{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "93b9a5d6-f8a0-49fc-8302-e9d3ce719724",
          "code": "L02BA03",
          "comments": "ATC|ANTINEOPLASTIC AND IMMUNOMODULATING AGENTS|ENDOCRINE THERAPY|HORMONE ANTAGONISTS AND RELATED AGENTS|Anti-estrogens|fulvestrant",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=L02BA03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "b44ee9d4-d24c-451c-80c8-88f4057aaf57",
          "code": "N0000175826",
          "comments": "Established Pharmacologic Class [EPC]|Estrogen Agonist/Antagonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175826",
          "code_system": "NDF-RT",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "c8908631-ad3a-4425-bbb5-7acf2b2db47c",
          "code": "FASLODEX (AUTHORIZED: BREAST NEOPLASMS)",
          "comments": "EMA EPAR|SKIN AND CONNECTIVE TISSUE DISEASES|SKIN DISEASES|BREAST DISEASES|BREAST NEOPLASMS",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000540/human_med_000786.jsp&mid=WC0b01ac058001d124",
          "code_system": "EMA ASSESSMENT REPORTS",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "8306a132-4f2d-44e7-9adc-d32aa3a17c8b",
          "code": "N0000000168",
          "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Transcription Factor Activity [MoA]|Hormone Receptor Interactions [MoA]|Hormone Receptor Modulators [MoA]|Steroid Receptor Modulators [MoA]|Selective Estrogen Receptor Modulators [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000168",
          "code_system": "NDF-RT",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "101ecfe3-f715-4743-a5f8-0bfd5b7444c6",
          "code": "QL02BA03",
          "comments": "VATC|ENDOCRINE THERAPY|HORMONE ANTAGONISTS AND RELATED AGENTS|Anti-estrogens|fulvestrant",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QL02BA03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "80a7dcbc-0a2f-490a-96de-b47ff6640157",
          "code": "129453-61-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=129453-61-8",
          "code_system": "CAS",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db",
            "98cc3ab0-3088-43df-96c6-2fe70d7fb887"
          ]
        },
        {
          "uuid": "58916cd1-236d-457b-b05c-ab0b9bc26555",
          "code": "C1379",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1379",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "fc952a9f-9061-488f-b7f8-0db1a1000e47",
          "code": "C070081",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67070081",
          "code_system": "MESH",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "4af55b90-c8cd-42d1-8b86-527b9b2d77a2",
          "code": "NBK548072",
          "comments": "LiverTox|Antineoplastic|Breast Cancer|Antiestrogen",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548072/",
          "code_system": "LIVERTOX",
          "references": [
            "24207415-e6dd-af22-180c-b3581f59ad1a"
          ]
        },
        {
          "uuid": "868acb59-1747-45af-9a27-ae99918231be",
          "code": "FULVESTRANT",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fulvestrant",
          "code_system": "WIKIPEDIA",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "5c253d22-79b7-4f4e-bd18-ea6fc8bc5239",
          "code": "N0000175582",
          "comments": "Established Pharmacologic Class [EPC]|Estrogen Receptor Antagonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175582",
          "code_system": "NDF-RT",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "80f2ef5f-3a35-4519-afbe-aed9ffd817b7",
          "code": "SUB13933MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "64c0b137-44c0-4432-967b-86881eaac1ca",
          "code": "7712",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7712",
          "code_system": "INN",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "c6d265c8-8a1f-46e5-be13-ad25e607c810",
          "code": "1015",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=1015",
          "code_system": "IUPHAR",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "54ff3929-236f-499c-907a-b35d02b55512",
          "code": "282357",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/282357/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "d2c193d9-5a02-49ba-9066-4719c096919a",
          "code": "m5583",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5583?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "3e911bd5-110a-4c51-92e7-d58e2082ecf0",
          "code": "DB00947",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00947",
          "code_system": "DRUG BANK",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "dcc915c9-ea4a-4ce2-964f-964a84a0d586",
          "code": "CHEMBL1358",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1358",
          "code_system": "ChEMBL",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "1243e95a-15e1-44b0-b8cc-e7cd957620fd",
          "code": "N0000000145",
          "comments": "Estrogen Receptor Antagonists [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000145",
          "code_system": "NDF-RT",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "a77037a1-884d-4904-921a-b27e399f4191",
          "code": "104741",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104741",
          "code_system": "PUBCHEM",
          "references": [
            "1d907972-b243-4dc7-bff3-d6b9879d71db"
          ]
        },
        {
          "uuid": "03dccb10-c8e6-52d2-d0e0-e88f90d73f5d",
          "code": "7658",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7658",
          "code_system": "HSDB",
          "references": [
            "c1a0b6bb-60cf-e437-45c4-ac58d9f3d628"
          ]
        },
        {
          "uuid": "e9f8a8a0-48cf-432a-8cd0-cb87f7e4c05b",
          "code": "DTXSID4022369",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022369",
          "code_system": "EPA CompTox",
          "references": [
            "fd05a2a7-ce33-8512-3620-d736d45b04af"
          ]
        },
        {
          "uuid": "6c107296-d6d4-9878-5f3d-0f936351a44f",
          "code": "C2116",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Hormonal/Endocrine Agent[C129818]|Antiestrogen[C481]|Selective Estrogen Receptor Down Regulator",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2116",
