{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1725dd10-953e-40e5-8752-89c0c8222577",
          "code": "27348-32-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27348-32-9",
          "code_system": "CAS",
          "references": [
            "22cb0e09-24ab-4eb5-b92f-78f5551ddbc6",
            "b7aa22c5-3033-4b87-a86c-caa01a0560ce"
          ]
        },
        {
          "uuid": "97fae74e-3601-40e1-baee-df3f8e94fa24",
          "code": "248-423-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.007",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "22cb0e09-24ab-4eb5-b92f-78f5551ddbc6"
          ]
        },
        {
          "uuid": "0d8480c8-f457-4d35-afb3-3b627ae8bacf",
          "code": "23391569",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23391569",
          "code_system": "PUBCHEM",
          "references": [
            "22cb0e09-24ab-4eb5-b92f-78f5551ddbc6"
          ]
        },
        {
          "uuid": "0a465b52-b8f5-c913-2c9c-41fc41abaa69",
          "code": "DTXSID80181785",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80181785",
          "code_system": "EPA CompTox",
          "references": [
            "d591dd5d-2a84-b306-92cf-4418089050b2"
          ]
        },
        {
          "uuid": "b901cf33-006f-42c0-931d-c06330efd89b",
          "code": "23227F83U0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c7a71f76-f24c-cef2-e89c-9c0525c4ff76",
          "code": "2548236",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2548236/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5ac71949-eabc-f27a-374f-aefa482d8165"
          ]
        },
        {
          "uuid": "fea6c8b3-6b28-de2e-467f-4a6c255af163",
          "code": "100000172793",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1f3bcc66-1837-f109-eb6c-054c064c7b3a"
          ]
        },
        {
          "uuid": "edd23112-76e6-5674-c02f-de84038394e2",
          "code": "23227F83U0",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=23227F83U0",
          "code_system": "DAILYMED",
          "references": [
            "de7a016c-23f8-fe30-006d-b20ea48c8a85"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "de779ae7-c9b8-41c8-a6b6-0c3908c9c485",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6a96027a-558f-4f7a-a9fb-4a70e098eea3",
            "refuuid": "e86b6ffd-b009-4d29-a2fd-c10b944f4ece",
            "name": "LYSINE",
            "unii": "K3Z4F929H6",
            "linking_id": "K3Z4F929H6",
            "ref_pname": "LYSINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "87051f05-ea13-444b-a28e-a2ad73b97baf",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a3583e45-06e3-408e-b295-1be782f9db80",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5c42ce79-ff9f-4519-888a-b64676b5d633",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a3607f7a-929c-4929-a7ce-8b3b397ca7e9",
            "refuuid": "e86b6ffd-b009-4d29-a2fd-c10b944f4ece",
            "name": "LYSINE",
            "unii": "K3Z4F929H6",
            "linking_id": "K3Z4F929H6",
            "ref_pname": "LYSINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cd98390a-9280-477b-bbf3-48a2bdd1c693",
          "name": "L-ASPARTIC ACID, COMPD. WITH L-LYSINE (1:1)",
          "stdName": "L-ASPARTIC ACID, COMPD. WITH L-LYSINE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96428c31-3388-47a6-8cee-744394f2dc45",
            "83f5bd81-4d1e-420b-b99e-5f65ee48ae72"
          ],
          "display_name": false
        },
        {
          "uuid": "3d0bd749-6bb8-40b8-8ed8-dc61d55e1373",
          "name": "L-LYSINE, L-ASPARTATE (1:1)",
          "stdName": "L-LYSINE, L-ASPARTATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96428c31-3388-47a6-8cee-744394f2dc45",
            "83f5bd81-4d1e-420b-b99e-5f65ee48ae72"
          ],
          "display_name": false
        },
        {
          "uuid": "49f4a711-0ebf-41c8-a268-099a94d9e824",
          "name": "L-LYSINE-L-ASPARTATE",
          "stdName": "L-LYSINE-L-ASPARTATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96428c31-3388-47a6-8cee-744394f2dc45",
            "1d920f6f-cb95-4aca-aa60-876235a5230b"
          ],
          "display_name": false
        },
        {
          "uuid": "5f2d7198-ff64-483d-bf90-ed196516e5ee",
          "name": "LYSINE ASPARTATE",
          "stdName": "LYSINE ASPARTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a299084e-5f1e-4f54-b396-83592853119c",
            "6134444e-9783-4f9f-b324-12ddb841403b",
            "96428c31-3388-47a6-8cee-744394f2dc45",
            "83f5bd81-4d1e-420b-b99e-5f65ee48ae72",
            "d135b743-d18b-481f-ae11-8023f340cb5e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d15efce7-4c5f-4f12-b599-967d0fbc1435",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7f9b72a2-be28-4290-917c-f71323021101",
          "name": "LYSINE L-ASPARTATE, L-",
          "stdName": "LYSINE L-ASPARTATE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5758dada-a741-4854-9fad-bf7108a8a78e",
            "96428c31-3388-47a6-8cee-744394f2dc45"
          ],
          "display_name": false
        },
        {
          "uuid": "d4a7ba6a-77ba-4beb-a48a-17bd7311eb1d",
          "name": "LYSINE, L-, L-ASPARTATE (1:1)",
          "stdName": "LYSINE, L-, L-ASPARTATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96428c31-3388-47a6-8cee-744394f2dc45",
            "83f5bd81-4d1e-420b-b99e-5f65ee48ae72"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "83f5bd81-4d1e-420b-b99e-5f65ee48ae72",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d135b743-d18b-481f-ae11-8023f340cb5e",
