{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7d9db056-b7cd-4d1a-9f6e-4292518f7853",
          "code": "481-06-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=481-06-1",
          "code_system": "CAS",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30",
            "b853a2ff-adf1-4f9a-a34e-15c6f5a72f34"
          ]
        },
        {
          "uuid": "80df0448-79fa-42b8-9cd0-fe4eb124ed1b",
          "code": "C87627",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87627",
          "code_system": "NCI_THESAURUS",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "2833f84e-cfa1-432e-a3bd-239e57190bdf",
          "code": "D012500",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68012500",
          "code_system": "MESH",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "f1d69cf8-8082-49eb-b0e2-a905adff4e1c",
          "code": "SANTONIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Santonin",
          "code_system": "WIKIPEDIA",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "e4b75f91-9f8d-4297-9220-79d9633cfa93",
          "code": "207-560-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.874",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "56481844-1eba-444f-97bb-1635516ed3d9",
          "code": "1311390",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1311390/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "2e6e2f63-b68c-4600-b895-6b8781716865",
          "code": "m9768",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9768?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "6a9bfae5-551c-449c-965d-221993171381",
          "code": "SUB15192MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "d0285c98-3672-422a-a81e-4de2fa7ef87b",
          "code": "CHEMBL259254",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL259254",
          "code_system": "ChEMBL",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "64e3acfc-5b21-49e1-a342-c7c49e7150a5",
          "code": "221071",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/221071",
          "code_system": "PUBCHEM",
          "references": [
            "594edbf7-8f6f-4e11-a97b-979ecf6dcd30"
          ]
        },
        {
          "uuid": "d78cb4e2-c03c-4fef-fe5d-70107bed3519",
          "code": "DTXSID7045312",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7045312",
          "code_system": "EPA CompTox",
          "references": [
            "88847403-edcb-5b0f-d656-3d8940c4b8f4"
          ]
        },
        {
          "uuid": "e606990d-7b97-bfe5-0472-7532797e60dc",
          "code": "C250",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiparasitic Agent[C276]|Antihelminthic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C250",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b0dbca4f-6f6d-6728-0111-605fa97565cd"
          ]
        },
        {
          "uuid": "7f9f814b-a65a-7d75-c7ec-625be7925c2c",
          "code": "26604",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:26604",
          "code_system": "CHEBI",
          "references": [
            "b0dbca4f-6f6d-6728-0111-605fa97565cd"
          ]
        },
        {
          "uuid": "1c53e483-0cff-4f31-960e-c4d69646770b",
          "code": "1VL8J38ERO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e561a0d8-a8c4-cb92-9540-89d62b74b935",
          "code": "1VL8J38ERO",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=1VL8J38ERO",
          "code_system": "DAILYMED",
          "references": [
            "e8b8f580-6d53-395d-db97-bc3ce118ca77"
          ]
        },
        {
          "uuid": "042bd405-580e-85e6-ca40-8706c1940066",
          "code": "100000078395",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "50e786bf-4a76-615e-cb40-04a4e3c60d1b"
          ]
        },
        {
          "uuid": "84ca5ba5-df37-3808-d789-508f34604fa5",
          "code": "4900",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4900",
          "code_system": "NSC",
          "references": [
            "4a8472ee-04a0-ef9d-275c-2f5d2395af4d"
          ]
        },
        {
          "uuid": "dc7812ca-b7f0-0588-c01c-91510e754d3c",
          "code": "santonin",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/santonin.html",
          "code_system": "ALANWOOD",
          "references": [
            "7424ae0d-fabc-45e4-a84f-9e2f857f0145"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bb02f00a-40ed-4250-8c1c-67099e85d8c2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3cbd1a25-ab21-4e48-a670-f4e31ffb9913",
            "refuuid": "1f5b6b67-b104-42f0-aaf8-b9e1051a5077",
            "name": "SANTONIN",
            "unii": "1VL8J38ERO",
            "linking_id": "1VL8J38ERO",
            "ref_pname": "SANTONIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a864a0b9-bbc1-42d8-829b-c44ee827921c",
          "name": "(3S,3AS,5AS)-3,5A,9-TRIMETHYL-3A,4,5,5A-TETRAHYDRONAPHTHO(1,2-B)FURAN-2,8(3H,9BH)-DIONE",