          "code_system": "NCI_THESAURUS",
          "references": [
            "24207415-e6dd-af22-180c-b3581f59ad1a"
          ]
        },
        {
          "uuid": "4189e893-a5a5-4505-b8a4-4a0819ba92c8",
          "code": "22X328QOC4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3ddbfb8f-abbb-854d-a1d2-39e1b5cff9a9",
          "code": "1255",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1255",
          "code_system": "DRUG CENTRAL",
          "references": [
            "24207415-e6dd-af22-180c-b3581f59ad1a"
          ]
        },
        {
          "uuid": "7ef92c13-9a80-d298-8b6a-9e7622030e0d",
          "code": "31638",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31638",
          "code_system": "CHEBI",
          "references": [
            "24207415-e6dd-af22-180c-b3581f59ad1a"
          ]
        },
        {
          "uuid": "a8bb55a6-93ee-f2e6-09e4-58bb02b1cdf0",
          "code": "1286650",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1286650",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "24207415-e6dd-af22-180c-b3581f59ad1a"
          ]
        },
        {
          "uuid": "63ef9110-9322-bd44-367f-d6f5b9dbc38a",
          "code": "100000089504",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "fc65c005-25d1-f454-52a7-8019e482c8ab"
          ]
        },
        {
          "uuid": "742ca24a-b26e-80ee-ca08-eef9aa0edd89",
          "code": "KK-128",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/KK-128/relevant/1/",
          "code_system": "USAN"
        },
        {
          "uuid": "5c3c7e03-d39e-435a-62e4-778c06af63a4",
          "code": "22X328QOC4",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=22X328QOC4",
          "code_system": "DAILYMED",
          "references": [
            "651f5e18-d99a-ed44-7163-ac73b5fcbac6"
          ]
        },
        {
          "uuid": "56a45174-0650-39c0-801e-5a4c38e6cc63",
          "code": "759879",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759879",
          "code_system": "NSC",
          "references": [
            "5285d2e9-68b9-9c18-0133-8149a7c97332"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "d62ec91c-0ab3-39fc-06e4-4c292a7d935d",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2002/21344lbl.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0805a455-fe78-48e2-950e-d7f73e40b5f2",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "66e576a0-06b7-45f4-8895-ce2380133b0a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45c374e3-99e2-4d38-b569-d29658d25583",
          "citation": "u",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4719b952-6cdc-47f0-ab00-1b9e1dbf410f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d41e4cc4-3b4c-4a02-8f62-cd32289b2d57",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01bba1f2-828f-4bc0-814d-ba4bb839596a",
          "citation": "INN Proposed List 79",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL79.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe32296f-1349-4127-b504-34011e718a9b",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad178524-7e7f-44e3-8e65-c823ea52e054",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "483aa9e6-f5b3-41fb-bbbb-68c57f93d4c7",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ca88dce-3f48-4629-94e5-6330a71924f9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca910577-1893-4223-bc8b-19270c1c4012",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5de34cda-97c6-4980-b605-3bd77054d46f",
          "citation": "EMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16ceeaf7-9982-4f62-a934-43d7d61c98a5",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13d8631d-ac91-415f-ab06-d68f54c6c3ac",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a0c3d62-3909-47b2-b470-316eb15028c1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2905af06-cb20-41ab-8c9e-bcf2b9f3a09b",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d907972-b243-4dc7-bff3-d6b9879d71db",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389754000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b86711cd-e570-4048-b972-a648fd18b0f8",
          "citation": "EP 7.8 FULVESTRANT MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4105e1ec-7dcc-4351-82ec-71953a50f368",
          "citation": "USP 35 FULVESTRANT MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4274e369-c1d7-48a7-9527-4e53cb110765",
          "citation": "http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Scientific_Discussion/human/000540/WC500021171.pdf",
          "url": "http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Scientific_Discussion/human/000540/WC500021171.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bde65b86-dbc1-4540-8a00-20b776c0428d",
          "citation": "SRS import [22X328QOC4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=22X328QOC4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389754000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a46365b-aabf-437b-9f76-37fde414909f",
          "citation": "FULVESTRANT [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0c9c9f3-7385-4d4b-aaeb-7fc3a26edf14",
          "citation": "FULVESTRANT [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39bbc823-f760-43fd-8019-b4b48177c270",
          "citation": "FULVESTRANT [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d649125-0950-4076-ad7d-890c51848059",
          "citation": "FULVESTRANT [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db0b0edd-eb7f-4b78-aa23-cb3f314d669f",
          "citation": "FULVESTRANT [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c4696a00-9279-4b41-9973-e1482218b62a",
          "citation": "FULVESTRANT [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0beb89f-2bc4-49dc-b281-298f88d3997d",
          "citation": "FULVESTRANT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "34c01b2d-b173-4997-8c4f-269538640911",
          "citation": "FULVESTRANT [EMA EPAR]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "97eaf5ec-003f-4685-894c-fcbe2be93b1e",
          "citation": "FULVESTRANT [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae1ef8c6-512e-478e-8e20-f5a883265794",
