{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6d8a40c-59f2-4cf4-b1a5-2e51de089676",
          "code": "DEHYDROMENTHOFUROLACTONE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=3733",
          "code_system": "JECFA EVALUATION",
          "references": [
            "09579a98-1e9e-45ea-a26f-c23deeefffb0"
          ]
        },
        {
          "uuid": "7facdb02-8da7-4cab-ab83-d00114b61b8c",
          "code": "75640-26-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=75640-26-5",
          "code_system": "CAS",
          "references": [
            "09579a98-1e9e-45ea-a26f-c23deeefffb0",
            "43920b9e-7924-4e85-829d-824f57e1326b"
          ]
        },
        {
          "uuid": "946018df-c874-4922-a3a3-bcd010673731",
          "code": "C527462",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67527462",
          "code_system": "MESH",
          "references": [
            "09579a98-1e9e-45ea-a26f-c23deeefffb0"
          ]
        },
        {
          "uuid": "f45d50bf-9e08-4682-b4cf-9c259a275c2c",
          "code": "71587277",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587277",
          "code_system": "PUBCHEM",
          "references": [
            "09579a98-1e9e-45ea-a26f-c23deeefffb0"
          ]
        },
        {
          "uuid": "b83b9a0a-1dd1-adcd-ff5c-d575e67d465f",
          "code": "DTXSID50226551",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50226551",
          "code_system": "EPA CompTox",
          "references": [
            "ea9419e7-7431-8b8e-84e2-ee1633796b6c"
          ]
        },
        {
          "uuid": "ccbf5bf9-5d9c-49e5-b8f6-659311398322",
          "code": "1V9879K8AV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5b95017a-fc90-27bd-0422-3ae3a064e7e4",
          "code": "1154",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1154/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "ff9fcfc2-54b2-b843-f346-cf436945e6b8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6500536c-44f9-4518-878d-b1c5cef905c9",
          "name": "(R)-DEHYDROMENTHOFUROLACTONE",
          "stdName": "(R)-DEHYDROMENTHOFUROLACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9806ff1-3295-4e0f-8627-f9fe68514932",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "faf74038-dd48-4040-aba1-da9484b1118a",
          "name": "(R)-TONKA FURANONE",
          "stdName": "(R)-TONKA FURANONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "630043c2-f165-4d2b-9058-1a205ab31b97",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "2db64001-ea76-40f3-83ac-4b82417cf8f1",
          "name": "2(4H)-BENZOFURANONE, 5,6-DIHYDRO-3,6-DIMETHYL-, (.THETA.)-",
          "stdName": "2(4H)-BENZOFURANONE, 5,6-DIHYDRO-3,6-DIMETHYL-, (.THETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "231d1b45-542e-4add-a568-716ccf70e7b0",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "4acdc010-8638-4cfc-9ba5-f674737cf655",
          "name": "2(4H)-BENZOFURANONE, 5,6-DIHYDRO-3,6-DIMETHYL-, (6R)-",
          "stdName": "2(4H)-BENZOFURANONE, 5,6-DIHYDRO-3,6-DIMETHYL-, (6R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9806ff1-3295-4e0f-8627-f9fe68514932",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "e77b3661-4ffe-429e-9f28-d51cfcba1600",
          "name": "2(4H)-BENZOFURANONE, 5,6-DIHYDRO-3,6-DIMETHYL-, (R)-",
          "stdName": "2(4H)-BENZOFURANONE, 5,6-DIHYDRO-3,6-DIMETHYL-, (R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9806ff1-3295-4e0f-8627-f9fe68514932",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "61ddc7ee-a899-4ff0-8397-bc71e2fe020a",
          "name": "5,6-DIHYDRO-3,6-DIMETHYL-2(4H)-BENZOFURANONE, (R)-",
          "stdName": "5,6-DIHYDRO-3,6-DIMETHYL-2(4H)-BENZOFURANONE, (R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "231d1b45-542e-4add-a568-716ccf70e7b0",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "08de6ec2-5309-440f-8615-27574e52339b",
          "name": "DEHYDROMENTHOFUROLACTONE",
          "stdName": "DEHYDROMENTHOFUROLACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58d389c4-8069-41a0-a4db-9561bd119e43",
            "231d1b45-542e-4add-a568-716ccf70e7b0",
            "47b9fccd-3731-4f4a-aeeb-9aefb84742ae",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": true
        },
        {
          "uuid": "6bcb91bf-6e47-45bc-8d96-66eba9f7fbee",
          "name": "DEHYDROMENTHOFUROLACTONE [FHFI]",
          "stdName": "DEHYDROMENTHOFUROLACTONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47b9fccd-3731-4f4a-aeeb-9aefb84742ae",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        },
        {
          "uuid": "78d309bf-4ae4-4cd5-836b-4df339fe7f81",
