{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2448cc48-29ac-4349-bddd-e5bb776a3f51",
          "code": "4192-90-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4192-90-9",
          "code_system": "CAS",
          "references": [
            "58d8baef-1dd9-49f7-8322-d8425bcd2e5f",
            "b936336e-82f3-4707-804c-6298462411dc"
          ]
        },
        {
          "uuid": "6bcf31ff-741e-4268-81b6-39992f7a04e0",
          "code": "TRILOBATIN",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=6121",
          "code_system": "JECFA EVALUATION",
          "references": [
            "58d8baef-1dd9-49f7-8322-d8425bcd2e5f"
          ]
        },
        {
          "uuid": "45cbc4f2-9dd3-4813-8a67-583eb9747ecd",
          "code": "6451798",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6451798",
          "code_system": "PUBCHEM",
          "references": [
            "58d8baef-1dd9-49f7-8322-d8425bcd2e5f"
          ]
        },
        {
          "uuid": "20f4b27c-4149-b836-cd7f-0a9043f74326",
          "code": "DTXSID10194681",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10194681",
          "code_system": "EPA CompTox",
          "references": [
            "902b8769-ad25-7c2b-b8cb-34ee6e4f5508"
          ]
        },
        {
          "uuid": "b0a2ad9a-c9ee-4af5-893a-acd8b12d43b9",
          "code": "23298I791N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "eb7d9482-168b-17fd-28d1-2e671903c7ab",
          "code": "145829",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:145829",
          "code_system": "CHEBI",
          "references": [
            "48137cc9-aefa-c055-c20e-3e5007b02ea9"
          ]
        },
        {
          "uuid": "b1a06de0-f651-0c4d-c4e4-0a59e5092522",
          "code": "2145",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2145/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "bbdabee8-d3dc-8823-e9ea-7af9763f5d3a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c2178d8f-ef3c-4e9f-bba6-184a0fe0f46b",
          "name": "1-PROPANONE, 1-(4-(.BETA.-D-GLUCOPYRANOSYLOXY)-2,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-",
          "stdName": "1-PROPANONE, 1-(4-(.BETA.-D-GLUCOPYRANOSYLOXY)-2,6-DIHYDROXYPHENYL)-3-(4-HYDROXYPHENYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5667b52c-cbe9-4014-8b77-c85a1495374a",
            "91a76bd3-3ab3-4686-9fe2-8257e92daafe"
          ],
          "display_name": false
        },
        {
          "uuid": "f9f5fa0d-0938-077d-9124-33848004ec8b",
          "name": "FEMA NO. 4674",
          "stdName": "FEMA NO. 4674",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4499e23c-c22d-978e-c56d-0271a1af4e01",
            "5667b52c-cbe9-4014-8b77-c85a1495374a"
          ],
          "display_name": false
        },
        {
          "uuid": "628658bd-2ea8-453f-b181-673adc65be3f",
          "name": "P-PHLORIZIN",
          "stdName": "P-PHLORIZIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5667b52c-cbe9-4014-8b77-c85a1495374a",
            "91a76bd3-3ab3-4686-9fe2-8257e92daafe"
          ],
          "display_name": false
        },
        {
          "uuid": "d053585e-df4a-462f-b061-3a96fb5c61ed",
          "name": "PHLORETIN 4'-.BETA.-D-GLUCOSIDE",
          "stdName": "PHLORETIN 4'-.BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5667b52c-cbe9-4014-8b77-c85a1495374a",
            "91a76bd3-3ab3-4686-9fe2-8257e92daafe"
          ],
          "display_name": false
        },
        {
          "uuid": "c09ed786-b789-4672-b408-b27544ec7a22",
          "name": "PHLORIZIN, P-",
          "stdName": "PHLORIZIN, P-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa3d89bf-4813-4865-a4e3-1302259fee37"
          ],
          "display_name": false
        },
        {
          "uuid": "9987183f-4131-4bba-a6c7-5cbe6da471c6",
          "name": "PRUNIN DIHYDROCHALCONE",
          "stdName": "PRUNIN DIHYDROCHALCONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5667b52c-cbe9-4014-8b77-c85a1495374a",
            "91a76bd3-3ab3-4686-9fe2-8257e92daafe"
          ],
          "display_name": false
        },
        {
          "uuid": "c8b4ce85-b7d7-47b3-a7ab-132419c04cab",
          "name": "TRILOBATIN",
          "stdName": "TRILOBATIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "178b2449-1c17-4e52-a9b9-d8743838cb22",
            "5667b52c-cbe9-4014-8b77-c85a1495374a"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "4499e23c-c22d-978e-c56d-0271a1af4e01",
          "citation": "FHFI",
          "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "b936336e-82f3-4707-804c-6298462411dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fa3d89bf-4813-4865-a4e3-1302259fee37",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "178b2449-1c17-4e52-a9b9-d8743838cb22",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5667b52c-cbe9-4014-8b77-c85a1495374a",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "91a76bd3-3ab3-4686-9fe2-8257e92daafe",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58d8baef-1dd9-49f7-8322-d8425bcd2e5f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391037000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "577c18f8-3374-4c0f-85ea-f80c38b62f99",
          "citation": "SRS import [23298I791N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=23298I791N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391037000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d943bf2-ca1a-4d0f-96c4-10fb28cbceeb",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "902b8769-ad25-7c2b-b8cb-34ee6e4f5508",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4192-90-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48137cc9-aefa-c055-c20e-3e5007b02ea9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bbdabee8-d3dc-8823-e9ea-7af9763f5d3a",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8a89247a-defa-452d-b63f-941744e36647",
