{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f967c3e6-5b32-423b-9eb8-5321cfe804f2",
          "code": "23180-57-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23180-57-6",
          "code_system": "CAS",
          "references": [
            "307cda65-a4b7-430f-8126-c90ceba477c4",
            "a01c8193-3228-4fac-8456-752fb306d435"
          ]
        },
        {
          "uuid": "5309f56d-1352-4e93-a88b-aaef7257abc4",
          "code": "PAEONIFLORIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Paeoniflorin",
          "code_system": "WIKIPEDIA",
          "references": [
            "307cda65-a4b7-430f-8126-c90ceba477c4"
          ]
        },
        {
          "uuid": "2bb499a5-4323-4322-ae51-cfe44d28f2b0",
          "code": "245-476-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.327",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "307cda65-a4b7-430f-8126-c90ceba477c4"
          ]
        },
        {
          "uuid": "567bb6f9-ed2e-4548-a87d-46e726c2718a",
          "code": "442534",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442534",
          "code_system": "PUBCHEM",
          "references": [
            "307cda65-a4b7-430f-8126-c90ceba477c4"
          ]
        },
        {
          "uuid": "4beebbd9-caf9-043f-1dca-1e7a0b4e2b7f",
          "code": "DTXSID2042648",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2042648",
          "code_system": "EPA CompTox",
          "references": [
            "01d49779-b554-7005-6d3a-a6742f13feb6"
          ]
        },
        {
          "uuid": "a9ac0805-81e0-41b0-6aac-8f7243ab0897",
          "code": "2288155",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2288155/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8f343108-70ea-aabf-c602-c82b6ee9d505"
          ]
        },
        {
          "uuid": "672b6027-e839-7fe0-310a-a78ba1f73abc",
          "code": "3250 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|chemical|Paeoniflorin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3250&item=Paeoniflorin",
          "code_system": "DSLD",
          "references": [
            "8f343108-70ea-aabf-c602-c82b6ee9d505"
          ]
        },
        {
          "uuid": "d3befef3-0806-4eae-8a9a-7555010ed3d4",
          "code": "21AIQ4EV64",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "65df6849-af63-f6ce-6a0e-86dbeb069523",
          "code": "1491616",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1491616",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "8f343108-70ea-aabf-c602-c82b6ee9d505"
          ]
        },
        {
          "uuid": "b3aca0de-1cec-48a8-fb20-c3948d21e1ef",
          "code": "21AIQ4EV64",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=21AIQ4EV64",
          "code_system": "DAILYMED",
          "references": [
            "7c33ed27-3dbe-1b6e-0926-8aef97622920"
          ]
        },
        {
          "uuid": "1b535d0d-203a-b7f1-6c99-57dd2fab1c27",
          "code": "178886",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=178886",
          "code_system": "NSC",
          "references": [
            "5795c185-b9a0-4a42-fc95-f597c0f74fd3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "c7d072e0-7284-461d-afd5-279e04223db6",
          "comments": "Effect of PL, paeoniflorin and paeonol on degranulation of rat peritoneal mast cells (IC50 = >100 uM) and RBL-2H3 (IC50 = >100 uM) cells.",
          "type": "CONSTITUENT ALWAYS PRESENT->PARENT",
          "references": [
            "90c9e4a9-94a1-4cf5-b4e3-64e68afeac00"
          ],
          "related_substance": {
            "uuid": "930afee0-de38-4d4c-a3fd-e16c8106ab08",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6001e2ac-8529-497f-a3c7-7f53aec40073",
          "comments": "Compound tested and showed no antiproliferative effects against two human cancer cell lines, OVCA 429 ovarian cancer cells and BT 483 breast cancer cells (IC50 N 100 μM) by MTT assay.",
          "type": "CONSTITUENT ALWAYS PRESENT->PARENT",
          "references": [
            "5b6b444d-f9ee-4ca1-9ae4-892675437ab2"
          ],
          "related_substance": {
            "uuid": "4d32b618-29d5-42a8-a69f-ad974af9d588",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "764e777a-b851-493f-8bae-10a0376e8f4f",
          "comments": "26.5 ? 3.9% neuroprotective activity of compound against 10.0 uM H2O2-induced neurotoxicity in primary cultures of rat cortical cells.",
          "type": "CONSTITUENT ALWAYS PRESENT->PARENT",
          "references": [
            "1f8c3c5d-b8c5-47bd-a362-71286381d62c"
          ],
          "related_substance": {
            "uuid": "ea8510e0-07e8-49b3-8e9f-600f304052f9",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9e3637b2-0339-4026-8b51-1f1446ae081d",
          "type": "CONSTITUENT ALWAYS PRESENT->PARENT",
          "references": [
            "44af7ad9-76af-412a-b6e0-8075bcd1fcbd"
          ],
          "related_substance": {
            "uuid": "f61047d5-4935-41e8-b4c8-d700f50be3f2",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e55f66e9-a965-4c5f-b932-fa8ef1c44b2d",
