{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b508ef7c-2247-4beb-b1a6-a27bb6c33ad7",
          "code": "193313",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/193313",
          "code_system": "PUBCHEM",
          "references": [
            "20a048bf-2742-4a95-b7f5-2ebe611705af"
          ]
        },
        {
          "uuid": "7d123797-cd9b-47cd-aff3-a147c4a0963e",
          "code": "566-19-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=566-19-8",
          "code_system": "CAS",
          "references": [
            "20a048bf-2742-4a95-b7f5-2ebe611705af",
            "9fd06c31-2dda-4e9d-955c-7c9834b10fcc"
          ]
        },
        {
          "uuid": "072e0190-e2d0-4623-a15f-f73c7e4dac03",
          "code": "C002914",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67002914",
          "code_system": "MESH",
          "references": [
            "20a048bf-2742-4a95-b7f5-2ebe611705af"
          ]
        },
        {
          "uuid": "3a1cfbb8-8431-4b47-8d4b-90c9e4da3f56",
          "code": "7-KETO-DHEA",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/7-Keto-DHEA",
          "code_system": "WIKIPEDIA",
          "references": [
            "20a048bf-2742-4a95-b7f5-2ebe611705af"
          ]
        },
        {
          "uuid": "fde7f3e3-6840-4f92-9e70-492e8281200b",
          "code": "1427084",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427084/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "20a048bf-2742-4a95-b7f5-2ebe611705af"
          ]
        },
        {
          "uuid": "b86f30f0-527b-420f-8b20-964be4d96c76",
          "code": "SUB120413",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "20a048bf-2742-4a95-b7f5-2ebe611705af"
          ]
        },
        {
          "uuid": "1ad4ce55-6b41-e900-0c73-551696908996",
          "code": "395 (Number of products:72)",
          "comments": "Dietary Supplement Label Database|Chemical|7-KETO-DHEA",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=395&item=7-KETO-DHEA",
          "code_system": "DSLD",
          "references": [
            "c24cd893-3018-468d-f833-502a03729bf6"
          ]
        },
        {
          "uuid": "153582bf-1af3-4d29-a8a8-65cac8988c69",
          "code": "2334LJD2E9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d5c2d554-ecb9-2390-a0b5-52a180fce238",
          "code": "100000143492",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bf3050ee-17fb-4182-d7a8-93859d9cb636"
          ]
        },
        {
          "uuid": "fe23f09b-5573-caf1-b2db-b325c527dbc3",
          "code": "DTXSID801024029",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801024029",
          "code_system": "EPA CompTox",
          "references": [
            "c24cd893-3018-468d-f833-502a03729bf6"
          ]
        },
        {
          "uuid": "93f6f6b2-497a-f8f3-0d7d-de2015728421",
          "code": "2334LJD2E9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=2334LJD2E9",
          "code_system": "DAILYMED",
          "references": [
            "2bc727c3-5b5c-3754-e4b5-4c89545f92ce"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "58278fe1-1e3a-422d-891e-f6dc9bd6b90a",
          "type": "PRODRUG->METABOLITE ACTIVE",
          "references": [
            "f16a716f-7f53-2914-5e65-08fb28fa1b26"
          ],
          "related_substance": {
            "uuid": "8b64532a-3787-4fe6-8ee7-d57f01ecb627",
            "refuuid": "09b485be-82f0-4889-a4d2-d78f3419844c",
            "name": "7-OXODEHYDROEPIANDROSTERONE 3-ACETATE",
            "unii": "84RQ0XOM11",
            "linking_id": "84RQ0XOM11",
            "ref_pname": "7-OXODEHYDROEPIANDROSTERONE 3-ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "82155348-1452-4d07-bc4a-aaf17ed0a5ca",
          "type": "ACTIVE MOIETY",
          "references": [
            "f16a716f-7f53-2914-5e65-08fb28fa1b26"
          ],
          "related_substance": {
            "uuid": "6aa44169-9640-4494-b73b-dc524201091b",
            "refuuid": "c2006042-619e-48f7-8f8b-5c50d0c3c44a",
            "name": "7-KETO-DEHYDROEPIANDROSTERONE",
            "unii": "2334LJD2E9",
            "linking_id": "2334LJD2E9",
            "ref_pname": "7-KETO-DEHYDROEPIANDROSTERONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1c46ee51-50fa-4ca9-ba39-e8eabf73fa3c",
          "name": "7-KETO-DEHYDROEPIANDROSTERONE",
          "stdName": "7-KETO-DEHYDROEPIANDROSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "283a2e5b-70a5-4dd7-893a-7e8fda49255b",
            "c056d2d3-46f7-4695-89b4-4808bd44d628",
            "0afda6ab-315c-43e8-bf04-e1253ded00b4",
            "1bf85ccc-b034-4471-8c2f-aca7c42c8c2b"