          "id": "8a89247a-defa-452d-b63f-941744e36647",
          "molfile": "\n  Marvin  01132107122D          \n\n 31 33  0  0  1  0            999 V2000\n    6.3818   -8.2505    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.6664   -7.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9563   -8.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -7.8387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -8.2505    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.5230   -7.8387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -7.0106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2383   -6.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2383   -5.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9484   -5.3635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -5.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -4.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2383   -4.1281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -4.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -3.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -2.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -2.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3818   -1.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6664   -2.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9563   -1.6581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6664   -2.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3818   -3.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -5.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -5.3635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -6.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -9.0741    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.5230   -9.4857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -9.4857    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.0970  -10.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3818   -9.0741    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.6664   -9.4857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 30  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 26  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 25  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 23  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 22 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 25  1  0  0  0  0\n 26 27  1  6  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  1  0  0  0\n 28 30  1  0  0  0  0\n 30 31  1  6  0  0  0\nM  END",
          "smiles": "c1cc(ccc1CCC(=O)c2c(cc(cc2O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O",
          "formula": "C21H24O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5e24a30c-dcd4-408e-b167-4da908efb7cd"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "436.4101",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "24e29107-4054-4cad-bd3c-4c9f8c8f2239",
      "version": "8",
      "structure": {
        "id": "411ba869-3563-4b09-a3d4-87a3ec377253",
        "molfile": "\n  Marvin  01132103262D          \n\n 31 33  0  0  1  0            999 V2000\n    7.8076   -8.2505    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8076   -9.0741    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0970   -9.4857    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0970  -10.3093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3818   -9.0741    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3818   -8.2505    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0970   -7.8387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6664   -7.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9563   -8.2505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6664   -9.4857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -9.4857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -7.8387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -7.0106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2383   -6.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2383   -5.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9484   -5.3635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -5.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -5.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -6.5987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -5.3635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5230   -4.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2383   -4.1281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -4.1281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8076   -3.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -2.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0970   -2.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3818   -1.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6664   -2.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9563   -1.6581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6664   -2.8934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3818   -3.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  5 10  1  6  0  0  0\n  2 11  1  6  0  0  0\n  1 12  1  1  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 13  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 17  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 28 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 25  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1CCC(=O)c2c(cc(cc2O)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)O",
        "formula": "C21H24O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "436.4101",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "577c18f8-3374-4c0f-85ea-f80c38b62f99",
          "6d943bf2-ca1a-4d0f-96c4-10fb28cbceeb"
        ],
        "stereo_centers": 5
      },
      "unii": "23298I791N"
    }
  ]
}