{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1a1d42da-702e-4eb8-80c6-f58bb95d4cca",
          "code": "89695-59-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=89695-59-0",
          "code_system": "CAS",
          "references": [
            "a3a5955f-8fcd-4725-acd6-d38f66098c54",
            "e683f14c-3261-4338-b070-6652d07c7993"
          ]
        },
        {
          "uuid": "17c253ff-265f-8a1a-21ec-4cdda6069e97",
          "code": "25231507",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25231507",
          "code_system": "PUBCHEM",
          "references": [
            "a22cbfe1-28ae-ca9b-677b-244369cd133c"
          ]
        },
        {
          "uuid": "f738ea6e-c440-4425-a919-dd68a072be21",
          "code": "1XGV09LL9X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "1635e995-a0fe-4504-8487-f267d203a9b3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "384f591c-5f07-43db-b48e-476382e7fc41",
            "refuuid": "f5ca9ce5-6965-4798-94f3-fa2e6607449b",
            "name": "CREATINE",
            "unii": "MU72812GK0",
            "linking_id": "MU72812GK0",
            "ref_pname": "CREATINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7c895a1e-49eb-4b31-97f8-b831a50ac1ab",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "b0fb7502-451f-4e97-82e3-ce0cd4215287",
            "refuuid": "f5ca9ce5-6965-4798-94f3-fa2e6607449b",
            "name": "CREATINE",
            "unii": "MU72812GK0",
            "linking_id": "MU72812GK0",
            "ref_pname": "CREATINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d0f2dc50-1601-4772-affa-79350c490246",
          "name": "CREATINE NITRATE",
          "stdName": "CREATINE NITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2166d06-64f9-42a0-b43e-34e4c2f32bbc"
          ],
          "display_name": true
        },
        {
          "uuid": "98357ff0-1010-48ac-a4d8-8bb1bc9c6284",
          "name": "CREATINE, COMPD. WITH HNO3",
          "stdName": "CREATINE, COMPD. WITH HNO3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e9199ac-f074-4a90-99bb-6cd0e3352207"
          ],
          "display_name": false
        },
        {
          "uuid": "9b3a1acb-4e96-44b7-9cf3-b956036f8012",
          "name": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, MONONITRATE",
          "stdName": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, MONONITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e9199ac-f074-4a90-99bb-6cd0e3352207"
          ],
          "display_name": false
        },
        {
          "uuid": "79c1cf4b-7569-44a8-9dfa-c7f06f7b1218",
          "name": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, NITRATE (1:1)",
          "stdName": "GLYCINE, N-(AMINOIMINOMETHYL)-N-METHYL-, NITRATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e9199ac-f074-4a90-99bb-6cd0e3352207"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f2166d06-64f9-42a0-b43e-34e4c2f32bbc",
          "citation": "https://en.wikipedia.org/wiki/Creatine_supplements#Creatine_nitrate",
          "url": "https://en.wikipedia.org/wiki/Creatine_supplements#Creatine_nitrate",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5e9199ac-f074-4a90-99bb-6cd0e3352207",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3a5955f-8fcd-4725-acd6-d38f66098c54",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390841000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8164a5c7-f6cb-4b3f-a877-17442a62d3c6",
          "citation": "SRS import [1XGV09LL9X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1XGV09LL9X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390841000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a22cbfe1-28ae-ca9b-677b-244369cd133c",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "e683f14c-3261-4338-b070-6652d07c7993",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e067e5d6-f48b-49b5-a263-9170a3c5ea72",
          "id": "e067e5d6-f48b-49b5-a263-9170a3c5ea72",
          "molfile": "\n  Marvin  01132111372D          \n\n  4  3  0  0  0  0            999 V2000\n    1.4842   -0.6188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1987   -0.2062    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.1987    0.6188    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.9131   -0.6188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\nM  CHG  2   2   1   3  -1\nM  END",
          "smiles": "[N+](=O)(O)[O-]",
          "formula": "HNO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e4fa5623-7aaa-4257-8480-8abbab0b7a9d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "63.0129",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "3514949d-cae9-4807-ad10-722e3183d982",
          "id": "3514949d-cae9-4807-ad10-722e3183d982",
          "molfile": "\n  Marvin  01132102502D          \n\n  9  8  0  0  0  0            999 V2000\n   -1.4842   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4842   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7697    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0553   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0553   -1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6592    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1987    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1987    1.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9131   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  END",
          "smiles": "CN(CC(=O)O)C(=N)N",
          "formula": "C4H9N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8db8aa10-1a2b-4869-a5f2-35faf534d272"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "131.1333",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "648bff70-295d-4edb-81b8-60388b2b875e",
      "version": "4",
      "structure": {
        "id": "fcba1670-fbf4-40c6-b419-a8758a6cd99b",
        "molfile": "\n  Marvin  01132113052D          \n\n 13 11  0  0  0  0            999 V2000\n   -0.0553   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4842   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7697    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0553   -1.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6592    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4842   -1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1987    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1987    1.0313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9131   -0.2062    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1987   -0.2062    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    1.4842   -0.6188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1987    0.6188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9131   -0.6188    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  2  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 10 13  1  0  0  0  0\nM  CHG  2  10   1  13  -1\nM  END",
        "smiles": "CN(CC(=O)O)C(=N)N.[N+](=O)(O)[O-]",
        "formula": "C4H9N3O2.HNO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "194.1462",
        "optical_activity": "NONE",
        "references": [
          "5e9199ac-f074-4a90-99bb-6cd0e3352207",
          "8164a5c7-f6cb-4b3f-a877-17442a62d3c6"
        ],
        "stereo_centers": 0
      },
      "unii": "1XGV09LL9X"
    }
  ]
}