          ],
          "display_name": true
        },
        {
          "uuid": "686fc492-3951-4cdc-8da0-64505d7300d7",
          "name": "7-KETO-DHEA",
          "stdName": "7-KETO-DHEA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc4bcc9d-7ce4-4393-9155-a5a55442c8c2",
            "1bf85ccc-b034-4471-8c2f-aca7c42c8c2b"
          ],
          "display_name": false
        },
        {
          "uuid": "027932a5-a19a-4315-92ef-e97c238d052e",
          "name": "7-KETODEHYDROEPIANDROSTERONE",
          "stdName": "7-KETODEHYDROEPIANDROSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc4bcc9d-7ce4-4393-9155-a5a55442c8c2",
            "1bf85ccc-b034-4471-8c2f-aca7c42c8c2b"
          ],
          "display_name": false
        },
        {
          "uuid": "fc3252c4-f3dc-49ec-9cc8-b219071d378a",
          "name": "7-OXO-DEHYDROEPIANDROSTERONE",
          "stdName": "7-OXO-DEHYDROEPIANDROSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc4bcc9d-7ce4-4393-9155-a5a55442c8c2",
            "1bf85ccc-b034-4471-8c2f-aca7c42c8c2b"
          ],
          "display_name": false
        },
        {
          "uuid": "a85772e9-3610-416b-bfe1-6fc172cd054c",
          "name": "7-OXO-PRASTERONE",
          "stdName": "7-OXO-PRASTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac86b528-de9c-43de-857b-885ac93d8530"
          ],
          "display_name": false
        },
        {
          "uuid": "19f83267-31ed-453c-b1c1-009a6f6754f4",
          "name": "7-OXODEHYDROEPIANDROSTERONE",
          "stdName": "7-OXODEHYDROEPIANDROSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c3ed3e9-a39d-4e4c-a11d-c0fc7ba82bb4",
            "1bf85ccc-b034-4471-8c2f-aca7c42c8c2b"
          ],
          "display_name": false
        },
        {
          "uuid": "46f580cb-5cca-932a-db04-cd8806642e3d",
          "name": "7-keto-dehydroepiandrosterone [WHO-DD]",
          "stdName": "7-KETO-DEHYDROEPIANDROSTERONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85f34301-26f5-0883-957b-c29b458b1c95"
          ],
          "display_name": false
        },
        {
          "uuid": "954e11ac-1461-482b-9aec-bb318725d23b",
          "name": "ANDROST-5-ENE-7,17-DIONE, 3-HYDROXY-, (3.BETA.)-",
          "stdName": "ANDROST-5-ENE-7,17-DIONE, 3-HYDROXY-, (3.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc4bcc9d-7ce4-4393-9155-a5a55442c8c2",
            "1bf85ccc-b034-4471-8c2f-aca7c42c8c2b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ac86b528-de9c-43de-857b-885ac93d8530",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB0329495.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB0329495.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "dc4bcc9d-7ce4-4393-9155-a5a55442c8c2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bf85ccc-b034-4471-8c2f-aca7c42c8c2b",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "283a2e5b-70a5-4dd7-893a-7e8fda49255b",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0afda6ab-315c-43e8-bf04-e1253ded00b4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c3ed3e9-a39d-4e4c-a11d-c0fc7ba82bb4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20a048bf-2742-4a95-b7f5-2ebe611705af",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390870000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afc5a4a7-4717-46a9-af8e-138325e6fe54",
          "citation": "SRS import [2334LJD2E9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2334LJD2E9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390870000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c056d2d3-46f7-4695-89b4-4808bd44d628",
          "citation": "7-KETO-DEHYDROEPIANDROSTERONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f16a716f-7f53-2914-5e65-08fb28fa1b26",
          "citation": "7-Keto-DHEA",
          "url": "https://en.wikipedia.org/wiki/7-Keto-DHEA",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "bf3050ee-17fb-4182-d7a8-93859d9cb636",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c24cd893-3018-468d-f833-502a03729bf6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9fd06c31-2dda-4e9d-955c-7c9834b10fcc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2bc727c3-5b5c-3754-e4b5-4c89545f92ce",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "85f34301-26f5-0883-957b-c29b458b1c95",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dd699116-baa8-41fd-a382-c8b7b68fcc43",
          "id": "dd699116-baa8-41fd-a382-c8b7b68fcc43",
