{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bc09857d-afef-4875-b2df-02df914219f6",
          "code": "2315-67-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2315-67-5",
          "code_system": "CAS",
          "references": [
            "d805f7e4-19e8-4045-8a83-906759a28d5f",
            "3a969bdd-b3aa-449c-9912-8cc3b1e03e65"
          ]
        },
        {
          "uuid": "c86b39b0-b24e-423c-af02-5d7dc229f0ac",
          "code": "1368185",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368185/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d805f7e4-19e8-4045-8a83-906759a28d5f"
          ]
        },
        {
          "uuid": "5973cb1a-94c6-4870-9632-82d7d4f8a69c",
          "code": "5590",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5590",
          "code_system": "PUBCHEM",
          "references": [
            "d805f7e4-19e8-4045-8a83-906759a28d5f"
          ]
        },
        {
          "uuid": "ef145d4e-0955-c9b8-0a84-a995486197f8",
          "code": "DTXSID1058680",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1058680",
          "code_system": "EPA CompTox",
          "references": [
            "99cc3919-856f-58f8-2c41-2f0db5cdde18"
          ]
        },
        {
          "uuid": "849c84a8-f7d0-4b31-a255-fe1d00167bdc",
          "code": "20CAX7IO75",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6d316c90-61d9-93c1-0730-bd00d3b2503d",
          "code": "20CAX7IO75",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=20CAX7IO75",
          "code_system": "DAILYMED",
          "references": [
            "f7f76467-67b9-0aba-c8cf-b6a1f38b2495"
          ]
        },
        {
          "uuid": "ec8e0c58-aed0-2732-ffd8-cb4574d8c4aa",
          "code": "5259",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5259",
          "code_system": "NSC",
          "references": [
            "d7571913-493f-a4e2-c8e3-92c7e519196c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4fda72de-ac98-48a9-bbbb-191ef286f1e5",
          "name": "2-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)ETHANOL",
          "stdName": "2-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)ETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c736674a-18d3-4bc4-9cc3-d1efc10e1eb8",
            "72ac0f2a-b9c5-4460-9481-35cfe3f42c25"
          ],
          "display_name": false
        },
        {
          "uuid": "c6f37884-c524-4d6b-b037-5351879bf3b5",
          "name": "2-(4-TERT-OCTYLPHENOXY)ETHANOL",
          "stdName": "2-(4-TERT-OCTYLPHENOXY)ETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72ac0f2a-b9c5-4460-9481-35cfe3f42c25",
            "5e5ac389-e576-492c-a56d-d9b65daef92b"
          ],
          "display_name": false
        },
        {
          "uuid": "0270270a-8670-4a7e-9da5-6cf883d3e029",
          "name": "IGEPAL CA-210",
          "stdName": "IGEPAL CA-210",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5ac389-e576-492c-a56d-d9b65daef92b",
            "d3bf61ae-2833-4a07-b52d-e67fa9c6766d"
          ],
          "display_name": false
        },
        {
          "uuid": "ee52138e-ba90-4627-aff2-9b6beb625897",
          "name": "NSC-5259",
          "stdName": "NSC-5259",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72ac0f2a-b9c5-4460-9481-35cfe3f42c25",
            "5e5ac389-e576-492c-a56d-d9b65daef92b"
          ],
          "display_name": false
        },
        {
          "uuid": "0dfeec17-0c04-409f-9250-89bbdfc6f48b",
          "name": "OCTOXYNOL 1",
          "stdName": "OCTOXYNOL 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22aa2a10-47ff-4938-821b-af0df336aa3b",
            "5e5ac389-e576-492c-a56d-d9b65daef92b",
            "f88cb438-bbb8-4dbd-8e4c-27e837636416"
          ],
          "display_name": false
        },
        {
          "uuid": "1b1aeb7e-d1de-4328-a837-f1ff22b0e94a",
          "name": "OCTOXYNOL 1 [VANDF]",
          "stdName": "OCTOXYNOL 1 [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5ac389-e576-492c-a56d-d9b65daef92b",
            "f88cb438-bbb8-4dbd-8e4c-27e837636416"
          ],
          "display_name": false
        },
        {
          "uuid": "6f821b5b-ebb4-40c9-9fea-2e3e05cc1dce",
          "name": "OCTOXYNOL-1",
          "stdName": "OCTOXYNOL-1",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39b73df9-ec80-4b41-aa98-6b7c46780dff",
            "2c8b857b-dbcc-4613-8601-645eec0f265a",
            "5e5ac389-e576-492c-a56d-d9b65daef92b",
            "22faef32-43ab-4934-ac0d-a739cce81414",
            "d3bf61ae-2833-4a07-b52d-e67fa9c6766d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b027ff0e-d2f9-45d6-965f-5c635785c581",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "cdf1d478-1d40-453c-b267-4bb507b981a6",
          "name": "OCTOXYNOL-1 [II]",
          "stdName": "OCTOXYNOL-1 [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c8b857b-dbcc-4613-8601-645eec0f265a"
          ],
          "display_name": false
        },
        {
          "uuid": "9050ec4f-da29-4d9a-8155-dd2429e97126",
          "name": "P-TERT-OCTYLPHENYL (2-HYDROXYETHYL)ETHER",
          "stdName": "P-TERT-OCTYLPHENYL (2-HYDROXYETHYL)ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72ac0f2a-b9c5-4460-9481-35cfe3f42c25",
            "5e5ac389-e576-492c-a56d-d9b65daef92b"
          ],
          "display_name": false
        },
        {
          "uuid": "ee3c368e-0c39-45c7-8042-7d8fb3ceefba",
          "name": "TRITON X-15",
          "stdName": "TRITON X-15",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5ac389-e576-492c-a56d-d9b65daef92b",
            "df7ded82-b182-42e9-9bad-24da23b842d1"
          ],
          "display_name": false
