{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "92e6df34-3bc4-4114-8553-215306b30e69", "code": "95520-87-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=95520-87-9", "code_system": "CAS", "references": [ "abe7eee4-0529-4657-b640-ab6595727c89", "c99640f4-b114-43e9-8cf7-a368b3e206a5" ] }, { "uuid": "5546d8e4-52f9-472b-8f58-f440d401184d", "code": "6852196", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6852196", "code_system": "PUBCHEM", "references": [ "abe7eee4-0529-4657-b640-ab6595727c89" ] }, { "uuid": "8e34fa1c-d3a0-4349-85ee-1682be813e93", "code": "1Z3RG3756V", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "37b3cb7b-d1e9-46ea-ad68-7b6462f8f682", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "da12f3f9-6728-4286-b2a8-927e0669acba", "refuuid": "697fe5bb-3492-4d07-96dc-f7eab1ee1527", "name": "PA-082", "unii": "1Z3RG3756V", "linking_id": "1Z3RG3756V", "ref_pname": "PA-082", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "b0799826-49f6-4eec-a900-751e65cc3854", "name": "ISOQUINOLINE, 1-((3,4-DIMETHOXYPHENYL)METHYL)-6,7-DIMETHOXY-4-((4-(2-METHOXYPHENYL)-1-PIPERIDINYL)METHYL)-", "stdName": "ISOQUINOLINE, 1-((3,4-DIMETHOXYPHENYL)METHYL)-6,7-DIMETHOXY-4-((4-(2-METHOXYPHENYL)-1-PIPERIDINYL)METHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0326c4b2-7b2d-4bc6-b7d1-44cbcbca8a55", "4b0b4f7a-eda9-4fdc-bdf2-7ac3b970b1af" ], "display_name": false }, { "uuid": "4a8e7c51-f540-4055-9967-290d685cbb57", "name": "PA-082", "stdName": "PA-082", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0326c4b2-7b2d-4bc6-b7d1-44cbcbca8a55", "4b0b4f7a-eda9-4fdc-bdf2-7ac3b970b1af" ], "display_name": true } ], "references": [ { "uuid": "4b0b4f7a-eda9-4fdc-bdf2-7ac3b970b1af", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0326c4b2-7b2d-4bc6-b7d1-44cbcbca8a55", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "abe7eee4-0529-4657-b640-ab6595727c89", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392570000, "tags": [ "NOMEN" ] }, { "uuid": "8b3b38d6-160a-40fd-b2c1-671181b41cbb", "citation": "SRS import [1Z3RG3756V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1Z3RG3756V", "doc_type": "SRS", "public_domain": true, "document_date": 1493392570000, "tags": [ "NOMEN" ] }, { "uuid": "c99640f4-b114-43e9-8cf7-a368b3e206a5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "afe0995a-5c0d-4668-b878-81a27be7531a", "id": "afe0995a-5c0d-4668-b878-81a27be7531a", "molfile": "\n Marvin 01132109072D \n\n 40 44 0 0 0 0 999 V2000\n -3.9296 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.2687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 38 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 37 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 36 2 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 27 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 19 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 24 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 36 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 29 32 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 35 2 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\nM END", "smiles": "COc1ccccc1C2CCN(CC2)Cc3cnc(Cc4ccc(c(c4)OC)OC)c5cc(c(cc35)OC)OC", "formula": "C33H38N2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "153d6f96-e27b-4122-a6c4-2c45e211283a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "542.6665", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "697fe5bb-3492-4d07-96dc-f7eab1ee1527", "version": "3", "structure": { "id": "97a84d51-4c89-4029-96ea-780069132579", "molfile": "\n Marvin 01132107522D \n\n 40 44 0 0 0 0 999 V2000\n -0.3572 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 1.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5006 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9296 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2151 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7862 3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0717 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -1.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5006 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7862 -3.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0717 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -3.9188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2151 -2.2687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9296 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 1 10 1 0 0 0 0\n 5 10 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 12 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 18 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 19 24 1 0 0 0 0\n 15 18 1 0 0 0 0\n 11 12 1 0 0 0 0\n 4 11 1 0 0 0 0\n 26 27 1 0 0 0 0\n 8 26 1 0 0 0 0\n 28 29 1 0 0 0 0\n 7 28 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 31 36 2 0 0 0 0\n 37 38 1 0 0 0 0\n 34 37 1 0 0 0 0\n 39 40 1 0 0 0 0\n 33 39 1 0 0 0 0\n 30 31 1 0 0 0 0\n 1 30 1 0 0 0 0\nM END", "smiles": "COc1ccccc1C2CCN(CC2)Cc3cnc(Cc4ccc(c(c4)OC)OC)c5cc(c(cc35)OC)OC", "formula": "C33H38N2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "542.6665", "optical_activity": "NONE", "references": [ "4b0b4f7a-eda9-4fdc-bdf2-7ac3b970b1af", "8b3b38d6-160a-40fd-b2c1-671181b41cbb" ], "stereo_centers": 0 }, "unii": "1Z3RG3756V" } ] }