{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "db73753e-f816-4319-b592-358a019a3726",
          "code": "5391-18-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5391-18-4",
          "code_system": "CAS",
          "references": [
            "4af0413e-47a2-4924-8e41-6a85497ae706",
            "3630651a-a79d-4e08-9937-a2520a39044a"
          ]
        },
        {
          "uuid": "c905ab79-91d8-44f7-983d-f187eeecd7b2",
          "code": "226-387-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.988",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4af0413e-47a2-4924-8e41-6a85497ae706"
          ]
        },
        {
          "uuid": "b5805ebb-ce33-4683-8213-573bc31f0668",
          "code": "111068",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/111068",
          "code_system": "PUBCHEM",
          "references": [
            "4af0413e-47a2-4924-8e41-6a85497ae706"
          ]
        },
        {
          "uuid": "952caf75-29a0-4ccb-98b5-0c7438551731",
          "code": "20TBL42142",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "db32454c-0025-b8b0-3426-75a65ce6dda4",
          "code": "DTXSID801021370",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801021370",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "2642bc4c-e2a0-4239-ac1a-e07050ad1752",
          "code": "31387-97-0",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=31387-97-0",
          "code_system": "CAS",
          "references": [
            "3630651a-a79d-4e08-9937-a2520a39044a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0df38b0e-0e50-4dac-ae3e-c63c4af8afda",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, BUTYL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, BUTYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5d1394-ce83-4307-abce-8bbe016cc4d3"
          ],
          "display_name": false
        },
        {
          "uuid": "1ba36087-7208-4bbb-b3d6-1ff970c77377",
          "name": "BUTYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "BUTYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5d1394-ce83-4307-abce-8bbe016cc4d3"
          ],
          "display_name": false
        },
        {
          "uuid": "d7e05c62-36c6-4685-b317-aa0f41552b37",
          "name": "BUTYL .BETA.-D-GLUCOPYRANOSIDE, (-)-",
          "stdName": "BUTYL .BETA.-D-GLUCOPYRANOSIDE, (-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a1824cf-7000-4ac1-a5dd-7bacd0f76471"
          ],
          "display_name": false
        },
        {
          "uuid": "775eeaa9-3e24-4ede-b693-70a0330bca99",
          "name": "BUTYL BETA-D-GLUCOPYRANOSIDE",
          "stdName": "BUTYL BETA-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81143da8-ed13-4fd7-a94f-7ac400c24b26"
          ],
          "display_name": false
        },
        {
          "uuid": "f9e9e32a-b76b-4234-950e-1c0f88948318",
          "name": "BUTYL GLUCOSIDE",
          "stdName": "BUTYL GLUCOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5d1394-ce83-4307-abce-8bbe016cc4d3",
            "4901118f-6739-09cc-4449-dd31114ca594"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b4d9bbb8-1671-4a8f-9b25-a57f509686a0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "08d0a515-df85-4ca4-ae86-90a64706b83e",
          "name": "N-BUTYL-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "N-BUTYL-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5d1394-ce83-4307-abce-8bbe016cc4d3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "81143da8-ed13-4fd7-a94f-7ac400c24b26",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd5d1394-ce83-4307-abce-8bbe016cc4d3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a1824cf-7000-4ac1-a5dd-7bacd0f76471",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4af0413e-47a2-4924-8e41-6a85497ae706",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392018000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0709d369-f4ac-4b17-92a5-ebca449e0232",
          "citation": "SRS import [20TBL42142]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=20TBL42142",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392018000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4901118f-6739-09cc-4449-dd31114ca594",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "3630651a-a79d-4e08-9937-a2520a39044a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3017a2e3-9501-4912-8153-ae0473e0177a",
          "id": "3017a2e3-9501-4912-8153-ae0473e0177a",
          "molfile": "\n  Marvin  12082113142D          \n\n 16 16  0  0  1  0            999 V2000\n   12.7218   -5.1088    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.0186   -4.6585    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.4838   -3.9107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4577   -4.7360    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.0468   -3.8376    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.7827   -3.4648    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.6913   -5.9364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2849   -5.0358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3458   -3.3918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1610   -5.1865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8110   -2.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1078   -2.1937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8946   -4.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6000   -5.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3359   -4.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0369   -5.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  7  1  6  0  0  0\n  2  5  1  0  0  0  0\n  2  8  1  1  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4 10  1  1  0  0  0\n  5  9  1  6  0  0  0\n  5  6  1  0  0  0  0\n  6 11  1  1  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O",
          "formula": "C10H20O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ae02baeb-4c9d-4a56-9336-7de7475835e8"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "236.2626",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4abc98c7-65a9-4ee9-a7d0-e99f54edc195",
      "version": "7",
      "structure": {
        "id": "84fe2b11-c11e-4174-a8ba-54e56a082d4b",
        "molfile": "\n   JSDraw212082113142D\n\n 16 16  0  0  1  0              0 V2000\n   23.9652   -9.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6405   -8.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4006   -7.3670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3515   -8.9217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6937   -7.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0800   -6.5270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9077  -11.1829    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2583   -9.4863    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.3732   -6.3895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6763   -9.7702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1333   -4.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8086   -4.1324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0584   -9.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.3871   -9.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.7735   -9.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.0940  -10.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  7  1  6  0  0  0\n  2  5  1  0  0  0  0\n  2  8  1  1  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4 10  1  1  0  0  0\n  5  9  1  6  0  0  0\n  5  6  1  0  0  0  0\n  6 11  1  1  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
        "smiles": "CCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O",
        "formula": "C10H20O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "236.2626",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0709d369-f4ac-4b17-92a5-ebca449e0232",
          "81143da8-ed13-4fd7-a94f-7ac400c24b26"
        ],
        "stereo_centers": 5
      },
      "modifications": {
        "uuid": "e9f6550b-3d3e-4130-92c0-3a927ebf29bc"
      },
      "unii": "20TBL42142"
    }
  ]
}