          "citation": "FULVESTRANT [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a965f24d-2353-49c2-8f5b-d75ecc19ddb8",
          "citation": "FULVESTRANT [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62b6f862-e82e-43b6-9987-7278ae5a4731",
          "citation": "FULVESTRANT [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1a0b6bb-60cf-e437-45c4-ac58d9f3d628",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+129453-61-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fd05a2a7-ce33-8512-3620-d736d45b04af",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=129453-61-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "35b175fb-9315-5350-487e-d2bba9149d83",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5550314#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "4f418f3d-7828-4735-bebd-b78bd1677ec6",
          "citation": "Lai, Andiliy, et al. \"Identification of GDC-0810 (ARN-810), an orally bioavailable selective estrogen receptor degrader (SERD) that demonstrates robust activity in tamoxifen-resistant breast cancer xenografts.\" Journal of medicinal chemistry 58.12 (2015): 4888-4904.",
          "url": "https://pubs.acs.org/doi/full/10.1021/acs.jmedchem.5b00054",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "fc65c005-25d1-f454-52a7-8019e482c8ab",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "24207415-e6dd-af22-180c-b3581f59ad1a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "860e4d94-bd4a-0320-87bb-ca875d2b6212",
          "citation": "Tria, George S., et al. \"Discovery of LSZ102, a Potent, Orally Bioavailable Selective Estrogen Receptor Degrader (SERD) for the Treatment of Estrogen Receptor Positive Breast Cancer.\" Journal of medicinal chemistry 61.7 (2018): 2837-2864.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acs.jmedchem.7b01682",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "98cc3ab0-3088-43df-96c6-2fe70d7fb887",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a4ef9dca-7156-491e-b2dd-1d9d2f471152",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "18047f50-44d1-a7d6-090a-55e583bcc546",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "71c096f9-2a19-e7b2-4b7d-2679225920f3",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "5285d2e9-68b9-9c18-0133-8149a7c97332",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0c6abb4c-9fe0-454e-b6cd-f178a9178d86",
          "citation": "\thttp://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Scientific_Discussion/human/000540/WC500021171.pdf\tW",
          "url": "\thttp://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Scientific_Discussion/human/000540/WC500021171.pdf\tW",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "73b9dea4-98df-5ca1-0626-e8783248236a",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "1d2346d8-e7b0-2421-7477-3eb200b47ae8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "651f5e18-d99a-ed44-7163-ac73b5fcbac6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ab76c34f-d648-4caa-81a9-a4d639bc2f52",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d7c7f20f-14ba-476c-b7d0-ed25c342b6c8",
          "citation": "ZB716",
          "url": "https://en.wikipedia.org/wiki/ZB716",
          "doc_type": "WIKI",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cdb7236b-f978-42a4-b7dd-3a41c1a03a93",
          "id": "cdb7236b-f978-42a4-b7dd-3a41c1a03a93",
          "molfile": "\n  Marvin  01132110372D          \n\n 41 44  0  0  1  0            999 V2000\n    3.1315   -2.5930    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.3989   -1.8120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6075   -3.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1105   -3.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3256   -3.6661    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.6074   -4.0710    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.6074   -4.8936    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.3173   -5.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0313   -4.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7452   -5.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4592   -4.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1732   -5.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8872   -4.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6012   -5.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3151   -4.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0291   -5.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7431   -4.9145    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    8.7431   -4.0878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4571   -5.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1710   -4.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8850   -5.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5990   -4.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1856   -4.2047    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0123   -4.2047    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3130   -5.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0269   -4.9270    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3130   -6.1587    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0269   -5.7454    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8893   -5.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1754   -4.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5345   -5.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2443   -4.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9666   -5.2945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2443   -4.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5345   -3.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1795   -4.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8934   -3.6493    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.9019   -2.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6284   -2.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3423   -2.8352    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.3381   -2.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 40  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  6  0  0  0\n  5 40  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 37  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7 29  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 25  1  0  0  0  0\n 28 25  1  0  0  0  0\n 29 30  1  0  0  0  0\n 31 30  1  0  0  0  0\n 30 36  2  0  0  0  0\n 32 31  2  0  0  0  0\n 33 32  1  0  0  0  0\n 32 34  1  0  0  0  0\n 34 35  2  0  0  0  0\n 35 36  1  0  0  0  0\n 37 36  1  0  0  0  0\n 37 38  1  1  0  0  0\n 38 39  1  0  0  0  0\n 40 39  1  0  0  0  0\n 40 41  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12CC[C@@H]3c4ccc(cc4C[C@@H](CCCCCCCCCS(=O)CCCC(C(F)(F)F)(F)F)[C@H]3[C@H]2CC[C@@H]1O)O",
