{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "88d4cf91-6911-4d42-8d20-5f4652c3c83b",
          "code": "M03BA02",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Carbamic acid esters|carisoprodol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M03BA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "05712fcc-1367-4095-b035-718d1e43d60d",
          "code": "N0000175737",
          "comments": "Established Pharmacologic Class [EPC]|Muscle Relaxant [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175737",
          "code_system": "NDF-RT",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "f327381f-9f5a-49e8-8433-f363833155b0",
          "code": "N0000175730",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Nervous System Activity Alteration [PE]|Peripheral Nervous System Activity Alteration [PE]|Neuromuscular Activity Alteration [PE]|Centrally-mediated Muscle Relaxation [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175730",
          "code_system": "NDF-RT",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "89302747-a94d-4e49-97cc-9d8f8f69246b",
          "code": "78-44-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=78-44-4",
          "code_system": "CAS",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8",
            "2de163c9-7779-480e-b81d-fee8fa816622"
          ]
        },
        {
          "uuid": "0067706d-9ddc-4b4e-a74a-d9d4447b6ea2",
          "code": "C28904",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28904",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "18f0a3a0-b61a-434e-8cc9-1645b775d345",
          "code": "D002328",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002328",
          "code_system": "MESH",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "3215aaff-da86-4b95-9d9f-c204756d7c9c",
          "code": "NBK548829",
          "comments": "LiverTox|CNS|Muscle relaxant|Carbamate derivative",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548829/",
          "code_system": "LIVERTOX",
          "references": [
            "402a5d66-0eef-1da3-a2d2-162fda3433e2"
          ]
        },
        {
          "uuid": "3dad18ec-3a4b-4d69-b083-7460c9cd45e9",
          "code": "CARISOPRODOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Carisoprodol",
          "code_system": "WIKIPEDIA",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "cc148db6-2ae8-44b1-b2fe-25ab20775e74",
          "code": "M03BA52",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Carbamic acid esters|carisoprodol, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M03BA52&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "3d0eea31-122f-4555-9af4-a373f27862ec",
          "code": "M03BA72",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Carbamic acid esters|carisoprodol, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M03BA72&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "a61b3881-7796-4b1c-806f-2f02cce8729f",
          "code": "QM03BA02",
          "comments": "VATC|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Carbamic acid esters|carisoprodol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM03BA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "5ec19b75-38f8-4038-a971-6b47dba56c2f",
          "code": "QM03BA52",
          "comments": "VATC|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Carbamic acid esters|carisoprodol, combinations excl. psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM03BA52&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "42383d5d-7f97-41b1-b9d3-19a2df9e5e76",
          "code": "QM03BA72",
          "comments": "VATC|MUSCLE RELAXANTS|MUSCLE RELAXANTS, CENTRALLY ACTING AGENTS|Carbamic acid esters|carisoprodol, combinations with psycholeptics",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM03BA72&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "bf2d0e2b-f8e1-4a6f-a095-efffe04b6d12",
          "code": "SUB06631MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "ddca8822-e56f-4dad-bbe2-789080f45228",
          "code": "902",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=902",
          "code_system": "INN",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "b7bf3a03-6a80-4ad7-88d8-b4dfc9aba770",
          "code": "8192",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "58bddb7c-7a03-49b1-ba7b-b3fcdf1efc9a",
          "code": "7610",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7610",
          "code_system": "IUPHAR",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "db8dc1c4-4d53-408d-80a8-80ab5e71628a",
