{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "94f1a017-d4ff-4874-a230-70cd5a1a05bb", "code": "862243-29-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=862243-29-6", "code_system": "CAS", "references": [ "6ccedc27-d6ed-479b-bc8a-b8f9c5fc6789", "6445b2f8-b2d3-4780-8adf-d1fb446c4cb6" ] }, { "uuid": "874fedb3-1f0d-4f78-8c08-6a94ae3036e6", "code": "24798733", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24798733", "code_system": "PUBCHEM", "references": [ "6ccedc27-d6ed-479b-bc8a-b8f9c5fc6789" ] }, { "uuid": "3de3038d-fd7f-51e6-2f14-6a0a325a3c3f", "code": "DTXSID0047375", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0047375", "code_system": "EPA CompTox", "references": [ "5abccf9c-2f19-ee4e-f68a-df6375b319a7" ] }, { "uuid": "7ea50c46-d2ca-4e2f-8a65-d527c8ce7aa3", "code": "1TZ335H993", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "1a154eb5-1a67-495c-91b8-76acdb0fc99c", "name": "1-(2-CARBOXYPHENYL)-7-CHLORO-6-((2-CHLORO-4,6-DIFLUOROPHENYL)AMINO)-4-OXO-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID", "stdName": "1-(2-CARBOXYPHENYL)-7-CHLORO-6-((2-CHLORO-4,6-DIFLUOROPHENYL)AMINO)-4-OXO-1,4-DIHYDROQUINOLINE-3-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f6f5b44f-8282-415a-bf8c-8f5a2f824c80" ], "display_name": false }, { "uuid": "37327562-64bb-46d5-b6b1-ce9e7c2509a9", "name": "3-QUINOLINECARBOXYLIC ACID, 1-(2-CARBOXYPHENYL)-7-CHLORO-6-((2-CHLORO-4,6-DIFLUOROPHENYL)AMINO)-1,4-DIHYDRO-4-OXO-", "stdName": "3-QUINOLINECARBOXYLIC ACID, 1-(2-CARBOXYPHENYL)-7-CHLORO-6-((2-CHLORO-4,6-DIFLUOROPHENYL)AMINO)-1,4-DIHYDRO-4-OXO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "27fec60f-ac1a-4322-ab18-3242a719aa9e" ], "display_name": false }, { "uuid": "b374de8f-34b1-438a-bb83-3a2c79f4947c", "name": "AVE-9423", "stdName": "AVE-9423", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "27fec60f-ac1a-4322-ab18-3242a719aa9e" ], "display_name": true } ], "references": [ { "uuid": "f6f5b44f-8282-415a-bf8c-8f5a2f824c80", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "27fec60f-ac1a-4322-ab18-3242a719aa9e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6ccedc27-d6ed-479b-bc8a-b8f9c5fc6789", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394107000, "tags": [ "NOMEN" ] }, { "uuid": "8b5b9f3c-203f-4fd9-920d-57bc860632f9", "citation": "SRS import [1TZ335H993]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=1TZ335H993", "doc_type": "SRS", "public_domain": true, "document_date": 1493394107000, "tags": [ "NOMEN" ] }, { "uuid": "5abccf9c-2f19-ee4e-f68a-df6375b319a7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=862243-29-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6445b2f8-b2d3-4780-8adf-d1fb446c4cb6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5ee24388-4765-4a13-8f6e-0a0847db8b28", "id": "5ee24388-4765-4a13-8f6e-0a0847db8b28", "molfile": "\n Marvin 01132104552D \n\n 34 37 0 0 0 0 999 V2000\n 0.7134 -4.9571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7134 -5.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -6.1983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -6.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -7.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -7.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8687 -7.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8687 -6.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -5.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -4.9571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -3.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7134 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7134 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.7234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8687 -3.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5822 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -3.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -3.2998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -2.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7226 -2.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4360 -2.4748 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7226 -1.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -1.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -2.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5822 -2.4748 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -4.9571 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5822 -4.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8687 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 9 4 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 34 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 16 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 16 17 2 0 0 0 0\n 18 16 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 34 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 31 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 29 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 33 31 2 0 0 0 0\n 34 33 1 0 0 0 0\nM END", "smiles": "c1ccc(c(c1)C(=O)O)-n2cc(c(=O)c3cc(c(cc32)Cl)Nc4c(cc(cc4F)F)Cl)C(=O)O", "formula": "C23H12Cl2F2N2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0a12cb83-f110-457f-8124-cbffd7327cbe" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "505.2553", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "3e1cf3c1-b79b-4c61-b68b-9e2b202fccea", "version": "3", "structure": { "id": "c63fb716-20b9-4427-ba62-e40dd86ca34b", "molfile": "\n Marvin 01132110152D \n\n 34 37 0 0 0 0 999 V2000\n 2.8687 -3.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8687 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -4.9571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -3.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5822 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -3.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5822 -4.9571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -4.5484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7134 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7134 -2.4748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.7234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -5.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -4.9571 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -3.2998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -2.4748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8687 -6.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8687 -7.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1478 -7.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -6.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4343 -7.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7134 -5.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7134 -4.9571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -6.1983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7226 -1.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7226 -2.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -1.2411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2957 -2.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5822 -2.4748 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0166 0.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4360 -2.4748 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 3 1 0 0 0 0\n 1 7 1 0 0 0 0\n 1 2 2 0 0 0 0\n 2 4 1 0 0 0 0\n 2 9 1 0 0 0 0\n 3 5 1 0 0 0 0\n 3 11 2 0 0 0 0\n 4 6 1 0 0 0 0\n 4 15 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 12 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 10 1 0 0 0 0\n 8 17 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 16 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 15 19 2 0 0 0 0\n 15 22 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 28 2 0 0 0 0\n 18 31 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 23 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 28 34 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 33 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "c1ccc(c(c1)C(=O)O)-n2cc(c(=O)c3cc(c(cc32)Cl)Nc4c(cc(cc4F)F)Cl)C(=O)O", "formula": "C23H12Cl2F2N2O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "505.2553", "optical_activity": "NONE", "references": [ "f6f5b44f-8282-415a-bf8c-8f5a2f824c80", "8b5b9f3c-203f-4fd9-920d-57bc860632f9" ], "stereo_centers": 0 }, "unii": "1TZ335H993" } ] }