          "formula": "C32H47F5O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f088e7a1-8176-40b5-8a0d-80426dc65363"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "606.7731",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e2eea7aa-861d-4e0a-a9bc-778d08929230",
      "version": "37",
      "structure": {
        "id": "d24085ba-b7e2-4b5b-8c3e-d0baa520864c",
        "molfile": "\n  Marvin  01132110522D          \n\n 44 47  0  0  1  0            999 V2000\n    2.3256   -3.6661    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.8934   -3.6493    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.3423   -2.8352    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.6074   -4.0710    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.1795   -4.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3130   -5.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1754   -4.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6074   -4.8936    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.5990   -4.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8893   -5.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6284   -2.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9019   -2.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1105   -3.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7431   -4.9145    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n   -0.5345   -3.6410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1315   -2.5930    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.5345   -5.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7431   -4.0878    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.6075   -3.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0269   -4.9270    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3130   -6.1587    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0269   -5.7454    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1856   -4.2047    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0123   -4.2047    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2443   -4.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2443   -4.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3381   -2.0085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8850   -5.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3173   -5.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9666   -5.2945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4571   -5.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1710   -4.9187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0291   -5.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0313   -4.8936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3151   -4.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6012   -5.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7452   -5.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4592   -4.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1732   -5.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8872   -4.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6033   -3.2402    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8893   -4.4761    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3173   -4.4928    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3989   -1.8120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  4  1  0  0  0  0\n  9 28  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  3  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14 33  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17  7  1  0  0  0  0\n 14 18  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20  6  1  0  0  0  0\n 21  6  1  0  0  0  0\n 22  6  1  0  0  0  0\n 23  9  1  0  0  0  0\n 24  9  1  0  0  0  0\n 25 17  2  0  0  0  0\n 26 15  2  0  0  0  0\n  3 27  1  1  0  0  0\n 28 32  1  0  0  0  0\n  8 29  1  6  0  0  0\n 30 25  1  0  0  0  0\n 31 14  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 35  1  0  0  0  0\n 34 29  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 40  1  0  0  0  0\n 37 34  1  0  0  0  0\n 38 37  1  0  0  0  0\n 39 38  1  0  0  0  0\n 40 39  1  0  0  0  0\n  4 41  1  1  0  0  0\n  2 42  1  6  0  0  0\n  1 43  1  6  0  0  0\n 16 19  1  0  0  0  0\n 12 11  1  0  0  0  0\n 10  7  1  0  0  0  0\n 25 26  1  0  0  0  0\n 16 44  1  1  0  0  0\nM  CHG  2  14   1  18  -1\nM  END",
        "smiles": "C[C@@]12CC[C@]3([H])c4ccc(cc4C[C@@H](CCCCCCCCC[S+](CCCC(C(F)(F)F)(F)F)[O-])[C@@]3([H])[C@]2([H])CC[C@@H]1O)O",
        "formula": "C32H47F5O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "606.7731",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bde65b86-dbc1-4540-8a00-20b776c0428d",
          "0805a455-fe78-48e2-950e-d7f73e40b5f2",
          "01bba1f2-828f-4bc0-814d-ba4bb839596a"
        ],
        "stereo_centers": 7
      },
      "unii": "22X328QOC4",
      "relationships": [
        {
          "uuid": "ac807dd6-6dca-4ee4-aadc-635e91c09006",
          "amount": {
            "uuid": "83fda0ff-f5c2-4d7c-bee6-010f1cf6b1c2"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b261c67e-b699-4a16-95df-7f3d9d585a8e",
            "refuuid": "e2eea7aa-861d-4e0a-a9bc-778d08929230",
            "name": "FULVESTRANT",
            "unii": "22X328QOC4",
            "linking_id": "22X328QOC4",
            "ref_pname": "FULVESTRANT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "36d361fb-b757-41ce-85c6-0f425cb5ac63",
          "amount": {
            "uuid": "a8943ab4-359a-4960-83ef-ec918bc429b4",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 97
