{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "86d5bcc9-e1d5-4155-8c33-a16fc9b29907",
          "code": "65113-99-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=65113-99-7",
          "code_system": "CAS",
          "references": [
            "0fb667c9-cfa9-431f-82be-9a3ac55c9b86",
            "0d102bfe-8f2a-46ab-910d-966743d2a921"
          ]
        },
        {
          "uuid": "303c61ee-8a6e-4e76-9506-ae72b0ef73ca",
          "code": "265-453-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.059.485",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0fb667c9-cfa9-431f-82be-9a3ac55c9b86"
          ]
        },
        {
          "uuid": "332db0d2-ec65-4d14-884d-465ebdef76ed",
          "code": "103212",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/103212",
          "code_system": "PUBCHEM",
          "references": [
            "0fb667c9-cfa9-431f-82be-9a3ac55c9b86"
          ]
        },
        {
          "uuid": "15985ad4-75d5-d196-d816-2a6fc1b831da",
          "code": "DTXSID5052335",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5052335",
          "code_system": "EPA CompTox",
          "references": [
            "ae23e0fb-3d9b-54fe-2f24-43771b18fc09"
          ]
        },
        {
          "uuid": "ee1eea41-3550-0be7-8e8f-e8518ec10d68",
          "code": "2373965",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2373965/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3e9ff56f-f181-6cb1-f327-65e87a24840a"
          ]
        },
        {
          "uuid": "2ba85c0f-f5c3-4d87-8488-4a1655e22012",
          "code": "1XL3NL51UU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7c648709-572b-8fa1-0818-fd0f10da7945",
          "code": "Sandalore",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sandalore",
          "code_system": "WIKIPEDIA",
          "references": [
            "6166a3d4-a60b-2dfb-31dd-339a540b892c"
          ]
        },
        {
          "uuid": "96f6f910-f8db-89e1-1b4a-cd2cd617d7e9",
          "code": "1XL3NL51UU",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1XL3NL51UU",
          "code_system": "DAILYMED",
          "references": [
            "a97bfed0-8cae-8bb1-d5b7-4726b9af8e80"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eb68f730-94bc-b2dd-54d1-688e55e0aaef",
          "name": ".ALPHA.,.BETA.,2,2,3-PENTAMETHYL-3-CYCLOPENTENE-1-BUTANOL",
          "stdName": ".ALPHA.,.BETA.,2,2,3-PENTAMETHYL-3-CYCLOPENTENE-1-BUTANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94dda47c-5203-399a-29f8-cbae9f7c5400"
          ],
          "display_name": false
        },
        {
          "uuid": "dba25686-4ba6-48de-9407-230bf46ba905",
          "name": "3-CYCLOPENTENE-1-BUTANOL, ALPHA,BETA,2,2,3-PENTAMETHYL-",
          "stdName": "3-CYCLOPENTENE-1-BUTANOL, ALPHA,BETA,2,2,3-PENTAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bc4e9a7-e6a2-4fde-9129-ed2c3b0e0425"
          ],
          "display_name": false
        },
        {
          "uuid": "17ad6a0e-5738-240b-c8b6-d457769063f9",
          "name": "3-METHYL-5-(2,2,3-TRIMETHYL-3-CYCLOPENTENYL)PENTAN-2-OL",
          "stdName": "3-METHYL-5-(2,2,3-TRIMETHYL-3-CYCLOPENTENYL)PENTAN-2-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94dda47c-5203-399a-29f8-cbae9f7c5400"
          ],
          "display_name": false
        },
        {
          "uuid": "1e3b8c80-a8a3-61ed-f538-e6f915f5a7ef",
          "name": "SANDALORE",
          "stdName": "SANDALORE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94dda47c-5203-399a-29f8-cbae9f7c5400"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dd76d986-f789-4071-b3ae-a64df55005e6",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "6bc4e9a7-e6a2-4fde-9129-ed2c3b0e0425",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fb667c9-cfa9-431f-82be-9a3ac55c9b86",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392561000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae23e0fb-3d9b-54fe-2f24-43771b18fc09",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=65113-99-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "94dda47c-5203-399a-29f8-cbae9f7c5400",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0d102bfe-8f2a-46ab-910d-966743d2a921",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6166a3d4-a60b-2dfb-31dd-339a540b892c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "3e9ff56f-f181-6cb1-f327-65e87a24840a",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "a97bfed0-8cae-8bb1-d5b7-4726b9af8e80",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "deb5c099-14c2-44ce-8591-7eec5053f01c",
          "id": "deb5c099-14c2-44ce-8591-7eec5053f01c",
          "molfile": "\n  Marvin  01132111322D          \n\n 15 15  0  0  0  0            999 V2000\n    5.6893   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9724   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9724   -2.0596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2613   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.2613    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5445   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8333   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1164   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.8604   -2.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0355   -2.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7851   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4508   -0.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0355   -0.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8604   -0.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CC(CCC1CC=C(C)C1(C)C)C(C)O",
          "formula": "C14H26O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff703ad2-637c-4360-885d-65095a651527"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "210.3562",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "b195c6c5-be6a-4fdc-b8f1-3bd51b35547d",
      "version": "13",
      "structure": {
        "id": "cdf28e8c-32a1-4ffe-b8c4-e916d7610164",
        "molfile": "\n  Marvin  01132110382D          \n\n 15 15  0  0  0  0            999 V2000\n    1.0355   -2.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8604   -2.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1164   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4508   -0.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7851   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0355   -0.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8604   -0.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8333   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5445   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2613   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9724   -1.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6893   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2613    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9724   -2.0596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 15  1  0  0  0  0\nM  END",
        "smiles": "CC(CCC1CC=C(C)C1(C)C)C(C)O",
        "formula": "C14H26O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "210.3562",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6bc4e9a7-e6a2-4fde-9129-ed2c3b0e0425",
          "94dda47c-5203-399a-29f8-cbae9f7c5400"
        ],
        "stereo_centers": 3
      },
      "unii": "1XL3NL51UU"
    }
  ]
}