01132103522D          \n\n 17 18  0  0  0  0            999 V2000\n    4.2102   -6.0835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2102   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9246   -4.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6391   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3536   -4.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3536   -4.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0681   -3.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5984   -2.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -2.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7826   -4.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7826   -4.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4971   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0681   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5378   -5.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5984   -5.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6391   -3.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9247   -4.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13  5  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16  6  2  0  0  0  0\n 17 16  1  0  0  0  0\n  3 17  2  0  0  0  0\nM  END",
        "smiles": "CC1CC(C)(C)c2ccc(cc2C1(C)C)C=O",
        "formula": "C16H22O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "230.3459",
        "optical_activity": "( + / - )",
        "references": [
          "5507accd-4301-45a9-8067-3afd0f6fd031",
          "bdb350b0-4a84-40ab-911e-99557c30bec4"
        ],
        "stereo_centers": 1
      },
      "unii": "234RB7A4FB"
    }
  ]
}