{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d7e5cf71-8b0f-400b-9f6e-8d945e963105",
          "code": "464-45-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=464-45-9",
          "code_system": "CAS",
          "references": [
            "1764edff-ceb3-4532-91d0-e21b0d2d20c4",
            "0a3504e4-3a8f-41ea-99d2-6ef96f45ac45"
          ]
        },
        {
          "uuid": "86236597-226a-4f9e-97ab-1ac3c7ea4da2",
          "code": "m2610",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2610?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1764edff-ceb3-4532-91d0-e21b0d2d20c4"
          ]
        },
        {
          "uuid": "0904dc2e-7be3-4b63-bdc9-a65bf2e2b0e0",
          "code": "207-353-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.686",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1764edff-ceb3-4532-91d0-e21b0d2d20c4"
          ]
        },
        {
          "uuid": "827a8ad1-a739-4a5d-bda6-97bf0d4593ae",
          "code": "1201518",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1201518",
          "code_system": "PUBCHEM",
          "references": [
            "1764edff-ceb3-4532-91d0-e21b0d2d20c4"
          ]
        },
        {
          "uuid": "7d756a69-0052-168a-624b-8bcd4823bdc9",
          "code": "DTXSID3022035",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3022035",
          "code_system": "EPA CompTox",
          "references": [
            "173ec51c-e8be-d2e0-0d80-8693be3dd2de"
          ]
        },
        {
          "uuid": "e4ed8b04-da6f-a032-a5ff-29dcdc281d48",
          "code": "2398335",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2398335/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c2c6817c-d467-3a21-34c0-ce6587f06459"
          ]
        },
        {
          "uuid": "639f788b-66cb-4c81-8a81-c0c72184dfe0",
          "code": "1Y84986J9Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ab78fa06-65cb-992e-fdfb-29a32f018858",
          "code": "15394",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:15394",
          "code_system": "CHEBI",
          "references": [
            "6fbc859a-f84d-5947-278c-f969e7094cfd"
          ]
        },
        {
          "uuid": "37a3931c-4fc1-2aad-3e55-cea1ae3c9225",
          "code": "1Y84986J9Q",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1Y84986J9Q",
          "code_system": "DAILYMED",
          "references": [
            "eceee91e-4925-3bb7-cfc3-a828754f63af"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "017bb88d-ff64-40b0-92e5-1782bd8ed5e1",
          "comments": "Pure compound identified in the Paeonia lactiflora (Paeoniaceae) root steam distillate with growth-inhibiting activity against nine harmful intestinal bacteria and eight lactic acid-producing bacteria.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "88e8be38-b58c-4a1a-befb-bd94a0c9bdde"
          ],
          "related_substance": {
            "uuid": "513ac3f7-5ad1-4718-933a-f81a26c72651",
            "refuuid": "bf47f653-3b64-4f68-8e91-5a64558795d9",
            "name": "PAEONIA LACTIFLORA ROOT",
            "unii": "3Z3866YW6P",
            "linking_id": "3Z3866YW6P",
            "ref_pname": "PAEONIA LACTIFLORA ROOT",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "36fafe7f-26c5-4461-9a0a-1cba7c9cef56",
          "name": "((1S)-ENDO)-(-)-BORNEOL",
          "stdName": "((1S)-ENDO)-(-)-BORNEOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "36fe6508-c617-4232-b8aa-fad9c7d7b251"
          ],
          "display_name": false
        },
        {
          "uuid": "42507d8f-0ec1-4b13-adb9-4c3c6ad6529b",
          "name": "(-)-BORNEOL",
          "stdName": "(-)-BORNEOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "14c77c07-d6db-4e0e-ba7a-c82e5ef03899"
          ],
          "display_name": false
        },
        {
          "uuid": "4fa844a8-69bb-48ef-85f7-053bc4ccfc02",
          "name": "(1S,2R,4S)-BORNEOL",
          "stdName": "(1S,2R,4S)-BORNEOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "17aa15b6-b5a2-4bb5-9b2f-c0f9767d02c0"
          ],
          "display_name": false
        },
        {
          "uuid": "3c6974b8-c53c-416d-a8fd-dd3989adb946",
          "name": "BICYCLO(2.2.1)HEPTAN-2-OL, 1,7,7-TRIMETHYL-, (1S,2R,4S)-",
          "stdName": "BICYCLO(2.2.1)HEPTAN-2-OL, 1,7,7-TRIMETHYL-, (1S,2R,4S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "0256c5a6-cfb2-467a-ae7f-38d4af7efafd"
          ],
          "display_name": false
        },
        {
          "uuid": "3f2001bf-1d9b-49ac-b84d-cb1f6970edfb",
          "name": "BORNEOL L-FORM",
          "stdName": "BORNEOL L-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "e4da1e92-dc69-4af5-ad63-2597b89506b0",
            "17aa15b6-b5a2-4bb5-9b2f-c0f9767d02c0"
          ],
          "display_name": false
        },
        {
          "uuid": "4ebb3cdb-ab08-4e9b-8f0f-c0fc827bd547",
          "name": "BORNEOL L-FORM [MI]",
          "stdName": "BORNEOL L-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "17aa15b6-b5a2-4bb5-9b2f-c0f9767d02c0"
          ],
          "display_name": false
        },
        {
          "uuid": "706d0fdf-2e1d-4d96-a236-cf378760258e",
          "name": "BORNEOL, (-)-",
          "stdName": "BORNEOL, (-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "17aa15b6-b5a2-4bb5-9b2f-c0f9767d02c0"
          ],
          "display_name": true
        },
        {
          "uuid": "7150099a-1ac5-481c-b6e0-55f117e8903e",
          "name": "BORNEOL, L-",
          "stdName": "BORNEOL, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "4e1d0148-c491-41a4-8761-13cb01cbffad"
          ],
          "display_name": false
        },
        {
          "uuid": "e3a47ea8-eefb-4955-ac6a-e7b8c95e5b67",
          "name": "FEMA NO. 2157, (-)-",
          "stdName": "FEMA NO. 2157, (-)-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "9f9390f2-19aa-41cd-a788-07e5135c4590"
          ],
          "display_name": false
        },
        {
          "uuid": "c85b4b61-9a8b-43c3-9ea8-aa92fe4330b3",
          "name": "L-2-CAMPHANOL",
          "stdName": "L-2-CAMPHANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "0256c5a6-cfb2-467a-ae7f-38d4af7efafd"