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "b86711cd-e570-4048-b972-a648fd18b0f8"
          ],
          "related_substance": {
            "uuid": "5dce87f5-609e-40e7-9178-6428c804e7d9",
            "refuuid": "e2eea7aa-861d-4e0a-a9bc-778d08929230",
            "name": "FULVESTRANT",
            "unii": "22X328QOC4",
            "linking_id": "22X328QOC4",
            "ref_pname": "FULVESTRANT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "06fa52b0-daf7-4127-a188-85d580449b82",
          "amount": {
            "uuid": "9004ecae-eda1-485f-b227-7c634ac4734b",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 97
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "4105e1ec-7dcc-4351-82ec-71953a50f368"
          ],
          "related_substance": {
            "uuid": "d30ed474-de9e-4daf-ba5d-abbf58620c36",
            "refuuid": "e2eea7aa-861d-4e0a-a9bc-778d08929230",
            "name": "FULVESTRANT",
            "unii": "22X328QOC4",
            "linking_id": "22X328QOC4",
            "ref_pname": "FULVESTRANT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f4d89e97-01d3-48c6-8831-e4a5b22d6e3d",
          "amount": {
            "uuid": "b0703116-61f4-45f8-9f53-b928001c4376",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b86711cd-e570-4048-b972-a648fd18b0f8"
          ],
          "related_substance": {
            "uuid": "aa052f6c-1e74-4858-8eea-27481df429a1",
            "refuuid": "47d7f725-8b7f-47d7-88d5-d6a3810633e2",
            "name": "FULVESTRANT SULFONE",
            "unii": "55928538EN",
            "linking_id": "55928538EN",
            "ref_pname": "FULVESTRANT SULFONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4574e8d3-696c-4994-b76e-d76533e273b2",
          "amount": {
            "uuid": "10038af0-05f3-444d-bf15-d8a2785e7233",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4105e1ec-7dcc-4351-82ec-71953a50f368"
          ],
          "related_substance": {
            "uuid": "4d930056-8631-4273-b18f-0e5cc66e721f",
            "refuuid": "47d7f725-8b7f-47d7-88d5-d6a3810633e2",
            "name": "FULVESTRANT SULFONE",
            "unii": "55928538EN",
            "linking_id": "55928538EN",
            "ref_pname": "FULVESTRANT SULFONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "37276a41-c0d9-42e7-853d-bf83d6833abc",
          "amount": {
            "uuid": "d8558ec8-fa13-4f6c-bd22-27a74eb0bedf",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.3
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b86711cd-e570-4048-b972-a648fd18b0f8"
          ],
          "related_substance": {
            "uuid": "a5d7079a-fb2a-46b8-80f7-c61cb528170d",
            "refuuid": "9f63545f-c2e9-4773-bcd4-c4df938096a4",
            "name": "7-(9-((9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYL)SULFINYL)NONYL)ESTRA-1,3,5(10)-TRIENE-3,17.BETA.-DIOL",
            "unii": "OMU8ZM6O3U",
            "linking_id": "OMU8ZM6O3U",
            "ref_pname": "7-(9-((9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYL)SULFINYL)NONYL)ESTRA-1,3,5(10)-TRIENE-3,17.BETA.-DIOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "88a00161-5712-4059-be80-222a3b45a7d5",
          "amount": {
            "uuid": "957b632f-6d74-4f85-be02-9678fbc78840",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.3
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4105e1ec-7dcc-4351-82ec-71953a50f368"
          ],
          "related_substance": {
            "uuid": "097cb421-cf6f-4ad8-a899-4f12f37e7105",
            "refuuid": "20a58829-a724-4856-be5b-f4fd3d1d1094",
            "name": "ESTRA-1,3,5(10)-TRIENE-3,17-DIOL,7-(9-(9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYLSULFINYL)NONYL), (7.ALPHA.,17.BETA.)-",
            "unii": "39AEN025PJ",
            "linking_id": "39AEN025PJ",
            "ref_pname": "ESTRA-1,3,5(10)-TRIENE-3,17-DIOL,7-(9-(9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYLSULFINYL)NONYL), (7.ALPHA.,17.BETA.)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e49a710e-615a-45c8-9eaf-430c6501182a",
          "amount": {
            "uuid": "b7c57ee5-59e8-455a-a0b2-c53ee2ca205e",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.8
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4105e1ec-7dcc-4351-82ec-71953a50f368"
          ],
          "related_substance": {
            "uuid": "b4dfcdb2-6af3-4998-85eb-f65d1ce9853d",
            "refuuid": "2709f38c-46c5-40a0-aec1-b07d0b8fee7c",
            "name": "7,7-NONAMETHYLENE-BIS(ESTRA-1,3,5(10)-TRIENE-3,17-DIOL),(7.ALPHA.,17.BETA.)-",
            "unii": "360UZ089BU",
            "linking_id": "360UZ089BU",
            "ref_pname": "7,7-NONAMETHYLENE-BIS(ESTRA-1,3,5(10)-TRIENE-3,17-DIOL),(7.ALPHA.,17.BETA.)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "93bce3d1-76b9-4360-a235-655b90065368",
          "amount": {
            "uuid": "1065eefa-a291-470f-8fb9-9c6b0812a69d",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA (CORRECTION FACTOR)",
            "high_limit": 0.6
          },
          "comments": "For the calculation of contents, multiply the peak areas by 0.7",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b86711cd-e570-4048-b972-a648fd18b0f8"
          ],
          "related_substance": {
            "uuid": "8e8d4c25-5231-4fc9-9f04-6ebaa174c14b",
            "refuuid": "2ce1a505-ecef-4409-926a-0eb35811b037",
            "name": "7,7'-NONANE-1,9-DIYLBIS(ESTRA-1,3,5(10)-TRIENE-3,17.BETA.-DIOL)",
            "unii": "6392824468",
            "linking_id": "6392824468",
            "ref_pname": "7,7'-NONANE-1,9-DIYLBIS(ESTRA-1,3,5(10)-TRIENE-3,17.BETA.-DIOL)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1bcc6156-1fd0-4c1e-902f-a8d1b5e19a4e",
          "amount": {
            "uuid": "b222a85c-893e-4051-adc1-e791466496e6",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4105e1ec-7dcc-4351-82ec-71953a50f368"
          ],
          "related_substance": {
            "uuid": "336b1079-c508-4f3e-a9ba-ee89392e18cb",
            "refuuid": "3550333b-81f4-4e33-8005-3e530c0eb1e5",
            "name": "6-Fulvestrant",
            "unii": "52A05VPF7S",
            "linking_id": "52A05VPF7S",