          "code": "2101",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2101/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "cea05391-2574-461d-b466-ad8e3125a056",
          "code": "m3112",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3112?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "6df27e2b-7ab3-43f1-b176-8f50950f127a",
          "code": "DB00395",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00395",
          "code_system": "DRUG BANK",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "ff2b51b9-44bc-4385-99e3-b1c72d8e804c",
          "code": "CHEMBL1233",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1233",
          "code_system": "ChEMBL",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "c7b29c19-c5a5-456a-84d3-d2133afd0c12",
          "code": "201-118-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.017",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "7bd45231-3368-4eb2-b94f-f6ac0eec9b34",
          "code": "2576",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2576",
          "code_system": "PUBCHEM",
          "references": [
            "cad9a80d-13e5-4f8a-8069-506546e7a0b8"
          ]
        },
        {
          "uuid": "6ae4220e-8be5-cf60-4657-2446d4b79e96",
          "code": "3021",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3021",
          "code_system": "HSDB",
          "references": [
            "f65b3ec5-0da0-36fa-1a41-05c7eff92816"
          ]
        },
        {
          "uuid": "7213de44-9088-d26d-f65a-6aab7673e4aa",
          "code": "DTXSID8024733",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8024733",
          "code_system": "EPA CompTox",
          "references": [
            "edb56634-4e2e-13fb-efb9-2d0654764361"
          ]
        },
        {
          "uuid": "9ae5b70e-2618-ed1c-274e-3101e338d8d0",
          "code": "C29696",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Musculoskeletal System[C78281]|Muscle Relaxant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29696",
          "code_system": "NCI_THESAURUS",
          "references": [
            "402a5d66-0eef-1da3-a2d2-162fda3433e2"
          ]
        },
        {
          "uuid": "4e5ecdb3-8e01-4b16-ab88-82b9e6e2230e",
          "code": "21925K482H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4a0752ae-6283-e7a7-f827-308cb71eaec7",
          "code": "Carisoprodol",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM340/",
          "code_system": "LACTMED",
          "references": [
            "402a5d66-0eef-1da3-a2d2-162fda3433e2"
          ]
        },
        {
          "uuid": "b53a9f2d-8a44-4f82-a6e7-93690fdb73b4",
          "code": "509",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/509",
          "code_system": "DRUG CENTRAL",
          "references": [
            "402a5d66-0eef-1da3-a2d2-162fda3433e2"
          ]
        },
        {
          "uuid": "579973b8-a757-7dde-4c96-55574b1ff193",
          "code": "3419",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3419",
          "code_system": "CHEBI",
          "references": [
            "402a5d66-0eef-1da3-a2d2-162fda3433e2"
          ]
        },
        {
          "uuid": "298053e4-4a3d-e060-ce05-dc132dce3800",
          "code": "1096600",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1096600",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "402a5d66-0eef-1da3-a2d2-162fda3433e2"
          ]
        },
        {
          "uuid": "1957a5f8-be8f-4e64-77af-973ca1b34633",
          "code": "100000084595",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "84e6b8ce-052b-03e5-c386-295a29fd8a32"
          ]
        },
        {
          "uuid": "508706ab-93a3-a488-0249-da31dd48ec6a",
          "code": "21925K482H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=21925K482H",
          "code_system": "DAILYMED",
          "references": [
            "d6b0252c-5cac-304e-9ed2-c446280e4533"
          ]
        },
        {
          "uuid": "85c1c09b-4876-1e17-f94f-f60d04176aa7",
          "code": "172124",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=172124",
          "code_system": "NSC",
          "references": [
            "427b0b1b-eb39-93a0-e33e-6ab10897b2c2"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "189c9c9e-590d-4fd9-8f64-c4c3766ab573",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c34247b4-659a-40cd-8b9e-0893ec906889",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b075985e-2651-473e-adf3-5e9f15343d86",