          "molfile": "\n  Marvin  01132111292D          \n\n 22 25  0  0  1  0            999 V2000\n    9.1491   -5.1466    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9337   -5.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4229   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9337   -4.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1875   -3.2866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1491   -4.3251    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.1491   -3.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429   -3.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7229   -4.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7229   -5.1466    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.4429   -5.5666    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.4429   -6.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1583   -6.8035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7229   -6.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0169   -6.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -6.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5815   -6.3927    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.8753   -6.8035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5815   -5.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -5.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0169   -5.5666    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.0169   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  6  1  0  0  0  0\n 11  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  1  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  1  0  0  0\n 11 10  1  0  0  0  0\n 10 21  1  0  0  0  0\n 11 12  1  6  0  0  0\n 13 12  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 21 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12CC[C@@H](CC2=CC(=O)[C@H]3[C@@H]4CCC(=O)[C@@]4(C)CC[C@@H]31)O",
          "formula": "C19H26O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1e2f4e6-4b31-49ef-b8fa-b2ceb474e31f"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "302.4087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c2006042-619e-48f7-8f8b-5c50d0c3c44a",
      "version": "10",
      "structure": {
        "id": "7ee9dbbc-d596-4fc7-8aed-cd08d53a18c7",
        "molfile": "\n  Marvin  01132106352D          \n\n 25 28  0  0  1  0            999 V2000\n    7.0169   -5.5666    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0169   -6.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7229   -6.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429   -6.3927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1583   -6.8035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429   -5.5666    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1491   -5.1466    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.9337   -5.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4229   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9337   -4.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1491   -4.3251    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4429   -3.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7229   -4.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7229   -5.1466    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7229   -5.9635    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1491   -3.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1875   -3.2866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1491   -5.9681    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4429   -4.7405    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -6.8035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5815   -6.3927    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8753   -6.8035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5815   -5.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2969   -5.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0169   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  1  1  0  0  0  0\n  6 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 11 16  1  1  0  0  0\n 11  7  1  0  0  0  0\n 17 10  2  0  0  0  0\n  7 18  1  6  0  0  0\n  6 19  1  1  0  0  0\n 20  2  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\n 23 21  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24  1  1  0  0  0  0\n  1 25  1  1  0  0  0\nM  END",
        "smiles": "C[C@@]12CC[C@@H](CC2=CC(=O)[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@@]31[H])O",
        "formula": "C19H26O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "302.4087",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ac86b528-de9c-43de-857b-885ac93d8530",
          "afc5a4a7-4717-46a9-af8e-138325e6fe54"
        ],
        "stereo_centers": 6
      },
      "unii": "2334LJD2E9"
    }
  ]
}