          "type": "CONSTITUENT ALWAYS PRESENT->PARENT",
          "references": [
            "2b92dde0-8a97-4b9d-834c-e078283ae068"
          ],
          "related_substance": {
            "uuid": "032f2def-31c4-43c1-9319-a7287963653e",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ccf92dfb-d676-4e4c-a464-bb89ddb5a7bb",
          "comments": "Compound was tested for anticomplement activity through the Classical Pathway (CP) and Alternative Pathway (AP).",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "4dfbeece-5a2b-4293-b9bf-cba78341824e"
          ],
          "related_substance": {
            "uuid": "5912d383-a7f2-4378-9ab7-bedceb5762f1",
            "refuuid": "f762b4ac-750c-4821-ac0d-fad841b9c4d9",
            "name": "PAEONIA X SUFFRUTICOSA ROOT BARK",
            "unii": "BUG255FE7X",
            "linking_id": "BUG255FE7X",
            "ref_pname": "PAEONIA X SUFFRUTICOSA ROOT BARK",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a35008df-0b4c-40a0-b3dd-33cbc069cb2a",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "ce4a603e-10e6-4449-8397-624b7416cdac",
            "refuuid": "edbb1c95-2c86-4f2b-b580-cf1958ad2674",
            "name": "PAEONIA VEITCHII ROOT",
            "unii": "VX6GD6M93V",
            "linking_id": "VX6GD6M93V",
            "ref_pname": "PAEONIA VEITCHII ROOT"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "65522565-0dfd-4c95-90e1-5f0cf45765e5",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, (1AR,2S,3AR,5R,5AR,5BS)-5B-((BENZOYLOXY)METHYL)TETRAHYDRO-5-HYDROXY-2-METHYL-2,5-METHANO-1H-3,4-DIOXACYCLOBUTA(CD)PENTALEN-1A(2H)-YL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, (1AR,2S,3AR,5R,5AR,5BS)-5B-((BENZOYLOXY)METHYL)TETRAHYDRO-5-HYDROXY-2-METHYL-2,5-METHANO-1H-3,4-DIOXACYCLOBUTA(CD)PENTALEN-1A(2H)-YL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1505083d-711e-47c5-abe6-ee10b21958d1",
            "8c50f078-56ad-4082-909e-30843b7f0dad"
          ],
          "display_name": false
        },
        {
          "uuid": "23a4c080-331a-4204-b666-6dab2b7c345a",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, 5B-((BENZOYLOXY)METHYL)TETRAHYDRO-5-HYDROXY-2-METHYL-2,5-METHANO-1H-3,4-DIOXACYCLOBUTA(CD)PENTALEN-1A(2H)-YL, (1AR-(1A.ALPHA.,2.BETA.,3A.ALPHA.,5.ALPHA.,5A.ALPHA.,5B.ALPHA.))-",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 5B-((BENZOYLOXY)METHYL)TETRAHYDRO-5-HYDROXY-2-METHYL-2,5-METHANO-1H-3,4-DIOXACYCLOBUTA(CD)PENTALEN-1A(2H)-YL, (1AR-(1A.ALPHA.,2.BETA.,3A.ALPHA.,5.ALPHA.,5A.ALPHA.,5B.ALPHA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1505083d-711e-47c5-abe6-ee10b21958d1",
            "8c50f078-56ad-4082-909e-30843b7f0dad"
          ],
          "display_name": false
        },
        {
          "uuid": "ad8c4a2a-a53f-41a1-984d-053959188e42",
          "name": "NSC-178886",
          "stdName": "NSC-178886",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1505083d-711e-47c5-abe6-ee10b21958d1",
            "8c50f078-56ad-4082-909e-30843b7f0dad"
          ],
          "display_name": false
        },
        {
          "uuid": "25b3a3b8-6a7f-4511-ac14-8f149fee3636",
          "name": "PAEONIFLORIN",
          "stdName": "PAEONIFLORIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1505083d-711e-47c5-abe6-ee10b21958d1",
            "a59ef463-e3ca-4d31-bf7d-fb19c1c04713"
          ],
          "display_name": false
        },
        {
          "uuid": "32850931-4b2e-d381-c7f8-1155ebf44c07",
          "name": "PAEONIFLORIN [USP-RS]",
          "stdName": "PAEONIFLORIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17c07af2-0ce5-58af-05ea-69e549ec7a9e"
          ],
          "display_name": false
        },
        {
          "uuid": "e40c733b-ba49-4f28-bacf-471a17205ef5",
          "name": "PEONIFLORIN",
          "stdName": "PEONIFLORIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f106b22-e9f0-4b53-b5ae-bfa88b0c356f",
            "1505083d-711e-47c5-abe6-ee10b21958d1",
            "a59ef463-e3ca-4d31-bf7d-fb19c1c04713"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2bae3ab0-9014-4334-8a7e-fa8bc186c1f7",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "a59ef463-e3ca-4d31-bf7d-fb19c1c04713",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1505083d-711e-47c5-abe6-ee10b21958d1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c50f078-56ad-4082-909e-30843b7f0dad",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "307cda65-a4b7-430f-8126-c90ceba477c4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90c9e4a9-94a1-4cf5-b4e3-64e68afeac00",
          "citation": "LEE, B ET AL, ARCH. PHARM. RES., 31(4), 445-450, 2008",
          "url": "http://download.springer.com/static/pdf/437/art%253A10.1007%252Fs12272-001-1177-6.pdf?auth66=1406923154_d7c9e8eb0f4ec5b4e0e7b354605b2458&ext=.pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b6b444d-f9ee-4ca1-9ae4-892675437ab2",
          "citation": "LI P, ET AL, MONOTERPENE DERIVATIVES FROM THE ROOTS OF PAEONIA LACTIFLORA AND THEIR ANTI-PROLIFERATIVE ACTIVITY,FITOTERAPIA (2014)",
