{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "92104eda-e434-40fd-8b68-2817823361ae",
          "code": "29493-77-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=29493-77-4",
          "code_system": "CAS",
          "references": [
            "ab103ef6-ea7f-48c1-b712-75bc6fe2c105",
            "d5b04b68-2776-42e2-81a7-e7434c3e0425"
          ]
        },
        {
          "uuid": "51d4f75c-e710-426f-a1ae-6e1194e58bfb",
          "code": "1590",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Stimulants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "ab103ef6-ea7f-48c1-b712-75bc6fe2c105"
          ]
        },
        {
          "uuid": "084de0e5-e065-8a37-abca-961d36548297",
          "code": "DTXSID2048870",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2048870",
          "code_system": "EPA CompTox",
          "references": [
            "63f25a4d-dd85-4108-8d12-ea1b7fc6d701"
          ]
        },
        {
          "uuid": "c274af42-3dd8-4605-925a-11f8b69e7b73",
          "code": "2149QZM652",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3aa5bce2-e7f5-bb24-6eb2-31c4b0e59a79",
          "code": "2149QZM652",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(2149QZM652)",
          "code_system": "DAILYMED",
          "references": [
            "6a5cb8b5-4da4-322e-818b-300f2795d394"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "795d1f70-866c-4125-a690-b6f8a8054aa0",
          "name": "(±)-CIS-2-AMINO-4-METHYL-5-PHENYL-2-OXAZOLINE",
          "stdName": "(+/-)-CIS-2-AMINO-4-METHYL-5-PHENYL-2-OXAZOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "031d662c-9382-4252-877f-c60254b17aa2"
          ],
          "display_name": false
        },
        {
          "uuid": "a293e1e6-b8eb-4a57-9db3-f63b4956599e",
          "name": "(±)-CIS-4-METHYLAMINOREX",
          "stdName": "(+/-)-CIS-4-METHYLAMINOREX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "031d662c-9382-4252-877f-c60254b17aa2"
          ],
          "display_name": false
        },
        {
          "uuid": "a2a5789d-d0ef-4bab-b78e-ec34c7fbb6cd",
          "name": "(±)-CIS-MCN-822",
          "stdName": "(+/-)-CIS-MCN-822",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "031d662c-9382-4252-877f-c60254b17aa2"
          ],
          "display_name": false
        },
        {
          "uuid": "9355ad43-0b08-428f-a9e9-3c12320792b3",
          "name": "2-OXAZOLAMINE, 4,5-DIHYDRO-4-METHYL-5-PHENYL-, (4R,5S)-REL-",
          "stdName": "2-OXAZOLAMINE, 4,5-DIHYDRO-4-METHYL-5-PHENYL-, (4R,5S)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "031d662c-9382-4252-877f-c60254b17aa2"
          ],
          "display_name": false
        },
        {
          "uuid": "b3afe0e9-e83c-4019-a10e-c423fb0f3120",
          "name": "2-OXAZOLAMINE, 4,5-DIHYDRO-4-METHYL-5-PHENYL-, CIS-(±)-",
          "stdName": "2-OXAZOLAMINE, 4,5-DIHYDRO-4-METHYL-5-PHENYL-, CIS-(+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "031d662c-9382-4252-877f-c60254b17aa2"
          ],
          "display_name": false
        },
        {
          "uuid": "578a04d7-02d6-4813-b7d3-01f6025b339d",
          "name": "2-OXAZOLINE, 2-AMINO-4-METHYL-5-PHENYL-, CIS-(±)-",
          "stdName": "2-OXAZOLINE, 2-AMINO-4-METHYL-5-PHENYL-, CIS-(+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "031d662c-9382-4252-877f-c60254b17aa2"
          ],
          "display_name": false
        },
        {
          "uuid": "6eca7e8a-2090-428a-97aa-7ff1b1eedb5b",
          "name": "4-METHYLAMINOREX (CIS ISOMER)",
          "stdName": "4-METHYLAMINOREX (CIS ISOMER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e586b11-e076-478d-a646-cb39dca75694",
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc"
          ],
          "display_name": false
        },
        {
          "uuid": "919e6e99-6577-4121-8133-354c3a894345",
          "name": "4-METHYLAMINOREX (±)-CIS-FORM [MI]",
          "stdName": "4-METHYLAMINOREX (+/-)-CIS-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "f3d5c8d2-9874-45d2-b12f-83d7647fb9a6"
          ],
          "display_name": false
        },
        {
          "uuid": "002ebe39-81fe-41cf-ad17-819971c4db77",
          "name": "4-METHYLAMINOREX, CIS-(±)-",
          "stdName": "4-METHYLAMINOREX, CIS-(+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43778dfc-0f0e-4013-aedc-5acd131babb8",
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc"
          ],
          "display_name": true
        },
        {
          "uuid": "e09e13e8-9536-4b00-9ad6-ae68126cb042",
          "name": "EU4EA",
          "stdName": "EU4EA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "f3d5c8d2-9874-45d2-b12f-83d7647fb9a6"
          ],
          "display_name": false
        },
        {
          "uuid": "10a5834f-d39b-4d33-b098-500a515722d4",
          "name": "ICE",
          "stdName": "ICE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "f3d5c8d2-9874-45d2-b12f-83d7647fb9a6"
          ],
          "display_name": false
        },
        {
          "uuid": "e5bda3d8-3d96-099d-3cab-1ea01e3108df",
          "name": "MCN-422",