          "citation": "DL",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96428c31-3388-47a6-8cee-744394f2dc45",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d920f6f-cb95-4aca-aa60-876235a5230b",
          "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB0467689.htm",
          "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB0467689.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6134444e-9783-4f9f-b324-12ddb841403b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5758dada-a741-4854-9fad-bf7108a8a78e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22cb0e09-24ab-4eb5-b92f-78f5551ddbc6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc6f313a-f93d-4c53-8a3d-4860c57e01a9",
          "citation": "SRS import [23227F83U0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=23227F83U0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a299084e-5f1e-4f54-b396-83592853119c",
          "citation": "LYSINE ASPARTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d591dd5d-2a84-b306-92cf-4418089050b2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27348-32-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f3bcc66-1837-f109-eb6c-054c064c7b3a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b7aa22c5-3033-4b87-a86c-caa01a0560ce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5ac71949-eabc-f27a-374f-aefa482d8165",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "de7a016c-23f8-fe30-006d-b20ea48c8a85",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "991a6882-d1a1-4973-b189-00454529c83b",
          "id": "991a6882-d1a1-4973-b189-00454529c83b",
          "molfile": "\n  Marvin  01132107572D          \n\n  9  8  0  0  1  0            999 V2000\n   10.2404   -3.7919    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.2404   -4.5974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9147   -3.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6161   -3.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3443   -3.3891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6161   -4.5974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5390   -3.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5390   -2.5521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8106   -3.7603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)N)C(=O)O",
          "formula": "C4H7NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "90e235dd-6d0d-4378-bc2a-660375cf0865"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "133.1029",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "8b1c4068-cc0e-47f2-8cae-504ec00be347",
          "id": "8b1c4068-cc0e-47f2-8cae-504ec00be347",
          "molfile": "\n  Marvin  01132107132D          \n\n 10  9  0  0  1  0            999 V2000\n    6.5112   -3.9559    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.5112   -4.7919    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7826   -3.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0773   -3.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3162   -3.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6109   -4.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8683   -3.6289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2210   -3.5355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9636   -3.9233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2210   -2.7276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C(CCN)C[C@@H](C(=O)O)N",
          "formula": "C6H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0de8d6ff-c20b-4c8c-a3ef-eab7b35686b6"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "146.1878",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "da4d038b-099f-48ff-ab7f-a1c02613d6dd",
      "version": "7",
      "structure": {
        "id": "69793c06-14d8-4d81-a99e-74b93727d114",
        "molfile": "\n  Marvin  01132105292D          \n\n 19 17  0  0  1  0            999 V2000\n   11.1794   -3.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8977   -3.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6438   -3.4714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8977   -4.7089    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4887   -3.8839    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7704   -3.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7704   -2.6139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0243   -3.8515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4887   -4.7089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1657   -3.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9026   -3.8932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4613   -3.9256    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4613   -4.7552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7383   -3.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0384   -3.9302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2831   -3.5641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5832   -3.9719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8463   -3.6011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1657   -2.7067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  5  9  1  6  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 10  1  0  0  0  0\nM  END",
        "smiles": "C(CCN)C[C@@H](C(=O)O)N.C([C@@H](C(=O)O)N)C(=O)O",
        "formula": "C6H14N2O2.C4H7NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "279.2907",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bc6f313a-f93d-4c53-8a3d-4860c57e01a9",
          "83f5bd81-4d1e-420b-b99e-5f65ee48ae72"
        ],
        "stereo_centers": 2
      },
      "unii": "23227F83U0"
    }
  ]
}