          "stdName": "(3S,3AS,5AS)-3,5A,9-TRIMETHYL-3A,4,5,5A-TETRAHYDRONAPHTHO(1,2-B)FURAN-2,8(3H,9BH)-DIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "309d5c05-c0bf-4ea5-a210-9ddfc4b4e794"
          ],
          "display_name": false
        },
        {
          "uuid": "c2371dfd-da72-45fb-a60a-41fb401aebed",
          "name": "(3S,3AS,5AS,9BS)-3A,5,5A,9B-TETRAHYDRO-3,5A,9-TRIMETHYLNAPHTHO(1,2-B)FURAN-2,8(3H,4H)-DIONE",
          "stdName": "(3S,3AS,5AS,9BS)-3A,5,5A,9B-TETRAHYDRO-3,5A,9-TRIMETHYLNAPHTHO(1,2-B)FURAN-2,8(3H,4H)-DIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4c26787-3781-4750-8977-564d9197f2e3",
            "61be868f-70d8-470a-99d3-9c19efdf4e15"
          ],
          "display_name": false
        },
        {
          "uuid": "726541aa-897c-49cd-9645-d2566a8f838d",
          "name": ".ALPHA.-SANTONIN [MI]",
          "stdName": ".ALPHA.-SANTONIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "679e9aa0-3f3d-410c-a80e-f9fbce30740f"
          ],
          "display_name": false
        },
        {
          "uuid": "968ed910-1fb2-4c11-a4b4-ce6eff17989f",
          "name": "NSC-4900",
          "stdName": "NSC-4900",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "778a3839-6467-4700-a44a-98cc38abebbe"
          ],
          "display_name": false
        },
        {
          "uuid": "dfcf41a5-df35-4857-882c-bbd4ba96c63d",
          "name": "SANTONIN",
          "stdName": "SANTONIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fc3ce66-0872-456b-bf11-83758d4d2085",
            "e08096b5-d2ad-45e4-9fef-8d78effd50c7",
            "46427833-1aad-45fb-a4d3-a42306b5aece",
            "979ef3c9-f526-49e0-bf02-1ac7283c9aeb",
            "29cebed2-b7bd-4600-9256-f63d890a4379"
          ],
          "display_name": true
        },
        {
          "uuid": "83446561-0733-4572-a6d1-09519a15ceb5",
          "name": "SANTONIN [JAN]",
          "stdName": "SANTONIN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f05a23ed-f3f1-349d-4e75-bd92d9fc33ad"
          ],
          "display_name": false
        },
        {
          "uuid": "454a2cb3-499e-4077-8cf5-c604c58de761",
          "name": "SANTONIN [MART.]",
          "stdName": "SANTONIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46427833-1aad-45fb-a4d3-a42306b5aece"
          ],
          "display_name": false
        },
        {
          "uuid": "74526de3-ca64-4470-9729-fd2c759a9c26",
          "name": "SANTONINUM",
          "stdName": "SANTONINUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41f01a61-be83-46c3-a166-3d880743d02d",
            "3d564e40-3261-4d6f-96e5-28439784b76e",
            "38396a33-2e1c-4f10-ad6e-0400711af800"
          ],
          "display_name": false
        },
        {
          "uuid": "1a6e11be-5f03-45d2-9443-b2b36f596a41",
          "name": "SANTONINUM [HPUS]",
          "stdName": "SANTONINUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d564e40-3261-4d6f-96e5-28439784b76e",
            "38396a33-2e1c-4f10-ad6e-0400711af800"
          ],
          "display_name": false
        },
        {
          "uuid": "530f3760-8a2b-3112-1a0a-53a56ec16438",
          "name": "Santonin [WHO-DD]",
          "stdName": "SANTONIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4defcfb-863e-12d7-2748-fbd94f50db2e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "979ef3c9-f526-49e0-bf02-1ac7283c9aeb",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "309d5c05-c0bf-4ea5-a210-9ddfc4b4e794",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d564e40-3261-4d6f-96e5-28439784b76e",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4c26787-3781-4750-8977-564d9197f2e3",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61be868f-70d8-470a-99d3-9c19efdf4e15",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38396a33-2e1c-4f10-ad6e-0400711af800",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46427833-1aad-45fb-a4d3-a42306b5aece",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "679e9aa0-3f3d-410c-a80e-f9fbce30740f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fc3ce66-0872-456b-bf11-83758d4d2085",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "778a3839-6467-4700-a44a-98cc38abebbe",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "594edbf7-8f6f-4e11-a97b-979ecf6dcd30",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390842000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a833d91-2540-433a-89be-1254f10c53c1",
          "citation": "SRS import [1VL8J38ERO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1VL8J38ERO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390842000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41f01a61-be83-46c3-a166-3d880743d02d",
          "citation": "SANTONINUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29cebed2-b7bd-4600-9256-f63d890a4379",
          "citation": "SANTONIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e08096b5-d2ad-45e4-9fef-8d78effd50c7",