          "citation": "INN Proposed List 10",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL10.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dc26914d-e332-4c55-b566-4b9cdef7cdbb",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3fecf04-cfa0-45ab-8343-bab748568ac7",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69b53be3-6e89-44c6-9b6d-fa4864c2c8a6",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca266b50-0709-4ada-a4eb-c46aefb53bc8",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89ebce27-aa9a-457e-a6cc-96732bbfb5f5",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b578b17-4a74-44ec-9c48-7c0045838622",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08d1e6f0-b2dc-4dd9-910d-40fe83f1f44d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "160a5f60-a08b-4769-b3fa-a53270ac86b2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa84ef9b-ed23-49f1-9626-f2951a65f068",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a8724ac-ddb0-4d0d-a739-03804f3b4a35",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a7c64b5-c296-45d8-89f2-78b5a5b04725",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3694c4c1-726b-4d90-9b1d-e54245e401e1",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8577d009-c1c6-4dde-a89f-54d5107daaab",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cad9a80d-13e5-4f8a-8069-506546e7a0b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bb26c04-964a-4895-8fd7-4b116423f2a9",
          "citation": "USP 35 CARISOPRODOL MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "096fe8d9-6a40-4e13-8ca3-8f9e1124c3f3",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0eb8c0d5-848a-4518-87aa-8a2b35beada1",
          "citation": "EP 7.1 CARISOPRODOL MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a15a488-5611-438b-ac7d-8b2b5f20fede",
          "citation": "EP 7.1 CARISOPRODOL",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb451016-163b-4658-9ff7-4d7560854898",
          "citation": "http://www.accessdata.fda.gov/spl/data/15f1e38f-9b47-4567-a84f-84f3b7ef11ec/15f1e38f-9b47-4567-a84f-84f3b7ef11ec.xml",
          "url": "http://www.accessdata.fda.gov/spl/data/15f1e38f-9b47-4567-a84f-84f3b7ef11ec/15f1e38f-9b47-4567-a84f-84f3b7ef11ec.xml",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e25cda1-933d-49c3-beb9-bfe1513242ad",
          "citation": "SRS import [21925K482H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=21925K482H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389675000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "825acb98-6a2d-44b2-afff-ef805bb74d89",
          "citation": "CARISOPRODOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0d2b414e-b79d-493a-abe2-65fcaface829",
          "citation": "CARISOPRODOL [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7dbf14b9-5de0-4d1d-bcd2-b22faacca176",
          "citation": "CARISOPRODOL [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fb03f5d8-2b09-4b0e-831f-0939f366f202",
          "citation": "CARISOPRODOL [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ca22e3ac-3032-4689-b42b-ed092c098444",
          "citation": "CARISOPRODOL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9e17e136-58a9-46b6-b660-51e527c6b409",
          "citation": "CARISOPRODOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebe5f1ac-4198-4dbf-bc23-2606c8381e81",
          "citation": "CARISOPRODOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d90539d-922a-4c96-bd2a-7f4549d4215f",
          "citation": "CARISOPRODOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0849afe7-d229-4c60-af68-e15faedd79bf",
          "citation": "CARISOPRODOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09311212-f325-4850-a481-58a4c2559565",
          "citation": "CARISOPRODOL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ebe58a9b-9a79-4b48-9908-2c7ff00c6c39",
          "citation": "CARISOPRODOL CIV [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3747fb6e-4a6f-bd5b-754e-73703d9d657b",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "f65b3ec5-0da0-36fa-1a41-05c7eff92816",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+78-44-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "edb56634-4e2e-13fb-efb9-2d0654764361",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=78-44-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cb2c7b3f-788f-779b-26ac-9daf1300b660",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+78-44-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "451e227b-080b-f591-3549-c11369cf370b",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/93?sec=monphar",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "84e6b8ce-052b-03e5-c386-295a29fd8a32",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "402a5d66-0eef-1da3-a2d2-162fda3433e2",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