            "ref_pname": "6-Fulvestrant",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3820deb5-8b1e-4ef6-be2f-9fc8623183ac",
          "amount": {
            "uuid": "63fc4d68-e272-45df-85b8-2c9fcbc6583e",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA (CORRECTION FACTOR)",
            "high_limit": 0.15
          },
          "comments": "For the calculation of contents, multiply the peak areas by 0.3",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b86711cd-e570-4048-b972-a648fd18b0f8"
          ],
          "related_substance": {
            "uuid": "28eeb8f7-e8d4-44fe-973d-54d3c3f2bb99",
            "refuuid": "afbbaa02-7a34-45fc-932a-b4072d4ea19f",
            "name": "7-(9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYL)-3,17.BETA.-DIHYDROXYESTRA-1,3,5(10)-TRIEN-6-ONE",
            "unii": "98WY072U8M",
            "linking_id": "98WY072U8M",
            "ref_pname": "7-(9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYL)-3,17.BETA.-DIHYDROXYESTRA-1,3,5(10)-TRIEN-6-ONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5be2c160-bca0-489f-af55-6e20f0c56d0f",
          "amount": {
            "uuid": "0f0eaf36-dd15-45d3-ac81-854791825244",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "4105e1ec-7dcc-4351-82ec-71953a50f368"
          ],
          "related_substance": {
            "uuid": "3dc63d08-6722-4342-ac3e-ca19b45fe47f",
            "refuuid": "d046e7e2-daa7-4b30-9aea-2123acca15af",
            "name": "6-KETO-FULVESTRANT",
            "unii": "M1IH3Z2RR8",
            "linking_id": "M1IH3Z2RR8",
            "ref_pname": "6-KETO-FULVESTRANT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "89282207-7e90-4a97-987c-f8dbe40cc719",
          "amount": {
            "uuid": "b13bf74c-b2f7-4491-9fb9-73f6d27e5008"
          },
          "type": "METABOLITE LESS ACTIVE->PARENT",
          "references": [
            "0c6abb4c-9fe0-454e-b6cd-f178a9178d86"
          ],
          "related_substance": {
            "uuid": "a37eadf9-05b2-4944-a6b5-0ad6dd8a7341",
            "refuuid": "67b49170-3991-4448-88cd-c75ffc628ebe",
            "name": "FULVESTRANT 17-KETONE",
            "unii": "4U9ZQ7YHR9",
            "linking_id": "4U9ZQ7YHR9",
            "ref_pname": "FULVESTRANT 17-KETONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4bc9fb18-deaa-458c-b726-f8f96b8fa8b5",
          "amount": {
            "uuid": "e755e896-8ef6-4bb9-b5f6-fe0ebbf275cc"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "4274e369-c1d7-48a7-9527-4e53cb110765"
          ],
          "related_substance": {
            "uuid": "ff34bac8-32a3-4c1b-9c82-d72cdc6e47d8",
            "refuuid": "47d7f725-8b7f-47d7-88d5-d6a3810633e2",
            "name": "FULVESTRANT SULFONE",
            "unii": "55928538EN",
            "linking_id": "55928538EN",
            "ref_pname": "FULVESTRANT SULFONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "74051b27-26cb-48e5-b145-1863c02526cc",
          "amount": {
            "uuid": "313a8fcc-c47a-45fd-8d8c-5c6def5def0c"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "4274e369-c1d7-48a7-9527-4e53cb110765"
          ],
          "related_substance": {
            "uuid": "d68388d6-510b-4e31-a59b-1e6ede724388",
            "refuuid": "d22ad5c6-eb4b-4674-977c-6575e81372a3",
            "name": "FULVESTRANT 3-SULFATE",
            "unii": "WJ34L4WA5M",
            "linking_id": "WJ34L4WA5M",
            "ref_pname": "FULVESTRANT 3-SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "081a516d-a8d3-4230-afcc-c30b89d3e4a5",
          "amount": {
            "uuid": "69d145f8-ca34-48cb-8537-a73583b4b4df"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "2e304d76-09ca-4c13-a90f-09000b8e7b2e",
            "refuuid": "2cd7778c-739b-4ef0-9cf5-f6df51488f58",
            "name": "FULVESTRANT 3-.BETA.-D-GLUCURONIDE",
            "unii": "RB33MP5RCR",
            "linking_id": "RB33MP5RCR",
            "ref_pname": "FULVESTRANT 3-.BETA.-D-GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "be5365f1-ef39-44e7-9ef3-db68f5542e05",
          "amount": {
            "uuid": "96f318d1-9662-4d0d-a1e1-2e90b0b5e6c4"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "4274e369-c1d7-48a7-9527-4e53cb110765"
          ],
          "related_substance": {
            "uuid": "43470f58-6970-4fd8-9cbb-b868077a5602",
            "refuuid": "dccc74b1-0bc1-4ea8-8218-81e72028e1e3",
            "name": "FULVESTRANT 17-.BETA.-D-GLUCURONIDE",
            "unii": "D9J6E34HZC",
            "linking_id": "D9J6E34HZC",
            "ref_pname": "FULVESTRANT 17-.BETA.-D-GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9e979afb-a96e-4f2b-8a1f-9b65e213ee77",
          "amount": {
            "uuid": "08afea64-f787-4709-a2db-0d28c951860f",
            "average": 99,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "35b175fb-9315-5350-487e-d2bba9149d83"
          ],
          "related_substance": {
            "uuid": "527ed380-bfcf-47be-955e-720dbb59c992",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fd5c9b46-0248-4ae6-ba64-d02ea582c177",
          "amount": {
            "uuid": "7c145777-7c56-44e4-8a1d-9e7825c1bea6",
            "average": 4.4,
            "units": "NANOMOLAR",
            "non_numeric_value": "MCF-7 CELL PROLIFERATION"
          },
          "comments": "Selective estrogen receptor degrader (SERD)",
          "qualification": "IC50",
          "type": "TARGET->DEGRADER, SELECTIVE",
          "interaction_type": "BINDING",
          "references": [
            "860e4d94-bd4a-0320-87bb-ca875d2b6212"
          ],
          "related_substance": {
            "uuid": "66cdf470-3ddd-49bf-b8ad-2c11e74ccc80",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "842c8733-604d-40a3-b672-81f6027b1c3f",
          "amount": {
            "uuid": "45170f26-e067-4ec2-88ba-13645888e29c",
            "average": 1.2,
            "units": "NANOMOLAR",
            "non_numeric_value": "ER.ALPHA. DEGRADATION"
          },
          "comments": "Selective estrogen receptor degrader (SERD)",
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "interaction_type": "BINDING",
          "references": [
            "860e4d94-bd4a-0320-87bb-ca875d2b6212"
          ],
          "related_substance": {
