{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0a9bc8b8-4ee1-4b76-8e8d-b6272a779a86",
          "code": "208465-21-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=208465-21-8",
          "code_system": "CAS",
          "references": [
            "6f6c5d4e-e22d-4354-92c1-104dbde2bc3a",
            "b155264d-0f36-499c-b09f-7d6a18489d78"
          ]
        },
        {
          "uuid": "7ae89951-9e4a-4a66-9182-10c32c493c31",
          "code": "C521745",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67521745",
          "code_system": "MESH",
          "references": [
            "6f6c5d4e-e22d-4354-92c1-104dbde2bc3a"
          ]
        },
        {
          "uuid": "44279ff8-6837-41d0-9e16-6a249e6452d2",
          "code": "122009",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2818",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "6f6c5d4e-e22d-4354-92c1-104dbde2bc3a"
          ]
        },
        {
          "uuid": "7f5b51b7-d1b6-4bb9-b666-9a208fe857bc",
          "code": "m7251",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7251?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6f6c5d4e-e22d-4354-92c1-104dbde2bc3a"
          ]
        },
        {
          "uuid": "b3624fd3-fdf8-48cf-8419-451b6e4084b4",
          "code": "11409499",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11409499",
          "code_system": "PUBCHEM",
          "references": [
            "6f6c5d4e-e22d-4354-92c1-104dbde2bc3a"
          ]
        },
        {
          "uuid": "cd758e18-ae32-1bdf-a965-afc952c44203",
          "code": "7889",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7889",
          "code_system": "HSDB",
          "references": [
            "69642575-20d2-9859-fdfc-1ceaade2c182"
          ]
        },
        {
          "uuid": "27c3e436-49df-51b3-b192-d6ca675fd5a0",
          "code": "DTXSID6034712",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6034712",
          "code_system": "EPA CompTox",
          "references": [
            "0633f8d1-da2f-cc26-b796-368c876b90a2"
          ]
        },
        {
          "uuid": "853b2656-260a-482c-9ff3-bdc2a18b87a6",
          "code": "22L00R79A6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "121a0027-5cc3-6cb8-52f8-87a87aa7a803",
          "code": "mesosulfuron-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/mesosulfuron-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "3e6c0434-cd9e-0121-a50a-c8533fb24e5c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "16f9aec4-bc5a-4e2f-b6ef-d758a221c824",
          "name": "2-(((((4,6-DIMETHOXY-2-PYRIMIDINYL)AMINO)CARBONYL)AMINO)SULFONYL)-4-(((METHYLSULFONYL)AMINO)METHYL)BENZOIC ACID METHYL ESTER",
          "stdName": "2-(((((4,6-DIMETHOXY-2-PYRIMIDINYL)AMINO)CARBONYL)AMINO)SULFONYL)-4-(((METHYLSULFONYL)AMINO)METHYL)BENZOIC ACID METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "a463045f-3b22-42e8-b446-d7d75743532f"
          ],
          "display_name": false
        },
        {
          "uuid": "ff96ad1a-8a15-4179-bee8-bfeeb6d09b28",
          "name": "AE-F130060",
          "stdName": "AE-F130060",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "a463045f-3b22-42e8-b446-d7d75743532f"
          ],
          "display_name": false
        },
        {
          "uuid": "986063b2-b7d5-44f7-8ce1-d34ab7b3ec21",
          "name": "MESOSULFURON-METHYL",
          "stdName": "MESOSULFURON-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4edb0a79-e33d-44dd-b58e-c512b6df5b9d",
            "ae508d6f-4f35-4a95-a926-906923e15fb7",
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "c40fcaf7-7f31-4927-be70-e771e991fd56",
            "4e7723ea-b5c1-4888-853b-25a0f357591a",
            "9cb08016-4205-40d3-8fa0-82ed7af70c19"
          ],
          "display_name": true
        },
        {
          "uuid": "a4672623-fa84-4fea-9b59-05af70cb1749",
          "name": "MESOSULFURON-METHYL [ISO]",
          "stdName": "MESOSULFURON-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "9cb08016-4205-40d3-8fa0-82ed7af70c19"
          ],
          "display_name": false
        },
        {
          "uuid": "46803f51-4e02-431d-ab43-eff645645fb8",
          "name": "MESOSULFURON-METHYL [MI]",
          "stdName": "MESOSULFURON-METHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "4e7723ea-b5c1-4888-853b-25a0f357591a"
          ],
          "display_name": false
        },
        {
          "uuid": "134d7a77-790d-4455-bbbd-acb7ce3505c6",
          "name": "METHYL 2-(3-(4,6-DIMETHOXYPYRIMIDIN-2-YL)UREIDOSULFONYL)-4-METHANESULFONAMIDOMETHYLBENZOATE",
          "stdName": "METHYL 2-(3-(4,6-DIMETHOXYPYRIMIDIN-2-YL)UREIDOSULFONYL)-4-METHANESULFONAMIDOMETHYLBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "a463045f-3b22-42e8-b446-d7d75743532f"
          ],
          "display_name": false
        },
        {
          "uuid": "51e122a2-b814-4359-b040-dde6e8354c17",
          "name": "OSPREY",
          "stdName": "OSPREY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "493bfa21-1e0b-4c3e-a3c7-bf977ce153e8"
          ],
          "display_name": false
        },
        {
          "uuid": "dae14f82-03d0-4b2c-95aa-642519d1af3e",
          "name": "SILVERADO",
          "stdName": "SILVERADO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bfba9dee-1207-460b-a6dd-1f40dd79b459",
            "493bfa21-1e0b-4c3e-a3c7-bf977ce153e8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ae508d6f-4f35-4a95-a926-906923e15fb7",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4e7723ea-b5c1-4888-853b-25a0f357591a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfba9dee-1207-460b-a6dd-1f40dd79b459",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a463045f-3b22-42e8-b446-d7d75743532f",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "493bfa21-1e0b-4c3e-a3c7-bf977ce153e8",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9cb08016-4205-40d3-8fa0-82ed7af70c19",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f6c5d4e-e22d-4354-92c1-104dbde2bc3a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26ee8683-38f8-4129-a617-d1600b35939b",
          "citation": "SRS import [22L00R79A6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=22L00R79A6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e98df0b-e112-4337-81de-292aad91cd60",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4edb0a79-e33d-44dd-b58e-c512b6df5b9d",