2de163c9-7779-480e-b81d-fee8fa816622",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "78d2788b-deaa-d68c-376c-759293ec2f6c",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "4c3decb5-31d2-3bde-23a3-d30a7361dd10",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "427b0b1b-eb39-93a0-e33e-6ab10897b2c2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cd2dc055-fdc0-46ac-d39b-f8317d031061",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d6b0252c-5cac-304e-9ed2-c446280e4533",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3b13c911-6a5d-454d-80f0-0fa70c74a5c6",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "430852dd-15be-481e-a32c-4ddb26de11c5",
          "id": "430852dd-15be-481e-a32c-4ddb26de11c5",
          "molfile": "\n  Marvin  01132103322D          \n\n 18 17  0  0  0  0            999 V2000\n    2.6831   -0.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0734   -1.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8411   -1.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3147   -2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9262   -1.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9965   -2.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6029   -2.1704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992   -2.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1799   -2.1261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992   -3.1801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6199   -2.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8730   -2.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1522   -2.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1444   -3.4689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4339   -2.2172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7079   -2.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0026   -2.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7026   -3.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  4 11  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\nM  END",
          "smiles": "CCCC(C)(COC(=O)N)COC(=O)NC(C)C",
          "formula": "C12H24N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ef0b40c9-95dc-42e8-ab2e-d3b5222c6b37"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "260.3304",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a6f412de-b42e-4ce3-8b61-8c034025ac35",
      "version": "35",
      "structure": {
        "id": "31f93663-97e9-4fc1-9ae1-2febb1c81397",
        "molfile": "\n  Marvin  01132102402D          \n\n 18 17  0  0  0  0            999 V2000\n    2.1522   -2.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992   -2.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4339   -2.2172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3147   -2.2458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1444   -3.4689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992   -3.1801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8730   -2.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6029   -2.1704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1799   -2.1261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9965   -2.5555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6199   -2.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7079   -2.6361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8411   -1.5614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9262   -1.6317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0734   -1.5536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0026   -2.2094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7026   -3.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6831   -0.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4 11  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  4  1  0  0  0  0\n  4 14  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 12  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 15  1  0  0  0  0\nM  END",
        "smiles": "CCCC(C)(COC(=O)N)COC(=O)NC(C)C",
        "formula": "C12H24N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "260.3304",
        "optical_activity": "( + / - )",
        "references": [
          "5e25cda1-933d-49c3-beb9-bfe1513242ad",
          "189c9c9e-590d-4fd9-8f64-c4c3766ab573",
          "b075985e-2651-473e-adf3-5e9f15343d86"
        ],
        "stereo_centers": 1
      },
      "unii": "21925K482H",
      "relationships": [
        {
          "uuid": "d0304d3c-0b10-4eb9-a52a-3a3d26bb0c6e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e8440085-5554-4e67-93c2-fb33970d00a5",
