{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "33c81407-b255-4129-97cf-b2702b58ee3b", "code": "31519-22-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=31519-22-9", "code_system": "CAS", "references": [ "eaeabcb0-5b27-4139-bcd1-7259f731479c", "6ae21278-2b1d-4990-a2f6-ae4785bc041b" ] }, { "uuid": "0d0ebf8d-862b-459c-9237-24efe8b4d4d5", "code": "C024023", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67024023", "code_system": "MESH", "references": [ "eaeabcb0-5b27-4139-bcd1-7259f731479c" ] }, { "uuid": "138f2e33-b7a0-4736-8e99-e2b873301b92", "code": "250-674-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.052", "code_system": "ECHA (EC/EINECS)", "references": [ "eaeabcb0-5b27-4139-bcd1-7259f731479c" ] }, { "uuid": "8fdbcbde-2511-4b82-bee8-816e0fdcb73c", "code": "671", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/671", "code_system": "PUBCHEM", "references": [ "eaeabcb0-5b27-4139-bcd1-7259f731479c" ] }, { "uuid": "35bb97dc-a89b-df37-ef7c-369a22e4fe75", "code": "DTXSID0037730", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0037730", "code_system": "EPA CompTox", "references": [ "2e267e75-870b-c4f7-d8e6-1c8a2ea64c3b" ] }, { "uuid": "2cdd438d-9264-4aad-acfc-597231d87c3c", "code": "1U77MR5Q7O", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "42dced08-9a9e-8c72-e659-225c7c88bb4f", "code": "18094", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18094", "code_system": "CHEBI", "references": [ "e06238cd-f668-12d4-f457-d466dda50d1d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0c1926c5-095c-4397-9f64-6ddce8b88b5c", "name": "1,4-DIHYDROXY-2-NAPHTHOIC ACID", "stdName": "1,4-DIHYDROXY-2-NAPHTHOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6e5b61fc-11d7-4050-bde7-28cff78533cf" ], "display_name": true } ], "references": [ { "uuid": "6e5b61fc-11d7-4050-bde7-28cff78533cf", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "eaeabcb0-5b27-4139-bcd1-7259f731479c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391223000, "tags": [ "NOMEN" ] }, { "uuid": "7a0f72c0-1216-4717-8d9b-039cb72be3a5", "citation": "SRS import [1U77MR5Q7O]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1U77MR5Q7O", "doc_type": "SRS", "public_domain": true, "document_date": 1493391223000, "tags": [ "NOMEN" ] }, { "uuid": "8fc1e76d-6e9c-4766-8864-46171d1d75c5", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2e267e75-870b-c4f7-d8e6-1c8a2ea64c3b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=31519-22-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e06238cd-f668-12d4-f457-d466dda50d1d", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "6ae21278-2b1d-4990-a2f6-ae4785bc041b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2d7ffdc5-31f7-424b-a9c8-aaad095aea58", "id": "2d7ffdc5-31f7-424b-a9c8-aaad095aea58", "molfile": "\n Marvin 01132102272D \n\n 15 16 0 0 0 0 999 V2000\n 0.3997 -3.5049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3997 -2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3148 -2.2674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1142 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1142 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8287 -1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8287 -0.2049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5431 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2576 -1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9721 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9721 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2576 -2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5431 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8287 -2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8287 -3.5049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 14 4 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 13 2 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c(cc(c2O)C(=O)O)O", "formula": "C11H8O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3fc8034a-9ebe-46b2-afe1-5f53b861460f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.1792", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e2bf21bd-f9b5-4f15-b0e6-1f293876f7a8", "version": "4", "structure": { "id": "3bdfa784-ae0f-43b9-96ac-2279631c7e40", "molfile": "\n Marvin 01132103102D \n\n 15 16 0 0 0 0 999 V2000\n 1.8287 -2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1142 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1142 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8287 -1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5431 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2576 -1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9721 -1.4424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9721 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2576 -2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5431 -2.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3997 -2.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3997 -3.5049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3148 -2.2674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8287 -0.2049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8287 -3.5049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 1 10 2 0 0 0 0\n 5 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 2 11 1 0 0 0 0\n 4 14 1 0 0 0 0\n 1 15 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)c(cc(c2O)C(=O)O)O", "formula": "C11H8O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.1792", "optical_activity": "NONE", "references": [ "8fc1e76d-6e9c-4766-8864-46171d1d75c5", "7a0f72c0-1216-4717-8d9b-039cb72be3a5" ], "stereo_centers": 0 }, "unii": "1U77MR5Q7O" } ] }