        },
        {
          "uuid": "43a88349-f5e0-41fa-8432-054c9e6fb0af",
          "name": "TRITON X-15 SURFACTANT",
          "stdName": "TRITON X-15 SURFACTANT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e5ac389-e576-492c-a56d-d9b65daef92b",
            "d3bf61ae-2833-4a07-b52d-e67fa9c6766d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2c8b857b-dbcc-4613-8601-645eec0f265a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "df7ded82-b182-42e9-9bad-24da23b842d1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e5ac389-e576-492c-a56d-d9b65daef92b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72ac0f2a-b9c5-4460-9481-35cfe3f42c25",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3bf61ae-2833-4a07-b52d-e67fa9c6766d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c736674a-18d3-4bc4-9cc3-d1efc10e1eb8",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f88cb438-bbb8-4dbd-8e4c-27e837636416",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d805f7e4-19e8-4045-8a83-906759a28d5f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390010000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "823f4487-fc8c-4236-afd6-5ec44c6d9c41",
          "citation": "SRS import [20CAX7IO75]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=20CAX7IO75",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390010000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39b73df9-ec80-4b41-aa98-6b7c46780dff",
          "citation": "OCTOXYNOL-1 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22faef32-43ab-4934-ac0d-a739cce81414",
          "citation": "OCTOXYNOL-1 [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22aa2a10-47ff-4938-821b-af0df336aa3b",
          "citation": "OCTOXYNOL 1 [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "99cc3919-856f-58f8-2c41-2f0db5cdde18",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2315-67-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d7571913-493f-a4e2-c8e3-92c7e519196c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f7f76467-67b9-0aba-c8cf-b6a1f38b2495",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3a969bdd-b3aa-449c-9912-8cc3b1e03e65",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1871796f-aa8f-49be-8ad5-1846bbdb38ff",
          "id": "1871796f-aa8f-49be-8ad5-1846bbdb38ff",
          "molfile": "\n  Marvin  01132101272D          \n\n 18 18  0  0  0  0            999 V2000\n   12.4251   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7107   -5.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7107   -6.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4251   -5.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9962   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2817   -5.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8692   -6.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6942   -6.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5672   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5672   -4.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -3.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1383   -4.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4238   -3.6612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7093   -4.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9949   -3.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2804   -4.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1383   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -5.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 18  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)OCCO",
          "formula": "C16H26O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6641668c-5d6d-4a42-915f-1cbe99dc5687"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "250.377",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6c7fb17b-654b-4582-b851-370a4d63810a",
      "version": "6",
      "structure": {
        "id": "baccd981-b479-4fca-b28e-cd334ca54d53",
        "molfile": "\n  Marvin  01132109402D          \n\n 18 18  0  0  0  0            999 V2000\n    5.2804   -4.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9949   -3.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7093   -4.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4238   -3.6612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1383   -4.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -3.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5672   -4.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5672   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2817   -5.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9962   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7107   -5.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4251   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7107   -6.1362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4251   -5.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8692   -6.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6942   -6.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -5.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1383   -4.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n  9 16  1  0  0  0  0\n 17  8  2  0  0  0  0\n 18 17  1  0  0  0  0\n  5 18  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)OCCO",
        "formula": "C16H26O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "250.377",
        "optical_activity": "NONE",
        "references": [
          "823f4487-fc8c-4236-afd6-5ec44c6d9c41",
          "df7ded82-b182-42e9-9bad-24da23b842d1"
        ],
        "stereo_centers": 0
      },
      "unii": "20CAX7IO75"
    }
  ]
}