            "refuuid": "a6f412de-b42e-4ce3-8b61-8c034025ac35",
            "name": "CARISOPRODOL",
            "unii": "21925K482H",
            "linking_id": "21925K482H",
            "ref_pname": "CARISOPRODOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9bf3053a-5d0e-445a-9695-ac3f4af309f9",
          "amount": {
            "uuid": "1cf9d54a-5f87-4c20-afab-0ea4f3e34fff",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0bb26c04-964a-4895-8fd7-4b116423f2a9"
          ],
          "related_substance": {
            "uuid": "86904e95-8932-4f3f-a2fd-48e93d9357eb",
            "refuuid": "6a25837a-09f4-4d26-81bf-fcc562fc1a4b",
            "name": "MEPROBAMATE",
            "unii": "9I7LNY769Q",
            "linking_id": "9I7LNY769Q",
            "ref_pname": "MEPROBAMATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6b9a6bd6-21d2-417c-a37c-3a87a6d09e81",
          "amount": {
            "uuid": "84965c93-94b4-42a0-a3e4-89801a6781de",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT SPOT INTENSITY",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "0eb8c0d5-848a-4518-87aa-8a2b35beada1"
          ],
          "related_substance": {
            "uuid": "e995e9f7-d958-43b3-94c5-65fa8034e7e9",
            "refuuid": "3b8a0ced-7b61-4267-8bc5-0b803fa2ac45",
            "name": "2-HYDROXYMETHYL-2-METHYLPENTYL ISOPROPYLCARBAMATE",
            "unii": "V1P2BB65RB",
            "linking_id": "V1P2BB65RB",
            "ref_pname": "2-HYDROXYMETHYL-2-METHYLPENTYL ISOPROPYLCARBAMATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "30c62fc3-c831-4451-b188-4932e533b650",
          "amount": {
            "uuid": "9df8663d-f04f-4973-bf41-eac310db9726",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0bb26c04-964a-4895-8fd7-4b116423f2a9"
          ],
          "related_substance": {
            "uuid": "dc183512-4112-4fd2-85e5-32b6fb35417c",
            "refuuid": "3b8a0ced-7b61-4267-8bc5-0b803fa2ac45",
            "name": "2-HYDROXYMETHYL-2-METHYLPENTYL ISOPROPYLCARBAMATE",
            "unii": "V1P2BB65RB",
            "linking_id": "V1P2BB65RB",
            "ref_pname": "2-HYDROXYMETHYL-2-METHYLPENTYL ISOPROPYLCARBAMATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6e73130f-f787-42be-b0ef-0bc1cbee1c1e",
          "amount": {
            "uuid": "eef1f7bd-cc1a-4df0-806d-e04f500e140a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT SPOT INTENSITY",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "0eb8c0d5-848a-4518-87aa-8a2b35beada1"
          ],
          "related_substance": {
            "uuid": "73b22f1b-b797-47e9-b692-b20a41392223",
            "refuuid": "fc3d7783-c9d5-4c8e-b5fa-d6cbea701f02",
            "name": "2-(HYDROXYMETHYL)-2-METHYLPENTYL CARBAMATE",
            "unii": "8A79Y1EPZZ",
            "linking_id": "8A79Y1EPZZ",
            "ref_pname": "2-(HYDROXYMETHYL)-2-METHYLPENTYL CARBAMATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "92654855-81ae-426f-bbb9-ce9d98757664",
          "amount": {
            "uuid": "f9e04864-c553-4140-ab35-e7c329492784",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0bb26c04-964a-4895-8fd7-4b116423f2a9"
          ],
          "related_substance": {
            "uuid": "a0e23468-0c9d-47a0-8fcd-40531f6e411f",
            "refuuid": "fc3d7783-c9d5-4c8e-b5fa-d6cbea701f02",
            "name": "2-(HYDROXYMETHYL)-2-METHYLPENTYL CARBAMATE",
            "unii": "8A79Y1EPZZ",
            "linking_id": "8A79Y1EPZZ",
            "ref_pname": "2-(HYDROXYMETHYL)-2-METHYLPENTYL CARBAMATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "19512c47-e083-4ee8-ad0f-4bb76c99d253",
          "amount": {
            "uuid": "8d744ce8-e296-4aee-b893-a3676193f5ac",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "0eb8c0d5-848a-4518-87aa-8a2b35beada1"
          ],
          "related_substance": {
            "uuid": "55df6a4a-2e0d-4f57-9a67-70d14b2a29a5",
            "refuuid": "a6f412de-b42e-4ce3-8b61-8c034025ac35",
            "name": "CARISOPRODOL",
            "unii": "21925K482H",
            "linking_id": "21925K482H",
            "ref_pname": "CARISOPRODOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c3d3c434-72ec-4e4c-bb32-6af51048c0df",
          "amount": {
            "uuid": "3b25aa89-fab9-4ae9-ae1d-76bc2d28c6e5",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "0bb26c04-964a-4895-8fd7-4b116423f2a9"
          ],
          "related_substance": {
            "uuid": "cf20a7b0-6efd-46b2-8b4d-4adfbc1c2839",
            "refuuid": "a6f412de-b42e-4ce3-8b61-8c034025ac35",
            "name": "CARISOPRODOL",
            "unii": "21925K482H",
            "linking_id": "21925K482H",