          "citation": "SANTONIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f05a23ed-f3f1-349d-4e75-bd92d9fc33ad",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "88847403-edcb-5b0f-d656-3d8940c4b8f4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=481-06-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "50e786bf-4a76-615e-cb40-04a4e3c60d1b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b0dbca4f-6f6d-6728-0111-605fa97565cd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b853a2ff-adf1-4f9a-a34e-15c6f5a72f34",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7424ae0d-fabc-45e4-a84f-9e2f857f0145",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4a8472ee-04a0-ef9d-275c-2f5d2395af4d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e4defcfb-863e-12d7-2748-fbd94f50db2e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e8b8f580-6d53-395d-db97-bc3ce118ca77",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5cc1dcc2-0533-40b1-a7f0-bf7f246dee8f",
          "id": "5cc1dcc2-0533-40b1-a7f0-bf7f246dee8f",
          "molfile": "\n  Marvin  01132104482D          \n\n 18 20  0  0  1  0            999 V2000\n   -0.6162    1.0184    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -0.3687    1.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1392    0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6832    0.3609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6162   -0.3094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4128   -0.0541    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -2.1089   -0.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1089   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4128   -1.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8283   -1.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8283   -2.5241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5398   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5398   -0.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8283   -0.0541    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -3.5398    0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8283    0.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1089    1.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4128    0.7709    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 18  1  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 18  1  0  0  0  0\n  8  7  2  0  0  0  0\n 14  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@@H]2CC[C@@]3(C)C=CC(=O)C(=C3[C@H]2OC1=O)C",
          "formula": "C15H18O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4d27d251-336f-45fa-a5f7-2a1731bc8816"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "246.3022",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1f5b6b67-b104-42f0-aaf8-b9e1051a5077",
      "version": "13",
      "structure": {
        "id": "71b78a54-96b3-4746-9453-3064c5ea6f00",
        "molfile": "\n  Marvin  01132105542D          \n\n 20 22  0  0  1  0            999 V2000\n   -2.1089   -0.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4128   -0.0541    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.6162   -0.3094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1392    0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1089   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4128    0.7709    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.8283   -0.0541    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.6162    1.0184    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.8283   -1.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5398   -0.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5398   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1089    1.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6832    0.3609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8283    0.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8283   -2.5241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4128   -1.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5398    0.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3687    1.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4154    1.5985    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4128   -0.8611    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 14  1  0  0  0  0\n 13  4  2  0  0  0  0\n 14  7  1  0  0  0  0\n 15  9  2  0  0  0  0\n 16  5  1  0  0  0  0\n  7 17  1  1  0  0  0\n  8 18  1  6  0  0  0\n  6 19  1  6  0  0  0\n  2 20  1  1  0  0  0\n 12  6  1  0  0  0  0\n 11  9  1  0  0  0  0\n  8  4  1  0  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@]2([H])CC[C@@]3(C)C=CC(=O)C(=C3[C@@]2([H])OC1=O)C",
        "formula": "C15H18O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "246.3022",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3a833d91-2540-433a-89be-1254f10c53c1",
          "979ef3c9-f526-49e0-bf02-1ac7283c9aeb"
        ],
        "stereo_centers": 4
      },
      "unii": "1VL8J38ERO"
    }
  ]
}