          "url": "http://dx.doi.org/10.1016/j.fitote.2014.07.017",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f8c3c5d-b8c5-47bd-a362-71286381d62c",
          "citation": "KIM SH, ET AL, JOURNAL OF ENZYME INHIBITION AND MEDICINAL CHEMISTRY, 24(5) 1138-1140, 2009",
          "url": "http://informahealthcare.com/doi/pdf/10.1080/14756360802667977",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "44af7ad9-76af-412a-b6e0-8075bcd1fcbd",
          "citation": "TSUKAMOTOA K ET AL, JOURNAL OF ETHNOPHARMACOLOGY, 153(3)884?889, 2014",
          "url": "http://ac.els-cdn.com/S0378874114002438/1-s2.0-S0378874114002438-main.pdf?_tid=cce7b186-176b-11e4-898c-00000aab0f01&acdnat=1406671429_6bbfb9162af8045bcb20afd8f378f2a0",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b92dde0-8a97-4b9d-834c-e078283ae068",
          "citation": "BRACA A, FITOTERAOIA 79(2)117-120(2008)",
          "url": "http://ac.els-cdn.com/S0367326X07002481/1-s2.0-S0367326X07002481-main.pdf?_tid=14e669c2-1682-11e4-8d58-00000aacb35e&acdnat=1406571048_56368a142f3823312ceb11bf6bedf068",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dfbeece-5a2b-4293-b9bf-cba78341824e",
          "citation": "SONG, W-H,ET AL, ANTICOMPLEMENT MONOTERPENOID GLUCOSIDES FROM THE ROOT BARK OF PAEONIA SUFFRUTICOSA, JOURNAL OF NATURAL PRODUCTS, 77(1)42-48,2014",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/np400571x",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "115d8338-3154-469c-8b90-178dae52c5ef",
          "citation": "SRS import [21AIQ4EV64]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=21AIQ4EV64",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f106b22-e9f0-4b53-b5ae-bfa88b0c356f",
          "citation": "PEONIFLORIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01d49779-b554-7005-6d3a-a6742f13feb6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=23180-57-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f343108-70ea-aabf-c602-c82b6ee9d505",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a01c8193-3228-4fac-8456-752fb306d435",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "17c07af2-0ce5-58af-05ea-69e549ec7a9e",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "5795c185-b9a0-4a42-fc95-f597c0f74fd3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7c33ed27-3dbe-1b6e-0926-8aef97622920",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "328aace3-109c-432e-ab04-2da854b78d22",
          "citation": "He DY, Dai SM. Anti-inflammatory and immunomodulatory effects of paeonia lactiflora pall., a traditional chinese herbal medicine. Front Pharmacol. 2011 Feb 25;2:10. doi: 10.3389/fphar.2011.00010. PMID: 21687505; PMCID: PMC3108611",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC3108611/",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ca619947-a127-4c0a-aa43-7d9c63df37cc",
          "id": "ca619947-a127-4c0a-aa43-7d9c63df37cc",
          "molfile": "\n  Marvin  01132110272D          \n\n 34 39  0  0  1  0            999 V2000\n    6.2892   -4.6397    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.2512   -4.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8284   -4.7628    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.5182   -4.3293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2284   -3.9073    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9400   -4.3079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6402   -3.8859    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.3615   -4.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2227   -5.0940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6402   -3.0678    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.3350   -2.6458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9182   -2.6673    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9182   -1.8493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2284   -3.0842    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.4968   -2.6882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6633   -5.0940    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.5725   -4.1640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7919   -3.9019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7227   -3.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4063   -2.6083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9742   -2.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9102   -1.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1618   -1.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4831   -2.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5524   -2.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2957   -3.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5775   -5.9010    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.6795   -6.1306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2892   -5.4250    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.5625   -5.1260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0639   -5.