            "ref_pname": "CARISOPRODOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6270cd30-f90f-4254-9c56-2365556a7dd4",
          "amount": {
            "uuid": "4d913afb-3781-4431-b6e2-6109a61fbe0e",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT SPOT INTENSITY",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (TLC)",
          "references": [
            "9a15a488-5611-438b-ac7d-8b2b5f20fede"
          ],
          "related_substance": {
            "uuid": "35acd8d8-ff34-4385-bd52-0ea17e3c5632",
            "refuuid": "27cf19d9-f202-4e5f-b870-0590763e22f0",
            "name": "5-METHYL-5-PROPYL-1,3-DIOXAN-2-ONE",
            "unii": "FXX4CCT5JI",
            "linking_id": "FXX4CCT5JI",
            "ref_pname": "5-METHYL-5-PROPYL-1,3-DIOXAN-2-ONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "57bc5c09-a644-4483-97da-67ce7460bd60",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "ddf48af9-9c5c-4148-9874-3c4f1af301e6",
            "refuuid": "f0d53f10-52ca-4131-aab5-218ff577d568",
            "name": "CARISOPRODOL, (S)-",
            "unii": "CT4GH6T56G",
            "linking_id": "CT4GH6T56G",
            "ref_pname": "CARISOPRODOL, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4cc87a83-012b-4af5-945a-bdd847cdcb13",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "1f118a9b-952a-43cf-b682-0adaa8654c16",
            "refuuid": "08c4bbf9-1d83-45a9-9958-cea62cd312dd",
            "name": "CARISOPRODOL, (R)-",
            "unii": "CS72YR891K",
            "linking_id": "CS72YR891K",
            "ref_pname": "CARISOPRODOL, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ded458ec-da7b-4e66-9482-811b3023b838",
          "amount": {
            "uuid": "dd8e943b-1bd5-4ea4-8c88-c65fd6bb3f5a",
            "average": 58,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "3747fb6e-4a6f-bd5b-754e-73703d9d657b"
          ],
          "related_substance": {
            "uuid": "210981f9-5ae8-48e1-b7ba-f34531dae2c9",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "03906d20-9bb6-4a3b-8f2c-c76d382e06f8",
          "name": "(±)-2-METHYL-2-PROPYL-1,3-PROPANEDIOL CARBAMATE ISOPROPYLCARBAMATE",
          "stdName": "(+/-)-2-METHYL-2-PROPYL-1,3-PROPANEDIOL CARBAMATE ISOPROPYLCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c34247b4-659a-40cd-8b9e-0893ec906889"
          ],
          "display_name": false
        },
        {
          "uuid": "b1ef041c-37c4-4194-a1e2-ce8c311c95b9",
          "name": "CARISOPRODOL",
          "stdName": "CARISOPRODOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08d1e6f0-b2dc-4dd9-910d-40fe83f1f44d",
            "9e17e136-58a9-46b6-b660-51e527c6b409",
            "2d90539d-922a-4c96-bd2a-7f4549d4215f",
            "ebe5f1ac-4198-4dbf-bc23-2606c8381e81",
            "189c9c9e-590d-4fd9-8f64-c4c3766ab573",
            "7dbf14b9-5de0-4d1d-bcd2-b22faacca176",
            "69b53be3-6e89-44c6-9b6d-fa4864c2c8a6",
            "6b578b17-4a74-44ec-9c48-7c0045838622",
            "a3fecf04-cfa0-45ab-8343-bab748568ac7",
            "7a8724ac-ddb0-4d0d-a739-03804f3b4a35",
            "0849afe7-d229-4c60-af68-e15faedd79bf",
            "b075985e-2651-473e-adf3-5e9f15343d86",
            "160a5f60-a08b-4769-b3fa-a53270ac86b2",
            "0d2b414e-b79d-493a-abe2-65fcaface829",
            "dc26914d-e332-4c55-b566-4b9cdef7cdbb",
            "09311212-f325-4850-a481-58a4c2559565",
            "ca22e3ac-3032-4689-b42b-ed092c098444",
            "5a7c64b5-c296-45d8-89f2-78b5a5b04725",
            "fb03f5d8-2b09-4b0e-831f-0939f366f202",
            "aa84ef9b-ed23-49f1-9626-f2951a65f068",
            "825acb98-6a2d-44b2-afff-ef805bb74d89"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f09bf18f-12f0-4ffb-9dd0-19326582fb74",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "aae9c1f6-dd7b-4c9c-bd91-a341893fabd4",
          "name": "CARISOPRODOL CIV",
          "stdName": "CARISOPRODOL CIV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3694c4c1-726b-4d90-9b1d-e54245e401e1",
            "ebe58a9b-9a79-4b48-9908-2c7ff00c6c39"
          ],
          "display_name": false
        },
        {
          "uuid": "dd764fd8-cd7f-4516-9529-507ea5189826",
          "name": "CARISOPRODOL CIV [USP-RS]",
          "stdName": "CARISOPRODOL CIV [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3694c4c1-726b-4d90-9b1d-e54245e401e1"
          ],
          "display_name": false
        },
        {
          "uuid": "f2acf19e-bcf6-4086-9a78-1b0ca8b0a63a",
          "name": "CARISOPRODOL COMPOUND COMPONENT CARISOPRODOL",