          ],
          "display_name": false
        },
        {
          "uuid": "06a1ad27-7510-4391-91ee-bda887a3ce3e",
          "name": "L-BORNEOL",
          "stdName": "L-BORNEOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "78188f29-edbe-4128-8aaa-77d74fd0e6da"
          ],
          "display_name": false
        },
        {
          "uuid": "03aac99b-ef53-4e0b-8d40-c541f5f37e97",
          "name": "LINDEROL",
          "stdName": "LINDEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "78188f29-edbe-4128-8aaa-77d74fd0e6da"
          ],
          "display_name": false
        },
        {
          "uuid": "9a40f650-ea85-4b5e-8c3e-e635654f5920",
          "name": "NGAI CAMPHOR",
          "stdName": "NGAI CAMPHOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6952fc16-3aa7-4dc2-be73-e165db1c529a",
            "78188f29-edbe-4128-8aaa-77d74fd0e6da"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "17aa15b6-b5a2-4bb5-9b2f-c0f9767d02c0",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6952fc16-3aa7-4dc2-be73-e165db1c529a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0256c5a6-cfb2-467a-ae7f-38d4af7efafd",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e1d0148-c491-41a4-8761-13cb01cbffad",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f9390f2-19aa-41cd-a788-07e5135c4590",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14c77c07-d6db-4e0e-ba7a-c82e5ef03899",
          "citation": "http://download.springer.com/static/pdf/937/art%253A10.1007%252Fs11274-011-0961-6.pdf?auth66=1407006",
          "url": "http://download.springer.com/static/pdf/937/art%253A10.1007%252Fs11274-011-0961-6.pdf?auth66=1407006",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78188f29-edbe-4128-8aaa-77d74fd0e6da",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36fe6508-c617-4232-b8aa-fad9c7d7b251",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1764edff-ceb3-4532-91d0-e21b0d2d20c4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390977000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88e8be38-b58c-4a1a-befb-bd94a0c9bdde",
          "citation": "NGAN LTM ET AL, WORLD J MICROBIOL BIOTECHNOL, 28(4):1575?1583, 2013",
          "url": "http://download.springer.com/static/pdf/937/art%253A10.1007%252Fs11274-011-0961-6.pdf?auth66=1407006655_98996b2fc60e276a4228eeac35b3bf01&ext=.pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37ef8dde-4906-443b-ad0b-9ba472fffdd1",
          "citation": "SRS import [1Y84986J9Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1Y84986J9Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390977000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95155498-a02a-46c0-8e8a-feba5172ae86",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4da1e92-dc69-4af5-ad63-2597b89506b0",
          "citation": "BORNEOL L-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "173ec51c-e8be-d2e0-0d80-8693be3dd2de",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=464-45-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c2c6817c-d467-3a21-34c0-ce6587f06459",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "0a3504e4-3a8f-41ea-99d2-6ef96f45ac45",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6fbc859a-f84d-5947-278c-f969e7094cfd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "eceee91e-4925-3bb7-cfc3-a828754f63af",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "68e56720-4941-46d4-8e1a-d2da6a6c44ac",
          "id": "68e56720-4941-46d4-8e1a-d2da6a6c44ac",
          "molfile": "\n  Marvin  01132105272D          \n\n 11 12  0  0  1  0            999 V2000\n    5.5805   -3.2542    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.2950   -2.8418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5805   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8661   -4.4917    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.1516   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1516   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8661   -2.8418    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.8661   -2.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3898   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7578   -4.1970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7578   -3.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  6  0  0  0\n  4  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)[C@H]2CC[C@]1(C)[C@@H](C2)O",
          "formula": "C10H18O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad992768-3a36-40b9-869b-e6bc9bf669fe"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "154.2497",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5ecd558b-e07f-4481-bed5-5808eab670dd",
      "version": "7",
      "structure": {
        "id": "3b0f860c-d72e-4d7c-8968-76e209be9927",
        "molfile": "\n  Marvin  01132103082D          \n\n 11 12  0  0  1  0            999 V2000\n    4.8661   -2.8418    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3898   -3.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8661   -4.4917    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1516   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1516   -3.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5805   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5805   -3.2542    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.2950   -2.8418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7578   -4.1970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7578   -3.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8661   -2.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  2  1  1  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  2  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n  1 11  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)[C@H]2CC[C@]1(C)[C@@H](C2)O",
        "formula": "C10H18O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "154.2497",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "37ef8dde-4906-443b-ad0b-9ba472fffdd1",
          "95155498-a02a-46c0-8e8a-feba5172ae86"
        ],
        "stereo_centers": 3
      },
      "unii": "1Y84986J9Q"
    }
  ]
}