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8284   -5.5323    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.6145   -5.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2621   -6.2215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n 16  1  1  0  0  0  0\n  1 29  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n 16  3  1  0  0  0  0\n  3 32  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n 10  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  6  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 17  1  1  0  0  0\n 27 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 28  1  6  0  0  0\n 27 34  1  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  1  6  0  0  0\n 29 31  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  6  0  0  0\n 32 34  1  0  0  0  0\nM  END",
          "smiles": "C[C@]12C[C@@]3([C@@H]4C[C@]1([C@]4(COC(=O)c5ccccc5)[C@H](O2)O3)O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O)O",
          "formula": "C23H28O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "be4e369f-cfb4-4000-bb4b-fc72600e9072"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "480.4627",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a14deb7f-1ff6-41c4-9356-1eeca74c3b58",
      "version": "14",
      "structure": {
        "id": "4d110d5c-d928-48b9-8601-925c03a140a2",
        "molfile": "\n  Marvin  01132104012D          \n\n 37 42  0  0  1  0            999 V2000\n    6.4445   -6.7506    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5775   -5.9010    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.6795   -6.1306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2892   -5.4250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0639   -5.7140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8284   -5.5323    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2621   -6.2215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6145   -5.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8284   -4.7628    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5182   -4.3293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2284   -3.9073    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.2284   -3.0842    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4968   -2.6882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9182   -2.6673    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6402   -3.0678    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.3350   -2.6458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6402   -3.8859    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.3615   -4.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2227   -5.0940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9400   -4.3079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9182   -1.8493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3335   -4.8449    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2512   -4.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2892   -4.6397    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.5196   -4.4206    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6633   -5.0940    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5725   -4.1640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7919   -3.9019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7227   -3.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4063   -2.6083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9742   -2.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9102   -1.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1618   -1.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4831   -2.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5524   -2.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2957   -3.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5625   -5.1260    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  1  0  0  0  0\n  6  8  1  6  0  0  0\n  9  6  1  0  0  0  0\n  9 10  1  1  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 18 19  1  0  0  0  0\n 20 17  1  0  0  0  0\n 11 20  1  0  0  0  0\n 14 21  1  1  0  0  0\n 11 22  1  6  0  0  0\n  9 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  1  0  0  0\n 24  4  1  0  0  0  0\n 26 24  1  0  0  0  0\n 26 27  1  1  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  2  0  0  0  0\n 33 34  1  0  0  0  0\n 35 34  2  0  0  0  0\n 36 35  1  0  0  0  0\n 31 36  2  0  0  0  0\n 26  2  1  0  0  0  0\n 26  9  1  0  0  0  0\n  4 37  1  6  0  0  0\nM  END",
        "smiles": "C[C@]12C[C@@]3([C@]4([H])C[C@]1([C@]4(COC(=O)c5ccccc5)[C@]([H])(O2)O3)O[C@@]6([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O)O",
        "formula": "C23H28O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "480.4627",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "115d8338-3154-469c-8b90-178dae52c5ef",
          "8c50f078-56ad-4082-909e-30843b7f0dad"
        ],
        "stereo_centers": 11
      },
      "unii": "21AIQ4EV64"
    }
  ]
}