            "uuid": "88337283-7c67-47a7-a7fa-05f22867f66e",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cfb4f85b-143f-4c45-ad4e-b70ad9b94f6a",
          "amount": {
            "uuid": "b598cb78-bd1d-471c-a3c7-56261e5541c9"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "d62ec91c-0ab3-39fc-06e4-4c292a7d935d"
          ],
          "related_substance": {
            "uuid": "373e4c12-73eb-4875-b197-8f7f6f92c83c",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f0fcc32c-9698-41b5-befc-0cc13ee33601",
          "amount": {
            "uuid": "5de01655-5c5a-4435-9df2-aa82279dfcd7",
            "average": 0.4
          },
          "comments": "100%  Degradation as control",
          "qualification": "EC50",
          "type": "TARGET->DEGRADER, SELECTIVE",
          "references": [
            "4f418f3d-7828-4735-bebd-b78bd1677ec6"
          ],
          "related_substance": {
            "uuid": "26ec0416-2b98-49f8-9ccf-eb00f0e3b818",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "59ef33e4-9f08-40f6-b619-3f9b9310a089",
          "amount": {
            "uuid": "81e28fb1-5b09-422c-8de5-5b32dc9be7e3",
            "average": 24
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "4f418f3d-7828-4735-bebd-b78bd1677ec6"
          ],
          "related_substance": {
            "uuid": "8aa86802-41bc-4ef1-862e-7b2bd3185775",
            "refuuid": "4673cf81-dd46-4a8d-8696-823ccebce65d",
            "name": "ESTROGEN RECEPTOR",
            "unii": "SIDP85PFD6",
            "linking_id": "SIDP85PFD6",
            "ref_pname": "ESTROGEN RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b354c036-8210-4007-bd70-df84f779efc1",
          "amount": {
            "uuid": "67012ddc-a42c-46ec-8a03-52a5133f6cd6",
            "average": 21,
            "units": "NANOMOLAR"
          },
          "comments": "Binding assay",
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "4f418f3d-7828-4735-bebd-b78bd1677ec6"
          ],
          "related_substance": {
            "uuid": "644ba2ac-32f2-4c1e-95ba-a048f750373d",
            "refuuid": "76ca6a0a-c020-48da-84b0-eaa4bbf232c9",
            "name": "ESTROGEN RECEPTOR BETA",
            "unii": "FO7FW4DL8V",
            "linking_id": "FO7FW4DL8V",
            "ref_pname": "ESTROGEN RECEPTOR BETA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e10fbbbf-decc-42ae-b9d2-63932ad4921d",
          "amount": {
            "uuid": "56769099-d3b7-44ba-8a2e-85bccef166c1",
            "average": 0.4,
            "units": "NANOMOLAR"
          },
          "comments": "Viablity",
          "qualification": "IC50",
          "type": "CELL->INHIBITOR",
          "references": [
            "4f418f3d-7828-4735-bebd-b78bd1677ec6"
          ],
          "related_substance": {
            "uuid": "7b019e5c-b79f-4352-bf0c-f5658e81a14c",
            "refuuid": "2b0eb691-e73e-4046-bb73-9f226693cbb3",
            "name": "MCF-7 Cell Line",
            "unii": "59NGC264UZ",
            "linking_id": "59NGC264UZ",
            "ref_pname": "MCF-7 Cell Line",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fc5b5f79-c4bc-49e2-b47b-0659c949de8c",
          "amount": {
            "uuid": "658fc09f-3748-48b6-aea6-ba65b8ba4e67"
          },
          "type": "PARENT->METABOLITE ACTIVE",
          "references": [
            "ab76c34f-d648-4caa-81a9-a4d639bc2f52",
            "d7c7f20f-14ba-476c-b7d0-ed25c342b6c8"
          ],
          "related_substance": {
            "uuid": "b17ef969-8e9e-4fee-840b-09005d6fbded",
            "refuuid": "a9d4e7ad-6322-4490-b2fc-f0d2d91c2990",
            "name": "ZB-716",
            "unii": "E35ZN95LMT",
            "linking_id": "E35ZN95LMT",
            "ref_pname": "ZB-716"
          }
        }
      ],
      "names": [
        {
          "uuid": "f50f48bb-1777-4cb6-9016-79efc4909c7f",
          "name": "7.ALPHA.-(9-(4,4,5,5,5-PENTAFLUOROPENTYLSULPHINYL)NONYL)ESTRA-1,3,5(10)-TRIENE-3,17.BETA.-DIOL",
          "stdName": "7.ALPHA.-(9-(4,4,5,5,5-PENTAFLUOROPENTYLSULPHINYL)NONYL)ESTRA-1,3,5(10)-TRIENE-3,17.BETA.-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45c374e3-99e2-4d38-b569-d29658d25583"
          ],
          "display_name": false
        },
        {
          "uuid": "aed4ec35-e3b6-4cab-b90d-d7e9df30c50d",
          "name": "ESTRA-1,3,5(10)-TRIENE-3,17-DIOL, 7-(9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYL)-, (7.ALPHA.,17.BETA.)-",
          "stdName": "ESTRA-1,3,5(10)-TRIENE-3,17-DIOL, 7-(9-((4,4,5,5,5-PENTAFLUOROPENTYL)SULFINYL)NONYL)-, (7.ALPHA.,17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4719b952-6cdc-47f0-ab00-1b9e1dbf410f"
          ],
          "display_name": false
        },
        {
          "uuid": "4a011862-0eb3-4b88-a93b-49eb7fe0b977",
          "name": "FASLODEX",
          "stdName": "FASLODEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4719b952-6cdc-47f0-ab00-1b9e1dbf410f"
          ],
          "display_name": false
        },
        {
          "uuid": "3dc39486-5232-4a00-a388-f803f17ea49f",
          "name": "FULVESTRANT",
          "stdName": "FULVESTRANT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0c9c9f3-7385-4d4b-aaeb-7fc3a26edf14",
            "97eaf5ec-003f-4685-894c-fcbe2be93b1e",
            "ae1ef8c6-512e-478e-8e20-f5a883265794",
            "39bbc823-f760-43fd-8019-b4b48177c270",
            "483aa9e6-f5b3-41fb-bbbb-68c57f93d4c7",
            "2905af06-cb20-41ab-8c9e-bcf2b9f3a09b",
            "d41e4cc4-3b4c-4a02-8f62-cd32289b2d57",
            "a965f24d-2353-49c2-8f5b-d75ecc19ddb8",
            "62b6f862-e82e-43b6-9987-7278ae5a4731",
            "0805a455-fe78-48e2-950e-d7f73e40b5f2",
            "f0beb89f-2bc4-49dc-b281-298f88d3997d",
            "16ceeaf7-9982-4f62-a934-43d7d61c98a5",
            "ad178524-7e7f-44e3-8e65-c823ea52e054",
            "34c01b2d-b173-4997-8c4f-269538640911",
            "01bba1f2-828f-4bc0-814d-ba4bb839596a",
            "5de34cda-97c6-4980-b605-3bd77054d46f",
            "fe32296f-1349-4127-b504-34011e718a9b",
            "9ca88dce-3f48-4629-94e5-6330a71924f9",
            "7a46365b-aabf-437b-9f76-37fde414909f",
            "8a0c3d62-3909-47b2-b470-316eb15028c1",
            "4d649125-0950-4076-ad7d-890c51848059",
            "db0b0edd-eb7f-4b78-aa23-cb3f314d669f",