          "name": "FEMA NO. 3755",
          "stdName": "FEMA NO. 3755",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "231d1b45-542e-4add-a568-716ccf70e7b0",
            "412723ae-83c5-4b8b-a121-d2dfac2c3bbe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "231d1b45-542e-4add-a568-716ccf70e7b0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "412723ae-83c5-4b8b-a121-d2dfac2c3bbe",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9806ff1-3295-4e0f-8627-f9fe68514932",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47b9fccd-3731-4f4a-aeeb-9aefb84742ae",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "630043c2-f165-4d2b-9058-1a205ab31b97",
          "citation": "http://www.thegoodscentscompany.com/docs/doc1428841.html",
          "url": "http://www.thegoodscentscompany.com/docs/doc1428841.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09579a98-1e9e-45ea-a26f-c23deeefffb0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391218000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d21b4428-4b56-4c58-9e79-f50e51e10862",
          "citation": "SRS import [1V9879K8AV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1V9879K8AV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391218000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58d389c4-8069-41a0-a4db-9561bd119e43",
          "citation": "DEHYDROMENTHOFUROLACTONE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "615f47cf-867d-9806-e95a-d329a9207d7f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=75640-26-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43920b9e-7924-4e85-829d-824f57e1326b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ea9419e7-7431-8b8e-84e2-ee1633796b6c",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "ff9fcfc2-54b2-b843-f346-cf436945e6b8",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c2b3f04d-fc35-4d91-a958-cb7ebe11e6d7",
          "id": "c2b3f04d-fc35-4d91-a958-cb7ebe11e6d7",
          "molfile": "\n  Marvin  01132110042D          \n\n 12 13  0  0  1  0            999 V2000\n    2.4908   -2.3171    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.7763   -1.9045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4908   -3.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2052   -3.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9197   -3.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7043   -3.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9593   -4.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1892   -2.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0142   -2.7295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7043   -2.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9197   -2.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2053   -1.9045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1 12  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1CCC2=C(C)C(=O)OC2=C1",
          "formula": "C10H12O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1a22661f-f71a-4437-9bdb-f4b87cbd5c33"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "164.2015",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3efdbd65-3555-4377-be7f-f49adea6e215",
      "version": "6",
      "structure": {
        "id": "62410a64-c0b1-4df1-838b-b3d44f604306",
        "molfile": "\n  Marvin  01132105062D          \n\n 12 13  0  0  1  0            999 V2000\n    2.4908   -2.3171    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.2053   -1.9045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9197   -2.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9197   -3.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2052   -3.5545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4908   -3.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7763   -1.9045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7043   -3.3970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7043   -2.0621    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1892   -2.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9593   -4.1816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0142   -2.7295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10  8  1  0  0  0  0\n  4  8  2  0  0  0  0\n  3  9  1  0  0  0  0\n  8 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1CCC2=C(C)C(=O)OC2=C1",
        "formula": "C10H12O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "164.2015",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d21b4428-4b56-4c58-9e79-f50e51e10862",
          "f9806ff1-3295-4e0f-8627-f9fe68514932"
        ],
        "stereo_centers": 1
      },
      "unii": "1V9879K8AV"
    }
  ]
}