{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4a6d3180-accb-4bd5-aa5c-cc2019e09863",
          "code": "17526-94-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17526-94-2",
          "code_system": "CAS",
          "references": [
            "a6e97e05-7f29-489c-b0b9-88dd73fb9c1f",
            "17b317a9-d096-47cf-b7d6-e04bab408f27"
          ]
        },
        {
          "uuid": "84badd02-c244-4374-a7bb-282984c0cb5e",
          "code": "241-523-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.733",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a6e97e05-7f29-489c-b0b9-88dd73fb9c1f"
          ]
        },
        {
          "uuid": "9b17f2d4-114a-4381-b059-3017c5c87425",
          "code": "87146",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87146",
          "code_system": "PUBCHEM",
          "references": [
            "a6e97e05-7f29-489c-b0b9-88dd73fb9c1f"
          ]
        },
        {
          "uuid": "30ea1f63-2931-c217-ca30-965d12be017d",
          "code": "DTXSID0044606",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044606",
          "code_system": "EPA CompTox",
          "references": [
            "ad3f8ce8-0ef1-7596-9759-248ea037eac5"
          ]
        },
        {
          "uuid": "9074cde2-29a5-414c-a0a3-f2f952ffd6ba",
          "code": "22X7S855O6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c8f2a146-449a-34b3-00b7-53ff5ff8d85e",
          "code": "375994",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=375994",
          "code_system": "NSC",
          "references": [
            "1da2b651-d566-2a70-ab61-4eadf025761e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1726a080-b0cb-49ea-918b-3a31c8ec0e94",
          "name": "1,1'-(4-METHYL-1,3-PHENYLENE)BIS(3,3-DIMETHYLUREA)",
          "stdName": "1,1'-(4-METHYL-1,3-PHENYLENE)BIS(3,3-DIMETHYLUREA)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "e2e80233-e37d-4e41-b6a4-aff593314475",
          "name": "1,1'-(4-METHYL-M-PHENYLENE)BIS(3,3'-DIMETHYLUREA)",
          "stdName": "1,1'-(4-METHYL-M-PHENYLENE)BIS(3,3'-DIMETHYLUREA)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "00d0084c-5811-4a9d-8a47-0c2a99ba9fed",
          "name": "1,1'-(4-METHYL-M-PHENYLENE)BIS(3,3-DIMETHYLUREA)",
          "stdName": "1,1'-(4-METHYL-M-PHENYLENE)BIS(3,3-DIMETHYLUREA)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "220ba758-8a8f-48fc-80d3-17b9aec8ea7f",
          "name": "2,4-BIS(DIMETHYLAMINOCARBONYLAMINO)TOLUENE",
          "stdName": "2,4-BIS(DIMETHYLAMINOCARBONYLAMINO)TOLUENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "d4e428c5-198d-417f-a80a-042d3726e3e1",
          "name": "2,4-TOLYLENEBIS(N',N'-DIMETHYLUREA)",
          "stdName": "2,4-TOLYLENEBIS(N',N'-DIMETHYLUREA)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "c12cf9b1-714d-4c35-a2e2-ed2dc48c886d",
          "name": "3,3'-(4-METHYLBENZENE-1,3-DIYL)BIS(1,1-DIMETHYLUREA)",
          "stdName": "3,3'-(4-METHYLBENZENE-1,3-DIYL)BIS(1,1-DIMETHYLUREA)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e86fca1b-c159-492e-8919-205d28b1534c"
          ],
          "display_name": true
        },
        {
          "uuid": "e9fa75c5-8f54-4e72-bae7-da77fb0e1c9d",
          "name": "3-(5-(DIMETHYLCARBAMOYLAMINO)-2-METHYLPHENYL)-1,1-DIMETHYL UREA",
          "stdName": "3-(5-(DIMETHYLCARBAMOYLAMINO)-2-METHYLPHENYL)-1,1-DIMETHYL UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "a46411e0-cdab-4969-8a87-5db376728c95",
          "name": "N,N'-BIS(DIMETHYLCARBAMOYL)-2,4-TOLUIDINE",
          "stdName": "N,N'-BIS(DIMETHYLCARBAMOYL)-2,4-TOLUIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "da2a468c-a3c0-4ae7-ba26-7e0163862d81",
          "name": "N,N-(4-METHYL-1,3-PHENYLENE) BIS(N',N'-DIMETHYLUREA)",
          "stdName": "N,N-(4-METHYL-1,3-PHENYLENE) BIS(N',N'-DIMETHYLUREA)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "ecaac2e0-2a30-4012-b5db-af6ce4662825",
          "name": "NSC-375994",
          "stdName": "NSC-375994",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1afe5f5a-5c5e-492f-a618-067acb760302"
          ],
          "display_name": false
        },
        {
          "uuid": "511e68eb-cbb9-4ffa-b1a6-05c368d4980c",
          "name": "U 410M",
          "stdName": "U 410M",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "7380cf5d-3124-49db-a2e0-e4b023632359",
          "name": "UREA, 1,1'-(4-METHYL-M-PHENYLENE)BIS(3,3-DIMETHYL-",
          "stdName": "UREA, 1,1'-(4-METHYL-M-PHENYLENE)BIS(3,3-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        },
        {
          "uuid": "f2fb3dd7-6700-4c6f-957d-ce1306511071",
          "name": "UREA, N,N''-(4-METHYL-1,3-PHENYLENE)BIS(N',N'-DIMETHYL-",