            "13d8631d-ac91-415f-ab06-d68f54c6c3ac",
            "c4696a00-9279-4b41-9973-e1482218b62a",
            "ca910577-1893-4223-bc8b-19270c1c4012"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "279b4544-0fb7-4a57-97f2-d90fc82faee1",
              "name_org": "USAN"
            },
            {
              "uuid": "73038d79-acc1-4427-85b5-a0aac767f259",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ea6688a6-95bd-470a-93bb-c9d0f2cb44cd",
          "name": "FULVESTRANT [EMA EPAR]",
          "stdName": "FULVESTRANT [EMA EPAR]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5de34cda-97c6-4980-b605-3bd77054d46f"
          ],
          "display_name": false
        },
        {
          "uuid": "e24d8aad-6754-a488-652c-ad99d10a67cc",
          "name": "FULVESTRANT [EP MONOGRAPH]",
          "stdName": "FULVESTRANT [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73b9dea4-98df-5ca1-0626-e8783248236a"
          ],
          "display_name": false
        },
        {
          "uuid": "676eefe9-124c-4ea1-9859-775955edb672",
          "name": "FULVESTRANT [JAN]",
          "stdName": "FULVESTRANT [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad178524-7e7f-44e3-8e65-c823ea52e054"
          ],
          "display_name": false
        },
        {
          "uuid": "05b3a1d7-be4d-478e-b4ea-5b15399ed9c1",
          "name": "FULVESTRANT [MART.]",
          "stdName": "FULVESTRANT [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ca88dce-3f48-4629-94e5-6330a71924f9"
          ],
          "display_name": false
        },
        {
          "uuid": "0e82b01e-4753-42f4-a2cf-8838f321d5ec",
          "name": "FULVESTRANT [MI]",
          "stdName": "FULVESTRANT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca910577-1893-4223-bc8b-19270c1c4012"
          ],
          "display_name": false
        },
        {
          "uuid": "687bd07b-772a-4132-b705-331cfd697b56",
          "name": "FULVESTRANT [ORANGE BOOK]",
          "stdName": "FULVESTRANT [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "483aa9e6-f5b3-41fb-bbbb-68c57f93d4c7"
          ],
          "display_name": false
        },
        {
          "uuid": "fffc8101-92f0-4c8b-836a-5094400e6d95",
          "name": "FULVESTRANT [USAN]",
          "stdName": "FULVESTRANT [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d41e4cc4-3b4c-4a02-8f62-cd32289b2d57"
          ],
          "display_name": false
        },
        {
          "uuid": "2d6ab2d1-1bfb-2684-6a3b-4ab16e641691",
          "name": "FULVESTRANT [USP IMPURITY]",
          "stdName": "FULVESTRANT [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe32296f-1349-4127-b504-34011e718a9b"
          ],
          "display_name": false
        },
        {
          "uuid": "a983f5fa-a535-f7b2-0436-2a36729ac2f9",
          "name": "FULVESTRANT [USP MONOGRAPH]",
          "stdName": "FULVESTRANT [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71c096f9-2a19-e7b2-4b7d-2679225920f3"
          ],
          "display_name": false
        },
        {
          "uuid": "162ac638-b764-4bcf-b676-44470ffdfaea",
          "name": "FULVESTRANT [USP-RS]",
          "stdName": "FULVESTRANT [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13d8631d-ac91-415f-ab06-d68f54c6c3ac"
          ],
          "display_name": false
        },
        {
          "uuid": "1b09ddc6-b675-4768-b42a-edd615787963",
          "name": "FULVESTRANT [VANDF]",
          "stdName": "FULVESTRANT [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2905af06-cb20-41ab-8c9e-bcf2b9f3a09b"
          ],
          "display_name": false
        },
        {
          "uuid": "44e07ea8-5e36-2356-d7ea-7accb72e12f6",
          "name": "Fulvestrant [WHO-DD]",
          "stdName": "FULVESTRANT [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d2346d8-e7b0-2421-7477-3eb200b47ae8"
          ],
          "display_name": false
        },
        {
          "uuid": "e0f05046-f7ad-43bf-b08c-2b3a92a05eae",
          "name": "ICI 182,780",
          "stdName": "ICI 182,780",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4719b952-6cdc-47f0-ab00-1b9e1dbf410f"
          ],
          "display_name": false
        },
        {
          "uuid": "555b2729-cbca-4f39-9029-4d8bd52b05e1",
          "name": "ICI-182780",
          "stdName": "ICI-182780",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66e576a0-06b7-45f4-8895-ce2380133b0a"
          ],
          "display_name": false
        },
        {
          "uuid": "8949aba9-71bf-ddf2-0d2a-e5cb43ef9c42",
          "name": "NSC-759879",
          "stdName": "NSC-759879",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5285d2e9-68b9-9c18-0133-8149a7c97332"
          ],
          "display_name": false
        },
        {
          "uuid": "07d83288-b32c-486f-91d0-64252c7277c2",
          "name": "ZD-9238",
          "stdName": "ZD-9238",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66e576a0-06b7-45f4-8895-ce2380133b0a"
          ],
          "display_name": false
        },
        {
          "uuid": "d75f7ca3-e556-4f93-9b58-13f01edf473b",
          "name": "ZD9238",
          "stdName": "ZD9238",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4719b952-6cdc-47f0-ab00-1b9e1dbf410f"
          ],
          "display_name": false
        },
        {
          "uuid": "b63207da-3a7d-47f9-a893-cd751755b264",
          "name": "fulvestrant [INN]",
          "stdName": "FULVESTRANT [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01bba1f2-828f-4bc0-814d-ba4bb839596a"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "aa102116-8802-4706-8c98-1bc70a4aec0c",
          "name": "Biological Half-life",
          "value": {
            "uuid": "eb0da7e1-bcfd-495c-a47e-4983f19924b6",
            "average": 40,
            "units": "days"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "35b175fb-9315-5350-487e-d2bba9149d83"
          ]
        },
        {
          "uuid": "dc030c4e-e5f9-47db-9264-0c077a634293",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "e90a4ad8-d523-4b67-a341-0ed93ea67c53",
            "high": 5,
            "low": 3,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "35b175fb-9315-5350-487e-d2bba9149d83"
          ]
        }
      ]
    }
  ]
}