          "stdName": "MCN-422",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8fa0696c-bc8a-b148-67a4-dc0de07300a9"
          ],
          "display_name": false
        },
        {
          "uuid": "210c6538-74a3-45a1-90c6-2d304e3a79fb",
          "name": "MCN-822",
          "stdName": "MCN-822",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "f3d5c8d2-9874-45d2-b12f-83d7647fb9a6"
          ],
          "display_name": false
        },
        {
          "uuid": "370a02df-9051-426e-9bbb-fb6aa97e4b19",
          "name": "U4EUH",
          "stdName": "U4EUH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
            "f3d5c8d2-9874-45d2-b12f-83d7647fb9a6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "43778dfc-0f0e-4013-aedc-5acd131babb8",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "93ee8006-83db-479e-b5f7-d5f911ccdcdc",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3d5c8d2-9874-45d2-b12f-83d7647fb9a6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "031d662c-9382-4252-877f-c60254b17aa2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e586b11-e076-478d-a646-cb39dca75694",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab103ef6-ea7f-48c1-b712-75bc6fe2c105",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392014000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40df2d2c-fcbb-4f68-b642-6f5a0593438d",
          "citation": "SRS import [2149QZM652]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=2149QZM652",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392014000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63f25a4d-dd85-4108-8d12-ea1b7fc6d701",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=29493-77-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8fa0696c-bc8a-b148-67a4-dc0de07300a9",
          "citation": "Controlled Substances \n- by DEA Drug Code Number-",
          "url": "https://www.deadiversion.usdoj.gov/schedules/orangebook/d_cs_drugcode.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d5b04b68-2776-42e2-81a7-e7434c3e0425",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "54f40894-3b9e-b53b-1a0a-f34a1c40eff3",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6a5cb8b5-4da4-322e-818b-300f2795d394",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d7abc4db-4e56-49f1-9ea5-a110d65805b7",
          "id": "d7abc4db-4e56-49f1-9ea5-a110d65805b7",
          "molfile": "\n  Marvin  01132111112D          \n\n 13 14  0  0  0  0            999 V2000\n    5.9708   -3.0186    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.5833   -2.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1614   -2.8480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7517   -3.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9301   -3.6520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2997   -4.1785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0521   -3.8400    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.7655   -4.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4835   -3.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1968   -4.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1968   -5.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4835   -5.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7655   -5.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@@H](c2ccccc2)OC(=N1)N",
          "formula": "C10H12N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "de394d87-d833-40b0-b54c-dc57651ff2f5"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "176.2155",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3452a426-0556-49a9-8310-d844c4ddc164",
      "version": "9",
      "structure": {
        "id": "d7088c2f-6d40-4a74-8634-3947eaf8cf43",
        "molfile": "\n  Marvin  01132111092D          \n\n 13 14  0  0  0  0            999 V2000\n    6.5833   -2.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9708   -3.0186    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1614   -2.8480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7517   -3.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9301   -3.6520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2997   -4.1785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0521   -3.8400    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7655   -4.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4835   -3.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1968   -4.2545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1968   -5.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4835   -5.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7655   -5.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n  8 13  2  0  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@@H](c2ccccc2)OC(=N1)N",
        "formula": "C10H12N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "176.2155",
        "optical_activity": "( + / - )",
        "references": [
          "40df2d2c-fcbb-4f68-b642-6f5a0593438d",
          "031d662c-9382-4252-877f-c60254b17aa2"
        ],
        "stereo_centers": 2
      },
      "unii": "2149QZM652"
    }
  ]
}