          "stdName": "UREA, N,N''-(4-METHYL-1,3-PHENYLENE)BIS(N',N'-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2714bee8-2c45-4121-b108-01611d9b0b21"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e86fca1b-c159-492e-8919-205d28b1534c",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2714bee8-2c45-4121-b108-01611d9b0b21",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1afe5f5a-5c5e-492f-a618-067acb760302",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6e97e05-7f29-489c-b0b9-88dd73fb9c1f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392272000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f7af427-cdcc-4f44-8801-48f08cb45473",
          "citation": "SRS import [22X7S855O6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=22X7S855O6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392272000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad3f8ce8-0ef1-7596-9759-248ea037eac5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17526-94-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1da2b651-d566-2a70-ab61-4eadf025761e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "17b317a9-d096-47cf-b7d6-e04bab408f27",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "df473143-00a6-45bd-8329-6b0f3abc9a70",
          "id": "df473143-00a6-45bd-8329-6b0f3abc9a70",
          "molfile": "\n  Marvin  01132111342D          \n\n 19 19  0  0  0  0            999 V2000\n    5.7362   -2.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7298   -1.6306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4452   -1.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0015   -1.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0015   -0.3867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2860   -1.6371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5706   -1.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5706   -0.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8423    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1398   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4115   -0.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1398   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4244   -1.6693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4308   -2.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1463   -2.8938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -2.9132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -3.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8617   -1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 19  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n 19 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1NC(=O)N(C)C)NC(=O)N(C)C",
          "formula": "C13H20N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "64fb2864-ddc9-455b-aaa2-5921e4cce1b9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "264.324",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b0a10485-966c-4a36-a81a-7146722c7785",
      "version": "4",
      "structure": {
        "id": "b3452133-029c-4f34-8059-a78568f34414",
        "molfile": "\n  Marvin  01132109172D          \n\n 19 19  0  0  0  0            999 V2000\n    1.4308   -2.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1463   -2.8938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4244   -1.6693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -2.9132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -3.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0015   -1.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0015   -0.3867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2860   -1.6371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7298   -1.6306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7362   -2.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4452   -1.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5706   -1.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8617   -1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1398   -1.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1398   -0.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8423    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5706   -0.4060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4115   -0.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  3 15  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 18  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 19  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1NC(=O)N(C)C)NC(=O)N(C)C",
        "formula": "C13H20N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "264.324",
        "optical_activity": "NONE",
        "references": [
          "3f7af427-cdcc-4f44-8801-48f08cb45473",
          "e86fca1b-c159-492e-8919-205d28b1534c"
        ],
        "stereo_centers": 0
      },
      "unii": "22X7S855O6"
    }
  ]
}