          "citation": "MESOSULFURON-METHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c40fcaf7-7f31-4927-be70-e771e991fd56",
          "citation": "MESOSULFURON-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69642575-20d2-9859-fdfc-1ceaade2c182",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+208465-21-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0633f8d1-da2f-cc26-b796-368c876b90a2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=208465-21-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e6c0434-cd9e-0121-a50a-c8533fb24e5c",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b155264d-0f36-499c-b09f-7d6a18489d78",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3890098f-33c8-4862-9c63-31d1bc40ae26",
          "id": "3890098f-33c8-4862-9c63-31d1bc40ae26",
          "molfile": "\n  Marvin  01132103002D          \n\n 33 34  0  0  0  0            999 V2000\n    2.9135   -3.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6295   -2.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -3.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -2.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6295   -4.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6295   -5.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -5.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -6.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -6.8041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -7.6291    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -8.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -8.0416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -8.0416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -5.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -4.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -3.9121    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -4.7371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9869   -3.1138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4886   -4.3246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2044   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2044   -3.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9203   -4.3246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3522   -4.3246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0635   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7795   -4.3246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4953   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0635   -3.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3522   -2.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3522   -1.8451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0635   -1.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -3.0872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 16  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 15  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 33 24  2  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 26 29  1  0  0  0  0\n 27 28  1  0  0  0  0\n 30 29  2  0  0  0  0\n 30 31  1  0  0  0  0\n 30 33  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(nc(n1)NC(=O)NS(=O)(=O)c2cc(ccc2C(=O)OC)CNS(=O)(=O)C)OC",
          "formula": "C17H21N5O9S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31b6ff45-8fb9-40ed-97be-37a8740e4090"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "503.5096",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "19215409-c151-4992-b9b7-b3f7dc8d0749",
      "version": "5",
      "structure": {
        "id": "c84d4528-b787-4f8b-9c36-945160c371c1",
        "molfile": "\n  Marvin  01132110212D          \n\n 33 34  0  0  0  0            999 V2000\n    4.3455   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6295   -4.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6295   -5.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -5.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -5.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -4.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -3.9121    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4886   -4.3246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2044   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9203   -4.3246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6364   -3.0872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3522   -2.6700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0635   -3.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0635   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3522   -4.3246    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7795   -4.3246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4953   -3.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3522   -1.8451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0635   -1.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2044   -3.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -4.7371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9869   -3.1138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -6.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -6.8041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -7.6291    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7726   -8.0416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -8.0416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -8.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3455   -3.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0567   -2.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6295   -2.6700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9135   -3.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 11 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n  9 21  2  0  0  0  0\n  7 22  2  0  0  0  0\n  7 23  2  0  0  0  0\n  4 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  2  0  0  0  0\n 26 29  1  0  0  0  0\n  1 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(nc(n1)NC(=O)NS(=O)(=O)c2cc(ccc2C(=O)OC)CNS(=O)(=O)C)OC",
        "formula": "C17H21N5O9S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "503.5096",
        "optical_activity": "NONE",
        "references": [
          "9e98df0b-e112-4337-81de-292aad91cd60",
          "26ee8683-38f8-4129-a617-d1600b35939b"
        ],
        "stereo_centers": 0
      },
      "unii": "22L00R79A6"
    }
  ]
}