          "stdName": "CARISOPRODOL COMPOUND COMPONENT CARISOPRODOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89ebce27-aa9a-457e-a6cc-96732bbfb5f5",
            "ca266b50-0709-4ada-a4eb-c46aefb53bc8"
          ],
          "display_name": false
        },
        {
          "uuid": "6f00930c-8336-1694-eb0c-4982f65f6f15",
          "name": "CARISOPRODOL [EP IMPURITY]",
          "stdName": "CARISOPRODOL [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc26914d-e332-4c55-b566-4b9cdef7cdbb"
          ],
          "display_name": false
        },
        {
          "uuid": "0e341416-7905-4281-a14b-b5a77f6a08a0",
          "name": "CARISOPRODOL [HSDB]",
          "stdName": "CARISOPRODOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa84ef9b-ed23-49f1-9626-f2951a65f068"
          ],
          "display_name": false
        },
        {
          "uuid": "7b8d02e6-f4de-4434-acd6-58e883a9d68c",
          "name": "CARISOPRODOL [JAN]",
          "stdName": "CARISOPRODOL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69b53be3-6e89-44c6-9b6d-fa4864c2c8a6"
          ],
          "display_name": false
        },
        {
          "uuid": "f2ebfac5-789e-47df-8067-d58b80977001",
          "name": "CARISOPRODOL [MART.]",
          "stdName": "CARISOPRODOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08d1e6f0-b2dc-4dd9-910d-40fe83f1f44d"
          ],
          "display_name": false
        },
        {
          "uuid": "64d71180-3789-4738-b18f-7e2d86049abd",
          "name": "CARISOPRODOL [MI]",
          "stdName": "CARISOPRODOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "160a5f60-a08b-4769-b3fa-a53270ac86b2"
          ],
          "display_name": false
        },
        {
          "uuid": "d136697c-9c9a-4aa7-92be-4ae163416d67",
          "name": "CARISOPRODOL [ORANGE BOOK]",
          "stdName": "CARISOPRODOL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b578b17-4a74-44ec-9c48-7c0045838622"
          ],
          "display_name": false
        },
        {
          "uuid": "2401de37-26ab-fd1f-475d-6f80e4c7f976",
          "name": "CARISOPRODOL [USP MONOGRAPH]",
          "stdName": "CARISOPRODOL [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c3decb5-31d2-3bde-23a3-d30a7361dd10"
          ],
          "display_name": false
        },
        {
          "uuid": "ccdd7276-6c96-469a-9f13-8b9eb2708382",
          "name": "CARISOPRODOL [VANDF]",
          "stdName": "CARISOPRODOL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a7c64b5-c296-45d8-89f2-78b5a5b04725"
          ],
          "display_name": false
        },
        {
          "uuid": "98b6f363-bdc2-6eeb-5ffc-416d5bab3504",
          "name": "Carisoprodol [WHO-DD]",
          "stdName": "CARISOPRODOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd2dc055-fdc0-46ac-d39b-f8317d031061"
          ],
          "display_name": false
        },
        {
          "uuid": "57ee07da-6f84-4087-ad83-825e0275fdb9",
          "name": "NSC-172124",
          "stdName": "NSC-172124",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8577d009-c1c6-4dde-a89f-54d5107daaab"
          ],
          "display_name": false
        },
        {
          "uuid": "a12ca92d-110a-4680-a059-b1ea75e76597",
          "name": "RELA",
          "stdName": "RELA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c34247b4-659a-40cd-8b9e-0893ec906889"
          ],
          "display_name": false
        },
        {
          "uuid": "92c0e046-42dc-4d25-bf84-98271bbeedc2",
          "name": "SOMA",
          "stdName": "SOMA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c34247b4-659a-40cd-8b9e-0893ec906889"
          ],
          "display_name": false
        },
        {
          "uuid": "b5cbe900-ba9b-4ea5-ad01-80fb6c3fcd23",
          "name": "SOMA COMPOUND COMPONENT CARISOPRODOL",
          "stdName": "SOMA COMPOUND COMPONENT CARISOPRODOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89ebce27-aa9a-457e-a6cc-96732bbfb5f5",
            "ca266b50-0709-4ada-a4eb-c46aefb53bc8"
          ],
          "display_name": false
        },
        {
          "uuid": "8788db1b-b3b6-47a3-bfba-b5988fb5250c",
          "name": "carisoprodol [INN]",
          "stdName": "CARISOPRODOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b075985e-2651-473e-adf3-5e9f15343d86"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "c02afdd2-51f8-48cd-a727-76aad67ad3a3",
          "name": "Biological Half-life",
          "value": {
            "uuid": "c23f7abc-7a70-4b99-b23e-f148165a594e",
            "average": 2.4,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "451e227b-080b-f591-3549-c11369cf370b"
          ]
        }
      ]
    }
  ]
}