{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ebabd132-bd09-42f9-9f78-68caf76fe106",
          "code": "7785-53-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7785-53-7",
          "code_system": "CAS",
          "references": [
            "93b1c34e-b1a2-4e2e-920f-8b73bd2d450a",
            "4803f010-dd82-408a-9f1d-25fb224fb43e"
          ]
        },
        {
          "uuid": "ddc5535f-e478-5815-afce-b7695b0a375e",
          "code": "2398338",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2398338/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0bdeb61c-f37c-8219-b2cc-5403d99e0686"
          ]
        },
        {
          "uuid": "f13ed423-c548-4e65-8aed-44a642a4fac0",
          "code": "21M14KDA67",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2923322d-de7e-49c2-b07b-5b2ed85ec900",
          "code": "442501",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442501",
          "code_system": "PUBCHEM",
          "references": [
            "3bd0588e-f6b7-4f72-b8bd-ba45d55d061e",
            "0bdeb61c-f37c-8219-b2cc-5403d99e0686"
          ]
        },
        {
          "uuid": "3357bc83-c665-3dcb-bbd2-4b4d208a2744",
          "code": "DTXSID60884429",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60884429",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "775ac484-1836-2074-e902-40dcea5a4bac",
          "code": "21M14KDA67",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=21M14KDA67",
          "code_system": "DAILYMED",
          "references": [
            "b2aba046-13a8-dedf-0127-4036c5dccfd0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9b05b50c-edc9-4629-bffc-45250232a4e8",
          "amount": {
            "uuid": "de04781c-e7f6-4d1f-bc55-731c637a7c58"
          },
          "type": "RACEMATE->ENANTIOMER",
          "references": [
            "3bd0588e-f6b7-4f72-b8bd-ba45d55d061e"
          ],
          "related_substance": {
            "uuid": "1386bb64-0e98-4081-8087-10980e2d0ca7",
            "refuuid": "4c2f36be-32b7-48dc-8137-e7b81af66374",
            "name": ".ALPHA.-TERPINEOL",
            "unii": "21334LVV8W",
            "linking_id": "21334LVV8W",
            "ref_pname": ".ALPHA.-TERPINEOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "877998d7-0ea9-41d7-a35c-b370088c3739",
          "name": "(R)-(+)-.ALPHA.-TERPINEOL",
          "stdName": "(R)-(+)-.ALPHA.-TERPINEOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3bd0588e-f6b7-4f72-b8bd-ba45d55d061e"
          ],
          "display_name": false
        },
        {
          "uuid": "aebb0f4f-f07e-46f4-a622-d4e996a09ec9",
          "name": ".ALPHA.-TERPINEOL, (+)-",
          "stdName": ".ALPHA.-TERPINEOL, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d143564-73e8-4907-9069-3e1b4d79198b",
            "3bd0588e-f6b7-4f72-b8bd-ba45d55d061e"
          ],
          "display_name": true
        },
        {
          "uuid": "839f7c22-f7f1-46df-8217-1b122b14a915",
          "name": "2-((1R)-4-METHYLCYCLOHEX-3-EN-1-YL)PROPAN-2-OL",
          "stdName": "2-((1R)-4-METHYLCYCLOHEX-3-EN-1-YL)PROPAN-2-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3bd0588e-f6b7-4f72-b8bd-ba45d55d061e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "52e6471d-d92a-4383-804e-6747c3d5673f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3bd0588e-f6b7-4f72-b8bd-ba45d55d061e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d143564-73e8-4907-9069-3e1b4d79198b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9891c5d-9b08-49e4-a4a0-3a2a98f8ae30",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e3122f0-9291-4832-8924-d6aaa9e54689",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d3b55dc-aa9d-4a20-898b-26eb884e0559",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93b1c34e-b1a2-4e2e-920f-8b73bd2d450a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390767000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc54e4bb-f7c5-4b33-ac1c-4b3342bc7039",
          "citation": "SRS import [21M14KDA67]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=21M14KDA67",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390767000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e04c3e07-bd2d-480f-b6b8-a063f70dfd5e",
          "citation": "(L)-ALPHA-TERPINEOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa942793-afbb-94bc-4a27-b458388d6531",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+10482-56-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "27011826-554a-ad66-567e-5d86c788a078",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10482-56-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0bdeb61c-f37c-8219-b2cc-5403d99e0686",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "4803f010-dd82-408a-9f1d-25fb224fb43e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b2aba046-13a8-dedf-0127-4036c5dccfd0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ce12bbdf-c460-f5e9-83b3-0acc9e7cf31c",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9c484bcc-aaf7-4273-af53-15864c660322",
          "id": "9c484bcc-aaf7-4273-af53-15864c660322",
          "molfile": "\n  Marvin  07142111392D          \n\n 11 11  0  0  1  0            999 V2000\n   12.9702   -5.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3952   -3.6083    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.2604   -4.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6856   -4.0242    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.6856   -4.8502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9702   -3.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2604   -4.0242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1107   -4.0212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7995   -2.8898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9794   -2.8957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5421   -5.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  2  0  0  0  0\n  5  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  2  1  0  0  0  0\n  4  2  1  1  0  0  0\n  7  3  1  0  0  0  0\n 11  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC[C@@H](CC1)C(C)(C)O",
          "formula": "C10H18O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "513890d4-b99a-4b15-b6d7-7cd4c22ac8dc"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "154.2497",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2e3661e4-3677-49a0-b6a6-ef387b9e3ef3",
      "version": "16",
      "structure": {
        "id": "f61b7749-6b50-463c-92a2-83401083f8dd",
        "molfile": "\n   JSDraw207142111392D\n\n 11 11  0  0  1  0              0 V2000\n   24.4952   -9.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1865   -6.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1548   -9.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8463   -7.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8463   -9.1600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4952   -6.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1548   -7.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5378   -7.5943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9500   -5.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4012   -5.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7982   -9.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  4  2  1  1  0  0  0\nM  END",
        "smiles": "CC1=CC[C@@H](CC1)C(C)(C)O",
        "formula": "C10H18O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "154.2497",
        "optical_activity": "( + )",
        "references": [
          "52e6471d-d92a-4383-804e-6747c3d5673f",
          "dc54e4bb-f7c5-4b33-ac1c-4b3342bc7039"
        ],
        "stereo_centers": 1
      },
      "unii": "21M14KDA67"
    }
  ]
}